Commit | Line | Data |
---|---|---|
a44161c3 | 1 | %!PS-Adobe-2.0 |
b585a9fa | 2 | %%Creator: dvips(k) 5.92b Copyright 2002 Radical Eye Software |
a44161c3 | 3 | %%Title: history.dvi |
b585a9fa | 4 | %%Pages: 28 |
a44161c3 | 5 | %%PageOrder: Ascend |
f9267e15 | 6 | %%BoundingBox: 0 0 612 792 |
b585a9fa EZ |
7 | %%DocumentFonts: CMBX12 CMR10 CMTT10 CMSY10 CMBXTI10 CMTI10 CMCSC10 |
8 | %%+ CMSL10 CMSLTT10 CMBX10 CMSS10 CMTT9 CMR9 CMTI9 | |
a44161c3 | 9 | %%EndComments |
f9267e15 | 10 | %DVIPSWebPage: (www.radicaleye.com) |
b585a9fa EZ |
11 | %DVIPSCommandLine: dvips -D 600 -t letter -o history.ps history.dvi |
12 | %DVIPSParameters: dpi=600, compressed | |
13 | %DVIPSSource: TeX output 2005.12.06:1546 | |
f9267e15 EZ |
14 | %%BeginProcSet: texc.pro |
15 | %! | |
16 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
17 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
18 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
19 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
20 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
21 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
22 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
23 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
24 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
84041b4c | 25 | N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin |
f9267e15 | 26 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array |
84041b4c | 27 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 |
f9267e15 EZ |
28 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N |
29 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
30 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
31 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
32 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
33 | 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 | |
34 | 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx | |
35 | 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx | |
36 | sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ | |
37 | rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp | |
38 | gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B | |
39 | /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ | |
40 | /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ | |
41 | A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy | |
42 | get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} | |
43 | ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp | |
44 | fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 | |
45 | {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add | |
46 | chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ | |
47 | 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} | |
48 | forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
49 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put | |
50 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
51 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
52 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
53 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
54 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
84041b4c | 55 | 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 |
f9267e15 EZ |
56 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N |
57 | /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ | |
58 | /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) | |
59 | (LaserWriter 16/600)]{A length product length le{A length product exch 0 | |
60 | exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse | |
61 | end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask | |
62 | grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} | |
63 | imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round | |
64 | exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto | |
65 | fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p | |
66 | delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} | |
67 | B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ | |
68 | p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S | |
69 | rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
70 | ||
a44161c3 | 71 | %%EndProcSet |
b585a9fa EZ |
72 | %%BeginProcSet: f7b6d320.enc |
73 | % Thomas Esser, Dec 2002. public domain | |
74 | % | |
75 | % Encoding for: | |
76 | % cmb10 cmbx10 cmbx12 cmbx5 cmbx6 cmbx7 cmbx8 cmbx9 cmbxsl10 | |
77 | % cmdunh10 cmr10 cmr12 cmr17cmr6 cmr7 cmr8 cmr9 cmsl10 cmsl12 cmsl8 | |
78 | % cmsl9 cmss10cmss12 cmss17 cmss8 cmss9 cmssbx10 cmssdc10 cmssi10 | |
79 | % cmssi12 cmssi17 cmssi8cmssi9 cmssq8 cmssqi8 cmvtt10 | |
80 | % | |
81 | /TeXf7b6d320Encoding [ | |
82 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
83 | /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute /caron /breve | |
84 | /macron /ring /cedilla /germandbls /ae /oe /oslash /AE /OE /Oslash | |
85 | /suppress /exclam /quotedblright /numbersign /dollar /percent /ampersand | |
86 | /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen | |
87 | /period /slash /zero /one /two /three /four /five /six /seven /eight | |
88 | /nine /colon /semicolon /exclamdown /equal /questiondown /question /at | |
89 | /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W /X | |
90 | /Y /Z /bracketleft /quotedblleft /bracketright /circumflex /dotaccent | |
91 | /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u | |
92 | /v /w /x /y /z /endash /emdash /hungarumlaut /tilde /dieresis /suppress | |
93 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
94 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
95 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
96 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space | |
97 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef | |
98 | /.notdef /Omega /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute | |
99 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
100 | /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef /.notdef | |
101 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
102 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
103 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
104 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
105 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
106 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
107 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
108 | ] def | |
109 | ||
110 | %%EndProcSet | |
111 | %%BeginProcSet: 09fbbfac.enc | |
112 | % Thomas Esser, Dec 2002. public domain | |
113 | % | |
114 | % Encoding for: | |
115 | % cmsltt10 cmtt10 cmtt12 cmtt8 cmtt9 | |
116 | /TeX09fbbfacEncoding [ | |
117 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi | |
118 | /Omega /arrowup /arrowdown /quotesingle /exclamdown /questiondown | |
119 | /dotlessi /dotlessj /grave /acute /caron /breve /macron /ring /cedilla | |
120 | /germandbls /ae /oe /oslash /AE /OE /Oslash /visiblespace /exclam | |
121 | /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft | |
122 | /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one | |
123 | /two /three /four /five /six /seven /eight /nine /colon /semicolon /less | |
124 | /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N | |
125 | /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright | |
126 | /asciicircum /underscore /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l | |
127 | /m /n /o /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright | |
128 | /asciitilde /dieresis /visiblespace /.notdef /.notdef /.notdef /.notdef | |
129 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
130 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
131 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
132 | /.notdef /.notdef /.notdef /space /Gamma /Delta /Theta /Lambda /Xi /Pi | |
133 | /Sigma /Upsilon /Phi /Psi /.notdef /.notdef /Omega /arrowup /arrowdown | |
134 | /quotesingle /exclamdown /questiondown /dotlessi /dotlessj /grave /acute | |
135 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
136 | /OE /Oslash /visiblespace /dieresis /.notdef /.notdef /.notdef /.notdef | |
137 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
138 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
139 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
140 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
141 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
142 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
143 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
144 | ] def | |
145 | ||
146 | %%EndProcSet | |
147 | %%BeginProcSet: bbad153f.enc | |
148 | % Thomas Esser, Dec 2002. public domain | |
149 | % | |
150 | % Encoding for: | |
151 | % cmsy10 cmsy5 cmsy6 cmsy7 cmsy8 cmsy9 | |
152 | % | |
153 | /TeXbbad153fEncoding [ | |
154 | /minus /periodcentered /multiply /asteriskmath /divide /diamondmath | |
155 | /plusminus /minusplus /circleplus /circleminus /circlemultiply | |
156 | /circledivide /circledot /circlecopyrt /openbullet /bullet | |
157 | /equivasymptotic /equivalence /reflexsubset /reflexsuperset /lessequal | |
158 | /greaterequal /precedesequal /followsequal /similar /approxequal | |
159 | /propersubset /propersuperset /lessmuch /greatermuch /precedes /follows | |
160 | /arrowleft /arrowright /arrowup /arrowdown /arrowboth /arrownortheast | |
161 | /arrowsoutheast /similarequal /arrowdblleft /arrowdblright /arrowdblup | |
162 | /arrowdbldown /arrowdblboth /arrownorthwest /arrowsouthwest /proportional | |
163 | /prime /infinity /element /owner /triangle /triangleinv /negationslash | |
164 | /mapsto /universal /existential /logicalnot /emptyset /Rfractur /Ifractur | |
165 | /latticetop /perpendicular /aleph /A /B /C /D /E /F /G /H /I /J /K | |
166 | /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /union /intersection | |
167 | /unionmulti /logicaland /logicalor /turnstileleft /turnstileright | |
168 | /floorleft /floorright /ceilingleft /ceilingright /braceleft /braceright | |
169 | /angbracketleft /angbracketright /bar /bardbl /arrowbothv /arrowdblbothv | |
170 | /backslash /wreathproduct /radical /coproduct /nabla /integral | |
171 | /unionsq /intersectionsq /subsetsqequal /supersetsqequal /section | |
172 | /dagger /daggerdbl /paragraph /club /diamond /heart /spade /arrowleft | |
173 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
174 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
175 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
176 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
177 | /minus /periodcentered /multiply /asteriskmath /divide /diamondmath | |
178 | /plusminus /minusplus /circleplus /circleminus /.notdef /.notdef | |
179 | /circlemultiply /circledivide /circledot /circlecopyrt /openbullet | |
180 | /bullet /equivasymptotic /equivalence /reflexsubset /reflexsuperset | |
181 | /lessequal /greaterequal /precedesequal /followsequal /similar | |
182 | /approxequal /propersubset /propersuperset /lessmuch /greatermuch | |
183 | /precedes /follows /arrowleft /spade /.notdef /.notdef /.notdef /.notdef | |
184 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
185 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
186 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
187 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
188 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
189 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
190 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
191 | ] def | |
192 | ||
193 | %%EndProcSet | |
194 | %%BeginProcSet: 74afc74c.enc | |
195 | % Thomas Esser, Dec 2002. public domain | |
196 | % | |
197 | % Encoding for: | |
198 | % cmbxti10 cmff10 cmfi10 cmfib8 cmti10 cmti12 cmti7 cmti8cmti9 cmu10 | |
199 | % | |
200 | /TeX74afc74cEncoding [ | |
201 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
202 | /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute /caron /breve | |
203 | /macron /ring /cedilla /germandbls /ae /oe /oslash /AE /OE /Oslash | |
204 | /suppress /exclam /quotedblright /numbersign /sterling /percent | |
205 | /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma | |
206 | /hyphen /period /slash /zero /one /two /three /four /five /six /seven | |
207 | /eight /nine /colon /semicolon /exclamdown /equal /questiondown /question | |
208 | /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O /P /Q /R /S /T /U /V /W | |
209 | /X /Y /Z /bracketleft /quotedblleft /bracketright /circumflex /dotaccent | |
210 | /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o /p /q /r /s /t /u | |
211 | /v /w /x /y /z /endash /emdash /hungarumlaut /tilde /dieresis /suppress | |
212 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
213 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
214 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
215 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /space | |
216 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef | |
217 | /.notdef /Omega /ff /fi /fl /ffi /ffl /dotlessi /dotlessj /grave /acute | |
218 | /caron /breve /macron /ring /cedilla /germandbls /ae /oe /oslash /AE | |
219 | /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef /.notdef | |
220 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
221 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
222 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
223 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
224 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
225 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
226 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
227 | ] def | |
228 | ||
229 | %%EndProcSet | |
230 | %%BeginProcSet: 0ef0afca.enc | |
231 | % Thomas Esser, Dec 2002. public domain | |
232 | % | |
233 | % Encoding for: | |
234 | % cmr5 | |
235 | % | |
236 | /TeX0ef0afcaEncoding [ | |
237 | /Gamma /Delta /Theta /Lambda /Xi /Pi /Sigma /Upsilon /Phi /Psi /Omega | |
238 | /arrowup /arrowdown /quotesingle /exclamdown /questiondown /dotlessi | |
239 | /dotlessj /grave /acute /caron /breve /macron /ring /cedilla /germandbls | |
240 | /ae /oe /oslash /AE /OE /Oslash /suppress /exclam /quotedblright | |
241 | /numbersign /dollar /percent /ampersand /quoteright /parenleft | |
242 | /parenright /asterisk /plus /comma /hyphen /period /slash /zero /one | |
243 | /two /three /four /five /six /seven /eight /nine /colon /semicolon | |
244 | /less /equal /greater /question /at /A /B /C /D /E /F /G /H /I /J /K | |
245 | /L /M /N /O /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /quotedblleft | |
246 | /bracketright /circumflex /dotaccent /quoteleft /a /b /c /d /e /f /g /h | |
247 | /i /j /k /l /m /n /o /p /q /r /s /t /u /v /w /x /y /z /endash /emdash | |
248 | /hungarumlaut /tilde /dieresis /suppress /.notdef /.notdef /.notdef | |
249 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
250 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
251 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
252 | /.notdef /.notdef /.notdef /.notdef /space /Gamma /Delta /Theta /Lambda | |
253 | /Xi /Pi /Sigma /Upsilon /Phi /Psi /.notdef /.notdef /Omega /arrowup | |
254 | /arrowdown /quotesingle /exclamdown /questiondown /dotlessi /dotlessj | |
255 | /grave /acute /caron /breve /macron /ring /cedilla /germandbls /ae /oe | |
256 | /oslash /AE /OE /Oslash /suppress /dieresis /.notdef /.notdef /.notdef | |
257 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
258 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
259 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
260 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
261 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
262 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
263 | /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef | |
264 | ] def | |
265 | ||
266 | %%EndProcSet | |
267 | %%BeginProcSet: texps.pro | |
268 | %! | |
269 | TeXDict begin/rf{findfont dup length 1 add dict begin{1 index/FID ne 2 | |
270 | index/UniqueID ne and{def}{pop pop}ifelse}forall[1 index 0 6 -1 roll | |
271 | exec 0 exch 5 -1 roll VResolution Resolution div mul neg 0 0]FontType 0 | |
272 | ne{/Metrics exch def dict begin Encoding{exch dup type/integertype ne{ | |
273 | pop pop 1 sub dup 0 le{pop}{[}ifelse}{FontMatrix 0 get div Metrics 0 get | |
274 | div def}ifelse}forall Metrics/Metrics currentdict end def}{{1 index type | |
275 | /nametype eq{exit}if exch pop}loop}ifelse[2 index currentdict end | |
276 | definefont 3 -1 roll makefont/setfont cvx]cvx def}def/ObliqueSlant{dup | |
277 | sin S cos div neg}B/SlantFont{4 index mul add}def/ExtendFont{3 -1 roll | |
278 | mul exch}def/ReEncodeFont{CharStrings rcheck{/Encoding false def dup[ | |
279 | exch{dup CharStrings exch known not{pop/.notdef/Encoding true def}if} | |
280 | forall Encoding{]exch pop}{cleartomark}ifelse}if/Encoding exch def}def | |
f9267e15 | 281 | end |
b585a9fa EZ |
282 | |
283 | %%EndProcSet | |
284 | %%BeginFont: CMTI9 | |
285 | %!PS-AdobeFont-1.1: CMTI9 1.0 | |
286 | %%CreationDate: 1991 Aug 18 21:08:07 | |
287 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
288 | 11 dict begin | |
289 | /FontInfo 7 dict dup begin | |
290 | /version (1.0) readonly def | |
291 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
292 | /FullName (CMTI9) readonly def | |
293 | /FamilyName (Computer Modern) readonly def | |
294 | /Weight (Medium) readonly def | |
295 | /ItalicAngle -14.04 def | |
296 | /isFixedPitch false def | |
297 | end readonly def | |
298 | /FontName /CMTI9 def | |
299 | /PaintType 0 def | |
300 | /FontType 1 def | |
301 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
302 | /Encoding 256 array | |
303 | 0 1 255 {1 index exch /.notdef put} for | |
304 | dup 0 /.notdef put | |
305 | readonly def | |
306 | /FontBBox{-35 -250 1148 750}readonly def | |
307 | /UniqueID 5000827 def | |
308 | currentdict end | |
309 | currentfile eexec | |
310 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
311 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
312 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
313 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
314 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
315 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
316 | 9E3948FFB3DF7BFF10C9BDA4EFE5F68A8CB1526990D1357AE6D2F7C2D2EF8496 | |
317 | 4E47B39E6712EB8908A3265E5FAB40567E866C244814449F1E993AAB422C3F1D | |
318 | DFA8C7118584F2E5197FD4BFA3A8AE9E953C6CD4672C0FF51E41C3A919749C1A | |
319 | F06650DF4C5E17492164BDBCDF22609A74BFA7F69960A64B9F949FFC2A807458 | |
320 | 8579366C4F41BDE1FDFBCC4845FA19BBB6963D65EE8532549274BAEBDFF24FA6 | |
321 | 03235D1BE37C06B1938AF369DA75BF38DDBC87A1FF445EAA16E1895ABE9506B9 | |
322 | 211955753E447865D33CEF007391D2666A046277A30A49804FFCED3FEA5EB2C3 | |
323 | E52EE14A9F75241EA10C91974CDA6236EB840FD44D6DDE4D9B3266C3B99BD38B | |
324 | D835BCA8CB819C073480FB972CC028D218F6A1D344CE1B63F4FBF2C826F412E1 | |
325 | 6E0B05A26125865A14FD7B7030B478BB8BC6BC395335C3BA940E1C348267F4F9 | |
326 | 0AF97BBEE253511940F1048E175D3569F7D05A28851B6F50765FEB6C9654FEDC | |
327 | 1BF52F535DB5BB90C1BD5D2EBF75E0AEBE82B20507F3C28A03746781018D4EB2 | |
328 | 298E4F2C27ACF73FA73EBE43F014BB575AAD516C0407B29E1653375135ECB74D | |
329 | C91372F06FA8EF37C31AF3FA48AE65318EAA6C34830A5377ABB2DFA5DA53A574 | |
330 | 433484BA1466709A4B186761655C8E482833B697673E847C691079E7F1DCB8D6 | |
331 | 1AD91101D757B83E2090337D525AEECB028FB3C9F6A6E6AD2F322CFDC5A833E6 | |
332 | 1CE4EDBF41FD34FD61630581D222F854A76C2EA9FD72796A7C9CC1F6C2FCCD16 | |
333 | E95CA05826A4ECFADA6A5FB83C41A7131E52BA6585DD6DD78515D8F7327DFC6F | |
334 | 9404F89293D6ACB433CD0802C43F0E74C6C4766A23A6AE3788FE6CAE82E1A104 | |
335 | BAEC8BEFDEFE4F292F625E60362F3886F602CE4121BF0AAD93526314BCBB5971 | |
336 | 40091A7BBF7EFB3BA355B88C897D9C70C841DE41309348751EDFFA8675215988 | |
337 | 49CB1599834A01EC6CD4FD813AFF97A614F56975775D5F48E9C1A9CE532FAEB1 | |
338 | 4EBE20C3FA87CFE03664C428BFC5C894668E507950005BD8C2BCA8998C1FB92C | |
339 | 4E6B791BA05B79F332EB8AF5B0F851B8B7EE372EC0861B09C007CDF43F82D0B7 | |
340 | 35446F682A0DA7F4112CDABE4F922EACFCB7B8C88BF550B60957E7 | |
341 | 0000000000000000000000000000000000000000000000000000000000000000 | |
342 | 0000000000000000000000000000000000000000000000000000000000000000 | |
343 | 0000000000000000000000000000000000000000000000000000000000000000 | |
344 | 0000000000000000000000000000000000000000000000000000000000000000 | |
345 | 0000000000000000000000000000000000000000000000000000000000000000 | |
346 | 0000000000000000000000000000000000000000000000000000000000000000 | |
347 | 0000000000000000000000000000000000000000000000000000000000000000 | |
348 | 0000000000000000000000000000000000000000000000000000000000000000 | |
349 | cleartomark | |
350 | %%EndFont | |
351 | %%BeginFont: CMR9 | |
352 | %!PS-AdobeFont-1.1: CMR9 1.0 | |
353 | %%CreationDate: 1991 Aug 20 16:39:59 | |
354 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
355 | 11 dict begin | |
356 | /FontInfo 7 dict dup begin | |
357 | /version (1.0) readonly def | |
358 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
359 | /FullName (CMR9) readonly def | |
360 | /FamilyName (Computer Modern) readonly def | |
361 | /Weight (Medium) readonly def | |
362 | /ItalicAngle 0 def | |
363 | /isFixedPitch false def | |
364 | end readonly def | |
365 | /FontName /CMR9 def | |
366 | /PaintType 0 def | |
367 | /FontType 1 def | |
368 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
369 | /Encoding 256 array | |
370 | 0 1 255 {1 index exch /.notdef put} for | |
371 | dup 0 /.notdef put | |
372 | readonly def | |
373 | /FontBBox{-39 -250 1036 750}readonly def | |
374 | /UniqueID 5000792 def | |
375 | currentdict end | |
376 | currentfile eexec | |
377 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
378 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
379 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
380 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
381 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
382 | 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 | |
383 | 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F | |
384 | D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 | |
385 | 92A36FADB679CF58BAFDD3E51DFDD314B91A605515D729EE20C42505FD4E0835 | |
386 | 3C9D365B14C003BC6DD352F0228A8C161F172D2551CD1C67CD0B1B21DED53203 | |
387 | 046FAFF9B1129167921DD82C5964F9DDDFE0D2686875BD075FC81831A941F20E | |
388 | C5CD90040A092E559F6D1D3B0E9BB71733595AE0EA6093F986377A96060BF12A | |
389 | A1B525CD9FA741FE051DD54A32BECD55A868DD63119A4370F8322CCBEC889BC2 | |
390 | A723CB4015FC4AA90AE873EA14DE13382CA9CF0D8DFB65F0ABEDFD9A64BB3F4D | |
391 | 731E2E1C9A1789228FF44116230A70C339C9819676022AB31B5C9C589AE9094B | |
392 | 09882051AD4637C1710D93E8DD117B4E7B478493B91EA6306FDB3FA6D738AAB1 | |
393 | 49FBB21A00AC2A999C21445DE3177F21D8B6AAB33869C882613EA6B5EC56476B | |
394 | 5634181ECBF03BFEDB57F079EACE3B334F6F384BDF9D70AEBD592C8ECF21378B | |
395 | 54A8B5DBF7CB9282E16AA517E14843909339B5E7C55B038BF3BB493F3B884A1C | |
396 | C25F9E8FB912CBE23199AD9D2C3E573727701BA301526C66C3617B9514D6F11F | |
397 | 11930B1D97C17816C85B1BFD9B973A191B33CC3B391815AD14F1CBE935942AEC | |
398 | D4004E6BEF379066FD72209DC88D2E634E79BCC2B98C766CBD92C561F2703F8A | |
399 | 109E6C6CEC7B866F2FC7ADF646BF492E520319F3B949AB5D84AE990B33344A40 | |
400 | 3971F58DFDF8D8D67FA0B8F2A0D884F8C09A5A721319B911DBA0A35903877343 | |
401 | C37BC36C5EB32353272D1E6ED5FCA611BE319A7E1E842CB7576E7DFC9BE98C04 | |
402 | 07AB81FFA0DF072948F163C014692806D9D0739EE9ECDE57FB6B4E8444A7BF3F | |
403 | 57BA77A5B85C09209D100200D1254D1A955F92899E0CC2F0901F01F8DD6EBFDE | |
404 | 0501C3A8645283E8FFDF47BCB83752A4AD5C94CE1F64D664B0583E69C9ED9E2E | |
405 | BAC3FB641A7B838DD8D9BA1EE40DE683F5B694561160D08A58F4C53E6346CAA5 | |
406 | 58F8EB6323884F1FA776B161890712BF54CC0E5A54FF1407D8805BBFBDD39BEA | |
407 | 8F1C47E7589E3C04DE43F3F9390B87C81A47FCAC3BCF056E2DAE0B266479C3E4 | |
408 | 55AD44629ECBE69C17E4357BA1E0AEDDB614942519741E52D7CA9C0E229AEBB6 | |
409 | E0AC8BE5129AEB56EB59DA82DA56B54E8E39E6B817F5EF1F8BC7AC5A4DC520C4 | |
410 | D494811451F213EF198092405D82ADA72C249F6D5D2657FBC6EA372867D2021E | |
411 | EA6828FC107BC22B5192121A59D527187D990EAE65A72B2FC47AC650AEA43CB3 | |
412 | 20B04A91AF599929E03670D1E956BF56D302DB0769E91FE4021E0F790980A242 | |
413 | A5D76D024A11EB57F9A84A040AB2093170D8C9EE54296BE826470077B39C4CE8 | |
414 | 2702AB49D06FACC7785CE175B92B5C98747613A7FF87D62E2433603C4F122CB1 | |
415 | 305D9F4913F805A2AFABEBBCC99F7F67A60842EE8677976428B7F6E150C93BAF | |
416 | 6D4B8085C2A77794527F35FBAB758FEE0DF77CC94A56CE73825EFF0AF966BE3D | |
417 | 10046B790C73AA615416079E5EC150FC6C157E62ABF8EB6B17857B8AF525F1D1 | |
418 | E39EA402C5E795C9662750AA35EB853AD3EB87AA78B1CFD3F3F926E6E75B0A09 | |
419 | 746F816E651862466008001BE791573B8C05AADB4AACF9237BC0326CB0C732FA | |
420 | 8CD0F289CE02AC1453B2B1732EC190DA4C3480E397272C045615709130DD125A | |
421 | DFDDBC4B2D2745824DC94F5D239D95A2E4379982515952A51B9EE6D00D71A3E6 | |
422 | F6C5B93F5400B553154512DC0DDC57D92BFB241617C83068CD7EC9E6B0F9EBA3 | |
423 | 64685D3E6B68149A64B0D19B3558EEB7C9FA389B206021014FB99EC18CA67E19 | |
424 | 7E589382E77B802FAA0B79AA5F3BC1DDFABF9113D3AF85B19E0F43A27C2D1E62 | |
425 | 1C7B580D573E9504BA119506EA424273DDECEE01FB94FCD893BFAA6FF0332CED | |
426 | 4F64D6EACDE630BA4A8E41B8120D8DB529531D4ACCA9ABFB6A27CE41029590F3 | |
427 | 46AAA9EFA728FC6492779AAD249D9EFDE27A2D987DE0FE1D9E4D7A91128761EA | |
428 | FD0A89AC4FBC4DADFDA502E7D01292D85EE63E6422615C6FEDF75F9256C6C3DF | |
429 | F7BFD47F477A1B93F5B8B8C950449856E34C36284F0FDCC05635F173341D509D | |
430 | 8DA223987F6BFAD2F6D004368D9A82EC77207ABF8E4801B59A30CAD6E04BDC52 | |
431 | 6C3068E0F4141F6F76D655F657AAFABC87E78C999A1C40894A5F776E2F868907 | |
432 | 376FF64C0782BD815D39FA2C290686756807E888EB002E077101F36229EEF79F | |
433 | 5AAE4D00AD85B4913CE4FB7AF667FD0198A52016A7B58B09CA5A9D4DE3A9B333 | |
434 | 28F623199C93E47E09D70AD3D2AABE3BCD6EE9EAA8B8D8F3F42FEE7BC3D846AD | |
435 | DAA4E31B62120EDE8B7DF8CB5BEFB6C5350ABAFB27FFBB57D312C4192EE98837 | |
436 | 5F959B63A6718C983F4072015EB8A4FACAE77EA1D6233B0AD532349F0CD15335 | |
437 | 6D8E1D99D543ACFB5B381FA56AF8B223EB57FD674B8484FFFF2BC0127121F68B | |
438 | 4A43ECCDE282B294B1DD39556DE0D73592C2911AADA2DCAEB67A78ECE80AF5BE | |
439 | F54C5DE76F128C6BF010D65270B58334575309D907CBEB138A1E3CF889CBAF5F | |
440 | 83368C5DE80B5DC665C6A7CA4054A673D75939E732ECCDFFD617677299A0EEEA | |
441 | FFCC76EF9E237CD7EFEAA6FA40029D9BB2BF563C969195353C28BDBE788BD14C | |
442 | 031216D5E46BD3B144A6E5859C8747677260B4E07C35FCB1939785C458CDC0F6 | |
443 | 9EAB2CAF77CE96DF0F44BAAFEEA51A0F455964C3349ED7593742237A8FFAB3C7 | |
444 | 4A7A976B203664AB65AC996F8A961B3D6559874FE93A808D4E19E0BC84CF4BD2 | |
445 | 5D991C4DF859F136E619CDF1B5D88315FCE55684B8A452B657C5275609B61DD2 | |
446 | 5C2D7476288D9E8A04DA330CBB10FEA5829EC3E22A7A6596C748683A9B038B96 | |
447 | 0ECBBC13DF9B63C2B9989A1D1028B1426E48EB1F3DDE0BE63DD65CE6C80A6345 | |
448 | 2060E5F11BCE38AEF6ABEA5F3591D840952BE27B3DFA574AB3B6406B020A519E | |
449 | 81A34FFAE360C9628D88C8E006A926884347A87E576344DC249DF32FE14CF02A | |
450 | F54147639C5F5A2C14DE888E497D9F9E62256AEBF70D2E88EAACED5439715B98 | |
451 | FD09A5AA5AE1C937F82576953C724A0B8C8E2BC58F75840E87A87782DD3CB1DF | |
452 | D6F3A2421354339A04D2F1B2A2F7B13230E06BE82ED286CEBE37DFCAE4C6DF0D | |
453 | 28D11A05F0C6A1A2DB756E508C0E7D8C9494D34A8ED76F7ED51A1C51E3EDF913 | |
454 | 345E0F296474DA42C2B148C48C647DA813EDA97F5D39B8B9CC8DE806774C5A99 | |
455 | 72BFC97D7F1D51388F8F4E4D31BA1A7B3F81EFB20DD597730427DB06500E0A8F | |
456 | 61B27DFA7761110EAF5F5CA259B6DC97586421AF73A631866648B732F7A8300E | |
457 | 9DDC21ADE33101788FFFCE3E9FFC67FD8A343DE64DFB53C575ECFF188E123C69 | |
458 | 75A4261C1735884916BA454D3EBD6162807B3C29BA48E771A731ED54E43E2BF0 | |
459 | 31DA4CE66B1CC113ED74F04964DA0B86EA8D3BFF1D682DBA606B6D6D0BF95544 | |
460 | DBC524EFE702BC1FBFCAC129B31581D7807F762471999DA10374D4684E59AFF9 | |
461 | DF7E03DA10D3896011C433A70889E42BD273FFF5616390FAC757B1ACB0444380 | |
462 | 139037855FD194E58FACA991E96337A8ACEE430875AA1EFF3B7A022D9E56CD0C | |
463 | FD5ED52EFFB79B72241963E91B1198A2E17745F07B36B31E1BC580AC24AA8B1C | |
464 | 5E8F59B7E19FFDACB14199B5CAF4AB2EF223D59199B0BCD9C6DB2399A144BA03 | |
465 | 517B2766DA8D6104CFFC0B7A29B405C21FAD7B9ABF356A0149CEEC522ED19839 | |
466 | D861BA710589FB46F2A52AF26D3B1E9D9664257FFA6594C524ACDD43865FFC47 | |
467 | E52D2AFC3F7C4AF04344ACE67F36EDB52CCD754FD6F93482D351D8C114D02B5A | |
468 | AF11A38276CF1C8527CAC28B97427963542ED96B9E79D82C5CD157CF83E7B379 | |
469 | F0044C578BCF872D940FC6F4B68FB21A50478AE6C015C18B69F01A5A5617D54C | |
470 | 0321981183D5F53DD9A27BD89747FC8D8936F2251F2A9290CACADB37B584F448 | |
471 | 9FA0215B6FC33F5A12E5A7677AC6056E67A6E881D32B76879E77CB62B596B027 | |
472 | 275E0C63744064AE2E4330639BA92FA33936C30C18C4997EAEFF4912A8E11067 | |
473 | 359C434B98256311E87EB99760A3CB7ED90210172FD107D9B7881788E3D22DE8 | |
474 | D7D58E3550D9A5CE0C59AF4117E34458F4628D734056751BC09D337D49629907 | |
475 | 732455C410D08877E333D0CA430AAFC7DC6DECD3DC2B9C5D382EFC464E9186AA | |
476 | 3C747CE4BF15C775ECBED2C410E95E01D4B68177CEF4FDDFC18A43ACABD890A0 | |
477 | 99C27485DF967BC6298C9AF4AE53DA28DAC11D5B2B88CB5DC9375DBAC099D39F | |
478 | 0AEFE1A15D8661B59DF458951F9A962851F7F0A36BAA5D1EFB36B8070A6A91FD | |
479 | 1C229C611E4F0A20954CC4DFE892F45FC3DB43C6B5D9B539675A28F7F7EAADC7 | |
480 | 0CE005DC7E2B3EB5D83717CBEEC50DCE10C80C3D5BD889BF05484D27FE296F43 | |
481 | 8E67B1DB1C3858874955449F7CC8148930F85B2EB2ABCAC14DBCD75102848360 | |
482 | 434C53100CB9E0E227B1B803D1C042FBC72AA6CC7E968AD34F753A9B31045985 | |
483 | F7B813CD552F3FE8C7A266013E54E661CC6E3357475625D69139489455541C21 | |
484 | 02E061270EAFE3B05FC5E40C363890799D92AAC2CD67D65ED6F8F7DE04F2BEC2 | |
485 | E9925CF98FE80EAF13329579C78F938EFA6248144E3F04F0A815851614D02DC0 | |
486 | 0D2D62196135E06AE1154A2F18B3D66D1BC73D513425D6AA7B41B56525B59247 | |
487 | 7BC8D9A40CA3CDFEBF237C63B3E1EF554742CC8BDE9A074659449C96D424BE8B | |
488 | 8E49EABD5915AC84F9D53F0A7FCFF6370C7AD77FCE2CC87B3B380A7A8C2A4AAA | |
489 | 7D0E0AA4D467A7CA592484851760C94E0ACDAF42BE0A45E50370BB667E1101B0 | |
490 | 24D79BB4CAFCF86414CFE39B5E6AEEEC9466BF34F7A600E245016E8D8D1FA756 | |
491 | 1E45FF38E5B4484A6292496398AD3F191F7116F117E49C3187612C941FA46CFD | |
492 | 83058920874109FDF29FF2A9F663D90F3EE75FE9549CF9B7314BBEFEE8499EBD | |
493 | CB561F6546847AD610C744F459F51A73D435B5BD2AD351933F8E76261D9A819D | |
494 | C65FD387F113DFC3D4FCF13CBB563C6DE69E7347252258C119A6147DD86C3672 | |
495 | 0853B3280BE2C0ECE83DB14317BF4ADCAE40E62EA1A295C693958ABDE0B544C3 | |
496 | 3B02DB82485FD45B0A5068F623015720F3F53BDBB9C8AAD7466A83357E0BA273 | |
497 | AFC6A6DD60C0C9F98ACDD44D0926CAA24B76112A9254D99AD577C28D5D6E96E3 | |
498 | 386240AE572864DBD7131DD6C8892B79E0A3262EBBD68ED9B42E5D076DAC3354 | |
499 | 92F05A01C056DED791B9C71B1CB72A23FA86C96DDA2DA640D259B9C1F2E3E9BA | |
500 | 3E115411F1CEE748013A60EBE3218847B20185419E1A8E1F2A1F002E4DA1261E | |
501 | 5C8285E7C90C8A2C976C595868D43A6174968368186E1EA63DB4E9A7F7BF3F2D | |
502 | 0685B921A21600B0E291700FC74B61D5F010FA467AA2747328EE08F94C838224 | |
503 | E540DBEFCDA1FF5B397C868A11D9BC794D06ABA2FECE7C71F1E0F5F43D33D18F | |
504 | 6E954D3C7122648C6DEEFAA185E220A37FCCD4848996E4C2E8570D9C91755C07 | |
505 | D68DA8E12D814788B6C5CA5E1A2B76A39712A9AB568848A3B3BD4F43BE18915E | |
506 | F0C1EDD8A5CAFD3EF3E3199146EB1624AD8FF3A59A42BDCED9B2A4DB651338F3 | |
507 | 539BA9081C360F5B1F1055775B2950F144C41E93CCE158DA1BC638FF2D0A3B16 | |
508 | AE48F309C87EC1A3EC548F55AF1A67C32B1716B56D70F19DDB3D8402E294C2F4 | |
509 | 8B7145400EC637F4E74A4A2C3319A19D2C8B6F049BE419B09E02A14CF5EEA11B | |
510 | F466B5BF07F0D25BA30DCBD7EBD036B4AAC76A7BD4E4E801549A2CA8C187CBA1 | |
511 | D6C6E8F774EA237FC79AA836C86740C79196747ED857C329A240DF23D75F9398 | |
512 | FE330C56724AC0D13D8B08DDBDCF922218C6B4CC175CD5AC99ADAC896B84A802 | |
513 | B40D36B4AE9E6DA1FF99264B81B5BC4356CF8B25E683FE7E46C1EA3F3CCAF955 | |
514 | D08145168C9051DB46B41D9A5E6C6AFC3BBE43B06F924CE25A9D7B63F311ED2A | |
515 | 6B186DA5FEF9D468614918AC257745FAAEB3632C851F048628CFDB29C6F3E60F | |
516 | 2C6FFAB377CC344542782671C3B06F3223E6BA4BA20C48DB3AF838B9115AA881 | |
517 | 61DBD8A6F278105B2291CBADD3E2B05BD72746C46B3DB93CC6D78F5786361D8A | |
518 | 5AB534808BAEE7004E43E32CE00AABB15332420F25FB746AD50F8BFF19FDDCBE | |
519 | 146449B64900B0D9E2877A6704C965FC444D05326392F006DF818198A292E9FE | |
520 | 16AFA046317811D136E15B44A402B78843F3F4B397D285716B07236EF0FF2026 | |
521 | BE9F30206779B2E1EE287238ABA302152718D25567C720694F8D7854155608C9 | |
522 | 310B9C4326892FAEEDE57B9E6AA558C1E632DF9E4F3642324194CE92F31F394E | |
523 | 18D39EB934133A47C0CFA879585C5B446A3B371E4C331E728642C8ED64754205 | |
524 | CC6975D7E395AAD0B54B68F421B49BE2DCE5C89395D40D166347CEBEDE8A7DA5 | |
525 | 5EB9F6385A65B176E7D47D875163E4B22B17E54884DF5B51828821673F90013E | |
526 | 7F543E2CE0AB355DD9769CAC32347F5F69D71FA21459DF2AF5E191AC313E46DC | |
527 | 8490A21791CFF90C57443C2CA11599D5BBEF581140A00BA471690BE5C5221FD3 | |
528 | EE8102A8EA43D166F5F530581CDB3E3F2AF38C70FA7760EB6A2F5E53E1AE0673 | |
529 | 550178AAEE7E1FC5E4489478CEDBE4EDC181D1EC1090F6F4AF1B514629DFDB07 | |
530 | AD3B95A20AC32C3D8B386875FDCB4FE166AFCC310EC644DD24CD051E0ABD8A8F | |
531 | EF3816236D6A8DDD7BA106D76F29962E535C2F3E5447A1F2CF445F5C8A588FEA | |
532 | 208397F477DA82261A3B642837816B70FA39F82D9CF69D957F11D36E1C35B681 | |
533 | 37BBE843A5D1B6DD7E1ADA05DCE43C273E4B1F26293485F7930FAE7C9AF55DCF | |
534 | C0AF7444304BE5D68D31B3008740B906D873BB719AEE71A3FD41C44778E32944 | |
535 | 0A8123583530ACFA771E3CC02DC776FDD6C5A99ED857CB344E12569BB0F3B358 | |
536 | B541746DB9BDDF953B2DCD7AA701984C05210B6EA6C7AD0D2C99BBA5A4E4008E | |
537 | 6DE433AD469234776162F1E17095824693AECC1BE92416D5602585049BCEB279 | |
538 | FC3F18D5C054901111E95B77554B919EB92A6C337CCD739D0DE40654C266373E | |
539 | 4A2262401E36DCAFEF09CE046581E9ACD43F7D5417C98E7F4379827DDA2B8D6D | |
540 | A1F82179F7ED427C4CE78399B8C470C4D224E77BA2C57C4F262120B62217A3A6 | |
541 | 5B4C46504BBACC03791A3302A29D9F124FF7A08CF82303111AAD48EBCB7E62F8 | |
542 | C8BF32D84F7DBC129A1B872096A3703C9B041C8743BF19B6D2B0B22AF820599F | |
543 | 93181D0C91EAE7540E17B0718EA0FD3443D887740891AB8C4C2D3CA3C505B548 | |
544 | FEBEED800FEF69CB12C8FAF6662EB15A9EE695424930BE8DC2FCA22201F033FB | |
545 | 252F0365C2CB7352EA0400FD21F1F100DA96AEE410826D07F1A930C1E1094F9A | |
546 | E57AAFD332405CEE40A2D5159483E3CCC12C339D9492E4BE419CD1875B9E3645 | |
547 | DEE7B00256BD144A5A743D4F21DF191A30ADC88AFC1A1401AB410870F874090B | |
548 | E98B347CFE36AB22D68581C47C30A8C6095E8163E1A88995DB89770CD427825C | |
549 | D66540AA957F6CFFB26A05BF1A5581B6E50735D101EB5301EE8DAD2B371A884B | |
550 | FF281829B836B6404EABCE30AF7F7EA135F0A7BE66E4F3BD2B55ED233B3277A1 | |
551 | 6DB62DB676980AECB2413D86B4CC2BABC18BAAEA8990267B7E52FEFCAD821884 | |
552 | 315182678DA1F36544CB16E0829C408843000C29A1F3221B120F14AC4BA3B18D | |
553 | C491CA354747E96FACB7DAB46C0115F3BE564F3435F7DE88536297BF6F30063D | |
554 | 84AD309FF1AD8A97717243B29C7518F62E9F83DC0FD73EA7876CE05B6D526107 | |
555 | 7533EDD59066091B7577DA2522C1F29BD369C2AB20223F581B9C553A37FF0132 | |
556 | 0FE0971845D56D48053014593CF50EC45016994A36E86DA7D06065C8CA3AE16E | |
557 | 5E860B970683E00F91FD93AC644D7114DEA31E6E9CBA1D76EE45D119DC0EF0C8 | |
558 | 39C3E9ED52C48C00B917A21160BA46CA3C7B33F696E3564486D5CC2D9388E34C | |
559 | CAC3BE8F7998DC89C3068F542B6D9D8D93E68AC73BA4A44E69D794F6035A2658 | |
560 | 27A6692346CF918338CEB7BF710200700ACCB43A5AF13E84865137FA8B1CF338 | |
561 | AB5260F08FB5371FFEE92CC2D9BA01AA1BB93490FCA55C1DEF6F1D73D6D3F93E | |
562 | 14EE07E85AE637B4BBDC546452C6D76B8AAC96288BE5723BA0E7AE9386476D10 | |
563 | 4B9A4E58C16EF66A16456135E14C3801CA43684EA28C58B9B5934677A71AF428 | |
564 | 29F1A4015CBB05EEB83AF5FEEA38FABF9FAF815622EC45486B489DE574084B48 | |
565 | 8A35739BDCB3025E8EB0F3A3D83B0787F0E6D599AE490455AB75A79F59AAA612 | |
566 | CAC364F0C8370981A33422CCD2ED96402B1AEE1E90044ECA7250077023655D73 | |
567 | 2B75D1E0A7B4CFE09C00184DDB3111345ECB8F39C1AB453F19AEABFB5DA03217 | |
568 | F5B99597826B9370CA481F1D15787BC7B4DC7C29D267DBC055C425F835F844FC | |
569 | 9253C179DC53D60ADBEA2D2B2588274F435E84F40A106BA1DBED09407888AA49 | |
570 | 7D3E58A45B7034B4BAADF5461522871A139CDDA2B9E37855FCE7C0AEAABCF0EE | |
571 | E062E1B6053B1B6A87C30E8BEF2A7337BA97D6583651711B281D7D657FD55F68 | |
572 | 7052E9F69AF5D5AAC8FB2A63C560103392E0D9BBE5FE727C61BD74AF45294FCD | |
573 | 093A8B2AD2617DDDD401AE3A9AE01EA4D1444642DDBA84031B4B5598AAD8D76A | |
574 | 7E38EAD377237BB0BDE6E4F10AFA91501A7D177B07FFD936FD7B5441FDF2F3A2 | |
575 | 321D37AEF9DC0212B6F8DD3FAD075FB7E2178BE642E86AEA49BB2DE0209BC8AE | |
576 | DEF9FD626C27B1FEBB39E25026E530EE07DA0016DBDE509B02D7113906F07403 | |
577 | CAE5A5A0DF4E9D890EF34E201B0E14E3C6CE229260B4A08B81F28D941C1117BE | |
578 | 1A9476071EF84055B87B28D1C3B40450C89114342F42CB995AAC941F5B1E730B | |
579 | 4919FD646599151EC05EA2877C22D5A79B2E8B8C82038821A63C4A463652B9BC | |
580 | 29DD00004A701F89B8378E71810C615904011231F6 | |
581 | 0000000000000000000000000000000000000000000000000000000000000000 | |
582 | 0000000000000000000000000000000000000000000000000000000000000000 | |
583 | 0000000000000000000000000000000000000000000000000000000000000000 | |
584 | 0000000000000000000000000000000000000000000000000000000000000000 | |
585 | 0000000000000000000000000000000000000000000000000000000000000000 | |
586 | 0000000000000000000000000000000000000000000000000000000000000000 | |
587 | 0000000000000000000000000000000000000000000000000000000000000000 | |
588 | 0000000000000000000000000000000000000000000000000000000000000000 | |
589 | cleartomark | |
590 | %%EndFont | |
591 | %%BeginFont: CMSLTT10 | |
592 | %!PS-AdobeFont-1.1: CMSLTT10 1.0 | |
593 | %%CreationDate: 1991 Aug 20 16:41:43 | |
594 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
595 | 11 dict begin | |
596 | /FontInfo 7 dict dup begin | |
597 | /version (1.0) readonly def | |
598 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
599 | /FullName (CMSLTT10) readonly def | |
600 | /FamilyName (Computer Modern) readonly def | |
601 | /Weight (Medium) readonly def | |
602 | /ItalicAngle -9.46 def | |
603 | /isFixedPitch true def | |
604 | end readonly def | |
605 | /FontName /CMSLTT10 def | |
606 | /PaintType 0 def | |
607 | /FontType 1 def | |
608 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
609 | /Encoding 256 array | |
610 | 0 1 255 {1 index exch /.notdef put} for | |
611 | dup 0 /.notdef put | |
612 | readonly def | |
613 | /FontBBox{-20 -233 617 696}readonly def | |
614 | /UniqueID 5000800 def | |
615 | currentdict end | |
616 | currentfile eexec | |
617 | D9D66F633B846A97B686A97E45A3D0AA0528A405DF15F03DB1C3DA8B850431F8 | |
618 | 0E5F73DAC973450D1ED0530313057E971FC7E7CA88E61DA6DB9A5CD61F0F76CB | |
619 | 4DE9105D0627B8DDF51A655098229920CF429CDAFC3F7788C95E7AB30E84F840 | |
620 | 8CED52E98DB4CFF161D2E62B0D28CB8B0AC82E7A8D2C007953BAFB3056D66079 | |
621 | 8064956E257D31C13509FB81A250D9E875C77A4E91CC49E9FB3C0718B2F691D4 | |
622 | B4A64F351F4DD68133DED7629B0D96E5124584A16FD2AC7A3EB244A934FF059F | |
623 | ED7297B0505F3C2994AD66A3CA5D2728B034DE94B64A8AFAF341601BD4DB5858 | |
624 | C9950A8BB9C598B8960609F48116ABA8C007190AF0ED335EB5BF61BA6871FA5F | |
625 | EAB5A26AEB5C7C352EB80799CEB983F19EEFA801093F62086AADD0B80BB6580F | |
626 | 2CF61B1390FA56DFA1A0B61C58DEF96BA767A8A37EA44730783C600706606C60 | |
627 | 4EE74EA99B7C0F8E2525C8847F3D31907C3C483EFA98F6C416B6B2C343DE6370 | |
628 | 52FAE423008D086A76A1FFB327CC7FD84B1C66B203A4F41582F4599A82F8362D | |
629 | 38108452EACCC937FFC4F3ABBFE3628DF51367DA6BA3F6826FC6522D6AC5E8EA | |
630 | 00BAD300FFB6DEDAB93237704202BACD030AA824B1E97C0AFE17FCE8C75F4FA0 | |
631 | B8A74329A6CF1788C7EB34DA7307411E9AD7ED8D6582884456E06E033B4FFE7D | |
632 | CD4DD8B06AD01340CCCFBC382C18CA451E4C886B01D082FF8CC5793F4727C3DF | |
633 | B52B4F1A242F31D1EB79D1E39A1D4FD13D6C5E2A42AD4B4D1CC4EE7BA0E5F80F | |
634 | 802E5AB57EA15F4DE44D82AC408AA86D4BF58EF967FBC6497BBC7F017C0598AE | |
635 | 32CF865DFFF0FC7FF9E6DCE9B5F2F4C7491AC674F46E8E7660452CE0A77C1EE8 | |
636 | 00DE382ABED85350033F8ECB97398E4E0A75D4877A107F6A909D0C76D14F9A96 | |
637 | 8A6CFDE3FD9D79B6FD82693A9F354BD2ECF30C6D99F7AC522F8D6C93EA214F7B | |
638 | 3D0ED77F042ACDE9414264C0698E86398562E2C640DEBBA0734AB4C3ACE3907D | |
639 | CC79E6B2C6C3C3F9B01526E8CD98237D4A9B403FF8CE3132222FA60C196A19BC | |
640 | A2393AE6935C0F8B67FC1D1A13507C100403B61A82AB0165B072581059B844EE | |
641 | CE34C714DB54843CA29B306D373EA67C2F6842FC3FE75898FB80AE43E689F641 | |
642 | ACB7715CF595C8ADDF68D8D5DBF99528FC4FAE495ACEAC9E0B61971641EF17A0 | |
643 | 4015E263840C96C1F2ECC22A3368F9E0A31475185420560CBEE9639AB9280831 | |
644 | 69636C32D1F3E397FF45DD97FAB9222771EC4C50F45E8DCE4BB761DA258F936A | |
645 | 1067924AD9A066E11FA841E0258039BF264DB97EA12311A8AE9428DBD5A0EEAD | |
646 | 12915888C3BC3E25EF203BA7D30C9D7ECD8A33F72604FB9DF9DEB133671C993F | |
647 | DC7628AC78C3E93D3441733E247F4A364C66C78334B1C31FD803FEDC7845EC70 | |
648 | 593FC75B7833792AE449CC2712A3E054148A9EBD8AC6170E14C7284C434CAD61 | |
649 | FBBE0BD31D7970A6C032BB9A12E164759735B18471D2E9E19735387607ED1E5B | |
650 | 56CA84F1874F59A6797CD8181B0EC05F42E02F27A9F63542254DE953559CAD95 | |
651 | 9F4987CB5A72A329F4E8D07A23DEFA2C0A9C4CD8AC65E867007CBF7D0309BE28 | |
652 | 9E515728F9495D1B5F3EB89A51AE836937E548CB10DA7B969F7558DA4CB29E45 | |
653 | 813BE23A40849203DAD5C8890394F1EDD90074E63CC0D6CDCE6143A153E79A9C | |
654 | 7556EA3C9D7CA44368B81DE3B5ECF4791A4E8955ADE6632B22972A5F8B5EC694 | |
655 | 1EEF90BC65E2C91643058C323CD53CC4059CAB8EB5930DE530817C6E4283E53A | |
656 | 210C7BCD93B4E2EB9A4530932868FF6924106C3A889A9B0DA120949F9D24B2F9 | |
657 | 8B1D9EAD4F1B84CC9CA63E7E3154A6D42A338564B7FAAC6509E08F47A207F933 | |
658 | 6F4A1813D7958F62EBFED3361E6A3D45A2DC552FFEECD0F18E60222219ACEC20 | |
659 | 45285AE5EF96AF299FB42C9F516E6BA7079D20C9739D73972DCFF9FF27FD8D59 | |
660 | 8397137DEA913CCB5A678062F02008D5780F8BE9C7928F7F6CEFD68BCEFAE707 | |
661 | 91903D42A7068C81CFA224FD71380A04959471DBD86E29945D101B4388D3A602 | |
662 | 7C6D4064720146BCB85DB7184C77F01C1D5A0AD5538FADCB48D3B3C39602EEAD | |
663 | D7611D55DF777E114E5EBFBFDBBF7C77F311801F40061DC2CBDBA9F26FDD2745 | |
664 | CC72A296FA4BB1E5CD41BAEDA4BCFCE3F6A21699F0C8349BCD63D9C21F268461 | |
665 | D8F1264444E9F6FBF93690970E6DFD201E68D6991B21201990FCB84BDE9D7FB6 | |
666 | 4A4E752D97E1CFCEEC9AA82D8B6AF47569D87C2B3372575BF5E84E0ED1F76C9A | |
667 | 6E6F6343A50F5728796F4EB21CE80020436D604A37608A43D74C1E8989E43473 | |
668 | 4469EB72EDE6B70938B405847455024F33E52134B08A3194F782F5FA47ED0EC1 | |
669 | BB6CD75BADEFDE8155D1D9B7FA2BBBC56190F00A6CDDAF4A4CC7EEEBC0FE24AA | |
670 | 7AFE725A4036C72D827D1D9FBBCF98313F2CF1159870F7A111D8C55B97DF77A1 | |
671 | 93D2BF77CF3FA9AD36114D778C7CCA8D1C32DFA37B298ADAA1758772B945A6EF | |
672 | 90C44A27B6CAC3A3B4A43885E9F6BF14BCBD877AF6B498D0BD6FC1C7AD0C5962 | |
673 | 0A0327A291FF7278694DEE9E55E882D08D162C2297671685F9EA8BDEBB060977 | |
674 | CF23C27B1036389C992B3FECAEC85C06816E9DC27D37CEB3AF8B1A3FFCA8CE3C | |
675 | 9AE090A3B8F72B3BFDB2AC87509499FB0C5D07A76A213E0579B9B48269500C37 | |
676 | 2448CE37E0488008B687947345E1A934F79560A4BDF44C1472D18714192F7706 | |
677 | F71A3A1ED9A6928E6609055B2B1A049F481B37C4442C78A6FBF91949B3E9EF3C | |
678 | 453B442CCA9E973265604C673752465786FDE0BAECC038104A9EF6BDF2F2F14D | |
679 | 79DFF55430837C0111E882DBF56674AE2C2081C1FA5558CF34C6F1B0C16795AE | |
680 | 541725E0D6329A606FBAF5946054FEB12CCA4575A32A49625E8886A253D7F438 | |
681 | E4C855F2F04139FB6309BB7147C7ABC18154AA559ECD0A46D70B8F87F5A322E9 | |
682 | AB517EDD481831CF66B43A6DEEE50E150C19F45F7500F07169D4F7922FD24284 | |
683 | 93AE172849E0570942758D2F5C57B44FE8A939CEFE3E7D708FB8D245FBAFFCB5 | |
684 | E6B51F90101493A58B7744FF0D135534A2ABD30E22F3541C7C606EB006277A1A | |
685 | 046FC6569559070DFEE59180284A8717058C2A0C2302694FB35B619731A26E6B | |
686 | ECA6C4A99F1DC6636C148411089A56902F9381A05B97C9C657FC03715D34BD3F | |
687 | 25FA9A3CA78D05C0EA643CFDAF8A4CFD4AEDCF97896F257068516DC6DB23F783 | |
688 | 2142E05DFD8F96ECB5BB268B6738DEF2540751595E1A5612A4688E0D0D1AF9F6 | |
689 | 737E036A0129F2400C05AD9F8D95B01A8743E72EAF700F4E1ACD9EDC1D5D0CC0 | |
690 | 733725A6C604ED2270E0D27677259609A67F5F59246F3A187A74FD2DD8E94F17 | |
691 | CE32D65DE64C2BF9F5AE2230B0CD64769075B74044CD1237EDC3DBBA2A0D51E9 | |
692 | 5B45FFE2447C2AFCAED3647B2AB12B68ACADC5F3041A85F43BCB2E60C195ECB8 | |
693 | 54A5D979F7A672C978E09777EAED15A2BB20D08C593B327CE89DE8A059141790 | |
694 | F71A34040F8249BD1F253568E2FE11647A66A9DDD647180BC39BADC5AF42E64F | |
695 | 316EBDE2B19D26E24FDE3105DAF9F4CA01765E4D7E623D77E988A301458C13E4 | |
696 | D0BEA87A09B2EEE7DEC079737BCD5C0DE724472800E03BCD16D8F9A6B380C7B0 | |
697 | B75563584CB753C5B2C0C72555D16E638ED3BF3883047A71D7F9B9BA46F335C7 | |
698 | 90B751ED53836ACBB3DB9524A5F6E26169CC86A3F805C63D027D3D161446FEBF | |
699 | E83E2377F39D154881EFF19DADBDCE48D6F3100ABB9C5DC617F3BAB482E4F570 | |
700 | DDBC1A9F98201E40AA149083AAD5FBE908FAAEC7281CA1AB5D1674DDB3F8E867 | |
701 | F4E311DA26C71CFF71080B03844285754575C9F94132C6F43A92553E922BA580 | |
702 | 19E418AEE7E71432EFF5994FD43BD4FEA2B5C70480758115CCFDAE38470C8A69 | |
703 | 8EFDE3172C30D0E8BFAF666253ECA7A93AB5DEC246F6DB6562B0D0D9A585EF56 | |
704 | 342E6A2891370C21A4F428682A1C1684514266051F9875875C64745BA8DE1680 | |
705 | 68DEB7407C1DEA7DAF8F7F499F123E7948C1DAD3844BCC12C835A632036E94AA | |
706 | 0C59E2566F2F7AF26CE5C87C975C481539AF17EC77B1B799C2C1C46C966496CA | |
707 | 3947C252153B9303EB31C11D0F1415EB2B4DF4CC55B081E514FECD172D82C0C6 | |
708 | 4CBF6ED2EA9DAC8F80563743B20F5D4DEDA1B60629E885EA183DB5119A06C541 | |
709 | 13BF437CCD89EDEEBB8D21CFCBEAF5C3C1112B4710BE66660A7D3726B4AE5FA1 | |
710 | E773A77E18D6B3A02A6065467D452D75DEA48803CDC1600C089C183E68F04513 | |
711 | F35FA955DF440EDFC083ED21F4121FC2CBD01D3B6D36504142E7DBD5D870AE81 | |
712 | 495A7D4F4B8504F5F87CA7E246EE341CDF20DC499FE279D8EBCC218CBC0D26D0 | |
713 | 2836C1C124D109F2D697BB54444952E5AF538B6514F222F693DA2CE3BC67ADBB | |
714 | 8CF143FFEB552224BB54C70AF45663B4CAC25BD25D514D3FC4D011EF9D5AA8B1 | |
715 | 9B16F5ECEE40488512E15798315CC2A85D604BAF68A3A3F980DD04A17D0E02C2 | |
716 | 702AE3E990DA9EF2AAC4957A3B6499771E8F00E7CAD3C207FACF32B372555025 | |
717 | 5392DBAB9E806F516866293506C3A0667C995BFF9AD8027FCBD2560E7BBB27DD | |
718 | 77CFD1FCC7B7BB072234CC908D7FD87B1410008CFEB63AF0C4B69BF22B75BF71 | |
719 | 6C811369BC4BBF5F410D6C61A12239FD1FE25363312A1BC595028157A185E9CA | |
720 | 308D7752DA09F6908E1C76A1BC08D254B7D7EDC295A6FF1658985D64DE0B9DBA | |
721 | BEEC85A884D80EFAE9A66B7B577AA734E7E662341D2FFFEC2851A2BCF11DC560 | |
722 | 74F28DA227F1F29AA27BB7088C1BDF4DB64490CE3D8D99F903AD9331161E118F | |
723 | CC75D0DAEC6AB9F63934371929EA2577CC16D9A2B0D452389FACBDE05B6C08FD | |
724 | 70A66B7C309F4990BF21EE6EE2B3B7B9BD4EFCC8B419499D4A9C8120FCACDDD5 | |
725 | 1CDB568EB932C74C8AA9D52B5C7B61828D696B41432661FC659B122FF69E7110 | |
726 | 6ADC582B8312F1FF10596833454C0FBF05CACE8E95EF9EB53119C5DE28B449CB | |
727 | 971F604BD8D7232C2723A155E37DD5519C6E959D365215BAC11AD54D30E42801 | |
728 | B93423C8C028EF1A9B13773C624106DD59BA15F4252846B4D677F7D71C9870B6 | |
729 | 6AEF7D061AF2A03ACE5A05D050DC3B7CFA03E249C473B3D754A4570DAC910326 | |
730 | CF6D61B084A54ADAA03A7C6D9B4A70DD94BE6467563A7B426A625C6CD1645E15 | |
731 | 23A707F0E2E119C1230F3BC3109EE3344962F90E37D679394AD3BAF2D557DD49 | |
732 | 4DC2AB31723955E9EBBC387154AA21F407F7F8F8423D5DCA8938BB7C22A65EFC | |
733 | C04D60083E7B001031B088A00093B9530A7E71BAC40A5CF652849A77F6999752 | |
734 | 246D794648F8D42A2BFE5F5E4297F92991CA2D157404B1D46851AB529435ED05 | |
735 | 781249F75606BE08CE143545CC8077B25DDD598A8DA2D679A4F4920C4345DDEC | |
736 | 907CDAF694F6DCC9BF3D50C70E089BFF04A77A7DCDA1D76465D6C5D152C8FE5B | |
737 | 6772AD632900AAA71EFFF3A4F90C9AB755B124BF079B98C0B811E2A364AE6A5C | |
738 | EAF99631D79BB7E144ABA2819811014301CE1C562BF38F9E58B2A4EA8EB8F72F | |
739 | 4A53F5F08A7FA95BF0A988A62214EFA998AADA81E6753161E8B32B45D4209B5D | |
740 | 64DE964EBC65220E146FC73BD34E4AEA2D4643453CF0FAF78EECB4B0539D36AE | |
741 | 853BF4635A063EBD1C1C04773886CFF56A12FF6B3F0FC7C76EEA3BBDCA392F4E | |
742 | E64DF93EC4AF5D2528E66ECA77E134EC3D4368E0AD8055D782D5BCE2E43F5830 | |
743 | F34AD1D64B9797DF1416046326290DCEDF3EA07175381A8C1D268B5A6E7C7C86 | |
744 | 4AF59EE9A71E1042EE5F23D303DB1B0A940D7C40950B4F7C60A78AE637 | |
745 | 0000000000000000000000000000000000000000000000000000000000000000 | |
746 | 0000000000000000000000000000000000000000000000000000000000000000 | |
747 | 0000000000000000000000000000000000000000000000000000000000000000 | |
748 | 0000000000000000000000000000000000000000000000000000000000000000 | |
749 | 0000000000000000000000000000000000000000000000000000000000000000 | |
750 | 0000000000000000000000000000000000000000000000000000000000000000 | |
751 | 0000000000000000000000000000000000000000000000000000000000000000 | |
752 | 0000000000000000000000000000000000000000000000000000000000000000 | |
753 | cleartomark | |
754 | %%EndFont | |
755 | %%BeginFont: CMTT9 | |
756 | %!PS-AdobeFont-1.1: CMTT9 1.0 | |
757 | %%CreationDate: 1991 Aug 20 16:46:24 | |
758 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
759 | 11 dict begin | |
760 | /FontInfo 7 dict dup begin | |
761 | /version (1.0) readonly def | |
762 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
763 | /FullName (CMTT9) readonly def | |
764 | /FamilyName (Computer Modern) readonly def | |
765 | /Weight (Medium) readonly def | |
766 | /ItalicAngle 0 def | |
767 | /isFixedPitch true def | |
768 | end readonly def | |
769 | /FontName /CMTT9 def | |
770 | /PaintType 0 def | |
771 | /FontType 1 def | |
772 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
773 | /Encoding 256 array | |
774 | 0 1 255 {1 index exch /.notdef put} for | |
775 | dup 0 /.notdef put | |
776 | readonly def | |
777 | /FontBBox{-6 -233 542 698}readonly def | |
778 | /UniqueID 5000831 def | |
779 | currentdict end | |
780 | currentfile eexec | |
781 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
782 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
783 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
784 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
785 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
786 | 2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D1E | |
787 | 2931CE5F5D18C658602059F07BE66E6EFC9239D7AB2FB8A4CBD41675B8ECF279 | |
788 | 650C29E53B14AC0E392A664848C1844B1CECBB2D5CFB72D0916B675C9A9A1E35 | |
789 | F12696A6F628473C604A95376468E06E295AD6F76CEB939D94113532050B9D5A | |
790 | D2F41A9EFB9424D986612313B89EFE9C8A71313340B248F6853B1EDBF02B7F9E | |
791 | F447220FE131D7D54CFB8AA1281DBAEA73E665BACB1F164552CC0CEDB63BD4B1 | |
792 | 4A9AE8AC6FA02242DBE8DA46B64B6BFC11762F0784F216FC8B9120D688D1705A | |
793 | 438B14F5E5DEAF2A98408B3B64620DE3732A4DAE6D08D5D97E34C75DAE19EABD | |
794 | BA0796165C1151BCBFB1DF8D29A63A8300DBDB9E3323CB82D0337598B83F4F2B | |
795 | A97CF5196D4D1CEC1EDB8966E548C0D9C194C932319610FB43EA1B86322FE641 | |
796 | AB48770FF13BD475A7267E142388563D1A400419C585B22A9886074687BEDF74 | |
797 | D905BE8EE440BA2ABF28EAB673399B7F129B9729DD5564C681954621903B84BB | |
798 | CAF89AC5ADB2932472DF29ADA2BDBDB4D05F65F28F5F4C529613D61858E0074A | |
799 | 082A852710A62A147C966F2B85B51B0BE85F11D2057C66FDD61F6C5755367980 | |
800 | 9F4DE680601D4DA41B46F8D2148450000413C27AA39B586B74B977B25F0FD3C0 | |
801 | 4BA1EBFAFDBEC531EA1210365091671CE3C86A6D4BC591C37DCC02570042575A | |
802 | 9D24252D6E01A8603753934D7EA5CAC1BE4E5AD2BA047DE8F3983B23A8A1511F | |
803 | B08D373B69E5076CE4300137B8805EBCC0AAB89BBB312A77835795E3C069322D | |
804 | 42C893A30AD739E2BDD299679B158F7493764F2321E3965141B5ED1C6F4765ED | |
805 | F46D391A646B30C90002B1C461AEE79E5F094CACCA656CEA3DB921CC5205F328 | |
806 | A2C69F817061D6C60B121EEE844CA5008F23DF08D999D8C635946BF53CDDEC4E | |
807 | 059481E167C2253B9F7EE17916C028D30C626217C07D5C81CB3DA2E154DB5E3E | |
808 | 3E812A739086F78F17DA8B363CAE0CCCB67D2814FDAEBF43DF0F99EC06DD6286 | |
809 | D3E9216952E5416F39B2FAB5CF61C034D2D759D4BBA9270C30B75527A790435C | |
810 | 4E6326684674D41BAEEBD0DC2FF367FD5E7F9B1F50668EB54DF00F6D0FD060EF | |
811 | 580CECEFCB7B346839975048606CD88FD88043E9E1B25BF945AFDA309B1F93A7 | |
812 | 59D38F69DE485852109B8C12468CCB7E8757FDF71A4A941B11F0DA5643922EF6 | |
813 | 826E0855F0EC6B7348949F80D7D4734B08895C8C87869F612FC30D3D28EB8D9D | |
814 | 1E79B7206E5C88E5A65C469831FC61994FBF7A6E6F2D3653FD6259722E05400C | |
815 | BDB34DA6F7E9B79458609BCA2C8EC2C0F99BD924EE5AEAE7FE90C328D2D18430 | |
816 | 08E5BFE7EE756FA078667201149F362918E52A75CBDCBCF913BA20865A8FAD47 | |
817 | 6A208F16730FBAB5195DDED6CAC43EDA6A697D2595A5EF262BF747DCA182C6F1 | |
818 | 3F561ED5C6BF8978681B815B376D1EAD4D27A33A9B7BC8F3FB317A9BCD83D9A3 | |
819 | 53404B9D2E52F90B52BF3749E1B269FE1FAC5C449F3E60D92C64274AB011C9F0 | |
820 | FC4B1A12DD044036479AD76E44AF206A632BD93666E90B95FDFDB3FDE9975C5E | |
821 | 5BAF9CD833D8FE18BF14B6C00927B7DF4F981F4D0982F7EB7707551D48C6D4F4 | |
822 | 9E9DA529FDCAB1F9D627343667C95D1F0EE6D4739A43FE779013BD61CF131046 | |
823 | 728073E7C51504048275BDE248EFCA8501BAFA0EFD16343AD840C11E8E93DF97 | |
824 | 73DBEEF3E23D6EA9F4285F4B40B76D09177873D07CB0AE21A5760049958EF076 | |
825 | 8B4F0BE92C0AA4B42E51B348553CA4A7D95AAB3E83D9EF3F425B7C19D62DDD24 | |
826 | 58AF2C157533F193EADB02D0EAF6FBC98A249AB08CB8DB2375841257ADA88D21 | |
827 | 3CCEC7B699B0776378CB8341BEFDE52A5873F871FCAA5401747A0B69942160FE | |
828 | C17190A7CC63DD4EFDF4286CF819747445A99B2A62F6C1FB61F8A334EA2BCF28 | |
829 | 896C3E0EAFADE5B5E0B6438A5AEC205208BA94B5B0B1F98A0DDE6AB389A05A1D | |
830 | 85DDCE6D2E82CBEEBA36C21DD0B6D7AAA34C75CCC1C9C74509ECAE3DC0B993F8 | |
831 | 59A839F732F0E6F24BB0A3D324BF69CE4651594329FF786627C888F6329EE8D1 | |
832 | CC2FEB58D7D516709901A873FA447E728A249922ED3DC0FCF0AAD744566CEDF4 | |
833 | 5AD20891E3771A667C625C1F5D35ACA12E607A500D2A512F9E1EFA810BB1CC8F | |
834 | 00DFDF692892F94C02170CD1ED7D1837038E9381E6114FE2212E6F5366042235 | |
835 | 281C80B962929EC9A32D127C6BF290BB2ECB5E45292BC2354057BFC547D279C7 | |
836 | 7A841E3437FC69664069AA9509E325AF93D148B1D025DBEFA31C6CACEEDFDBB0 | |
837 | EB57451DCD25B9D37534B4526E89825B0B750462A5F3FD0943F40560508BDA21 | |
838 | 63207D78B199094BC784B0277EB656F40309989C96AA23368780E8B5ABCA54CE | |
839 | 6CCA1E86DC9A2F935BF5AE867A6CF511D0BB330406E90C1C5EB93164E709211A | |
840 | C4C3BD3DF34ED4AFDA4270389C8E24D87BA370118C827AD1AA7E9D64A58813E5 | |
841 | 0233C0F5ED34862DD74D805558B4E8983FB43AE7B64E3F1955BE2B32C1157407 | |
842 | 801A0FB59E2B2D6F9F16225CB8D4E10D7B7F8C90C06A5492C052318359F7F0BC | |
843 | 4C715A3C21D7479D8C290532061061FC9981FC5B8A8D01E6571FA77853BADFC7 | |
844 | EC9A89F16A6D75AFE20E0B31B2A699BBBB6C8FE2A3CB43B2494BC6CE39663ABD | |
845 | D4789EA15FE947A5F30D933BAC442B28943BFE72C66FF26384D23306454040A4 | |
846 | 72817FF4087220BAE3FECBB5050E2D2C206E5AC0AD978E6B59D167F7550254F8 | |
847 | 15FF785D7F6EAE5177853F4E9B3FDCB2A0CDA0FA67D0A0F0AF73413B1CDBDE29 | |
848 | BAF76A74508DEDC3EC6533101611B3AF3FB854021BD89D4F595817059A5CFF00 | |
849 | CEB4CC210F7A920446AD9C83E5DD84041CC13AD5A0419CA99FFAE27C2FC69971 | |
850 | 4DBB0F1AEA6D8D88605C4BCBBFB93A4E52B7E0AAB3DC3498A86BC4604D4C3575 | |
851 | 899B8B48BDEF6B13E1CEC5B0A9110ED9B1E2FF42F7F17076666EABBB12110BDA | |
852 | D88D8938B7F61BB974653DC31B448784EE202D733874CD81BB31C1BE5C78D906 | |
853 | 1408C6B030EDAE6C39E6ADDBB7846CBA642B5EA337A6DBE8E708468E1FC94C2F | |
854 | D0B890092E4197C86AEEC94E188CC00EF9539548FFFCBF41C51794E79A258F10 | |
855 | 39348798B2FBCCF53D786D3AD5D2C6C9360B14177E8C1C9BC44CB9362C938C0F | |
856 | C09F6B5E959F0A9E57336098454E62592F356B40D05FD132CECD9747DD11D9BB | |
857 | 5DBC68462F9701B7AD89A3A9DFEE129745CD92FC7A3CD14E1C385D3221CB23AC | |
858 | A6E06A359A7E1443BE82D929FBE2331349FB97FA3DBAD83254A92E22D6C95894 | |
859 | FC2CD2245F41D24A844544C49DE32A4F21C661690EB1C6A1F7024B4A427A6D6E | |
860 | 6612157ECBE211C3F2E4A7FE08A9D5A219FEF5C21FD5AE9FC38E6DA6C5AEFACF | |
861 | A236DDC128EEAF37CFA58E9DD31968ACC4540809D083EA27CF261493DF467FDA | |
862 | 614870CE334A5876BC87020F8BEC20C12CD808E431E6E1383158D8B46D2511F9 | |
863 | 0750CE5A4A07AAE523390230FEA3511D2230993C40908B61B42C50EFF921DC42 | |
864 | F22D7557BE4ACD616B196489E88707BFFD3644C2E49F015D2B8BA75A070EE256 | |
865 | FF459F1B41788C61592AD09D22025C69B1231C9A97BF59C567E651AE86D80428 | |
866 | 43A517362D5B0279F76183E64767CA065A07C82588612CF5691340F649D3ED54 | |
867 | 4EA7E71CBAEADD51614F3CA74A6A761D9E1D19EF7E76D34E6E74347C7404A22C | |
868 | 53C887FFD6F83EC590A626BB72B538B0B8BF02839BCF3F2E926A84EE37A536EF | |
869 | 10C079EC0530B59355EA2AE74707F87860185E01A6A1578EAC52902703131EC8 | |
870 | 4115BB2A18F6C062FEA1B16A635CCE2467C34C34E197E89C45A8633FA5F7EBA5 | |
871 | 475857805921FF836D146335D2A0C0F665DB2B880A4E1ED79F03DBB89AF73F18 | |
872 | 07FE54C20106C118FBF8A410AFF0AFF397E248846580B6CC3C42A50095D221E6 | |
873 | F6E2CE4E880AA773B718C89794E27E6FD1D20287707819C3668B0AE01BD7B1E4 | |
874 | 761554462E05D56E8A259FC97AF94A2BFACAC574EC90BC08B3EED027E8C4CA46 | |
875 | FA54E53CA4794F99920F6494CF6EF4C0B6C54AE303EF4D32F27F2676C7CE6268 | |
876 | 51940C8FDC40BF16DD4622D803F232AF0255E72A189222F4AEA83E4597E8B9F0 | |
877 | C56DB69A5A7C0CEC09BB794152054BBA9844D936C6792F9EA17319D0C69D8417 | |
878 | 1A8847562AEB2E433CA94A4341C8781B5A0702C469049CC94E028E881B0B5D4F | |
879 | 89C3925919C7577B93C25D67D8C093C7DE834A3BC0131394740996E4D6B233A7 | |
880 | 80DF5A380A78299E92DF0FF33E8B8C0E9E81283EFB2C284B8F18439BA4CEE60D | |
881 | 9BA146A69B57CF41BE979E49A2B90A878F96CF22C81CB7510D56B9AA2B6E60F2 | |
882 | 02EEBBC41A5A852607EB5C00BCCDD117C162A5F1D7441FE4260901D9AED49BFE | |
883 | 2D9F92B8A6A1E6401BA6224C67A6FA778348EED53ACF1E76E61AA6159A2E9543 | |
884 | 262B9EFBA99819B1DE43D3CD4D623CF8C00515292056AFEE78A2B351D7460FC8 | |
885 | F8D49FFCA4E45AB4A12FA0CDAB25E084EA60B40B660B8F29B64F0B0C04F38D89 | |
886 | C1AEAB5C160C90FE0FE02836143C579B76F9C03828A6417098BAF9B4C85FEAB4 | |
887 | 4DCE99E55643ADC2677025948FF1DAA1E5846A0875D6A463BCB4FE13A5AEE274 | |
888 | 1FEF59E21CB0F17DA28BDB4D2F8D8CDC46704A33E990FA9E4B50B3A58606C36F | |
889 | B10763DC2E4F50981EDAC1B6DCCF1415D150AC0D97AD7C415317ECC4B6B98C98 | |
890 | 240F9715A25F992A1B7A4250BD36D205CFB3AD2F3F153205B5083916C5466B25 | |
891 | BCA0D30D5F4E3C8B08D7B3D3597FD7E931FCA30162A86B7305AE9C6AE03B909E | |
892 | AF9CE0909560D719136EAEDD8B2655644FFDE826322601E457C7A0A8F73BE730 | |
893 | 03506BF446383C1594DD9D294390F35957FA5FF5F60F8DD7B66399D808F23DE9 | |
894 | 0355AFE0A04FD60CCA0E56A3A4BFA0DFC316C8B1997682AC063DF9E6C6F66EC2 | |
895 | E094F98F5756E4A25DA6695C71B07F51167CA66BC3F432D280094E1856CBE89D | |
896 | B349ECE305C9EE15067D08E4A64EF4484E792A6E57EB2C859A42DEA616178A80 | |
897 | 132C796CA06218388BBB5EC4E262F1682C736B7BFC06096508EE75272A7B5734 | |
898 | 8401507757861EAE30F5B1BB4EBC4D5CFC4755041549D675ED0F08F84BE8804A | |
899 | C28CAECAF527AEF5172DBAA077CC0D4ABA31A2A58940406FE0D83A0EBF0F1954 | |
900 | E621D43E6C71455AA3471857C08E5BFB0270A5C991BF7A13C2815BC19FE4DE38 | |
901 | 3C0201C795AA113648425D04FBEF58A4FA9B39C1B4CAD85D07E5CB402A41B015 | |
902 | 04EA0985B6CC772E401B7DE1403FD88D4E8DD82424200DB7B136F0680289010A | |
903 | 379AABD0DDB60CA784849B9831500A7B56486B66DF6D18AD92A8705A7BB7A422 | |
904 | 6A61700058187DD41385DDA283759C8028C6E6F08D83F8CC701E58BB22D8F7CF | |
905 | FF88802F9CB37A528BCC6FEB7483631402B1BDDC6C1033856935689A29649154 | |
906 | 2290057E12AC15AD1C1FFB6876033DCB14918F2F14508612C84854263CBB9971 | |
907 | 1D83CD39EEE4CBE8483F8296CE20C1960241B4DA55E0B865B822E8C325390786 | |
908 | 18ACA7C548ADFB111F2070A16883075BE56C6684E3809115135744F7E5651106 | |
909 | 2EE5E6A9DF571D01ABACB23F6FA53555F1D1CA8A8BC78D8C017ABC45D2BA37C4 | |
910 | 8B0DA9EBF0B505FB34678C43FC1862DE21ABD217A96E869ADC14B416A4E68006 | |
911 | 2D5B05B8CF9FB94BC82DE73E420DB1DF38EB58B325AE3F2181E508B7440757EF | |
912 | A743E92B76EBD90E748E9CCA53D3FEA9F317574F60706E7DB8869DB5D4A10ABE | |
913 | 6B37AC6AF1CECCF9DD6683E0BBFC74CD76145D9CA3E18930A5E116CD8650CCB8 | |
914 | CD0AE70FC9EC9BDC5952E41CD2CA7F274E03BE671C0764FA74C3462902CA726C | |
915 | 296F3B9C4C7A649AD23E89D1D79F4E61872BF34A5681D14F7437D876C9653F11 | |
916 | 5A6CFD1C92398579F5E6EFCF85346A95D1F1862C6E081059A116F2F4B0BB0414 | |
917 | 5522AE3AFAB5C0419A21D158853C90ACA8816A973B1D3EB8132583E70D9CFF93 | |
918 | 39F093298182BDC1D2F9BB3DCCC5F1A697E779762B49771E357E99E56CCFE0B8 | |
919 | 458D8644025AB81FCF125574187E0D975EF42DB0736EB1D9EA27ECA4FBAE87E4 | |
920 | 1DE9FB6E9D3F42638048737DE6C89A4E0EC1A21C51A577785CA610D9C201F205 | |
921 | 987594ADF811D7CF5C7B78505F296A080442134E4F60324BDDDFE5D7458942F4 | |
922 | FA99DE4CC8DE3B4622C92F216ADC31816E7E1E922E4EFC6887A4BFCC28C4A790 | |
923 | BBCD0BBC12B726DB85BC1455A8BEB843B32CE2A7AEC5F6B066C8D21D754F97B9 | |
924 | 8E9DF5F61AFB7B94C33BF8BCD218E726F7243A5E7A64390B70C95135B444FBB7 | |
925 | 42369397865EE5D9B2D9B575877ABAC9C6CE59EE395103E14EE1AFDD31701409 | |
926 | 8BA2BB985468960AAB94F462798F1B2B86D2055BB47C84286345E51C929CE8D6 | |
927 | 58A1A083E7A23A63C5795F3C4563A5D7D7A4192289D43D518F52A23784BA0DB5 | |
928 | F97DC933EB78FDAECF9BC9F049AF415F9EFFB0AFD2DE84BA8CD4F63CA5F6C488 | |
929 | 73CC3625D497200D7D26EAD733DD62E5638D363A9E34EB8463D4213E746882F9 | |
930 | 13E8948B4F1935597DF34BDF3B20FF3660182D8695644138C3AE7E3E99E79755 | |
931 | CCEEF6F8395536C29E675D3BBBD24C1678FFE64E356A86C142B33E3F921D1E62 | |
932 | 41F8C698C13A94209D1876E090C23EB9DDB670F2BED3D4F7BD5CFB8B40D8193D | |
933 | 22B051F65EED5BD47E1D788B00E9F8CD717291F2936F190CDF798D47A4DECB4C | |
934 | 7CAA1F85374316B1425B76C0723EF4B73D1BEAE5B7D62D7779BF6D2EED8B5DEB | |
935 | 7DCD1015F8A75D6EA8E0DE412328D443CBC9DEA25C8343DED3B3C7201ACF32DF | |
936 | 5E7CA143D3EDE9315B199364EBB83F79C156B44B4AD267EF71E39A570B951453 | |
937 | 36F971775F67DA78449E480D2CCAE56F1CF9BB502217060003A54970F60571FF | |
938 | 8C4211FB591AD10D37A88E368D70F46F18653A5DE3794834BD80F96678BE1B87 | |
939 | F587780357A378F9B9BDFB13915F38184C51E127B26D7587005190EF2CA8106C | |
940 | 7062334641CF3AF71F084D7383FC5588CF0AADFC995FA89899497611D1A06BCA | |
941 | 69917F530FFADC98F672810CB8524E7B8B9A81D6E1E636018ED9C6A511C81C18 | |
942 | 94AA72CE1C11DB0B8154C12B31DCF28B2F7EC49949405BE689F0C54ACEDED54F | |
943 | F7C13099CB92B197DB63C1B539BE4206DCB1CE8E1ED725C87CEC4A50AE3C85CB | |
944 | 6107107DC5CA03AD63126A049FAC98FCF5EB23E744410065B519E1354FB8E150 | |
945 | B3EEE5A201E465CA3C271CC74885768446EC8A8F8C0DA1A389853AA8B82559D2 | |
946 | A70F4B4F04C80F0879440F70701247B9AF44AF66A9BC378373E7159E46D5C4D9 | |
947 | FBAD7413E1359D52CA29A8AC6E29727CD5A65DCDF073CB8CD7709D5808B13E37 | |
948 | 3E5CDD794F5E780E169FEDBD1918C71112FCC4708EA9F024A7592E4B24EB2892 | |
949 | 053FB730845CEEA345E5CD538787E5AEF5014E5D603ACABBC5808FA630E9CFE0 | |
950 | E27DF84092AA6C913F01D43878057A46CBFCFEDC4E403F2A1EB05A0FE0E138CE | |
951 | 87FE0401623EAE6135D6E75F695BC8880CA14E83AD535A6A91FA5B3E96A0DA60 | |
952 | 771839FFFD8E533961E9DE55E203468033F54CFAFD876A7BE8901AA5302FE8ED | |
953 | 20F7290B4FC341FEA326530ABD626919ECB6DF8995A534631AE68EBB84866C29 | |
954 | E7BAFF0D8DFABFA4138F10EF9142C2CB6ED163C0DF31594D0331B254F63739C4 | |
955 | 9C86287001B2E2DB0C479720D629AA8DA67752ACADF48F7846FBBAB7126FF37B | |
956 | 5FA478F0CA4329CB167693CD6E01BCC5F45B14B4D8D939E05493A313D91FE691 | |
957 | 620B176CF3D98C112B74E05AB5FCA5E4927DE8363FBAA3439935CBDC02DFDFA3 | |
958 | B405E769CCCCADA2156894A9AC8D9E5064EDA098F9216A36886421BDAC6AAE7E | |
959 | 9A41A1E1F8D06EAF5B2634C421F83F3B393CE9101AAC1CEACDF1A8E062BBEB0A | |
960 | 35BBD77311DB45D2DFE80C5FC40BA7F164DA6FDCA80C42BD47EDFD127BE6C854 | |
961 | F8B7C6183C92635179444246239471F53A07F9BA9624159E4E5B0E62D3B6A325 | |
962 | 51CB065E3A70264EB1643C682B0BC8CDDAFD999C4C5C49D0C082C7508B10CFDF | |
963 | 0B97FF78F3A7F2FBEDF798FBDF73FC049A4102E0986BD80E0A8173D78F4FF64D | |
964 | 59F821EE9D055103B29C8EF5ABDAF4B7703C93F2F51F3501723EC21A18256319 | |
965 | 34CD3E50796351385A0F9E5D2ECAA2035BD818DE969E91BC84F9CF728D7089F5 | |
966 | 5EF6D436FF1B82C1EAEE12918614FC870FA778A6997824093E0C2F22540ECCE2 | |
967 | AB9670D0300ECDC0BA5773F3EC8B5A5B0A1A7589B582286769C2E1B84CF79561 | |
968 | 0ADDE0B1550181522EA254D719724DFB464D9CBBB0265AC65554A708C1B77C20 | |
969 | 532410B1398105EF48610E51F7674E6FB0A36EC7F578636E4E4C1463FC099CB5 | |
970 | BE569EDE7A60C017E95531B220E3CA0E534DBFD549A187255A77A52C6C77294D | |
971 | F6DB3CE2AFFA9512294AB88D753E3924A5991BA8B458A96B4FF576C8F00E06C3 | |
972 | 6936DF540A4981ED013EEC9B56C47B25641D639CFB2B285C05E2441259546892 | |
973 | 02BB04B24AF9AAE71BA71D4A9BD6C8B8FFAD0BD41A6D4CF9CC6C20CF5B8F7358 | |
974 | A87C170FB6DAB203C59A96D8B68690C92022F39A70F883AAFCB078CEC81D2A5D | |
975 | BD5C3A391ECAA6228C43F2E406B0579DE6701CD9AAE58393F5E7F9E56BF195E3 | |
976 | 1F76B78F4710167E3D9C19D7117B2E0203BE1763295063C3FAFC0F7163BBCB48 | |
977 | F6A27E229696B92D877C5626DE87FC163E3B0F590B0E3EA053463F339C814882 | |
978 | 7D0CDEB24F14E0C1506CCAAA1CE4B14EC2DFDC4A4D87F5B42CDD079BCCBDABBE | |
979 | 21CCC132F23D67DAA62DB74529B4FDE5EB634F0E3FD77408BADDE551AEDE6937 | |
980 | 0670EC7E277FE19BCB4B36B4831DDAC191A308CCF7086C04EBC3C8EE6BD1687E | |
981 | 9E678D5490DAD1A746319CC33707A386316C5152C4A7A0164CD463670A534D9D | |
982 | 0997BB2339DC30D328753058602C3A0FA9BF508C0D955C8BF29D2331B272FB07 | |
983 | 5E365F2A04A74594FEEA5CC21EFAB0C5EA5D602DFCF72E35ADB36F9F5B75DC79 | |
984 | 97774D3D1FBC40C9A0E2DA75E81436F267D75DCD4C4FB814E380F118C4F5F5F4 | |
985 | 15AA464E902740759E922DB75AAACEB6BD0499FDE4DA1453B1ED979AF9F18F38 | |
986 | A2BB21E4140CFAA1DA2CEAF997F4086F34BC7BB2DF69FB857E21576B5ED55511 | |
987 | 3E1113F174994B4BA18500443766AA8285482A391121FD99CB940C23625911E3 | |
988 | 6553A363FC97C4FE91285BE00A8043517AABAB1B276B0050CED46B53A9EED1E2 | |
989 | 078749595463C192B6442DD82E4FF60A8038F9279B504FE6415AE3E6D380E612 | |
990 | BB95CB93CB48E054032EFFD4DE2F3E0B2432A6EE6A9245243BD61AF4C9723F14 | |
991 | 26ED79C4B2B0A8AD2DB51D0A61768B3324A2D896CC47AD1F49B3520E312ACAD6 | |
992 | F485C6FC31263ECA0ED87F39D13D32F5ACB9B6406CC928BDE316908106D348C2 | |
993 | DCADF8C50737F4B745BAB96E3C668B6F5CA01274F4A6D16329EFA2E2A4C4D08C | |
994 | 5DBE3020DE859BFF20970F5F5CD0AC8D7F546AC164B2A422512EF01273DE9283 | |
995 | AE697E98738A08612E06CB85F8DE09049DB661B000380A3EB776BBA8D4058892 | |
996 | EC83E019A74E3BC8793C7AC7F370ECA6FFC8EC6355CF4D8BF19699E2CC2B7670 | |
997 | DCD34D5916006DB7DBDE93D5AABE5BEBF20C2B1216FDAA48848C4A704D478771 | |
998 | 415B1A6BB2737CCFE9CF0E8FAB134A6DB2540DAE86EA3150E051172B87C62EA3 | |
999 | 4A89FC2916F0AB0941D9590BB8DCB356E1F2AF650D2EDFABFA0FB359B6C4560F | |
1000 | 9F1D3E467685E3CDECC6A75272F723509B0410D5331F76DA8315B3F9AD8CE15D | |
1001 | 88A45A535BD433E00515568A1ED887AE4ECAD35D66FFBF8508F253C1CC437BB0 | |
1002 | F0D7F17FC58D13BF7978387C65261BE0CBE9EBC9CA9F241CFF2C03A37CA9DED8 | |
1003 | 27E4B64508FEFAFBF1F072D9F7C4C552E4431A4964B1872D3A7DF842B1890119 | |
1004 | 03C0467D143A069A0A83FB619329FB8AB390CEF29E76C3B6E488C9C786B0AF3E | |
1005 | CB0D8EABADFD0C59AB5A7BB8E19EABC8C4DB1138E37A902378B6571CCA48171A | |
1006 | C4C7D04527B76A317174E0DF7DC50CA7DC5F4BA0EBBE98321FA5A7BC4E9167D2 | |
1007 | E2FA85F9AE8502A760B62838BBD6930596C59BCAA879ADE70BE761384D6AE09A | |
1008 | 9B0CFF658BDA93584A31DD715DD1718A67F2D7F3FBBC75135B90C90FA4BC8EEE | |
1009 | F565EB19A1E92C67085D57124A85A6F6885518FDC363072E82A7043C444E2C8C | |
1010 | 144EA64398D5AD4039D1F228469D5D0EC725449D2D12D5DB3C8FB9E38399C7A9 | |
1011 | 4A80CEC20EE84E3FCA86A4008073C2D6EFF3D7ACDE4797C6146B6ABAD6CCBB09 | |
1012 | 99EFA2EC0C742F7120F05187E6005EE9203FBA5CC4BE3AA0E7CC707EBF5BFABA | |
1013 | 5DB5E786FC88CA67E06F6D504A7CCA4ACC7002F48A0F0C48903EC136850F0495 | |
1014 | 4D042D2E55077888D1531C52AE927AF7011D311CBA1BE836DD755476578966A9 | |
1015 | D3A57A609487750C136DF0B646D8090BDF84474B5B545A8C7A6DF1F3932D8433 | |
1016 | D31BE5C587F84A7B03363A3AA801574F210D44C7EBC04880F67BF44A8173890A | |
1017 | 4422CDC3F3F2C15869CCCBFFE19D912A026FA8992AF3A9BC8284CEF8D1D5236C | |
1018 | C6038982C697C9770CEBB680C66B60D3E9A34D140B5C6B840CFB5C99161E7D3C | |
1019 | 7B9CF4A7D1A4C50E247E1B8A383A4F2E8A4F62DCBAFCFBFF0E8EFC9C0F35153C | |
1020 | 332E1214E9FBE8BB86AA65F1D9DA16B616B8C781E62C2FC61DD09ED83C5F3664 | |
1021 | 28C9DB214AF5DA7A5642C0EC18BFBD099D46AA66BD4D36180A9A27BA8007ACB6 | |
1022 | 2FFF27E8561AE693635014DE406C91C0F62B5D9CDACC4AD391889315EB536B90 | |
1023 | 80F1CD15954C19416F20F907204E7D9D77346E9BE3B621FD00034F57664FC8C7 | |
1024 | 1B164486CFFAD0B0475BDFCBE08D5FC6E602EA4BBAE13B0739E5E12CE867B110 | |
1025 | 84248EEE5A98819C2213D557B61F8673F75BDB8B30EF39578F46895AEDCBF4C7 | |
1026 | FA865C930C810217322C383CFDF7C5DC75539543310BB2B2412015689CB6B185 | |
1027 | C2EE7990D16322C569FFD5A984B62C9D70789CDD0EAB73B2C1B9FC4834794457 | |
1028 | B27E1967217CFF0651D927E80A97F63A264325F3122B609A5DA01C1370568995 | |
1029 | 8BFBA22CA4E98C0F52F6539297DEDE027B43F7C497A266EEC2BCC41580EC4181 | |
1030 | C23CD495527AEA370920A6C7F25739B934E2A9C369AF17C8BA1081AE371ACC64 | |
1031 | 93130A3429A3E7488FC6DCA1824F9E38E6683702F7BE40D8B94A8B26967A709A | |
1032 | 3F072207F8F5E5D3DD1A33F48FF86AF9D7A1811CDC2B514D310929D059B78720 | |
1033 | 83AF376F2D28306A26BA16DD0D2D03E11219A453A299EB7BC67008D3437378F0 | |
1034 | CE28C0A7F76AA4269201ECCF9A41D62D826F8AFF629C83F8286138609E31B6EA | |
1035 | 296C8FFA32617DA4327D29B6BDB26AE44D3C2A2682EECCB1A3D9BB58024CECA3 | |
1036 | 66135BEB39124B865DED7365A4203F98FB75A3062D538D0901B3325ABF1A2AC5 | |
1037 | 348262D968134AC8A65139CD3F60512E9AB6EE562BC6150A2C82ACE44C43B6A1 | |
1038 | 9B1908FFB320BF7E6E2692C3E9591E302CA42E8C7D559AF6D46C15DF3021ECB0 | |
1039 | ADB9D8772AB897B00C603EDB98A1AFD99F224262410CB7AAB3F80F1A07EC99EB | |
1040 | 398F16E0FEA1932A344D7A6D92DBC26CD262626ACE8D617AB8FD883F2000FB5E | |
1041 | 62AAE6E450A7FFF2ECE3069FB0F58696B762F35E3F551E4E8BF2E0BCA256EAB0 | |
1042 | E1098DFC31D2EDF4CE4D7BD6A478A8CC74A71C4D2B54BB66E534731447375BC9 | |
1043 | B8077C2166A8C31E14A73EBAA23325BFE1ACC9ADF4C6B9D5339DD8FFBE839709 | |
1044 | 0A27E30840EF99E72E889F61B1DAC331C871CB2F14A297E14C77723E9192271D | |
1045 | 8082ADF61193D6A42FECE24A285BE83437A1C3897C2BFDD0DEE8CF7B606F32EE | |
1046 | BD002CA9D590C5D12B49D05A26018C453400018E08FE2E3B4450B78CDD613F69 | |
1047 | 60BCA4635E34C5A4E3C02930E37CC8A6E778082B14BB5C522002CC74FD9B21C7 | |
1048 | 62A519F2F9D98CA11563D4817191A74CAA80897D68ECA8E373E820175F38F268 | |
1049 | C48B91276D0F41022E4337F8229B060858AD44B163F9E56ACD5539B2A9934798 | |
1050 | 27ED0063058416854C4A288424DEDAAEC8BBBCEE76DE7B443D4E2D6F371CF670 | |
1051 | 96655CE9B18EC8CB5024D84825FB6F2F8C831855BEDB0B2650E13F947921A91D | |
1052 | E728C3DB8DC0CE25A35FF4DF2400ADE317AF7CAD468C3CE94F647124747121F3 | |
1053 | 9629DC9EC2B8BEC5E29C0161F4BD6567FA681DC4610F878EC3DD1C8047758127 | |
1054 | 5837BA93CFCDE473F470ABAD9E5396A8A97D78F5A3EE519A51FB172A72EFB614 | |
1055 | 77F51F1F55BACD353FA7C830D9F7EF9974BB27CE478D68E2C11310A8A83BC7D8 | |
1056 | 028C165314AF960F45CB8B8D1610D4014F9B6DE03C8CE6D0BCCA6373A7535519 | |
1057 | D52B7A8447337A4199AD5338F1B19257A2C8948767EAEC66B1DC839D679DBAA3 | |
1058 | 025D9A12304F0AF9A621A03752DA6FCF6FF8F103B3F8AAA319C467D9B0BDDE23 | |
1059 | 90FBCB5A9F0E53DF354D181A4B410153CC5FAC52282851EC97EC6877674E9411 | |
1060 | 7907DB40999F33CEABB3F9D73A8FF97C836640644904A60216A09D3FDCAEDBDE | |
1061 | FAF13E7885ECADF69B3B3A8C7C48BA5EE9DB4BD6641A254B1EA03EDA77185954 | |
1062 | DFCE6D7663227E2A062414CF06B7C5B4B1CF54A7B2866EDDD893D279DC2E2DAF | |
1063 | FBED736E3A79A72E602E4887CB0D67FBD1D2996EADB75C48F9835776AE604FBD | |
1064 | 1BB7120E428867967A1FBC57994DA71C8E8D3026A7F2599C072DFEC0AD08783F | |
1065 | 946C382B6C134343D4BFB86D23AE5025EA4B36045B8CD72F0C5C60F404CC9F69 | |
1066 | BD8431150A6E598118A1555D87222563AF1BF8586A99DC57D57BCC9977663927 | |
1067 | 0BE9BB80703E1DCA16EB9D3F4875DF55B6E1444F71583259E1AF45621DB86300 | |
1068 | ECBA0B07FA9F73FC17799EF8AE95783C168E4ABA576D48C8005CB8F9AA012321 | |
1069 | 3D3710987E0F63A71E5FFA0E19365050160D26D2BC4BF0DFBCEF5CC56FB8867A | |
1070 | CFEA19E4F0C335D9DF403E52148AD098ACA0DDD9C02546B36F06F6D3F640E40E | |
1071 | 0742315C2D9822072E7A6F320AD549D6333DC707E7EE1EF45C34C422FCF071A3 | |
1072 | 5C4AE5D9FCD4EC778CFDA048745B741BC17422367EFEE454450815842FD08943 | |
1073 | EE13C6C38B11F8895139D26E7C559C68E8C8DD827F759564961A9157B4B98517 | |
1074 | B93A55BF2744E3E92CB12E6E971C924EF183AF4A683D345F4B20DC378719E8AA | |
1075 | 3E05DBADA8FBC490C1963146F8C057C64FC894B7A14606E1DD0A308B13D8EE86 | |
1076 | 4C6C75FF68023995D33E113A5019B6D481EA33600429453F47815F417EAFCACF | |
1077 | 6224BE0B3012EFE7EA729E7A4311C49A0F876B739F35B8AA9A8D6C69A4AE35AE | |
1078 | 03BA6A731F7DC08BAFBD7C4114FFE951593B4D3BEAAE057E450F43E143B82555 | |
1079 | 574B05AF742DE8D42C9A92D32EE480CD06671C642554B440768B071E7495C8B0 | |
1080 | 2E8B1CA6F1FAA2FF9EEA25065E1D8FC32446CE916DD1F4175AF24ED37D24BCB6 | |
1081 | B55F5C81321A82A11042D1C01A58FAB6E649B2FDA27E258A235D6847B01B98D0 | |
1082 | CC9B15A30C35874E2B5A0976B232A3F549AEDFD7B1A4E11F1A21EDCD65214BED | |
1083 | 38C7CEFAEB6C9D36517908F5DE580781FF13C11519244CED34DBAC55F7B2349D | |
1084 | 6ED7FC4822CDA966ACFA78AB532E76F8F8AA50C2AE5C33B685AA33CBC5605222 | |
1085 | 7F1B46E8E1281F39821291401DB8E68B25346BA84696AED6C6800A7D48B310CA | |
1086 | 743948B4EC7F6C21E7E0932220D3B3861F1DDE667359B510AE27578E4EAB1884 | |
1087 | 84B21E420ACBF0717D031FE5D8CBF9AC103D5616A29B46469A5182167AF69713 | |
1088 | D4DE5A1E6B269779FA834A39CDA83A1AF169A9481CE31B941F40D2AF7128D9EC | |
1089 | 0AF513405D1448E329C041996901161ED6D4F7B8E6FD2044B7B355ADAF5520ED | |
1090 | 48C4FAD1394E6D03669D1BBEC48808B89B465149FF642E76C1605A39AEFDA61E | |
1091 | 0399871189B0612305357495DD4D72F9683A41E334FE8213D40BFD8630B4C71C | |
1092 | A1601AC3AE2533B31D39BA2E70B585DB806E82D8205173100C468F5C2302637B | |
1093 | CF65E7DC255DD861D3633CE2541AFBBE0F6D88735EF80F48D95E9914A797B4FC | |
1094 | 3A78488EB034B7EBD7AC0EC3B1CF4BFEF57DD9E3CFF172FF38D9C9690CD75E16 | |
1095 | CFAEA6105902810790E602842BD16436B158CC600D7C49942F498A364FF47FFB | |
1096 | A6678DCDAAE1EC32FC04289F070A93C192F172190DFCE5BCBFC13CFF1BD72289 | |
1097 | 8DDC2CABECFDB9F7DF9FED80031C7805F52C3D56080692B2DFE103084D9CF109 | |
1098 | F41E3B1996BBB4934AFBF6199F6495F5E35104DAF1873BD33340DB4E110BE18F | |
1099 | C67EBC1B79A420360ACD2554C5C29D8357CE6E681D767D0BAD46BC022F257C90 | |
1100 | 5801F7A52E3C450D164E7C303E6EFB6F899F115DC1BD20652505F6F733183F41 | |
1101 | 585524AD75F9A90DDBD46C5FEEB77BAD89877C663EF5C8D3D9050BA851F2E9E2 | |
1102 | 55C8CEE530CB81AA6E303CE0DFE240334570FBD39A50714EF05E1844FD338648 | |
1103 | F34CBE3B92CD718270610603FD3AD63A5030CF48C2E3AA11E054E105EE054F12 | |
1104 | 2329B7966CDCC12D160739EF5F94FF7069D508AC3801433EEDB02DB57A9BD9E8 | |
1105 | 5191875BB9EF249ACB52AA1D8EC2D4BD27998BA65847A929F9C4C03775982D15 | |
1106 | A5F3BAF94F225C0EBF4524377307383331C668A82D552949B61A3A3B3EDCA39F | |
1107 | 5AF0DE18F09CA7D5560F1337B7E5090417C7CAC2FE4459A417B8D4789E721B8A | |
1108 | 2185C1F6697E9FD0B640BC0B04821C93E26D2C01EAC11C81CF376F508CC4C9C1 | |
1109 | F0E81D216D959A130C5819D99A50DD9CDEA60AB95B7024E2B5A4A51EA90924E8 | |
1110 | 5E825ADB2F302A04B2BA3734622DBC9A6024226C3E17CCF4B89359D08DA35C7D | |
1111 | EB8945A40A1818A9B3D3C8456A9837665CE0477B9541BC11C05B6AC8F430D3F9 | |
1112 | 1D106FE932BD93EC002D46AFA13F411C5FA6ADF3A44C6580510DEF798D119E91 | |
1113 | 18794470FA5A6694F68282BAD136F0705E599E2BBBC79350902B596DC15B06A4 | |
1114 | 3F32DA3A415B67A5BFFEBE01CAE0C895E7C87CCE12B5BD4442300527FCDBE763 | |
1115 | 5BBA21CE602E086A475C1A54A6CE2ECDF1A5C6F9099252E24F947ACBB9A2CF4C | |
1116 | FD92F3CA959748844585C354130E592211D39CFC0C736F273AEE4BCB425C191D | |
1117 | 85CBD4ED9A11E841BDDBDEB1DAFBB07AFB459C3C7C1EB9985EA4886170A8E345 | |
1118 | 2ED764D40195F79A38D0BD3B10806AF6ED520FE0E728A2DEBF951EB1D2094FC2 | |
1119 | 79E2E4443A5A496779580234923487723A760F4B7B93BF088B6838F9ABD5E907 | |
1120 | D717EE24D3DC0B927D311DF68386769012FAB21D94F564AD4714E5F1778D568E | |
1121 | EF783C9133B03F3DAE41404CC96FDC88816D8D7E40EEF397FE47C697637EA250 | |
1122 | 2B735D200B801E14FB8173EAD8518BFBD0C353F8799147DB8630BB04CA5F2583 | |
1123 | B4A76420CFBBDBED64B1624486FB5A0514E651F7AF489790EE4D95B8D683863C | |
1124 | 9A36DC8C3DE90C5E90CD82093E377D619CB06974852736555CC55A3BD95B534C | |
1125 | 4F0481B338EFFB47CFB9F16617728E11EC5B3583EE3856344E092289D8D89A4F | |
1126 | 951DB5C51B49DEBD07912D6530DDD4AF310464CE75FF6E315A06830C62D45688 | |
1127 | 488F114BD47B9C7A167729AA3DE3C7E8B111E420C7BA4BBC343D9B64D50DF5C4 | |
1128 | 1C2FF51695F1E6511803D36789F3ECF99120B9CC7503CB7013271ABD88C660B8 | |
1129 | 5120063D9AD988729736C152BDC6A29F2D59BE887EC71912A9774C1A7BF2B40B | |
1130 | BFA63CECEE88EE5797276D89CE7988180861A50B1D3E62DABD3686E0B94A20E4 | |
1131 | 55B88889FA2784B4D2E14D7FEF07026E323B1B0582E485839662879D193540BB | |
1132 | BCE7AE45D77256CEFCBFCE658676209DDAFE6874CF079B603DEFB729F1842E81 | |
1133 | 4E169DD973E1E1904EC57A4342A7C16812B75FC4F753A8003BFE25368AF5E02C | |
1134 | 76E5790C61F4DD74A432C71DB22B86AE3241358DE92DAFDA95F5BB2B4F7352DF | |
1135 | D47A7AF1DBF95E29F30AF79E6569B9702600C804E92D67FFFC1A74DBD01A2773 | |
1136 | F4C10427C32D0BD873ECEB3128B5469943740B7000694D1A1A89B9B5F3D787C0 | |
1137 | D559081D2CF9A9E254C0AAF7AD8E5ABCAD70B79C81624FF1BFE218883C4925 | |
1138 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1139 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1140 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1141 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1142 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1143 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1144 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1145 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1146 | cleartomark | |
1147 | %%EndFont | |
1148 | %%BeginFont: CMSS10 | |
1149 | %!PS-AdobeFont-1.1: CMSS10 1.0 | |
1150 | %%CreationDate: 1991 Aug 20 17:33:34 | |
1151 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
1152 | 11 dict begin | |
1153 | /FontInfo 7 dict dup begin | |
1154 | /version (1.0) readonly def | |
1155 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
1156 | /FullName (CMSS10) readonly def | |
1157 | /FamilyName (Computer Modern) readonly def | |
1158 | /Weight (Medium) readonly def | |
1159 | /ItalicAngle 0 def | |
1160 | /isFixedPitch false def | |
1161 | end readonly def | |
1162 | /FontName /CMSS10 def | |
1163 | /PaintType 0 def | |
1164 | /FontType 1 def | |
1165 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
1166 | /Encoding 256 array | |
1167 | 0 1 255 {1 index exch /.notdef put} for | |
1168 | dup 0 /.notdef put | |
1169 | readonly def | |
1170 | /FontBBox{-61 -250 999 759}readonly def | |
1171 | /UniqueID 5000803 def | |
1172 | currentdict end | |
1173 | currentfile eexec | |
1174 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
1175 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
1176 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
1177 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
1178 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
1179 | 2BDBF16FBC7512FAA308A093FE5CF7158F1163BDCEEA888D07B439DBD4E8B4C9 | |
1180 | D198C03874B5E6F8FBF4922065A92BC3E66D05DE53971CB1424510E892442858 | |
1181 | D69CE1F76E4DA76C87C763A4B2FE36321E54B1328C9155B8ED6361855A151723 | |
1182 | 3386AEA3D042B8D89C8C0E9A33E5DF3B466F7BB8C2C8A4ED4CDAFF55FC6D3EE6 | |
1183 | 0AF2CEBFC1AC3A6E6692F8BB81F82D86BAE85016AD62FCB05467082C2E5AD348 | |
1184 | 44D1439C2B59F65590E57CA0DE481A7A34E79931B1513C4C30156170409A4BB8 | |
1185 | 46D412D1DAF88AD30722F12DBCA1CCC6B4BCC28D06B0D29149DDEC520C8FBA13 | |
1186 | 6B82E2E1790F00B216282FF122EF0D47B70A1B29514DDF7C0435ED238C14BDF5 | |
1187 | 6DA243117FBEF7398F97EB95597707ED63C6797EBA1B46EA19ABB1DABDA171B3 | |
1188 | 16CD500F5D64CBFBE4F9CBC3E66A34427D3C4D0C432710289381F9BFD91B4FF4 | |
1189 | 1E3A896C3EEA2F3105C218877D6C0C6B763760FA364D00065E1CAE9DCB5676ED | |
1190 | 286A9ED0D1C946DCA6A2A670EE0936FB4706CC62E234CFEED34AA615C48D2872 | |
1191 | A087F30990C85E64BA68F3D5C117123467DB411C9F2D6F6858CC70C1E352C477 | |
1192 | 713097321B4C4FD4C5CDE305415F998E7245908EEDE6E056A736EA77BD8C639C | |
1193 | 3A79FFD0B74B3D28F0494A115F2841CF8A8827AB5608F96FD8998A5F40FB3DFE | |
1194 | 3AA0C7696DE4E1D18DC0D6E84B943175FC38FFC42A9C0CBB13A908978C98BFE5 | |
1195 | 034F88480F32B9DEB2FD228FF6CB0B89B045AB02020C82E3F5716DC640613185 | |
1196 | 9F597CE262729BC52132F43922B9E28BB71A30AC8709634561B22D13C4FAFE0A | |
1197 | 12C4451969226B220038AD8DDA990A4E2CAD53DBEAB698898BBD3046234EB4EA | |
1198 | 901287E71CB41296C431383AB85F18882F65BE36923F6C0FD6FADAC5B42FDB68 | |
1199 | 64C06E047434FA7A659EF7F3D1AA8E547939FBF9C2ED7AC829F03CA59AFFBFA5 | |
1200 | A7AD2E0FC7BBE619961AE1785D09444B333993199FFED007382B54DDAEBE21E0 | |
1201 | 1E75E0AB6D309DBE53BC7BB9F95D342F51798574D70B95021FA40163A86BE6C9 | |
1202 | 342536A5730837C522D5314B1289D9B7E4EDD108BE7F35A20AB2A16608F6F007 | |
1203 | 6DDD702A5A9BA1325CE2C1CD020DF677872135CF04F4E4F1E9AA6B494E2BC22F | |
1204 | 107C331A7E80718B030A1103804D144802E3B03EF7CB083BCCDEAC7B43F1B4F5 | |
1205 | C1BF6016741B741CF7E12B4BF95221A72CC9F4657264771AA69C73DA1DA29102 | |
1206 | 65D01A0E61F3024E672AFCCBE13CD0B7F54AE1418B72E357A0BABB4D03073B1D | |
1207 | F4EB54F899AD4A41A9F94DC200880A0DB99D67235A2451B25F710C29A882865B | |
1208 | A922E56E9FC16756014FA5CBDB1C32750BD6835A70EB715CEA19A8872041905E | |
1209 | 8C660BACDCA26C8247D6B3C10FA5DC240E433E479AC6AFCF57CF96697FF46BE6 | |
1210 | 44748E | |
1211 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1212 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1213 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1214 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1215 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1216 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1217 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1218 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1219 | cleartomark | |
1220 | %%EndFont | |
1221 | %%BeginFont: CMBX10 | |
1222 | %!PS-AdobeFont-1.1: CMBX10 1.00B | |
1223 | %%CreationDate: 1992 Feb 19 19:54:06 | |
1224 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
1225 | 11 dict begin | |
1226 | /FontInfo 7 dict dup begin | |
1227 | /version (1.00B) readonly def | |
1228 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
1229 | /FullName (CMBX10) readonly def | |
1230 | /FamilyName (Computer Modern) readonly def | |
1231 | /Weight (Bold) readonly def | |
1232 | /ItalicAngle 0 def | |
1233 | /isFixedPitch false def | |
1234 | end readonly def | |
1235 | /FontName /CMBX10 def | |
1236 | /PaintType 0 def | |
1237 | /FontType 1 def | |
1238 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
1239 | /Encoding 256 array | |
1240 | 0 1 255 {1 index exch /.notdef put} for | |
1241 | dup 0 /.notdef put | |
1242 | readonly def | |
1243 | /FontBBox{-301 -250 1164 946}readonly def | |
1244 | /UniqueID 5000768 def | |
1245 | currentdict end | |
1246 | currentfile eexec | |
1247 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
1248 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
1249 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
1250 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
1251 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
1252 | 2BDBF16FBC7512FAA308A093FE5F00F963068B8B731A88D7740B0DDAED1B3F82 | |
1253 | 7DB9DFB4372D3935C286E39EE7AC9FB6A9B5CE4D2FAE1BC0E55AE02BFC464378 | |
1254 | 77B9F65C23E3BAB41EFAE344DDC9AB1B3CCBC0618290D83DC756F9D5BEFECB18 | |
1255 | 2DB0E39997F264D408BD076F65A50E7E94C9C88D849AB2E92005CFA316ACCD91 | |
1256 | FF524AAD7262B10351C50EBAD08FB4CD55D2E369F6E836C82C591606E1E5C73F | |
1257 | DE3FA3CAD272C67C6CBF43B66FE4B8677DAFEEA19288428D07FEB1F4001BAA68 | |
1258 | 7AAD6DDBE432714E799CFA49D8A1A128F32E8B280524BC8041F1E64ECE4053C4 | |
1259 | 9F0AEC699A75B827002E9F95826DB3F643338F858011008E338A899020962176 | |
1260 | CF66A62E3AEF046D91C88C87DEB03CE6CCDF4FB651990F0E86D17409F121773D | |
1261 | 6877DF0085DFB269A3C07AA6660419BD0F0EF3C53DA2318BA1860AB34E28BAC6 | |
1262 | E82DDB1C43E5203AC9DF9277098F2E42C0F7BD03C6D90B629DE97730245B8E8E | |
1263 | 8903B9225098079C55A37E4E59AE2A9E36B6349FA2C09BB1F5F4433E4EEFC75E | |
1264 | 3F9830EB085E7E6FBE2666AC5A398C2DF228062ACF9FCA5656390A15837C4A99 | |
1265 | EC3740D873CFEF2E248B44CA134693A782594DD0692B4DBF1F16C4CDECA692C4 | |
1266 | 0E44FDBEF704101118BC53575BF22731E7F7717934AD715AC33B5D3679B784C9 | |
1267 | 4046E6CD3C0AD80ED1F65626B14E33CFDA6EB2825DC444FA6209615BC08173FF | |
1268 | 1805BDFCCA4B11F50D6BD483FD8639F9E8D0245B463D65A0F12C26C8A8EE2910 | |
1269 | 757696C3F13144D8EA5649816AAD61A949C3A723ABB585990593F20A35CD6B7E | |
1270 | 0FA0AD8551CEE41F61924DC36A464A10A1B14C33FAFB04862E30C66C1BC55665 | |
1271 | 6D07D93B8C0D596E109EE2B1AAB479F7FAA35279ADB468A624BE26D527BFF5ED | |
1272 | E067598E1B8B78188FA4BCFB0B51692D07B0BEBB930C6F0997B437E2C51B876B | |
1273 | 61A563A2673932C2045833FAA35DB22ADE12102335D5DC734AE3AC5EEE6658D7 | |
1274 | 92EB62131E1DFBA441F53EFF9021D9D4C491F26BE8F54C61165CAD778CE8695C | |
1275 | EEAF70E3B20C64D4C2B34A084B5770BAB2A974E898F62BFE90F132A37E2DCA4F | |
1276 | 43E13DB13C94DFA8ECE2B7374827AE168634FA007F8981ADA046CED3448BF453 | |
1277 | FCD9A4F194FA648F9FC0971734BB69CB75348A88CC361FF06E984C86AF0EA429 | |
1278 | DAA5808CCE3583664AEFE0C59EDA04A147FB51227A5AB0C13942323E9B3733DD | |
1279 | 3EE7DF7F774DE5D0D0980DA8C0192983F1E3EF18481EAF1EFEDA0068BCBDB28A | |
1280 | 7FC7D9191EFFC574588DEC1E180341DC959F8EF56ED5B19F50AA82A4653649B7 | |
1281 | CDCA11A1FF27AFA7FF189A7E8A7C0E94AEEC901DDEB541604DEC0FE90FA0685A | |
1282 | FDEADECE61CE2731FDDF7FCF2AEF7CC2B1EE7095F483C2597F66694FBD2AD81B | |
1283 | F68FF2E378BD8357CD1B60A1CEDA2DE760A98868ACB45CCC8CC2370FE267830F | |
1284 | B795058E0FB0EB3C625259C36BF9AD2EFB5C64A45797E18797CE1A2C0304CDE9 | |
1285 | 9D88E11E878A721610EC57958C7E80A5E78226017A263288DEF5D335199E8F28 | |
1286 | 787DF769550AD33E15342FC5E4751F8865AA66E78B8CD2388EC3618A619AD302 | |
1287 | 5760E9F293085CB54BBBDD47C5ADC3F479E39A795541ED8CC921D1B41C9FB1CE | |
1288 | 57B1340BB4BFAD1329EE4EF2DE599944404B7DF94C759037CBE96073FD77DAC9 | |
1289 | B140B4580EF178A84D0746276D6E667E26671117EE04102304F2F599A423A687 | |
1290 | 53CD9E2B061D02D54EF56439E33AD985A84C1CA8F6666CF7746E0DB19A79F249 | |
1291 | AE1F7714AE5E1D6723C5D3AF86E6ADC9F2BEA6A62C3C03A67414A99FCCCFEB42 | |
1292 | 4EE4BE9FC8A530F06879F46889624F7D704EFCB951C1DA1613D55D61D33F6213 | |
1293 | F12610A6F071E79918AC289EA5A3AA9049229902B646FE14E8D19DBE673E1D7C | |
1294 | 76577E34ABE80ECF2F5D6E13CE0926F0C9B11F5E5D17EC5986042BA2AB6B1EE9 | |
1295 | B54CF450D616DA46373918953438A7BF83A5707CCCF26590A7EAD89B5D357947 | |
1296 | 0B6F8BABCE6FC66BF2AF462C2CB99B5A68F1A2C237143FF92C2646B149EFE040 | |
1297 | 41F97A52C48474684B9EDD0F3D0F3838AFFB70E7F7FF8CB8BDA06483F8DD04F8 | |
1298 | 914B752F4C116BF243D31CBF9ACF04DA93BDE4B87D181C42111A2C90181E0A11 | |
1299 | 9E87434F46801D6CFEB350467A78A899A70DC8E12CB2FCB376647F5A155A83C3 | |
1300 | 77B72A0E058550E0F60C273A6320B331A6EA21B51F5B00B6A5271C331235A8D6 | |
1301 | FB9BAF99E4565B1461937DFF6818CCB8A8483BB54E58726C1DE836B9C4706491 | |
1302 | 422F243DAFE6BE7369B09D87BC5CE3BC8085344D4C845A45AA9D915695F9BB8D | |
1303 | 9B06CA358A3A330694E6D269BE179704DCEDE985C2D886B7B063AA7F521FC8B9 | |
1304 | E79876B9FC0EB9BA8441E3317316AFA050E3668411CE8134224945A30F2EA5B9 | |
1305 | A5DD581A67B9ED8497F91589BC155957FAB5540E8BBBDADEBCCD2F603DF46B05 | |
1306 | 2BCAB7A7EF420C9B3F65FFEE9BB27A58C0EE923DFEC5353B929C620B3DBE5907 | |
1307 | 1A9A5C6FF4159148CCD2E6CFCC6E3C177C7B9B13E9D3BBEFE3BBE38FC35F2ABE | |
1308 | 5EBDA74E0C1A3C6088F9D4DEF480CF4159D21CC2053245EA9EC1BFF1FE50185E | |
1309 | D3E3B571B0993AE6EF09489BAEAA2C651E2B36599BD91EC9CF3807A632FD8242 | |
1310 | 987A4BD933A232B6B87B4DE659011DF6A9662F41F92406BA64B662E39B31F32A | |
1311 | 26E6383E35E94459E74818A1079EDD7E7CD7DAB678673AD6323A17E88BEB2179 | |
1312 | 001A3E25129CE05627CF59CE93A0B573BD76012EC927D1C1192A4AFD93425E59 | |
1313 | AAD0956F5C7D86B041209C43F812FCAF2313A96D43C46130D2A97EF3BFD5718E | |
1314 | C9B828682BD0FC3A8C1DD860018349469AE8C381986C7320BD5A43E9D8B6BBB1 | |
1315 | 59101E0972207B00682D78C7D0D38BBD88AF888A1D40FDCA4A69FC37A674FADC | |
1316 | B42C18CCECAD4B7903E604DCA338B1D285C1FE487F5908E91D24581DD7E2E06B | |
1317 | F0FC950B0BF19082B1089C7B425FF511C296C50446E70F27D06E1507CAF0D0ED | |
1318 | 7DD1174A7C4B7A3C7AFD5F839A29623D84E230EEEEB8447E36922B89806FF2C8 | |
1319 | AF69B87071E0D539B09480BC55785C8A9D80A46BA1248A18471B33D92A13595F | |
1320 | 0EDE6193F5EBF1709D42A63E773ED530EB0B04B8D6A1831CF959644F27D6448E | |
1321 | 67AA52FE371F4FBA8269324A7E8B0E41A605484F6865BE95E17DC2C4BC1FF8C6 | |
1322 | 6CD446D36AE4AEE4FA368AC1C040829CB2B306993080C60257834B13D47DA51C | |
1323 | C091CBFB4CE934C64703826C4EBE1A51B41DA786A6A52A3247AAB64EF62554EA | |
1324 | E506E462CFB81E37D2BC162273E26308C11057A6F4D3CA089F1D7A96B27EEA60 | |
1325 | CE265B2E1C4ADEEF44AEFFD1D93C4FA05ED77931DA0505228B03B4D63FDC6266 | |
1326 | B0A1BADE5C91E895BCADF2091E7BE64276CF0B3CD653149127C48600BF42FCF1 | |
1327 | 49812AE035389822288DD5F4196447D266E737DE7D84AA2A1EB338AD0FA8D70A | |
1328 | EE35815425EE181370751E1320C7DEE6A4FB3C3118A7F1E5CF0E5D3BE9F34A5C | |
1329 | E22C4C864AD700BD51025FA86A225F58EB79F4F3A875167E88623E8D8B297333 | |
1330 | 7282BFACDC57E51AAC431B40F30B5348393D8705829264BE437E004CEA8DAC95 | |
1331 | C23756E2165F046D62361632E44C10C54F7A0F569A87E2C814B0CF44E1E30032 | |
1332 | A91F58BF9551E9B9EFA5D7E91B0D5D19111DB04DBCF488D3E41E799C3141C641 | |
1333 | 7ADA4AED435F4C8F7E3FE50C83E1F8AEA74720D1742D5D51D400490BBBB383A9 | |
1334 | B997B337E2B3E21DFE4DF383F8EE183A2CF426C8AAB91A083C7B567CB1729DE3 | |
1335 | 0CF5CEF028388B1D8C5D6CF58752D6261F07DBE1A45526811F4E16EF0936AE24 | |
1336 | EB4FE66A6F008F525660CCD5B8C1DFF81D3C3B90569E1D02455D0A5B69C676AE | |
1337 | 1100E168882E1B027C80E13D91B04945E24E9CD66BB2D8A472DB7656217C7740 | |
1338 | 478645255E610ED1660A009AC5A6A59F7276598F53DB7ECA14D98FD8FE49243E | |
1339 | 987625F370D1B018D89396152EBAA897EA46DA433274E28DF1F705BFD767D093 | |
1340 | F92B3F50F54F0619F3847C60DBFF60107C1B4FA5FA6AEEE5D53163F185EFE0F2 | |
1341 | 11D22F0C863BD4D11A04445F241CFCA40B5250C646ACD15126FF98F6A2CDE37E | |
1342 | D00377785349BE7C346F790A3B5B2186A853B8CDD82819231FA5B5FDF25915B9 | |
1343 | 6A206F5CC7C194AC07D09DDC0CD806A662AE92945FDAA10AFC8039A221B96214 | |
1344 | 214B719784E9A12C9FD5AB9F7329249FEDB3E9D40D3A88330FC39E426795AC2F | |
1345 | 4FD864AFAB653FC435957BDFD52D34C3F3A4522C716E55E84337B5C45E6BBBA5 | |
1346 | 3808AEB1E1B60900D7A8C5F67E3FEBEB649BC52A0676C541DED315AFE779682C | |
1347 | 30EC72067C498E1664F4F223BC883D88620D7B542DAEB0CA003B3B171ED2EC0C | |
1348 | B9E7AA59C09748AE95451E181185180E137013F6BB5D8F3592AF6A397DD70625 | |
1349 | 5E4208BE09C2935737333652CE9E4D5ED5EAE7828E66FF712BDDB256E1E8BC81 | |
1350 | 7B8714D29A3391CD25BF8A454864E7D6B532A9CC83018848408174703B86D68A | |
1351 | 1A5CC929AB9EDFC761E19294E9201AC307E5A836482047D0CBB0088C22DEC3E7 | |
1352 | A543B962151B9BAEDA8415DD0B033756CC0F098ED8043D9DC258300DB9A634F7 | |
1353 | C28CE3903FC903D398EC69BBDCAA656F53280FA2C4A4732D5485F6E63059D97E | |
1354 | 25C1BB3BC0FF5C49F10D137D7C19C832325A60E6A15A33F2EC4134905059DF64 | |
1355 | 4454285D9D7DA92DC963CE154116CF05BC3A35E6673B29FBCE645743245759A1 | |
1356 | F4C131ED6766428B7AA5E7B6FA0FBA7418B620EFA4B837D6187507E00D14C8C4 | |
1357 | ABE61125830B95F8A4EA8E636EABB5B7278A960A761C63DF55F27E310869507B | |
1358 | 1E7963245669FC6A6F7CC0B47E9092614EB3124F590941F75F1E132345439BB8 | |
1359 | CDF5DCE540ABD05EDC63F5B6148EB75EADC57A7DB8DC6AD2101C616480A43600 | |
1360 | E16B14CE6DD00F559641BE7C03E6ADCAF332BFAB42426A32A5EA49C08095EA9D | |
1361 | D8CFEF2CFFC99C6AC54B2BC381E00AFE9B3D29F16DC87C475C11F1E5CF52C004 | |
1362 | 09FF20C7E7D90C5078D61DE6F307D4EC307CF2E593FD96B8712FD0A0F737A8E0 | |
1363 | AEF09E129E7A5C2F577B3F1DF538D90CBACF1B30DCBEFD86A9895D44FFFAE70D | |
1364 | 9660A3F8A820A466CD431C9C2C06FA00CE7DAE4419176E35616ECA9AD2239A72 | |
1365 | EDB1EA56B4CAB9E9EFF8C3E22729261965E0C060D9B15A8A6F761CBA35887E01 | |
1366 | 428750FEE2A583E314DD21F65B8D032F3F7F0C6A7CAE0AEE1169BBC762A0D1EB | |
1367 | C4E42C18B827A986C3AEC866699699A8318E88386646156CC3CE3F3A47230269 | |
1368 | 64EAF40964EC1A52B342C551EE1518EA4C6551C3E9FFDB4F9BC87743D3A18D71 | |
1369 | F60486A40A75597BA69674C7E9B71F1B3E069062F8A603DAA823DDF0F26C03F2 | |
1370 | E2BA5F18273C7CC45CCC040C1E0A01CBC5E3C964988FAB19D1543A2C69F9A241 | |
1371 | 36313020AA851C4EB9FFBB39CA7F46461AE6CE7FB5B5F2BCED463E1DCEA983AE | |
1372 | 4650CA2D8D3032046DC15E7AE5DA2B6B7562BE28F6B36FF60720173B6096F93A | |
1373 | 36994AECF7B15DF9E1E1A7FA36E2515393B4E0A1A5DB4D7414EFAFBF04A090C9 | |
1374 | 9392F0A2634955A3E1CA3D8B86447E48879E95DB4F4092EFB954FF00DAD34134 | |
1375 | 4506914914E3FB81CF7455F3028514E95216CDEECF6EC5917E1277A6A3B70B34 | |
1376 | E5EB97B91922020E06CAA774324AE2E29A516F28FD6E718502F8EB18C20A7627 | |
1377 | FA3BC8E4572972D906A46CBCF77A87912D5E523C9C205BE2A2593B0114AEFFD1 | |
1378 | 4154E62A82CB766EAF4564FC746DE08A9D89FFD2E9F0A79633555D0C8634FDB7 | |
1379 | 3E8F0D78B440DFC00C5B02E4E22731E82FF4110F4B1C697D9285C881E8410639 | |
1380 | C6BB1173197B2AB21C27FD4381BD540C35F56F44428D756B2CAE216257ADF5AC | |
1381 | 294B1FFFE9F0DAEA3FDEAE3B206556EF6044879DEE2E0359B7F03214AB14DF5D | |
1382 | DC4B0586328D5EA1248876600D9227D627B4B54DE7C4324F438BEB9C3B176A15 | |
1383 | 623C28BF6ED326030826EC104DD31980A04FFB0B5420632DB31B3E96CFDA14F6 | |
1384 | F5D59582C1DA4E9B9C2F054C1468E4166F88FEF3C197FA50222BC3EE4629B9F7 | |
1385 | 00BC3DF48D0D490F17185A03C2A5B36BCB4CD8CD53B24CAEB00C5C3F82974E84 | |
1386 | 228A32F6FC48B21E5AD6778D856E914F7D133BB316969E5D42D146CAE8F76733 | |
1387 | DD146D73C7B983EF91329D39D83B21BF916D27CCB0194ABE686419F565450CF9 | |
1388 | 83B3B1205B9F393C0D832783F5C3BF538B365B232163CFDA95C43351CC77CC1E | |
1389 | 3834CE8DC52A6D4AE99208EA5F0418E0B2AD004352F4EC28735EE7C5895CAC30 | |
1390 | CF5851B221E40D124D1F7B4326454390C3D35DB4FE98BDEE3E35F1888B795CD2 | |
1391 | 47543AB21EE6B1B14A98CBDE3AE262068132C55E8DE92CCFF3B230BE04E29516 | |
1392 | 8B072B52001F766E26775BC17F3DE4FBED085570F010C67BD861E39261FA16AD | |
1393 | 537DD595AEF258E579784CCCDD714018EF547FA81980888CA777FE6DD3F1ED23 | |
1394 | 1C4AF7E15CC50E6FB2C4C9689E0FCD12A79A9E35EC43B53400A8EBEC365D3D80 | |
1395 | 766E50660757A179708C6D33D83A4C6B964F7C89426FC6B8E56B62C18D5D0D38 | |
1396 | 439DD18A60ACFF9FF4AC30AD8672537997B5E0DA80D6AFEC5FF084057BC8146B | |
1397 | E3B8FB430F0F4369FA1CED42DB88219946915759B06D45305C90EC757B3C540F | |
1398 | E5CD32B7A0A3CC5463BB9107338601E092F57313C7AD6148130F394E1135E1FD | |
1399 | BD1ED3D8DC1361D89CF384DEAA0DB95C45FC78FA5CF5A5E50887C486ACF50DE7 | |
1400 | 83EDB18AB747BBA8C7D7E2314714759F1D46B13B69ECF5898FD1C2CC5283B113 | |
1401 | 9D4E8071D17759CFCAABBC01B266E471BAD6717A8CD101E98A3C2AB037DA6F41 | |
1402 | 1AA5BECEC0BAFA3DEDFC486CDF0AF48EFA9117087326975186946AD2B1519D95 | |
1403 | 4EE8827EEBADA88A44C7AD29D3BAF35C3B81FD69FDE31DA47D8EB2BBF4B1DE58 | |
1404 | EB5D3B1C4466A670CC3397679BD09BF4AF56C09091A97F9FA40C4A7B9D0ED0F3 | |
1405 | 5F7F0DD7031A6805EAB6EE1B6FB2326C7C54E716F388FA1D9D2376656115231E | |
1406 | 24A3538589228B1D74D78E3BA2F92401F929EE1325ED43E274761717152B407C | |
1407 | 9711C4EA0F0430F835CAD9B7E2048C8B05EE8A832C6E571171C7127DF003C557 | |
1408 | FC6DF91C41C53E1BB27A388FAFE3E47BC0EA5EF7E6B0925704FD522906D5D2A5 | |
1409 | 49DC34ACDFE059C67B057F415C32DE5ACF3EDFD41F89C9ECC9C51CC58FFB2A7E | |
1410 | EFC19D8AFCFCF0EBB4758DEBDA39439B18AFAFC3C5A656A83F30AAE799B78930 | |
1411 | C056596AEF43E473B3AC6E0114759A2048D429A7EEB8CBA7C9CE9E7A8493AF79 | |
1412 | 32354FFBA5FB27F24A343C608C5AB5CB6FCC962DD46A60E7BAF1FEF39011B500 | |
1413 | 5C4C1B195C22F668D2B9A8F6F4A307BC3BE10B58C500DC01753241FC22197D9E | |
1414 | 2E37437B4DF008E4868B39C865B5DA92AB147839FE3E0F5AA329F901B745E908 | |
1415 | 5B5B4ACEA87701F16A7BE07B0B5B1D59BC72AA5D7507CEA5A3A331F085D33E45 | |
1416 | 2710B96F2A130FD5669CF15FCB986C9F94E67F5E6382F4830B5AEDA4DAA82B47 | |
1417 | 797A2DEAFC0B851C101CE4A9DAF6DAB63CD22AFC1127A4DCAFFB6F5C933F8D72 | |
1418 | 04F778DC9FE9CE6E7C93E1AB6CCB82A5D1C8FE0AC18FBAC2684AA87592337555 | |
1419 | 5F3D53E2A9923FF626B74E7B0C248490668E0D11F1E2CB576D5ABCF9FBB714D7 | |
1420 | 961A55FDF0B26D863DF9937494B161A28EF983DB65636BF824C04055E8A6E75D | |
1421 | D3A22EDC7EDCF47EF5DD95B506AD0F876F1119F58EEB6D838C9F3E1A3F65221F | |
1422 | 721EAD4FF3DD74355745F8BDAB5FBD835A87546A55C6C1648C2982AF76E8A760 | |
1423 | 53DE528A5D0DD02B1F068182AF324251654893A61F3A926B6C0AADAA4D3A6613 | |
1424 | B4E703B86F1C3591761E78C86ABDFAF9FEDE1D4523612C2F461B06FF27B96A4F | |
1425 | E7C6761DB1CB573DD6F76880C1678828CF3706C85B76F3BC292741468CD682B6 | |
1426 | C83B99E5D047759A59F106BF5A21F6BED5E2557F9F3FBE911BC16DE30E830FEF | |
1427 | 66DF51B9D28D6D9D49BFCDA1D2524F83DAEC3282A869E0FCC6D1422789055A80 | |
1428 | 1370617A02A159DFF29350EEBDBD941A6357BC79DB69F0726AD66DDB5C8B4B50 | |
1429 | C49192B86374085B8382E2FDC42C314CB58A2C46BF0976A1D9D6A365FAFC08E9 | |
1430 | 330CF2E2F3B26F6D997F56C565B113CCAE3F3A979825889A7B7EAEC1E6521E8D | |
1431 | C7585FFFC2CD3AB2683792C61570DBA2E23C9B66354C2AF757913E785DA632AC | |
1432 | CBAF1AC1680B13227048D5232C722A84EBA424483E2A0156B538490A0DDF1435 | |
1433 | CD7310DB183F8C941BF1B203A068FFCDE19D09C161375FDFA300B84110531D1F | |
1434 | 735A96C6A2D7F55AF41EF32A81B44907FD0C922EDAC6231D7A19868F4A67A4F6 | |
1435 | E9DD38552B2E56879AA11FBBACA27883CABC44676E22F99CED0E47168D692B61 | |
1436 | 7221A595656E7981D35117D729F9136089A3B85CB733D06B0286A7604A9D692B | |
1437 | CBF2715BCD63BC5288943F2F1432E086165F4F86425FC03CAA91D933E5768E39 | |
1438 | 62B1EC282DBCB5DE928A51074C2584A6E2B49C67BAE7CC71F893FE10C89ED1E8 | |
1439 | 7C3DC2E3FADD3672D3D6CF95DFDC2D9248A6040E4291D9DCDB0A680AA70700AF | |
1440 | F3A63FBC3818FDA1B73FB76BD1B21906B6E7EDCA248D1BD4863B0A438AED4707 | |
1441 | 4D775B8D9664E118602D16D8A89392C1E5BA8756B52902CC65002F71DCA33C7B | |
1442 | 71BAF36DCC0DE4BC9D11381C5E48 | |
1443 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1444 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1445 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1446 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1447 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1448 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1449 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1450 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1451 | cleartomark | |
1452 | %%EndFont | |
1453 | %%BeginFont: CMTT10 | |
1454 | %!PS-AdobeFont-1.1: CMTT10 1.00B | |
1455 | %%CreationDate: 1992 Apr 26 10:42:42 | |
1456 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
1457 | 11 dict begin | |
1458 | /FontInfo 7 dict dup begin | |
1459 | /version (1.00B) readonly def | |
1460 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
1461 | /FullName (CMTT10) readonly def | |
1462 | /FamilyName (Computer Modern) readonly def | |
1463 | /Weight (Medium) readonly def | |
1464 | /ItalicAngle 0 def | |
1465 | /isFixedPitch true def | |
1466 | end readonly def | |
1467 | /FontName /CMTT10 def | |
1468 | /PaintType 0 def | |
1469 | /FontType 1 def | |
1470 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
1471 | /Encoding 256 array | |
1472 | 0 1 255 {1 index exch /.notdef put} for | |
1473 | dup 0 /.notdef put | |
1474 | readonly def | |
1475 | /FontBBox{-4 -235 731 800}readonly def | |
1476 | /UniqueID 5000832 def | |
1477 | currentdict end | |
1478 | currentfile eexec | |
1479 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
1480 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
1481 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
1482 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
1483 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
1484 | 2BDBF16FBC7512FAA308A093FE5F00F963068B8232429ED8B7CF6A3D879A2D19 | |
1485 | 38DD5C4467F9DD8C5D1A2000B3A6BF2F25629BAEC199AE8BD4BA6ED9BBF7DABF | |
1486 | D0E153BAB1C17900D4FCE209622ACD19E7C74C2807D0397357ED07AB460D5204 | |
1487 | EB3A45B7AC4D106B7303AD8348853032A745F417943F9B4FED652B835AA49727 | |
1488 | A8B4117AFF1D4BCE831EB510B6851796D0BE6982B76620CB3CE0C22CACDD4593 | |
1489 | F244C14EEC0E5A7C4AC42392F81C01BC4257FE12AF33F4BFEA9108FF11CF9714 | |
1490 | 4DD6EC70A2C4C1E4F328A1EB25E43525FB1E16C07E28CC359DF61F426B7D41EA | |
1491 | 6A0C84DD63275395A503AAE908E1C82D389FD12A21E86999799E7F24A994472E | |
1492 | A10EAE77096709BE0D11AAD24A30D96E15A51D720AFB3B10D2E0AC8DC1A1204B | |
1493 | E8725E00D7E3A96F9978BC19377034D93D080C4391E579C34FF9FC2379CB119F | |
1494 | 1E5BBEA91AE20F343C6420BE1E2BD0636B04FCCC0BEE0DC2D56D66F06DB22438 | |
1495 | 452822CBEAF03EE9EAA8398F276EC0D92A7FB978C17805DB2F4A7DFBA56FD6AF | |
1496 | 8670EB364F01DE8FCAFBAF657D68C3A03112915736CEABAA8BA5C0AC25288369 | |
1497 | 5D49BD891FABEFE8699A0AE3ED85B48ACB22229E15623399C93DE7D935734ADA | |
1498 | DA7A1462C111D44AD53EA35B57E5D0B5FC0B481820E43222DB8EFCD5D30E15F9 | |
1499 | BA304FA879392EE0BCC0E1A61E74B3A1FC3A3D170218D7244580C7AA0DC65D19 | |
1500 | 741FA5FE6F8CBF60250ACC27454BBF0897CA4B909C83A56672958752ED4B5E79 | |
1501 | E18660764F155E86F09EFA9F7685F2F5027EC85A775287B30E2069DE4E4D5712 | |
1502 | E7D033481A53A2702BA7542C71062173039030CF28D8B9C63B5596A9B42B33E7 | |
1503 | D922944A38713383D3648A4AF160A3B0C8F3379BA4372BE2E7EA49AABA75AEEE | |
1504 | C5DDE1D8BF68483C3D21271280ABB91D54CC819680322EAB72E1250A760BC8DA | |
1505 | 726405EFE420635B5B7F0B48752C06083E92BDE06401C42A2C528C8A60381227 | |
1506 | CEBEF0C9440DC034DAD9C19FB27A350233112B0A339366B7373CE058456E0E1F | |
1507 | 139E2DCAA12133B5B6017B0E08E776403F967AF719E0161CDFBF8BBE8490F57E | |
1508 | 53C78E97517EF7FB7C00035D601CAC8F4EB2F16F8765614227C71C390C32E960 | |
1509 | FC7E9B9BF26D89F808B05C2E483B9171450E4CF3A8690E3B6B1BE17C36157131 | |
1510 | 89E42D8A2F51D4CBFFF07F50789D0603806EED2D0A9B5E8B7CC0959E57AA8088 | |
1511 | 5F48BBD28B37BD51EAC7264D45CD2BB8B6137529B2B5DEDDD7A740458F045922 | |
1512 | D1A14E07A9E9FCC940D89EF56E274BF533927DB8276C3C0DE704CD8EE4010F39 | |
1513 | 365AF1E3665CE873D8D1CCABC9C69A6BA8939F170B873994330F32963C330E9E | |
1514 | 70E95D62A5C4D2D09AC4B8DC7C837D9FE7F5A0D4D082743D038D458D90740478 | |
1515 | 2A04E7693C96DB4A91CE237B8ED9D9F07DD4FB4B701891DCF294052EB8263EAB | |
1516 | 5FBF7689500DE29E1121A4460B725C793F71E79A58BEF6EFD29C6CA85702DCF4 | |
1517 | CD2435CA9A0CD4A1D81C15602B768249EFC229A2EFAD0BFC7D5A8BCDA1771DC2 | |
1518 | 2641AAEE34E58BF6A236F62E2FF68B3D9E7C68FD5D104811925266AC67F16A32 | |
1519 | 9B1EBC55089A05E3025EBD787EF14F4E053B456205C8CE2E24295401232C0AF1 | |
1520 | E01BB90B390E2DA8E42E624C32F3D68ECD59EAE9ED878D07889C7FA8C80E0D27 | |
1521 | 527E9E0C57C12DC1B10508A039CEA74CA8BA027FD8DB0BC0356DDB161357C983 | |
1522 | 3A144F697E1407791DE270911E25370499A0ECD912B9974490F2B66AB541C9F0 | |
1523 | 02DF28DA53E7B3E21299192933DE13DB56210B6FFF3953D09440A8A043987724 | |
1524 | 6555A448EF5A54023D8E6CB060F41BA6C3C8CBCCD856FAE2C86A1A0341D380BF | |
1525 | 3236F1B526BF811976506A517AD5913B0681D45D284FA7EAAB535507CBE0420D | |
1526 | E457EE415EC91B8FA42F9AEA4E63ED29DA0BDA7A7824634309E57D721A422806 | |
1527 | EBA4D2DF543A0050108FA7C6104AE75ABD65EA7274C12CDCA7FCFA6C39F8014E | |
1528 | 3FF49B8FDA5FF5956B72F581DC7CA6A860D2BE2C522ACDB1012E622D211700E6 | |
1529 | DD77FCC8AECC89A787D2F047F08594CCA2DC2658D2CEE3752854AE62F5AA846A | |
1530 | E022FC901203388B0FEEF795DD5BDAC0103B576E5C8052A696B8D6B3EE6EA3E6 | |
1531 | 70E6B2646715C9E74043ADB3ECDBD95A5EBBF4AA112FA800B833CC7FB49F8E12 | |
1532 | 35B98E34D63EAD6CBD062C1AE5742C9209DD34458E39EB8655E6B527FA848B86 | |
1533 | 53984B3E009AE9D16AB83276141F2ED66D8668A2D2BAC65EC966102F7A8A90AB | |
1534 | 3469707A2778A2BAA4EF3EE6CA7CDDE0B2D7C324D5E17D8D3447C7DB378C2718 | |
1535 | FD1506535B0DAA1FF41130E8FDA53CDCA01893D9427374A0F969A7D69917D208 | |
1536 | 370931CC09A9C208EADDAE21563370D6DCFD1E591848685A16CC6D9E7CB721BF | |
1537 | DCBF09EF118B1D13C0FDAA909B281BA48BA7AD6C7A73A0AA5A4F2DCB93E51912 | |
1538 | 51AA351E1ABCCED1DBA4DF7D97253280BEA5C4E123D6C2BD88C3F361437144A3 | |
1539 | B9B93F0C89748A06DCFC12D821107C2BDF700E997D75F69D5F5E9ED4F1C1C474 | |
1540 | AA0E18D6D9F021CB238A01BF3FCE903663E4049D19EA3C07707E779367B696C0 | |
1541 | 50BE98D3D4CC8F356F3B4ED8B97BE899A205358552A39355E7C672FD88B94E04 | |
1542 | 6C593496F77783ACBD92A642CABFD0AD4150A5F7D7970C02F30CBB0F947AC53D | |
1543 | 3B78A010DC543131E6128AD18C9F9D3030101E269EC58ACFB223C121763BEC1F | |
1544 | C3A2B8ED77E75395B2D2349A2CDA54A740F0074309C516D38FA7D25E14B90B47 | |
1545 | 8D919C4E0D57C84F717E297425F4ADD0853749B9A21418E8BA34579F9816D46B | |
1546 | DAEE0D92BE78A093BC2846AA3FD7BBCC226C417C6ABCC4E194A3BB7EF01DB553 | |
1547 | DA2C3EE963DCFFD81F9D28788B092D0414BA913E25585D8D884977CCB9CCEB84 | |
1548 | 5803FCAB0A16B77BDF4F21D22C850CC32F5E5883453A34FC12F50239DCA3961A | |
1549 | F4E9F1EA81A6FDCEDC0A4A053203D165BE090E639AE340A1775358D00F40E960 | |
1550 | CA1B852885B0B040D76D61F3E3AF2F525ABE6095544DAB11595C5B0AF5E0ED37 | |
1551 | 443A7D44AF469C1136C8E4670DA0CE541B6797CF9199BFB907E4DDF141CCE2A9 | |
1552 | BC2F72401338CD90749FFEDDF626AFD2578388B1C41AA44A033BC4F51469257C | |
1553 | 193A2B62A6DEB712EE81A120A4774D7F601F1FD25B074E94FC85336B79A9B4BA | |
1554 | 66B807F0FAA7A0A65DE3CAAAD6326F110FD7FAFEDAFE4BB55CC50AB35B7DA8F2 | |
1555 | 9F4F4907DC451EAEE650D67F0623D7FEFF4252D6727E16FB2961167639A6CC6B | |
1556 | AE6966D7F2B86F558F706DF92DFD61B07DF1B9D5C4D5F6AD7E1F2DC34FB845E9 | |
1557 | D151F2435453FEF430A79F1248DBE9BACB7F4BBF181138277208EB4E01D46963 | |
1558 | 9D38E06D81EF314A8993AA7EBA9BAB51A02F9B0A38AF60EDA811C1BEA5A2A538 | |
1559 | E5A5834625D892A0D4EDBD50E1A6F7B5326405DBA2AC5E67987A4E68C761DC6C | |
1560 | 4DC14CFB81F7E64E2ABA70BB34214D39DB1F786F410B0AF211D95850C0D7CED9 | |
1561 | F7D421D1432CBF4E642D41BD7306F89AFFFBE22BFA3CE0C0C991711C475472C2 | |
1562 | 87F2E0EC27C8E12F3C8198051E4EFB4BFD7D48FDE19DECC18B7A4EB5FF3995CE | |
1563 | 5D5EC2AFABB33F50F65C541F23FF7B3428BEECD8F4B6B456579A55A91ADB1F9D | |
1564 | D32CA440884D36E77E43F532E1A558A28D9BC89492EF878887E8D1D54EFDD0A4 | |
1565 | 148DFA9BD5BF57DB9F0B05ECA64165D6493E079ED13D6A4173C2B5F868484262 | |
1566 | 5A38C1763674544FA86A017B2CCA3F553F33D2BB50B1C2887A4AD18BBAD03E0D | |
1567 | 66AA907D2C755BA4FDFF7AD251439DA0ACCDD0A6A9BFD8BC74C0FD731918DCD3 | |
1568 | 3E5DDD3B97D2D8B15A759F3BACF7F2D6C7A1DCAB9F5CBACA46547EE4243F46FA | |
1569 | 14559105B14506779243C4D98BFA9BC319BD3BA9ACC048038E8E8B14BF49881F | |
1570 | 71AEAFD406E065B3933CFE3E4C08D5CFF2AC90AF8E6A96CB802069CDA7AC92F7 | |
1571 | DE0A370CB5AB593E23B2B9037B44DAFD888C4380C1DEB6693F5212919AFF44C1 | |
1572 | FC66298FDE6321E90EA3C985AB96C7E600B50506D9DFBE405803B02D3E998D06 | |
1573 | F9B7DF3C098BE3E489DEDC21A8DD358C1DA0D5390DF317ED309F6AD082C7BC23 | |
1574 | EDE9EC51636D4711CDECE391FBCC0C5277DD5614E955631DD349DA06D047202F | |
1575 | BD311D6D70303F437EEA0B65B90B8345460F2BDF324FAA2C7A8F206938312C2B | |
1576 | 63B4E7B51DC727BC7F8EA99509C97626D5CA84B3CBB5C7D65BE822C31B350695 | |
1577 | 24E93E904C0DAC7BC53B0920B4F23FB0916975D5A2AA52177937834EBBD82B96 | |
1578 | 0892D32316D48ADF29518E4F8CB316CD650621B1A021F6855C2A3A84AE6BF42A | |
1579 | 9DB4D209EC532D8ABC7CA2289FA635B14B5C5C59EC3DFC0DB504615236D106FE | |
1580 | 98363DF080B162F4CA4701782AB53BCC0C7650233F5F7495C72F7523440B44E6 | |
1581 | 9842A608A4550932671DFE066FECA714C054A80664CDB9272454A0CF4F4CF071 | |
1582 | E0ED8A2103FCCFE2FA8289C2F588CD2348E33D38A12CB75DAEA71A5D9DFC9463 | |
1583 | CD7DC1C794AFCC65E597460E28FE42B871C4FC8407AE12AF961312B28D4DCB4B | |
1584 | 42172E242CFEAE3B22838711999308990B6D49AE7B65D9469F4712834134CC21 | |
1585 | FAB9EAC1F23B2C8214A1F00F2B59EBDC8F77C08F6BA6A907D05F614F6DEC44CC | |
1586 | C80993966950BB43BF8F9395BE2BC0C2AED92C483850227D254E2856604A188D | |
1587 | 83282CCF23B170C8EA1F01FF9BF9CE49934B1A613491785249B9740D9583EF0A | |
1588 | 1640869CE4D4FAB60F60D8ED862326817A50FFF03AF0978DAD2A356AF78D768B | |
1589 | 2A12B2DEA9193EE82FF34CE1075457D4F325609C76CFFF546E59EDF5B389CD92 | |
1590 | 459CAB05D6DF84254B85E1C220A20BAF6A5D81BD6A83660640D2588354281B88 | |
1591 | 04DBADA8203A1A609DAA208CA8D5596ED8392594597441E2900CDAFFA49FA51F | |
1592 | D65CC39A02AA7CE7E4869A58D29D37F1C659F3A323D7A91F60A61FB54A39B266 | |
1593 | DA47A5E39B8BBBC317A387DD18633A054B2CEAF502B131E618ADA606486B749E | |
1594 | C6E64CA8745820C560988AA44B30B2CA0A3997BC572F50F0CBAF5B9CB612474B | |
1595 | 661C4211569B1A9591557A197CA580B2AB4ACE30362D08D9793743127E5568D4 | |
1596 | 2783C4CA7C07E20B43C749AEB5FF0C21883832A0FA943582FEB3B5010C99FFBB | |
1597 | A0FC837C27FDE910AC56577FA88F3FAF575687DE5A90B95835154EF384F00D4A | |
1598 | 01AA0E48209DD042AF03C9C7BEAAA31E9BD00AAAE10EAED451C01E377606428B | |
1599 | B0672BF8F10F7526F84ACB5446528023E01F5E5D4AA4EFA9023492F03F60893C | |
1600 | EA25E14FC4D26478710C3DEAC1E534196AAEEEE29D266CF2BB9B80970B677353 | |
1601 | C97D691545D78222988FE902865F14F44C079CF7C14ECBE561680EA1DC4A6FA5 | |
1602 | 7420C58C4EEC87315A4DAF152222BC979B0CBB4EC17049F677D1C2BC31ECB5E2 | |
1603 | 9DB869D0C42363DEAD89512B3560AB65C05F21272A5ED159300C13FA74BD77B2 | |
1604 | D96EF810EFF4F64A864BD09C258EEA32603CFB5DF407AD61DF528C6D6A6D0BEE | |
1605 | 9AFFF0D60FEE18FFBF841DA43AED3480DEDBB652AECACA1A4E5CC93D3304873E | |
1606 | EBDFB49D16000ED8A04A0F88FB1CEF1F847A439DA1FE93957A5CCF9116EE2FB6 | |
1607 | 1EFA6CC5A38D4D855098D6F59427FCFABFE56583078E913516620B634A7BD0BE | |
1608 | 52324D15609D3C035A9B53594FF8395969BAC155BD01B0209AC49279D4BD5667 | |
1609 | 46D80D6E54FF98D6A7C1EB07E11277D2EE26DB98BC69411A414AF9761F7AEF27 | |
1610 | DA1766E02B76E8BC6660BFCC2DD4344DBBA0098DCB2888A6E243628D30D45183 | |
1611 | 435DB3B91480428B4E44A465FE46B1D554D723AB1F527F9AD2DCD1806996425B | |
1612 | 00FE8CAFB659393FE9AC0F5A896880949A9BB8F476BDB2903EE2CD9036AD07E8 | |
1613 | 8BB8DF5550FCF873B348AF96B8CD1C9CE8EEA7AB743F5B3FD659EC6502ACF722 | |
1614 | D5D76A0E6EC89FBA669BC533C930310917C153F567CF6E1EB802A90EE2EFAE7A | |
1615 | 504DE21454974868FF67C8610815C4F69F28EF80CC396D4604756E74C7943E4E | |
1616 | 100203D1FF1ED3788022A0E9337D23BF9B0895A6F7294936A4FCC386FCFFD4DF | |
1617 | AF48F623C4791E61D7E32C9E28A3DCFC4106265A0BF1832C68B2124A41948CFE | |
1618 | C1B0394614736D14CA8AFEB7A6130BD8CF4FF7A5797243C6DB868724484C460A | |
1619 | ED3005C22D75E82D090B3649F0964532A1A48987E2F7E138A2BB55BEC5A5F82D | |
1620 | FBAB6581276C8E608350AF950651784A9CF3FC65BD589F13DBE1B062C6A53FFB | |
1621 | BF3E541FC918AFF48B538C095A4F227E02250F737A3B261AF3058D3D632E30FB | |
1622 | C79ECE7CCBC15239EC5BAA0CE80D730B7CDAB94909A083EDD5EE662D052DB314 | |
1623 | 4F6EC57CF202478C32A06F41DB65955BA4BFB080B8979E257486F9201DBEA6F8 | |
1624 | 446CA87E01CAED0D8B8923101CB2C0B6A3569E06A400268F4150CA9C72519A6A | |
1625 | C36F67332959E4D760876ED149B6C42909017CFEF05B776B81911A3B3E1976E5 | |
1626 | 25BF0EA073F443E4B448EAC699FFC78D8C41D2035146596E31AEEF0CE4CC54C9 | |
1627 | 83007A8283BCBE5DAE2A9A848B64008D0FB672904CCC43ABDBD8378BBA54C367 | |
1628 | C6AC47D9EDE1B848B3FFD68A652BC3DE67F1BC4C119BF07601B7BC8EDE2DD9A7 | |
1629 | EAB5A340CF47871AD3022A5896A56E03A6E25FD960F5128928F49385DB23D6A3 | |
1630 | C7FED79BCACE2BE339FA2C27A24236E3298B1A5F701043EB83528C972C735FAC | |
1631 | 9C9A065E06270ADDE1503A42C4001F33661C98403F4BD0041C71AA7282A577D3 | |
1632 | 885D2394800E0FAC158EFDDDBFA151D74742F21962F40BA1CAC0C4D1F24C0246 | |
1633 | FEF440341DD25E478936F2FEF81331F8937F04A6D691B235FC3875708A4162DA | |
1634 | 1C92F9795340C36B1D34DA7D1430466F8C15D41E95434EA889269BADD42C8E57 | |
1635 | 12CBA9FC3144D21C57E5EE98412B073147B6B117B20E925AF141CF455B1513C5 | |
1636 | 97ABB1BFAE357A9DF3FA0BFD7D7226B878CE3413E04F03FD017FA179C78C51C2 | |
1637 | 3FD10BE0B3F18834178D3085F15D19AA0F8C3E6447795B47E86017F44EEB4963 | |
1638 | C806F86516E1F0B4A7FA3A64C55D2C03727AFF10957B6409D2F133D32EAB06C0 | |
1639 | B612F66B4C881D59C78DC9EB6AC60F93C2E96A2B79ED573EB2978BBC0098D828 | |
1640 | B3FDA22E6B5F779D67DEF54714CFFC927FDC717C6FFE14F90DBDC42075D598ED | |
1641 | 54810D8993180BCC5C41A4739E86201DDB5B8B3E80EB68FF6ED19973801564D9 | |
1642 | F4E48CD86224B10B4304740F8CD2EA890E862AA3BCD0B8041516E74BD0221A5D | |
1643 | 26E073049279B20209ABD297DE5844AD9C61499DF968F5B9AB5D3BAEBC36256D | |
1644 | 46805492265F75F906E1ADA46A08974E4F230A52D8A4D84C70194649ADF9782B | |
1645 | 187C449E5C2346EB97298557DEF216DE9729B71B69D48EB018BF38259AC98860 | |
1646 | 9DD729939883821E7A1A64537E2CBEB1E6F11A50284594B65D130A48FC73D252 | |
1647 | 7185FCD35A3EF61F01F41251DB285C37B8541846C47C7845A0A46E1B986C3788 | |
1648 | A3E7E3E99F151F5CF98EE4BDED2B4CC64303A4900E73B070DF660E927022C641 | |
1649 | 1A0D28D993F850BD82078EEB4F9ADA23EE8AE0CCE66F1A6D076E44890DEB5D9D | |
1650 | B4E8B15A6E58B4E09DD44BD0ECB14825D8C4DA0E7209A930812EC636DAD9EE09 | |
1651 | 301888CD25BA944C779110696016D7B3E6FE2E9DC4A1F81A6F61B932E28900E5 | |
1652 | BA43EABB709B33E9E856BB6CA7A33FA08882271E5C2F8F12F8A0A673B6F42D73 | |
1653 | 66DE9104027EA7D02F33869E0F06B70F64018549DC99E4B50A7382EB1A36B1E4 | |
1654 | 907E8F54A59D4D832D5CC333D1B5037B64D1569091780BE317D9451FF583E0B1 | |
1655 | 2D8877EBD3A0EFEA9A0330D31642A6784223E955EE6CB5CA803CE68CECB253C8 | |
1656 | 44F74677782D40D6D5DABCA5C244303CE41B1B3CAAF862479453D3AA945D7B83 | |
1657 | ACBCB37BB6D87F134A815FF024D0934907C991D20DFEEBEE22B3966D4CE79893 | |
1658 | 00AA038DF7367147556383CE72E85C2144D84A8B13D66722B8AC2C636367CAA3 | |
1659 | 1C8D2BC5DF468F47AA78625C35A7362DA519CE31946F28AEBBF16D4983C7DA5A | |
1660 | AFEAF86F93E25200820747361EE02F06D5109415FB7EEED188310F0B9CF93E1F | |
1661 | DA929D2FA47AE4C334948D0D75609AEF71DFF8CD11C7312D81760509D6530898 | |
1662 | 26E4B2E7F9B1B5EC94D1837F25A7A33BC6748574303DD9B08C8FC223DB659FE6 | |
1663 | 13C71C29F0907C36E357A0A81038F944077383B7536337F074EC7161797E110D | |
1664 | 1D8856F64C96DB506CA799197D4579D94C8DBA0D276205EA830F92646A4B0700 | |
1665 | 5AAD1B29C58EB222833E8E48D1A79B785EEFE59B11C8A829A829C975C80EFD63 | |
1666 | D47DC9ED98700A3D555807E4844F5033DC6C73266DD4F25A6EFC304560C917AA | |
1667 | 3BE805DEDD3D787797300EE0CEB33CCC4D9A16EAAAE902B986E2C4FF864E2D64 | |
1668 | 19EBFF3438035FD9FCA2D9B0C3FDC17CBBDA433544D27E81BF809C89CA30F36E | |
1669 | D0AD52D33CDACC72650A96E9CD8EECD7A8D50296EB4897E99F28030DA0F2AE93 | |
1670 | 7E4A94A87CFD3388642CCD8BF26672482473C4DAEB3D20BBB23C0A97EB3AC5FF | |
1671 | CF4A8A2CA0EDA2E686EB1E669F2529B027F5FCAADDBE3F75C384B769D09EA28C | |
1672 | FACFC479964A89B4421C932E4A1CEA3FC5312FD56A3011D6E25C5C6086883930 | |
1673 | 704307CED7321A8DEA59338DA843D4C9FDF58C0611E0E53042CB19E04C69B9F4 | |
1674 | ED385B3994A64E1A5685FF6AF0D6F8FF4166483602D28D8E18EE1EA94DD1AB37 | |
1675 | 72F1E331DC0E46ABC1131A2CF8C3C08D33AC7BD044F4232724F23A9135FAD97B | |
1676 | 52114A426195C599A3182461AA4E126F1F445FAC9B167F418E172DB630C94782 | |
1677 | 4E5E41E0F6315516BCE49EC4346A4BB307893F98B46B46D42113614CE9DA96F3 | |
1678 | 6A950EB081E5FADD29F930BB1764DC41407B71D38449AD35913B2787A1A1BA62 | |
1679 | 3E71BE24713598DFD96BE5056B7AECD3EE16850B66F6384029F144E19D06A9EF | |
1680 | 4598B15534147880941D0358CDC52B6E08A2D907EAFB536B702C8E6AF76D7F11 | |
1681 | 4018566762B88560CEAC97F3DE8AF834AC196D7CD3C3DF440150E894D0A53E6A | |
1682 | E687B9FD1AB8CB252FE5493CAB2990CF11AB549155DCA114A36B64BE7A835749 | |
1683 | 3E86907EB95D9498BB04DF38DC85A34CF1701647FE2237F9639C0FB578D3A4F7 | |
1684 | 471B2F21B787ED260775CC8495B6C852F4CB3CBF4F5A3452A29B97B51A4CAE76 | |
1685 | DF1F66F292BB219C387C34399A8415772F7A5439EA3A7602FF7A6AAB74EB1F73 | |
1686 | 88563F452B5F10AF6089B4562FC1269895E6A3DEBEFF589643C60640DAF4839E | |
1687 | BA525A1710F2643A456E0DEBB90CD2EF2C75EE6DD31C3251451F41EA11372717 | |
1688 | 9BF47259C422A4C596F1D76672AA27B57E7F903F785CB394029009859931EB4C | |
1689 | 42F9B7A6B1494704E58084978DD2033EED656FC8BE7A2127FB7D3DFCBB0C6B6A | |
1690 | F9A598B2833CA12B6F9B2F0E253D9652706C4E12A0376F864388407BBF47CA5A | |
1691 | 4E47A3F8567E7C360B6AC74DBA73F686B318E5182B14983FB340A08010170CEF | |
1692 | 6D92BECF86958FC7D409ACCE13CB5DBF5D5B215D7DB86D61EDAD3D9D0FD969A2 | |
1693 | 4532689CA7DFDFE46CFADB5ACCBFC73D6FCAAEF1304EAA37D0C9392FED28FDEF | |
1694 | 0D9A1DE83CF6C344EBFFF0E47CA8ECF053AAC4D8064254346D1F01AA8CAD860C | |
1695 | 98D0335B6F211989DB72E96889B2CFA81D424FB75FF678B426C414477F6821B0 | |
1696 | E0255646C15A661E9DD18514329842474F0105FAAE1D43D5D738D5FC84AEE185 | |
1697 | 6212C0CC4DADFD74488F6BDC88EE33D2428F7DA04A30C6E543FA57A13091BF3E | |
1698 | C76B5C4475A66B8148046B62C8B631E7074AC229FF199073FA8F8799C7D602AB | |
1699 | B95CE248DB1736315B501A0EC560C61C695B372F461C48A506F3F92272029DB3 | |
1700 | 13B23BA5BFC29991759B6DFCE5C3186284D4F7EC85348B61712690D709410FB4 | |
1701 | F000D4D59DD639936C25254AEFE481B178027E06CBAEA03EBBA1FCA6CB8AE2C6 | |
1702 | C2F83ABC9D871308AC30DCE86941AF19A3B105EEC3CB4AB9EE20846A67A0EA46 | |
1703 | FB57F71714203FC56A476BDFFC3135778FBB28104B539C4A54D244E8D3ABC7B0 | |
1704 | A515BE0F6DB3AE9D9FC964328F79045D21D98B233FE73EB7898FC48C4908E729 | |
1705 | BA6B9562CEE5965EE9F63D310BADC9040796736B4952CA489318C9EA8948D466 | |
1706 | 56A46A3F3091A58D1C227CFB5E8C3D3FDB6EA6B4A16D6FA565335AD569B3E421 | |
1707 | 4BA3627D6049E6C87A1E45458A54EA574953885CD8A7CFF065130948DCA0EA63 | |
1708 | B3B1F8FD043AA910C138E1EB546FA676A29AE7AD8F1928EF6B28527053445480 | |
1709 | C278117432723F3DED55BF3E09CF8E142C517A3787BB9DE2787D2CD37B5326EA | |
1710 | B4C1CDA63F2EEA8F55C5989E35D88F5D75E88C4F383570329C62DCB9186D7AF5 | |
1711 | 8FD22AA953C1E21658C9DF0985B55E088CFB7C7C941A692FAF215935A38899C6 | |
1712 | 31160CCAE51529BEA466951F1BE5776DF69A2019C33A6428BA43F6662065F16F | |
1713 | 4580B2AFDDE7E9D32D6545BA96BA2D2710F5FDF8C9B3044974BAC9390D4F0FCB | |
1714 | E693434C32BEA67C69413C7E01DEF1257879C7E044F553FB46604267A1D77750 | |
1715 | 2320FA125E385B8CB7C56F70F05D81632F2182636A401C79F97AC61C5ED3F44C | |
1716 | 81104E60175938287762E1B5B0A9B595FBBDB7B5126CA287BA9F4CCF583B1CD7 | |
1717 | 74B38884ED467AF4E1AE43555BD3FC71BDF2C4FC041A8791594B410699263DF2 | |
1718 | 0B10C5356437BB6CCF6952A6E23373CFCC1F95731DCCD869E5F7B394A8E585F1 | |
1719 | 50D14308AC6EE6AA201024040EEC1E55CDDCE9DE74A3AF1F42AD918CFF7F0731 | |
1720 | 2B3734F389F6B602CCABE9C13F529EBD194254192B0C8DCDA14E3DA68B3D0654 | |
1721 | 3140A875826F93973FB04D64B22AF5B1504D81D677A6307CD0D2EB57C448F2AD | |
1722 | 1C16C5A7B1EB35A044F20D2C4BAC9FB1CE0ADD7E1AE8BA3457DE4BAB168141D5 | |
1723 | DBBB22C31E79B151A815D4CA3E44963D0E28C34840B7F3C596354B3CA3956C95 | |
1724 | 4148F24AFD08883A36A691630A298AEE757B92E02A862556778E6E3A2041E4D1 | |
1725 | 1AB4580E5FDD4841988B8B7D735803876A4D5C898AF6856321251DF6D42CFB3C | |
1726 | 7115734998020F9E6155E37CD7C2464EB42B96972342F12440451A23F736284D | |
1727 | C9B98FF4B58E07E35A12C42C70ECE5EF8DAF052EFD32BEF574B67AE003DA2FB1 | |
1728 | A7433ECC75D79D10D2F32C90726C97E64F754529F7724EC8644225C18646F309 | |
1729 | D4D7F22894B3DBCA226473866EE2E9467A7847CD62DE83DF3D68DE2EB993A031 | |
1730 | 2E858D3DD47422DD97F257E0B3E2E5B49BC9DDF0AA76463FDB5BF5243C4E64ED | |
1731 | 9C308B167B35B78D2BFC33F087CF8737CB5AFD3318BEB0F08F03B373FF6533DF | |
1732 | 67F9850F5D0FEF6D4394D888CFE283EE50C32305224699E71A1D02B2A16DE21C | |
1733 | EDB0A53C9C5E312B532AAAF067243D88F5DA40D4FE0A0A2F4385BFF34FA9B5D3 | |
1734 | BE1C1DD5065A386FB88CFF7A8CAC4053918114683EDE4487B7BB85D1AC4EB927 | |
1735 | F1E1A9CAAFB3B23F4ED302CD7D12AC365C69ED004DCE51C729BE9C9A0E9B8874 | |
1736 | E47ED7F9565CA1E5AE8C0972A5FC37CA8A023A3E728C0EEF8AC72552671D500A | |
1737 | E3D619A309A53E31AFA37CDFD3FEAAAFF7E90E69C96CA07DD0DB4B89061452FA | |
1738 | 8950FF79F1565BF8508496CD55806A62F111C9F46B7DC15EE257D317DB135816 | |
1739 | E42D2BD7EA95D0B6BCCBAAC32D267350604D7798E1198F03B819E80D165E0C7A | |
1740 | 0DA795D1850D48928450B7F7967D58C8E8930A452F160BA5A54A2B7D45F9C8FF | |
1741 | 81CD1918ED808958B9AD4B07353FB328A69F4E73A6804FCE3132A0DF069E25A7 | |
1742 | F40D4B133E0D851EF27A895D04451EBCFE8B07C05095D9E8D9603F8A5C4AC797 | |
1743 | 84196B9E09879EC026894A20F217A4BBFDF13DCB519321910535F4BBBD8D31B0 | |
1744 | 66253B27C034FD1014A134BFF9393201C8A1A55125BE0EA4EA9B7F56F2C038FD | |
1745 | 0E828902CCDA438F91250C47306AFE4B8C5016CBF360C0621F402DEE13302A66 | |
1746 | 9F1793E6D3D352A24349EAAA8D9B320EF85560A935E2A4D2D67BF4F0FAFFA84A | |
1747 | 0FAA45717F23855D19400A1D823C17BE7A005E1B5AF9388A2150E14CF7F229A5 | |
1748 | 07096C67460B989066D033C7567003EB6FC8512DD685E44DEBCE8718B1408872 | |
1749 | 40226BB9D8D2E2E3409C100401824AEE6914BF53123B7F1D367688D2F3E90CD8 | |
1750 | B2E2FE7911A5B6439D7D421E59EB7BCE4DC0B8D09692DD02629A4A40500C6C83 | |
1751 | C27C127120069536BB5A08105C137A80E112FA949C7DF8F2A78E89169BADA01A | |
1752 | F444837C8EDAB8D31EE7381BDAF2E3FC227D95784F07ED0C2AC12234D81A07D2 | |
1753 | 0B2E26D95FF19FB74DD5CFFBB705BB286C09DA08F4164048B9DF68C5751A6C64 | |
1754 | 3B053ED842F997E75A75BA9076985E27E65C1B256B7AF6541BB257B908133225 | |
1755 | C7A7608D62E9E0D28C4BC1FEAB3DCAC226D44F02F2B6BB5D786789E9AB51BA25 | |
1756 | 9EF0748C3BD02385391A390D3DC2B49422EF5ECF8A09998EDB111847D830744F | |
1757 | 0FBAB1F688A9A2FF26D16A0EBD334D53D323DB863B8CFAC15C6E48131C4BFC68 | |
1758 | B8038C436F156BA2657F05C9524E8F8BA4DE9C0C5CE3393927F1ADE80359DE51 | |
1759 | 2686AC1919CDD6244D58C099125C87A6E27D0CC62214B0ECE2E19AB7E771E099 | |
1760 | 272FEFD178889D220E763697AF056160B54EDFC103A161CE16FCE42A1BF4106B | |
1761 | 46500819C85E7668BB2B9DE3242A7FAA558993F4E06DB47912801C79BDF6C10C | |
1762 | 502FB005913DAD8BB35F210F2BD6225C3E9C0D37D599FD296B0487E8F373B28B | |
1763 | FF8CA001BEF0E6F9DC29C679382EECFFAAC4433C1116C416A6AAD52097B105BA | |
1764 | 1C18592A38C7C97782ADE3AEEAF808809F91B144BB90197900D5A88B752A322F | |
1765 | 99AD6FC16629D1F78E9BCD372310FB5C33F728971CD8CA9555D81E199FF523AF | |
1766 | BCCCAAEAAD8E951A6D48A704B4D89A3D1065406B82B00A6A421E25E79D147594 | |
1767 | 6446382B4028943CFE86287A666FF655DA13878D845BD930CFAB8217EF2DB874 | |
1768 | EE748A9464B77AADA51319CD18C196E4C37F23DAAB0B26857C837761182EB3E7 | |
1769 | 41BBD9FE52371D4576012FCEE98F20B91D85C7F0EF8D428DBCA7D0B0F9A93F9A | |
1770 | 8369AF11DD05D35395BA5B79E39B969EEDAD31CFC722ECA91D7A5A3E437C3068 | |
1771 | 36F0319EADD7AD35C6383706380D6E5AB63FCFF28A9A21F1706772EA74C40F22 | |
1772 | 59C5B338356AA658F479C7E2E7C4176F2105D7957B43F9FE20ECF7FED5CC0A33 | |
1773 | 0CA8F9063144E480793010ACE37E3F577C6075138D131576B56F8302D6E4EACD | |
1774 | 1C8E02EDD061BAE820F90FA7C2840867DE92F2783410CC56199C1FE7DF9F3154 | |
1775 | 3057B95CE752A30B7BC4AAFADD5BDB3FDC04D7D40A74444B1A135C1F96682188 | |
1776 | BBA5CD3C06B1B84BE01018233829B4A78C54845CA06C20F1C86B1D31207FBD50 | |
1777 | DFAFFCFF029618CABA5782488DCE6D0FBB3C50F27F44E55504D9DCBCCAD6E99D | |
1778 | 49E3F8CF3F9F597EAD433F7E7409FD15BDF7AC32CC09A23259222EE3690F3C7A | |
1779 | AD0D44DD92DEC93B9C5EBC8571DBD3B80864BC0EB5379C0A4AF50016720FBE36 | |
1780 | 8307FFD35CD365241A4CA0D7FC015362A3D8AB49571448461F5B497BC4E8AFFE | |
1781 | C8E9C61CC91837D1036CC017588B4E3944112405379B6066F3EB0F2D7B0D6C2A | |
1782 | 90E1CC201090A85690DACC92F4BFB4D4DA42D4262DA96A4BC78AAF804CE39863 | |
1783 | 8B8DAB0886C27E289633FF58CB49AA3B67B3AA0BC0EB1B3B8B44511BDC19417C | |
1784 | D7F8272481C7D12424A1C1473749B9FFC50B2BB1649D2AA3DB8439BEFE38F70B | |
1785 | A1682132EBABA78E41833A05662A690B77C18CFFE6EE308D8584B7247174BDA3 | |
1786 | C64AF4886DAFBC452E2F431AC0B02380FBB2130C0CDB339309EC1C1929F8AB43 | |
1787 | 57E8F5D1A47EFAB0CEB2B5E01B2BA8D81FA1E63606342E47DFA92679E6FBFA47 | |
1788 | C93E3490A0DCC5CF2C5DF298F81DDD1B646EF8598F821380983D00BE3C2FB456 | |
1789 | F848F339BA6329D23C727391B84EEC670579F39F3263F5E535960C95962F5A16 | |
1790 | 2C1D5A3DD5FF459041C153EA2E549935449D7FE37C2E1D058F8F80F41F2D5C80 | |
1791 | 972EC033F5B87A6B1BD65A2BE9A8576D30069745C1DA75F072BB492A212EAD29 | |
1792 | 3209E08C3FF6205097FCB14111933252708033589C8AED0D1A28CD86DAB13EC3 | |
1793 | 18859BF08EC86D751F370377CC0E724F7CCB632A4B115D2308083E2B5B8F2EFE | |
1794 | 260262D780EF5276AD5CB5E28D73BB6920A8C18D720A4CDA52DFFDDFA2BFFEB2 | |
1795 | 31900CE110AC33E086B6DD0FE457FE29E8D010C7CD6D0C6BC2BF9021A4378731 | |
1796 | 77FC26E244D06CA5FEAEB6A51A164335F29507E1BE86D75A610012C6F913E64A | |
1797 | DA7FC95E6BB98FA90E399CD9624699229172E6D2AC88D61C2D0BB651AEF862A1 | |
1798 | FC7EDAEAC0C9BEFF07C533FA1FAD72E929275EE1073D32DB29EE477D4F1275BB | |
1799 | ECF7960D5ABCAC007A1B9BEA2E555D02D7FD2F8DAB37DFB612F6C59D0B3D6159 | |
1800 | 88938E23372FD48E2534EE404F327B53D22AC9A8DD968F50ED144EC1B30B4222 | |
1801 | BFEB70376DBF1C5C9F7BCC1D765953E76894BBF009DD7E83BCE3D56AC4099153 | |
1802 | E5E147B7F1612E84935A5243AD8C420874937D4662EFD9717CF715D68925C2DC | |
1803 | EDDE5070407F7210CC3A141AA6DA723E7B7057130728972EB466F0EE63D66BDD | |
1804 | 0DD680A09CB69D4D9978556790AD98E3A8F1A5FD15571A4B607DB1EDA51250AE | |
1805 | 8256180D00411469F2C4ED97CA517CD8EAA731B74B7055FA21C6ECADC9FE18C0 | |
1806 | 21D063FDFAED57B276D51B33042B2868CCE630771DF7AE0DD9E26C48892FF1FB | |
1807 | 332FA26CB639A581FCFBE19CD022A1B770922FFD38A6AA5E28EEFCF3AFAB7974 | |
1808 | D963F2BA5782C765C81C3535D453667165F6593889C316CE1DB54A4BC928CCD5 | |
1809 | 9948E7B7DF992073D2C334130819CDE861B60B463E55F17673BD244804C6E376 | |
1810 | 59851D9DEBBD20FF335EF0F32CE99DA138AF75D3C03B72CFD2084253330051FC | |
1811 | F467C0B06C413F8D71316835AD963600C6E2CB564FB392D6A68DFB98D5A2452B | |
1812 | 45C6ED8548A8D5068B434A993B745F7C49F9E5273636066F2B726E52082EC848 | |
1813 | 825A05CDB19FECC21628C80070AF0F80F4B1D858FAFECDAA1C5C689E8AF110F4 | |
1814 | 7AC324A037E89A65113883060B08020A1A93A816B6E69DB90C3AC9C2B378A277 | |
1815 | C6FA2AC6FB93ABD6AD2960BFDECADE173AA9A512F2448371C9F4A944D623CB2C | |
1816 | A53597E7D01C3D6C4AE282FEC4E8232A7617FB535D0E8DFE5C80CA13782327E7 | |
1817 | E581746D460E8040ECBE4321720CB8A6FC181364439F41D4D08C8B7E582C751C | |
1818 | 629F4AFB1A7A390ACDE76ABD0B162282C83E410F3CDC311C1113763D0C4D6C92 | |
1819 | 36A117DB6A5B259EC8ECABF53080B9D278CF87BAF14BF5D7AA9ECBEC98EFD0AD | |
1820 | CD622F9B4D6A92B5C103BB7D5E97F863E2594D306A119871CE7C5CD6592EB0FB | |
1821 | 5338FC288D23D86D493F5AA886155AF1847FCFA0E92E84A1E1BEFC4076F43350 | |
1822 | 56E42CB16F7543F5D057D3547E49D75E2CF22B376BA9C1E87370651DF9EFEB07 | |
1823 | 91DFD4B59E6A99F45A962C5E021D4EFB3BC1F63953FD6E09928A551C220A98DC | |
1824 | 4BB366A4BFCC58A7B314CF9902BD1FFF53551D19033D8C4D28952ABCCC62B468 | |
1825 | C61A97A76C9CB68B8FFFB8BF91FC96E1AB49D2B161F37A25CBFBD5D4896815E9 | |
1826 | 4CC17385F5BB185A15B0B8413FA31E2CFF6D67F74997261568B94C2F85DEC393 | |
1827 | 300B794EB87E97C7769BD6FD84CF81827FA260BB161281E7F75D1C37276AB529 | |
1828 | 5087F4100BC37879DBCB97723EB71A3A6A40D923234FC1C8348C184710F40DB1 | |
1829 | 0B2C0A6DC172FC28BFAE2D2B2B295BAF3CB1A39A6D5A4A73FF52F080D1EBDF30 | |
1830 | 3D9434BDE34FC62441911BF2F82FE2154E76A0CCCEE232A7DBD1A22511C39624 | |
1831 | 22C76972FD5D299DC8BE9A2BC8BCD5FA48E8FFE729844C41AF0E53044BAF93C1 | |
1832 | 36A63F4BE10178F9296D2CA93A8EB0E76743D8EF16447E7A3991AA1BDE4B85A1 | |
1833 | 4BBB15378434CE1865218F9EF95F649A6F21B7AA8E75CCEEC717EEBDFD14F6F3 | |
1834 | EFEA304CA35132B59B21FCE65B13326EFA5736DF81447F675118E512E631C747 | |
1835 | 2654D4BCF7890CF072C39468CF9B5A4ECE1C6DB0F4A4728A9929D821C7599FDA | |
1836 | 454A6930350475791CFDDEC6F9982A6CBB09E45B75EE0C8202DEB19B74786C51 | |
1837 | 09E4F90457DA1BFB94CA77A3C6C7B346314BD5E2990DA7DFC78EC75897C59FB9 | |
1838 | 1414D259A9728D14327E5BB151FA2195D80D9BA0A852DE19383AB17D4D6D9717 | |
1839 | 144DB34ED80B2910C4F442D4BD722B7F251B938114B4C0872E874C3DB20F7939 | |
1840 | 368A79C3C46A13E5E761E397E5A6B3E8BAF6836632D2FC7A1B3252D81D41904D | |
1841 | 13C65774BC8DAE4834C07CAEA4AD04DD6CA8301EA1E20AD4E9C7701907385036 | |
1842 | 2DED96B06F5847AAD5D004965F255167231BF07E1FBC6FB101B73F8620765755 | |
1843 | 9262273AA6F111626AD38CF86788269CFC4B8611C55AB4E9675EEE714CE2D305 | |
1844 | C9CF8E201CF812702D0DCDCA8BF76F04DB029FF56F7AE4EE3064BA785148E822 | |
1845 | 7592906D2C27F043D16A13A48DEF8482193ABD5A45712B0D5ABD3CEFE3BE93D2 | |
1846 | DC5F98C33CD602BC65F3D02EE0007D6057D81B3D3291877F399CA1D04547A274 | |
1847 | 322C8E4739543B229703F48F02C6B1945F5F537129288B7289BC2FEB01339565 | |
1848 | 40E6DFF827D1582F0B84D517869C7465D00D653C1EE3EDFD9497BF86D03CBB79 | |
1849 | 25C4D4D7CC74C6DFB45CAA3EC5DF90A6C117AC984CDB7643B906C6EA625BC933 | |
1850 | 892FD590050090C94C | |
1851 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1852 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1853 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1854 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1855 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1856 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1857 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1858 | 0000000000000000000000000000000000000000000000000000000000000000 | |
1859 | cleartomark | |
1860 | %%EndFont | |
1861 | %%BeginFont: CMBX12 | |
1862 | %!PS-AdobeFont-1.1: CMBX12 1.0 | |
1863 | %%CreationDate: 1991 Aug 20 16:34:54 | |
1864 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
1865 | 11 dict begin | |
1866 | /FontInfo 7 dict dup begin | |
1867 | /version (1.0) readonly def | |
1868 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
1869 | /FullName (CMBX12) readonly def | |
1870 | /FamilyName (Computer Modern) readonly def | |
1871 | /Weight (Bold) readonly def | |
1872 | /ItalicAngle 0 def | |
1873 | /isFixedPitch false def | |
1874 | end readonly def | |
1875 | /FontName /CMBX12 def | |
1876 | /PaintType 0 def | |
1877 | /FontType 1 def | |
1878 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
1879 | /Encoding 256 array | |
1880 | 0 1 255 {1 index exch /.notdef put} for | |
1881 | dup 0 /.notdef put | |
1882 | readonly def | |
1883 | /FontBBox{-53 -251 1139 750}readonly def | |
1884 | /UniqueID 5000769 def | |
1885 | currentdict end | |
1886 | currentfile eexec | |
1887 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
1888 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
1889 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
1890 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
1891 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
1892 | 2BDBF16FBC7512FAA308A093FE5F0364CD5660F74BEE96790DE35AFA90CCF712 | |
1893 | B1805DA88AE375A04D99598EADFC625BDC1F9C315B6CF28C9BD427F32C745C99 | |
1894 | AEBE70DAAED49EA45AF94F081934AA47894A370D698ABABDA4215500B190AF26 | |
1895 | 7FCFB7DDA2BC68605A4EF61ECCA3D61C684B47FFB5887A3BEDE0B4D30E8EBABF | |
1896 | 20980C23312618EB0EAF289B2924FF4A334B85D98FD68545FDADB47F991E7390 | |
1897 | B10EE86A46A5AF8866C010225024D5E5862D49DEB5D8ECCB95D94283C50A363D | |
1898 | 68A49071445610F03CE3600945118A6BC0B3AA4593104E727261C68C4A47F809 | |
1899 | D77E4CF27B3681F6B6F3AC498E45361BF9E01FAF5527F5E3CC790D3084674B3E | |
1900 | 26296F3E03321B5C555D2458578A89E72D3166A3C5D740B3ABB127CF420C316D | |
1901 | F957873DA04CF0DB25A73574A4DE2E4F2D5D4E8E0B430654CF7F341A1BDB3E26 | |
1902 | 77C194764EAD58C585F49EF10843FE020F9FDFD9008D660DE50B9BD7A2A87299 | |
1903 | BC319E66D781101BB956E30643A19B93C8967E1AE4719F300BFE5866F0D6DA5E | |
1904 | C55E171A24D3B707EFA325D47F473764E99BC8B1108D815CF2ACADFA6C4663E8 | |
1905 | 30855D673CE98AB78F5F829F7FA226AB57F07B3E7D4E7CE30ED3B7EB0D3035C5 | |
1906 | 148DA8D9FA34483414FDA8E3DC9E6C479E3EEE9A11A0547FC9085FA4631AD19C | |
1907 | E936E0598E3197207FA7BB6E55CFD5EF72AEC12D9A9675241C7A71316B2E148D | |
1908 | E2A1732B3627109EA446CB320EBBE2E78281CDF0890E2E72B6711335857F1E23 | |
1909 | 337C75E729701E93D5BEC0630CDC7F4E957233EC09F917E5CA703C7E93841598 | |
1910 | 0E73843FC6619DE017C8473A6D1B2BE5142DEBA285B98FA1CC5E64D2ADB981E6 | |
1911 | 472971848451A245DDF6AA3B8225E9AC8E4630B0FF32D679EC27ACAD85C6394E | |
1912 | A6F71023B660EE883D8B676837E9EBA4E42BA8F365433A900F1DC3A9F0E88A26 | |
1913 | 3318B32500F76B1038FA6122C2AF6261B025BDD004EB9575D102D625A351A20C | |
1914 | 914D7D79EDB0FE343726526D57A9A8E3916B437A95C895F542DF4685E4683CC7 | |
1915 | 5729A4B41F0C51BF910AE542A1270EAD05AA2FEB6B95C3C5D068210D457D1D9B | |
1916 | 9901C8946E0E7F47B23BA12743FE43A1E7DD18C56A6CC68C5E4A22180E24EB3D | |
1917 | 2F5A6484A170FF45D2C5CDFEC7958ACD37C305412BF2757630252907C69FE044 | |
1918 | 85724CFCBA4A85C02D4F9BD5A5405E4C0FB1EFF4AF9CC41401B5ED407E78B0D1 | |
1919 | 5C0676C625A5277809A8DD0E44091329701D8ACE4A981EAA0BDFEB0B26110396 | |
1920 | B24839B5C59B1FE13EDD5D4B4E7893CD85A4712726BE26357F427EF53B157DCF | |
1921 | 77791447877951ACC19D5AF1C2D7375BE53F8AEA5E0CD8A2A049A9A010F44016 | |
1922 | 9628A12E5B6E740E5831CBBB715F036066DA33343EB22AA89073787148760EA5 | |
1923 | 2D543B42DCD6EE8CCF825D2517702FE270BBEAF8E0A66AE44F449F50768E82B5 | |
1924 | 2FF1C533720E8AC2E18BF0674D88A0E4F0886D945C07FAF1986E1BF838C45EE1 | |
1925 | 82E2BE8223231B396D5B6D92DFF0856AC03EA1AEBD993F54CCCD58CE6464B075 | |
1926 | EDB4CB853CA500A8A20EE43FF3CD82392656D4FF38F76196CB51A342FC562563 | |
1927 | EDD69C2C184172D19C7B427CE4C129CC61BA35BF65FE6D040B5311884EA16C4B | |
1928 | 0123A05FA94FFC1816637359FB28825C2F87715E1C40CE71329521E7C7A92012 | |
1929 | FCF11D3C94E9BDFC43E18A19EB6E1A8821473D6516B93247B1A832735ED606C1 | |
1930 | 6116751239DD1796B4921B67B731CDF45FF38FB615067D07696CFFC6F923D0FD | |
1931 | 24EC833922FFAC22BC4B1E0E9802A64B069EC783F250F034D41623C5DAE1CD7B | |
1932 | CE63EA49C9D1893ED2B49561573AA2A8B1DA6988B30FB49A68755F65A792A42B | |
1933 | F2D921E87B2E130D22ED26833FFEF003C8D45B7A060E2039B87E081A69AA68D8 | |
1934 | F31902E1134D23DA8F948BD1756B54919DC4117ABB32BD4E8F3E26B57F0239FD | |
1935 | 67262DBC2A0EF4EB5F318C9692EA8AADBD4448CE15DF8CEE63FADFFC457D413E | |
1936 | 2558832AC91C10C6C268EDDF2D00E9139B47199E2CA386F0821EBD9589C53A01 | |
1937 | 663813D56ED0E7358AB0DAF4C3308924A727859FC812BC344FEA19C3AC00F9C7 | |
1938 | 48DFAC6CD48FD3E28645458464BFC984D7081CE5A5B5ECE9CB7FAE1BFC00063B | |
1939 | 2EEBDF0E19E8AEDE76CE2EA7D7A61CCB4A38B3C29066DEDB13D30BA7CBA0BE11 | |
1940 | 29CB91BB723DDEE57E94E9D82ADE3E1E8FCC275437E98C727EBCA148F56EFE2D | |
1941 | 1E545E514F8E81695527107ECFD91090BF23C2A3C760E5FAB9E10D88E269416B | |
1942 | 79DDAD372757EA4DC7A12F41C4A87F34A1BEB66C02BB472D766ABA60F2257132 | |
1943 | 43772C6378C18F75F0BFC2F6B7FB57FEB5647A0A35E1EEC41115D113D1BB2118 | |
1944 | 6E60A0DDBDFEC305AC9E46D84EB1296C9EDD2C49AC52226E64F213E5361903E6 | |
1945 | 4F213111934D0B2C28CC638CD1E15D1E21ACF6F1CC9481B9A890B012120E08CE | |
1946 | 5D57FDD7A07337AD22726A31A8DA7465504566DE14927A0EA88AF85F396FE7E5 | |
1947 | DCB9C32AC3FAD7BECCC6AF79FC16F39F94903687CF39CA0CDF1A3FD9B10E2FA6 | |
1948 | EFFCCFE76E2C8A60A37BDD75E978304F473FC03AF2ABFA38EA9614012D76D505 | |
1949 | 965CEDDA91D3E53BE06A0919AA613E76F5B4ECB6D0274192BB85A7B1A9F597CA | |
1950 | 96CCD0253BFCB69E8184A92E705C71A0C1F51B1DA24C53C1A358673BC055E067 | |
1951 | 2FEB7BF9C8D3E1455174C03ED1448BAE5AC7128EBE59697E4A24B3BC6461A8DF | |
1952 | 3FC5F3447D7CB23AB6A0722E7CCACEEFC178E4841FA54B0ADEC7354B49EBE023 | |
1953 | C98B79953D5AF990CF8D409A2EAD724635A20D53DFD46B9EEC62BEADEFDD0A6B | |
1954 | EB64F0985C5A8CE0E95C6DA596094DC5EF1D719E6B3CD71A7E20FED6B2967F2C | |
1955 | 365B82E865F225697728E8D302FF0FD231A2E71A78783CFB3252E748E235B7DF | |
1956 | 8EE1B10CCB5B18E66A990F6D20656DE153CDD47C5C6EBEAF8BBD23474366D296 | |
1957 | 8D07C370F2283013CE6587D8E9F65E334C4F96991A54012516FBAD8A2FD9DC7B | |
1958 | A2F13E74C01831C6D6C10FA3FA1131107D3A77CEA31F5E57485E52C2F566EADB | |
1959 | 70475F61A74AF672D624C1DB3B49CB827E40909CBE10E5BD3F0D9F3D2065A7A9 | |
1960 | 9E8329D75B9B65B0674BC1D3EF63F7B697A80B3EF103B8F31868FE00259084A6 | |
1961 | 06CDC3515915293B0B3856F80A8CEE3322B68BFBF39144223F0FC8B80A1CDEB1 | |
1962 | 6D2371AE89C9CA2B77FB978F6F2DDB2E628809D233E14384C00D08106D5F68DB | |
1963 | 2259D8DE59F69FCB8458A6CEE232139B9F72FA3A101D54A9474A9BE8A3CDBB79 | |
1964 | 64613F90CD7814BA8EA766925B7B37311649690F886A7ABD5C5A14FA72E2F004 | |
1965 | D43FD246BF83346F2D49D3708D0B37B9A7D55B241D6381C6F488A683C8212420 | |
1966 | A68A690865DD17F17CD579A34EC3318C501F1B0F1237088D7E1F647A0641441C | |
1967 | 27BFF16E1456BF253FFB4EEEEE08E3A2E2E39A524CF2B7DD391B9130451F7C10 | |
1968 | FA1D754E5FAEA63CFA78618FA45B4A0AAA2AD482FABF9595352CE99103BFB9B4 | |
1969 | 529BD32968334005D9EA26AE33663A323DECD7462F03F7F2F07F015839416F08 | |
1970 | EA006ED12713F24DE165906A87233386E27AFC8E45963EE3B7E03E7EA67C59DC | |
1971 | 709580489C6C255DFF182151042A618DA8C05670939F0BF62175ED90B3745DCF | |
1972 | 49CD881F0E5041DE1B89C636D5433C4EC6DE0227ADE952332674A6C57677A265 | |
1973 | BF1A5F7012582EBBAC5FCC7C3BE258D5020B60C9BFDA7B236919B58256BF8B36 | |
1974 | 3922A6793B2FA4975B9B9F53A0EA212CE16B4D2B67956F6A939FABD3BC1A6A20 | |
1975 | 97D8D1655EC1AEF330B189A459F24D7BDF1B4BCFD7DD180AC9437D10DC9D4489 | |
1976 | E53AA776C956C4F1C0C8E04B8A06F4A958C41877AE3A0F2DAEA2CBBB07009274 | |
1977 | 6C703DD40F9DCD63CFF5B98B7AB8D5ACB3F16FC70BF1707721AC1273D7978996 | |
1978 | 34E777DFD5199187BDA107F865E2CC6B5C0C08DCF04509B91602C5750C9A5A3F | |
1979 | BF2AF84BCDD33233898EF2EB01766D985BFA326ABF0080AAFA40E9992CFDBEFF | |
1980 | 8599696D621940D7AED320411AD515FF250D1BCB9772AC63E703FDCB19C12E71 | |
1981 | 18305C430C05740EC063B5E4B38BD32A7044A8FE10213A4C6AD11C25F640418E | |
1982 | A1DED2480AB59A077F69AD4E201F41D83CD14018C23BB9AEB7688C15A0717E2F | |
1983 | 0351DF1CC6B5BC43FD2144941FD045916C9F5404A8D18E2FD74229C673FF3067 | |
1984 | FA7516B2214ED5AEF5E1E1F058313F6A5E30F3B6691622009E4BC2A80D8992A8 | |
1985 | 1531F4F79802F3158818683CFE8C05EAB46290B7BD698C96E1FFA48BBD8DDC94 | |
1986 | 050ACA118339CE2D98A7E3C3B929E90FA8CFA62D7F57AB3B07A0002AA2BC5B5E | |
1987 | 6A623EF048B442F587A40A2EE804E72EAE3BD75B5D048B721FF5915C45908AFB | |
1988 | D28E6116AEAECE7D57952E53E9DC16396ACE32C717D22DB3C38708E7E7C99BD0 | |
1989 | 29C299E8E32FE619C4048E7B1359BE4C5B525DCDD9382518D857FC0E1A6E352C | |
1990 | B321B742C4CA32D74E62BC421459FB2C578CCAD0316A1A4A3C631D9ED4B0F0D0 | |
1991 | 6DEFD47F6EBEC82B2F680E300FE42DBA525E0783040E515679FD9E29412218E0 | |
1992 | 1F9EFA394D0B7F665AFA72CE42B7ED65D4144E80AB7369C74E9F84B2DB3A6FBF | |
1993 | 8CD88C660F746B452BD99C75C557C6F49E68593D068CF992854B996327277CCA | |
1994 | 7FB50DEC7C17263BB4D209B6A0AEB0D45B77B6DA31895055C392AEDDEFA1FF18 | |
1995 | FE2F5CF4E94D68FCA1439FBC32FDD986AF7A947694F026FA9A72FAAD00C06022 | |
1996 | 5E61413D3FF06FC2A74815657666D45C797D20A294ADA0255AB7C6B053C21464 | |
1997 | 9B5C0CEBAC0B282A4817F068E86CE1DFEE0B0D2D243077C18D3E134CBAA7A281 | |
1998 | 8642C76C1DBD0059FDA73A13AA8DCD378E9CFB16329B2EE2285D4981A5C8FE2A | |
1999 | A44B3C4130FEE029061A7AD0B4E4E069BDAA1B97A28415203CD47B45B47ECAE9 | |
2000 | F8DC4FB177B7E0599EE0250DA1782D51269E826A15964938F59083A7C372B380 | |
2001 | 0E130C5ACB824CB4EB9DCF09449C17FC4ED66D2B21373118AC780958C89CE3E5 | |
2002 | 16B89344F7A0207085A9C60B48C57A379BC463BA2DB695C27596F089C541D635 | |
2003 | B57F1304F4ADDF3BFE4F6D4F5DD4807597EB9C1F93E9C451A73AE9FDEAE39BBA | |
2004 | FF36EC5D920B4B041903960E0F301DA0DBE6AC89578C15D396FD7D30E8B5D452 | |
2005 | 5834BEAB6319555DDAAAD16F3208E6AB503D4D12CA34CE5421B65747BBFB8EC9 | |
2006 | DF3F89B704B8330E54353527EA338913843930F131E6877C06612C91D7CA8EF8 | |
2007 | 97B11BE6B46F984BA88854EDFBC412054AF5D0954BED5FA40C80049252E2943D | |
2008 | 794252A3A3D8EEC5FCEEC42202BDF237B52C08880C4352986ABF812BA76C8572 | |
2009 | 00334BDFAD40518AC034E6CB8E5435D6487EA268708F9CAE63EE39E456420DC1 | |
2010 | 56C3A41545A7835D921256A203ED551E79E7F6F9903B4BC1D2D83FEEC81B76F3 | |
2011 | BE19DB4AF3E6BA14E5DCF0B3BCC2B0C86CA2630EFE89D5790A1CFD0C8D52514D | |
2012 | 87573FBDA73E98B0301D2CBEA419B296049DA09666D498203B3758E098FD37F9 | |
2013 | 1FEAA2F0C8D49AC5C6C8E04E8087F29150E50C0D4EBD9857EC8C587415B57424 | |
2014 | 0F0A3134584BD9FABCA8566AAEFF065F46901BDBB36DA1DE58CD70D6D4DBEB05 | |
2015 | 8EF41261CF94AD09A6A02D5D89DBF15F9BD641C6B82773EA38B6392C9F5132B0 | |
2016 | C3707912608756E277D253FE00E23C4B535862A0C99FD7435B8C19AFE3ACC5B2 | |
2017 | B37ACA7BBE0F65273CDC2EFEEE1FF43A511CAB373E873520EFB4D2FBC6FA4C23 | |
2018 | A11EEDA078574C5980471CFA9CCEA5D59F1297C71447FED173DC62CBFF5DEC19 | |
2019 | 4EFF6885ED29B857F2DE2312D6F14835FCE098462E9F02D701D0F2D2A94AD756 | |
2020 | E375B950B593CB132D1EC9146B53CC8B1A057E7DDEB1BF9CCD1C88BDA332EC75 | |
2021 | 7B7F019180594638792A5B935D7C886A6E6572529DAD20BD16ECCFCF31517608 | |
2022 | 207CFE03E8A7E87B0F29BF4363FCD14C18A6FE7CA3974D569BA9FA2922445E39 | |
2023 | BC4242CAA8ED91C4CE36141010A01A17F5CD160F4A1A7C4BBBAD67D9868CE28E | |
2024 | 20EFB97C2B840BFBF5E73A98A04A8DF558E0453BB6A561F5779E91262F962712 | |
2025 | E18F4E2FB5E918AD34E797A7E25E87DAE39E4FA81DA40702499E6BC39391B23B | |
2026 | 5FCCBE0B273C3AFC1FB64E8B6B8AF4B681C868A01E59A04E02231BB8407CD182 | |
2027 | F0570389B4B39CC599E03C66E5C5D03BD5C0759F5E476BCDB1122C3A689EB3ED | |
2028 | 2731820B2EB9F46CA40980EE69E6EE147A2854E8DD060B3AA21E096A8E661CFA | |
2029 | 7ADAF3BA20F230BE6BEEEE59D7B037F421BA2377BAAD5AD9DBD2FE236C16ADFC | |
2030 | 43473B792F9AEB1643576AF86476F6D19DC980DB1B5F4FF4BD385B629B3E1B79 | |
2031 | E3DCC0333D6F63050ADD53D3F84579945DFACE63744C662A092F7C756262743D | |
2032 | FEE700588806241DCB043B259CDB01078E7C6BA126212597FBCD841B555D90E2 | |
2033 | F79EB9ECE179909F7C44436796FC93DFA327552CA8ECD0C19730B9AB9C9FDF8E | |
2034 | 97FA4066CD918064B53DC4B8A9F564DCD00B476F761BFDE9F605DE2CDCFAFB6C | |
2035 | 06A1F1274B9BEDC5F2683D87A360C4A0549FA3B864416418D9EC75CF7F1EDAE3 | |
2036 | E0E0590C59D3FA8B42C22911FD8244FC588112616346C1A2253F600D0A8CA5D8 | |
2037 | 086CDF8505DE847C3321EA8D2297DD4343C5951B928B95E999ECCA8F7CAEE5CD | |
2038 | 326AD2F300C8961E317321A4600B97194E384F84190772F381D543EB860C8EF3 | |
2039 | ED0025344C08CE76A5F768D7217951F3B8675565CA2417349D150B5805BA9089 | |
2040 | 792A6135343F1357644C50049BCC150EF05FA7E788DA9515BC0AECCED86B919C | |
2041 | 6862BDE04DB76AADCB7095DD3AD72FE7FBD375A24526C7E0C79CE575879EF500 | |
2042 | DB261BBFF7076C45E03FBCB17F10CFBE5CFE712AA9BE70E9C1AC11BBFE437E0D | |
2043 | E0811F6D24971DE9C9F7BF0867D7859F808F3A34F9A75E4D64E0F186DFB4C9A2 | |
2044 | 16F2DAB020BF454B68B5FF7BC79A2B26149C80D88C258D42B82C0D8C4D2C497A | |
2045 | 43234D6B8F08C10766A237A744B63090BE6480DD3BF61E52A77B24AC8E9263A8 | |
2046 | D18859783FB9D65C991C46C57A3782DB9563A5B8129BC9C78CC087A0A34AD9F5 | |
2047 | 383D8AFEAE4EE7AB8DC18C529C0CD79E17EB290206AA872F248E732A1D1C9865 | |
2048 | 4B45C50220339B558865784BF6D2D1423A78CDA03B3BB521768427BEBADD7555 | |
2049 | 6D180483310D6EACB8CC236F81BBE0685AC8F56795683DDE91722D4A3FFBA24B | |
2050 | 386AED629619715797B88D83091D52B33FBFDCBD3CF8CFD9F993A3DFE464C627 | |
2051 | 7FA61A273110BDBC9D897725AA5B1593FE10F74BB68761AB1168194879DF551F | |
2052 | B464A4AF554DEB374D1FCFF071BC554A5D58FE9E29E5276718EAFB0BDAEE3FE5 | |
2053 | 480D2FE83F12BDA1192C9D165677293149296D8DCD78E609270B821651EBE9EE | |
2054 | 17BF9B48BB958181C84B1A455141AD2DC7432074418DEB26FA90B8BE391A70C8 | |
2055 | 1A291570EEC07C0D32EDD5D21CF6164FEF20728572AEF32EA74334CA18FECD9C | |
2056 | 34E76C798D187AEF66B51A0D3AB9B396CDF64B80EACE6CB50A2D91FCC0E7D6C0 | |
2057 | 1FAE443EA3F8774783238C336E13AA8EE581F3555DD159951D860628BA36F573 | |
2058 | CDCBC6EE351395A5007B4F1BF2BE5E770A8C4F8AEB7CF11DCB80340986B0EE66 | |
2059 | A03B833587D904D1E903C4538AD6091C4C199ECBD5E9A9E7C952398B537B645D | |
2060 | ED28471C3CA16D4F16B8F9D42E6177D1F5978AF1B35FEE4507E6A90A26B9F459 | |
2061 | 19D300A92CE334FC8C653A8EA88A2390760E548C7BB1A81FA23AEA13B7B9A3B4 | |
2062 | 95A77283FD0CD439302B1344C349A44DA4A9318C09E841AAAF50BFE7B6B855D3 | |
2063 | 4A63FAF84587855C6E96D27C7F32E98EBC015C81E5BBA3B4FD305D1A7EE4DB3B | |
2064 | C578D18A022D963D12C37630F5E41A062559F6BB8DA38F2FB566DE5AD8E85B35 | |
2065 | B8B1A21EEB6668C65A73CBCB57373BA393254F80C8CF23F9A0C290546E849EFD | |
2066 | 4510E6CE0015511A5B80C46BDDB98FB309218D3DFEEA68016EFE39B6FBDFDABA | |
2067 | 97B81E5EF6642D41B8B67A11FB665CACACD38EDFFEA12C7DF93CAF9AB4638831 | |
2068 | 0440281A1EF338475D1198E61A3761C8806DCDC7D67ADF9723093894E47B4D6A | |
2069 | A492FC0F121F69400B03E5FCD6B9F62DDB79478BBA426FCE1CB4AB4B073444C4 | |
2070 | 4CABA465C7618519F021ACF198E058494E1E07EDC4E9FE7DE079DCC1EECEB58A | |
2071 | 5EFD843C9D7789D577266A3993FC8B975FD7CDF34B73A2C7DF0CA67BDCC32E22 | |
2072 | 0F51BB22F703BAF05C1F942CE2A1E19059782948480639B4DF983C394D7E7E1E | |
2073 | F254EC11D4784EA989186FB3FCFC69F56967E78F4DBDD2E42C15E439AFF91B5E | |
2074 | 5596DC299ACD88B2A4A73EF2B849E3EECC0AC9DC5F2AFE412E7CD0C1FF22D7AE | |
2075 | EFCD278602F24A45D103330C0016A2A03E28257B8A79AAE1B4B5FB10096FE963 | |
2076 | BA3AFCB41BA533817470FC4E6242A21D7BFC0AA63659627F12B590905B1C815A | |
2077 | C0C4974FD5A7353657E03001E28658FBF3D8CCD38403759B32797118BDDC54A7 | |
2078 | C18752F62DB85C128D88EACCFE237F1D57CB38E5CCC9D07CBB9BF522CBA91BA4 | |
2079 | 3C63F201AC013CCCC206CC494286406CB0ACFA548E59F63B9EE7C3C09DBF39ED | |
2080 | 355D9849EECC045CD99384934172D4B06ECFDD103BBBAF6FD72ACAE95ECC222F | |
2081 | C3E1D52B5FF630FD40322B025F24BC0328C4F7DB73ACA6A4AA41F00A7EF49CD6 | |
2082 | D89698EF1D4461C788A3A0573AA0A51F17443A41DBFBF64C85A2DDB92CFA8439 | |
2083 | FA5B56016CE952BB12D601BA905C6861A90974970C07DD57CB489D9B7F2BDB15 | |
2084 | D32B49FEC3B2DF2B99D23A8A7FCA361414424D4DDC6040585F3A661FA10BA5CA | |
2085 | 717BD3F7AAC86BF54AB116A4C4E293DF0A37253F2DC38833C15D619BF5268865 | |
2086 | 10FA87433C9D6FE121AA691D77A4A701577A9BBC488CEDE0D2015D2CDBB3831A | |
2087 | 7A651359194F066A00D0B7D848D6916357641344C7CDF2F1156F681DC4B0F97A | |
2088 | 320BA45B98E0BBB9FA677E876DA142D06DD926FFFFC6DA7F6EC484D3A803BA3C | |
2089 | 08F61CF2ED0ABFCD66ED93060E45B7068325BEF53F6DDF1E48B6145EB887F819 | |
2090 | B39F6F79C70C1658825C28B79561A9A66AF79447C786EB0034890C173185DAB6 | |
2091 | 551CD02E1EA6849F75FA6C0A891639F1CA1373A3458CEFC909A89BD6A2FEB96C | |
2092 | 7E38010AECB039A33BA1B82A00E9728B13AF760A7A420B1BBF24B8E9713EBBDD | |
2093 | 57E5D69259F4B50900FAFDD3EF8AF1469189D24BC646F0F958069A563F17F567 | |
2094 | B1846C75DCC8E5068680E7E893B61C99CEF73F52C4A3FDD947F98B4775A754DE | |
2095 | 02778088194C212B1228BAAC6BA26CB133630690D24E2A533ECF1E97586DE1E3 | |
2096 | DC61FABDA612B9548CE55D2413C94815BCC9204E2FE948EEC675CFAFBBD98D75 | |
2097 | A952025DE9217A55B89834E5F60E49494596074473AC25DB530BDEE564CC395E | |
2098 | D68B70D422FC6896E29220153D8172C0DDCBABD1505A9C0D01DF7689E8B41498 | |
2099 | A4AC0B3FAD5A642747522C52187A2E442EE9E492EA4117172C27B25230121813 | |
2100 | D3ABF7622268AEB835199E84AF2C57DAFBC1ECE9EFDEFFAC71E3D439524D9FBF | |
2101 | DD51D65D03A0F75F8E1A49E9D350345EE26ADE5ED627F39F1757D2F98F805BA4 | |
2102 | 6FDE80FB63B915AE92DB29FBB7F44A57EA530E0EB7CDEAB857CB13C7B7CAF327 | |
2103 | D4BFC320777AAA5CDDA46FDAC045DAB1AFA65981E0B9EBD8C9CD92F75CAB251C | |
2104 | 56C3A5851C675B70AB474C8D2C4E3A844D66F145275865F8F2689445B4FBE274 | |
2105 | A7788411A3216228DFD1C1A70EAB2D803C0A349EF1150B368E2FB6CE5B535D2C | |
2106 | 025A601EA9363AF4A961145363D4B02C1D4DE8FD459AF9AE23F8C885AC8E66B9 | |
2107 | F34197484733B5C41DB7F38223CC18BF8C4B4C682C00EB2680C1A47DF7B1E91C | |
2108 | 3F94171D98B22A6474FCB4239D801CFF4AFD2EC4810619C04ED39CEF51A45523 | |
2109 | B87B774ECA3B61E32C7B1CEEE65C0281FD3F46697F48489BDB14BF0560E0925A | |
2110 | 5ACD0E69FC0BAA13AAD12C5BEB8E6B02EF302EE049023A0839F3501896526DA4 | |
2111 | 184FE5CA04D07084BEA4011D556E97C3DE98AA0464918E5DC36FD25F7FC22646 | |
2112 | 5D87A66DF8764D70E31D4FD2B8F631D117A106D53C89A49BEE936CDB30E18C49 | |
2113 | C212C0C2DE3ABCD348A48999EC5B204299A0DC82F2495B4EA96E0B4506483157 | |
2114 | 3D32E83C83F85100F17EFE625783894E6F0ABFAC2FCD8AAC3EE7EA170E9E3A26 | |
2115 | 48D00A9B5E51F69A133E2A58BFFF8D301F6611C72E8AE67BB82158F9A65B63CA | |
2116 | D173C56BA9C387E2BBA8299A1A8EC5C6CD2E39CB828BE33397DCC7102DF7728A | |
2117 | 4E317B58094F16992E8C1155D8910425D6E4D468554DD16205CE43EDC33D3402 | |
2118 | C67ADAB3271555EAC089D36EE7F751C2B9FEB4186BAA2239D3C5773395194431 | |
2119 | 590D4860F9FF5D6960FDD4D28A5B4E92389CAEEA44CC90C36992D780C7E5D0E1 | |
2120 | 56BF0E3D75AAABF24C06A12DB86E5B89F473D30458CEB0A4021589391C38D768 | |
2121 | AFAB16056EC8C054513872A7015038237AD27D76EDD37A7E0DEB20D7580296AD | |
2122 | A70536C4484D0C459E32E331579E923AC0B81B8B7497D778498F98338EF7B3B0 | |
2123 | A564C3C7CCDEDEF299ED4294DFE77D288CE487B10FC63267ECCD88B8F36070A9 | |
2124 | 9A3E25FEA50E6BEDF43CE897ED04C6CCCDDE1E6C846CD0AB890126681EA0CFFF | |
2125 | 927EBE23E63161D75375E8B320724E6D896AA3467B75C9E61CBCFCADEC7B1D51 | |
2126 | 41862525340CA95FB06E828E5E4E44437CCB14C1E92384846181A727A5748A03 | |
2127 | 1E58F47C0CB8332F7B5EAE4CE3DA5380ED887CA1837931FDC508F69F5B47997A | |
2128 | 4A243B254201274F7B0038CFFAD2EBC6D0C653537C427878606A01B1D89552DA | |
2129 | 19EC93A2F36BFA7EBE0EDC86DED777600C6C0235166F02CC9CE77CA0550FFBA7 | |
2130 | 7F26C94E7899AF976628ABDDC64F2B3853176E3209CB141EB90D10E62BF95343 | |
2131 | CB42D4E71FC7EBA282C3F52903955611037F74DAFE274AF2EF631A7F89498BBA | |
2132 | 0D61D9A744D113E572BAE7EB176E470B96979119FB738F8E5A048CF9A06543B1 | |
2133 | 175CFF919E5CDA4FF3533449390B153E5A7361F01813A3F0B35F73C320C48959 | |
2134 | 48A6A46F5EBD1D027D1E2397B95B04EDD775237DACCE343B2D868BC97C009E3F | |
2135 | 3BDEAA329D265B75A18CC22C4A6B6038C218AF3FDE10EC81D29A5895E573CE1A | |
2136 | 0FF3A730510952530A43C1E0093EEC3E1E8D0BA1F32669888C831BC61583DF6A | |
2137 | E30AA23439F5CEBBFA176E8516868B95B0A47753886C56A03A71AD9EB4DA2FDD | |
2138 | 8E0C66111E0504F2CF6F2E98B2F244850EB7F9D0588F1D135EF0D54253600537 | |
2139 | 01EAFDFCD9219558EBEC100444A4ED143D3F0666A010ECA61A61FE4F4086FA87 | |
2140 | 9363584AB6689F6072E7E3CF1386CDD52BAABF193444484B90C6DA959781342D | |
2141 | 69F6C37344912B80CC414D3B763314AB2016633D7AD6838DC5DE7169C97EA89A | |
2142 | FBFAA322E5DD7013CD78CCE43AB9C9F9CB4C549AF48AE1107E0A371720695274 | |
2143 | 8AC2B221E321085BEAE67A5F28B913BF82C8BE9C8ECC91F4F0E207CE9DAA453C | |
2144 | 96BA6AB3F816CB68C8CAA7BEE72D06BB81A4EE0D07D62C8B377F5F84F0DC0C5D | |
2145 | 07BE1B902748E92CD91ACF4FA925DC20A87B1D68FCB8BA12BDBECD4CF8158F64 | |
2146 | C786055BA9EE8EB8C04977D513B264CC2553678015B26F0BED0B6B40E9C918FD | |
2147 | CF921973F8EBBE6069DF657140A78B27FECC079449D2AEBC5AD41D096CF2CD8D | |
2148 | 99849B5F9B0DA598260C4F219AF1C76D786A086B6926A41D8303BF33F59A39F4 | |
2149 | 5B4F4222B36107A9DC2CB7A28DA2F6ABAB02EC4B8360436768B941CD0B590E5B | |
2150 | E8BC36DFB239E726C665C6DD29D3BDC5292201A2D494C53A08B1EBE9AB477977 | |
2151 | BC0F431FC73B4CB24C18E43FF0940577EACC17DF5AA1F68942A97545AD204004 | |
2152 | 0C52CCE5F190EB02A982A0F66E5351EC5ACA8AAA3CCD8A29E1AB3F12E5A62E2B | |
2153 | BE89BA28C2B87C2EE9603DD2AE947C0C9319C7E946E11212A45AE94D5520CD1D | |
2154 | 4335107FE43273384211882110A064486C74715FC6EE0A08A6DCD1BD4C9A463E | |
2155 | 90D973F566C4914DFE7407E1518F90739FD341CF93319E34C5FC2BCC37CEBD1B | |
2156 | 84E1D1C16A6C8D89651160A4980327F82AB41E1DDD66B2F579F70DE0F41009B9 | |
2157 | FB28299E902B4438CD191233B375107693A799B752880A5FFFDEB0BA29F1D454 | |
2158 | 20055129029C8EC38D9C73622288B3CF85FAEC74DE342A19F8E91573CAEB9706 | |
2159 | 7D6060BE1586EEFD709F325722E4DF41D45C24FAD348B246B14E4C6933F696E3 | |
2160 | 1C0325BD8AA56F959381D28E578E1C097252F69570A7FD1F51B23ED588797249 | |
2161 | 547690741C8C021CABE87EE439B5C16B6FCA3465C571FEC8CE6B83977B9F037A | |
2162 | 259480AD370875BC54454CE3A7A8C454A70DB840C51C057ECF53CEF2FC995D53 | |
2163 | 4C01 | |
2164 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2165 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2166 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2167 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2168 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2169 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2170 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2171 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2172 | cleartomark | |
2173 | %%EndFont | |
2174 | %%BeginFont: CMSL10 | |
2175 | %!PS-AdobeFont-1.1: CMSL10 1.0 | |
2176 | %%CreationDate: 1991 Aug 20 16:40:20 | |
2177 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2178 | 11 dict begin | |
2179 | /FontInfo 7 dict dup begin | |
2180 | /version (1.0) readonly def | |
2181 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2182 | /FullName (CMSL10) readonly def | |
2183 | /FamilyName (Computer Modern) readonly def | |
2184 | /Weight (Medium) readonly def | |
2185 | /ItalicAngle -9.46 def | |
2186 | /isFixedPitch false def | |
2187 | end readonly def | |
2188 | /FontName /CMSL10 def | |
2189 | /PaintType 0 def | |
2190 | /FontType 1 def | |
2191 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2192 | /Encoding 256 array | |
2193 | 0 1 255 {1 index exch /.notdef put} for | |
2194 | dup 0 /.notdef put | |
2195 | readonly def | |
2196 | /FontBBox{-62 -250 1123 750}readonly def | |
2197 | /UniqueID 5000798 def | |
2198 | currentdict end | |
2199 | currentfile eexec | |
2200 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
2201 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
2202 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
2203 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
2204 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
2205 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
2206 | 9429B9D40924DC059325D9D4CC0344F3F997A99E6CC0676735EBCD685AAC9142 | |
2207 | 08DAFEC78BB41AFC2F1C219910BDF41D6279284EF600B69776CA15BC8A34347C | |
2208 | 30783C52AFA60FBE3E353E2AE354CF87B558776A22C776C7A0B5AB5CE1F941EF | |
2209 | C2D9CAC37294BF407A671F10E4743BF842143F4F7DFEE643BA3BBD8BB9E3F24A | |
2210 | BCCF7F0ADF8BA500620C81033EAE8C4EF2C1DEF13AC575F1B3BBB66F093D3B78 | |
2211 | 5412B82B67FFA087AF57182B2230F9F2137180CA58A7D9B2C822FF04BE6CD01D | |
2212 | 43B2CA7058C7B953F6D9B5D6E91ECBAA5CDE1159B0E59C83DBAD96D6C8C8BAB1 | |
2213 | 374EF652D10C0F3EE7104472C98DD3572AAF2D45A70BF7061447E21EE3C3BF23 | |
2214 | DF39C2D1B35B42CD5297BEBE6BC94F7C9DC6E61EC67E4F677256FED9064BD3E4 | |
2215 | B51A71B1D27CA4E5AA9E1D8080E6DAB5310711EEF87C40859FA935B19524AE83 | |
2216 | 63B163FA8397BDFF443227FEDF7DB27DC35D89FB1C5E435DA0619A5C88AFC73B | |
2217 | 89A2DF5E767C5B536BC7167A840A0C32BD57A14DE69A7D0D819AC36FF32F908A | |
2218 | 5070F32983BB007437E3500799DF5E0AD3710A4C0000F0098D5BE99F2EB9C1C2 | |
2219 | C444FD9552D0DCA098A94B3BF176F511CEE13DB7EFFAED7C47B5ADCF8D4700F5 | |
2220 | 7B6DF50EE617C00966B9A2828882804DB7477F4A8CF5345B7F3568B4F72BCE73 | |
2221 | 2E2AA5BC4B4C70E21F3AD9AFC3B8605A00D67EF9ED1F4D13DDAA920D45B43CE0 | |
2222 | 0941BF17CF05D2B777C11D4D844AB20C0693D1DDF00B27D9E1AA2D98A4A06CC6 | |
2223 | D342AD8F644F4787B66CA7D861E7CE13FCDA85C1B0C9F94009768EA89838EBA2 | |
2224 | 7818F40A3CBAFE9BD3ABDEC16E56A061E3D8BDCAA7496D85236E8E9F367E6A91 | |
2225 | 8899D14E4FE387C2622661DD1B2034C83AC85533A4FF10AC4AA0904C9D965C23 | |
2226 | E5FB21A264242B60B3D723712DB1C7E6CDE1725588732D2015D40FD5DEC0863E | |
2227 | 8320029BBF3F90E947D34F99F88CCD346D1DEA83AE8E0D5F898736BAE8398BEF | |
2228 | E547ED0DCB01E5F4B7D8A8485E9E1C5DF63143FC30A0231DB7571CB33503C85B | |
2229 | 672147CD91A8317522E45BEC7DF430828265EE5A55D33F1B875A075B423E65C1 | |
2230 | 55D155EA8F7C766AF61FD509D9C99C8F38872F703739368548855C0B0FEADF46 | |
2231 | F6EA9A77B68F598BEF9535DEABCAE2F70FB0E4B05DC87892CAB78B55D40624C9 | |
2232 | 04EDE7C5E525952635FB3059CC14EF7874E823E5520FEAD85613CEA9D5011918 | |
2233 | 2FF1F9F1682DDC3E9B10559172A814DB77E89D87102630AE9502222612D14E8B | |
2234 | 18DD83D3F0FA239951E9111AA35CE0FFBF2294C3ECC4F053B1DD3C688164E7C4 | |
2235 | 8C965C3474706163EB83BE7031E212DF471C34CE68CF7D70DD29848D8C05236F | |
2236 | 421F25279D061BF76853C3FBD8C0DE771F52AEE2C073C3F41476A2224CAF7390 | |
2237 | 856B7A2ECD5BF46EF467E9B287AF931E334DFA1B0018C107C64FEF306452B6A0 | |
2238 | A63117B670FC331F08E0EF834B994A1AF7BCC480922A7FDF74F175D4EEA169D7 | |
2239 | 1FF9161B866CD6978AD88F4DEE1CCC0C22498A58BDF7CF4264ECCC81686451AE | |
2240 | D285F40242479B95BAA84AE32F97AEA31A3AFC45DE6D8E1589F091413B865D72 | |
2241 | 99E9231D16326AF8A2B70E0583D57FA6A389B913B206E6FC8EC71136B1C1EB61 | |
2242 | 5CFEFEA62B273B47BF2785C20A2B490185CF414800B9C7181DDD2966D19C0A48 | |
2243 | E3949E779E7A37DD5F123228EECADD70FA07614FCA1420B2BAA0B1552F072057 | |
2244 | 530A5EED48BA1E49327FECA2888C40C69426905BD60B960C531822346DBD1DFB | |
2245 | EB71B9BEA3DAC83F6FAD7485BE6ACC31CB469D62EECDBCB3C14CA0A8CD4A72C6 | |
2246 | E516817520FD82D31A1C99A5337F71E1D5632A76E166E68F0757663323A916CB | |
2247 | 3D48CF3448F91109909BF6331982658F418D167C9C8A0133DD53D86A930DEF31 | |
2248 | AF0B2E504EA1F94E68CC14E9AD5E49D41E74759BE49A271EF14D62081959550D | |
2249 | 057A623838930D0515F701110146AAE3E5D6817E4757ACB14B5CFF85A867A3F8 | |
2250 | 3B47821D0F16FB60A0346D0F46BBD63ABB6F00D23AB0B3162A72528DE96A7A49 | |
2251 | D33CB75BD8F637D32A2A937AB39700E30411F9C4DC93A7454C485903F81A5C8F | |
2252 | 9F53684D59147F0A783D92FE163965606AA9656E1B245CB21FF345165A6DA0F3 | |
2253 | 5FF4BBCBAEB32103F45616EC2963917BC0840669CCD97D46D892BD95D0AFD53A | |
2254 | 5384D36F72A3B2DA10569D05818AD1D55C3BE41834B6992072E693BCF656EE20 | |
2255 | 2835996FF99A4EB2075B1EE2E20695E8A039D788B53F9467438C53130D7FE320 | |
2256 | B65A1E16EE040128DF932BF0A0B180C838CE7542ADF8AAD187BB769182F53897 | |
2257 | 5E84E3F0836C26D7104A178CDD976B87AF041B0B2DB7B2A0B3B98FB8D16A7B29 | |
2258 | 335331C128BF78F0E3CFE186C974AAB8F23CDB283118159DA6766E17DEE5B1EF | |
2259 | 4F608088A0CED6ED465CA01B27A7E6F1BF8DFDD40C559014F8D65D1894F22CC5 | |
2260 | AFA7F18F38F6ADCC89529BB1A5F9B5CE3A5067AA7B17413C5C16086BA8F1AD7A | |
2261 | 0E1065B54F5A0D2511E4E779B2F4CE5E505DCC3CEB98D4BA4F3F28CC7EF2D305 | |
2262 | 0656C55134F0EEB77A9CCE3E6151A9CFCC7005ADFE32998C6E79A46D03A53373 | |
2263 | 42B7D50641F802F76DC08E8D2ACB7011A6A7AAA346BA6C05BA6B4372F7EF8943 | |
2264 | 81E15DD7306E1EBF900220DD72E50A5D55A840C1634FBF4C58F0DDBB3F18CF12 | |
2265 | A99FD758F7A598EA4517D512DB69A06C672DC1F2D1C6FDDDA60289AB9005FED6 | |
2266 | 0ACCDB75328F262213699545DF28164F801FF7D86758D7D6AEB69346BF974EFD | |
2267 | 0967F89A38E9C392A72A6E52F09FAE76844C66E38809E23BD20C3C963AE64C4B | |
2268 | 5E4A248FC50AE2C739EED7AA04A8F5663644C9A597E790BDC148D695D9A09DC0 | |
2269 | 4255440738E531DA0610D58C84322F7D88A98850BB660430BCCD0E4366D709C9 | |
2270 | 1693C7EAFFF3EC5E1E3E1C2ECC1DCACF547072F0DFAEEDC82A761C8BFBF281F5 | |
2271 | 32004366503014BBF94D1FA67491BB410B74B399750FE176E55FDBEB5EF05746 | |
2272 | 6316C13022E5F0F681BE0B48DA57A08B9C578AE362758A5AFB7AE95C180A3A6E | |
2273 | BD63388107B0581D2EF6011EC3E6A0F3314D2D5E0CDAFF39BD7CA16D7127B6D7 | |
2274 | BFE2622E9036A97C13B887A808A697563EE375E8BF35184694123A7311004F14 | |
2275 | FB923D3162CF6E18D4101E3D03FC496B4941B24085583DAC124E13185F34BC16 | |
2276 | CB5357031A2EE7D5CF085A06AED38D246553EE200D16F83069F6D5CBB254B882 | |
2277 | C1E1DC0639C7838E8272818E31FC42958EBC9610A02BC76C702F3AAE5FD965B0 | |
2278 | ABDC7E4D76AA33ED2B2672C00146CB84E336C8171DF44FD03768A41BA20E74C4 | |
2279 | E1C8A4B6983D877C4CD574652BC101CDEF68FE7FDFD9890163E9991BBCB9900D | |
2280 | EB38C0EEA027B1FF1EDE8FAF74298025D4E980AAF78F0F215F8A79CC2FE01AA0 | |
2281 | B2FDFB3B62524E85E57B09844AAC4EE5457EBB6E94B26187F6D9C0CDB40DA66B | |
2282 | 67124BAE194EFAE0DACFC151B4DCFBE62EDAAAF73D3C35406B4DC63A52F640C0 | |
2283 | 1BB69E4DAF62B54A455B08C13EE090695E298F7298D60081BB180725E265E234 | |
2284 | 6298797DDE5B729BA62EA1476171D371F441C8E812A78C07E93BE7B54595873C | |
2285 | 41802D035746B9913146B8900A0B6A72D45495E9747C6174F425F0D541C4B965 | |
2286 | C93DC19B7DD23028247500D4FC6B56483311CFBE2E3ED7009E0BB448F4260429 | |
2287 | 1B6E7F7F51B8EA2CE690FEB9E399C048B8A44BD6427266A531419995F63CA763 | |
2288 | 6F33472938317C8B4DF4A08288239DC5CAB08CF2B685E06C025A080F9AE859DD | |
2289 | 92AC686E5A6750E1416CAF269808C2B41456B85E90182ADF7C49EC289A584A13 | |
2290 | 8F4423E055FBA92CADA57AEECF0B080F588E467A56C0D5BF3E5474C4AE72C9DE | |
2291 | 7E58CD7019A120985CA7466E7FBDA1A3BBDA5851F29FD9FCEE6D4C7E83DE8D01 | |
2292 | 30717D1A87D9B2519F83295DB8D129E9FE6F63EFA562F2887EAB20251B38F8E2 | |
2293 | FE3B426F6B6E3F9DD18044784D031FE559FF54FCE638FBC4E431A5D2B1FB4598 | |
2294 | 0599EB21025127EE5984E4B9547C9174949B8BD298851FF2279F49DDB60CD6BB | |
2295 | C791FD5C98C9F101073CAF431807AAE3EFAFB62C26F20B744BB9C2AB2CA7685B | |
2296 | EA939E79AB343F7C7682E7049EE484026A87422524D7F05E74946EF3EA3D3138 | |
2297 | 14AA4D5B84888F0324BB693DCD9D488F11D9AE9033B9542226D09F3E212ADDC7 | |
2298 | EEDF0E695D5FFA6BB8736924271BC6C0EC991E123F2EFB42CD4738C089626585 | |
2299 | D6D9C81A5B600986D34F5746F58BD4A3C6018786F83ADDE80D4AADAC74AC5D57 | |
2300 | 92B3B2AEA8A23CD46D96C73253430550DE6A9D38318D19924172F753A925852C | |
2301 | E254E291C75D2A2FAF88E8B1EBC9338CD4633891C274A891C34BDB36F11B4539 | |
2302 | 09B3DFFBA7C8F69F130782B2C52BC4FFD73AFB85E9B89D77C0E281656E60DE46 | |
2303 | 96AD0403E5FA280B5125386976E1931ABF92869B9FD35FAE8CBD8C81C6761A0A | |
2304 | A58BED448C83D578415C9F3C6651EFF09F06D3232048EDF12BACFB2C79D88C5E | |
2305 | 266A3AE6889C188B9C0AA2B08507960F779B4DD780C1BFD4897B5C9D54AFA801 | |
2306 | 821C4BA6E0388CA3A7B4679425C777B390518F169CF463976039BF7FA2EB65F6 | |
2307 | C0430AC41C449B6B86BFEAA1FB31141D790F3AED1BA2A996D09DE2C2562BDD5D | |
2308 | 5CFA628A96891AED8619606A54B7C29F92922F9523CADF456632E7583DE33282 | |
2309 | B450298AFE02A5FF44B03753E69D688049379A58D9D64CF54D838F3ADBC2E189 | |
2310 | FE9533FA4CFAA739984DFC92B242BDC27A9B2D7EA5B7DA2BD8E68F56D3F9C50F | |
2311 | 1787DE3DC6A563E026E0F825EB44E94AE20A166126C23D6C1C50845D69CEDBFE | |
2312 | E5BF8BB1CD69ADB8719E0D323248A16BD5474EB8866B27D076319E2DD94E22F6 | |
2313 | B5775E1C1730A230DF4A9B6E755FE9ADE2C2E52050812566548AB8D23E3FA2DC | |
2314 | 0D7D40D41E7FD479139C518C62755AA7AB849147A9DA060248AC709BC9AF5397 | |
2315 | E4C2436DE40DCC4DB45F25A6F13A9CEF167844DEA396AF7F276F3E406429BF4D | |
2316 | 77B52727620D1EDEB498AAAF82882A64A536B27428DAD07B65E4F67204F5F6EA | |
2317 | 640BE2DD1A4B0C3219E0A4078F4E724C87EC03F40687457FE0A33BC7ED668E0C | |
2318 | 1ADEDCB711CE4B6C3FF6C6B795C8D94AB21258B80EBE07D5C6750C31141DFCCE | |
2319 | D040FC0ABBA2F70FCE652DA2B054667AECCBCFF2CE44067C59D9B519DF8D0BC3 | |
2320 | 601DF1C69E3C527D3DA14E300AB16DE394C3B6834224E6ABD0D3C5D69CDF3BED | |
2321 | 0F1D25B40E43461A419E09EBE7C064431E1A65E38381C3B499DC14A5EC914115 | |
2322 | 0EFFA2A0D3E3410C04BA946888CCF34B9E14CA34A9AEDD7EE33A21616222E1BF | |
2323 | E452124F8385EB91CB3B150C09CABC844B3AE4A6F160A76402FEFF88143B8EB8 | |
2324 | 7861911F813B9F4FBAC396AA1A0044583B6103CD6C06D835067FB4A805F012F6 | |
2325 | 8B4DD3A94998DA21774A2F367BF35DC8DE396F2744AA755FA1E9CC924D55936D | |
2326 | FB5816F04D690C73F9A6745A31F44ADC6AD84E5EED1FEF8C79FAF887254B9B43 | |
2327 | 1D7E7D936EA73A6C17FC206CDF381B43CEEAD16372472E1557C331BD84AC314E | |
2328 | 0F0DD068CF5614855302073C29D827D25AA28AF4EDA5ADA51E7A41D82AE8C541 | |
2329 | FFBD51070BE1223BC469284BC7202DD0511BB35187CBF51619FF6AC2C4EDFE3D | |
2330 | 59CFE708C4CCEF1477728909812020747FCB20542187D663538CB4499E0F1E78 | |
2331 | E7A855D1B98CC60EE8E94484067CB726E97FEF6B73806DA6AE03A03A999CD3C0 | |
2332 | 448BFA5D5D84D2CA2FC3FF8B9B0C44EA6301536D468066263726581D67AA247F | |
2333 | 2474EC9818DC904B50A6B37CCB054D2BA43BE164D56A52D277ECFFBD89A9996D | |
2334 | ADC9DFEF4206BB16B1D30F57229E17B22ECD569CC5184B85601B8D4114B1CDF3 | |
2335 | 19104059BF448D7784AD86A432ACB9E9CA67D1F7E2E3AD1CB4444BDDBCD42F70 | |
2336 | 8B0BEF950219F68CA869D4F9154AE0D98A562EC75BDE9FBB9EDF4BD321544151 | |
2337 | 918A39D105A812662B4E1D3BA59EB980AD687F300EE7B4864FB69D6BBF9FB1A0 | |
2338 | 23C9DE5EB29A2C67BD41A651D37FAC1EA23FDD1A6A03C2DFFF7B8B0352273FFA | |
2339 | 00F718CEA4DCA42903F88F341F19E16C2BE1A49073F672970206381B4560B701 | |
2340 | 21614EA094C3B2447FE83F460867A432A1665AC8A41E099B63A549B7ACD5F451 | |
2341 | D4950B6ED06EA1420D679616D3290CAA8530E83EDE95826B1FBBF20E3935E861 | |
2342 | E36DF20550F20B97D6055B702D897AED20C970EBA4287EC14B933BD3360320B2 | |
2343 | D39147E6C37CFD7E0434D163D1DACC8D2D3BBADC1E064076F0B7F4C2E113C99B | |
2344 | 362F9A6A241ACA27BF0000CBF796C099F56097DC88725D6B7471D840C6641394 | |
2345 | 193D994B7B16FF93ED96322766FC9FEE2434BFDDFF5C5CCCD2F7DF30E4942DEC | |
2346 | 8AF62A14CAE56679936650E8140ACABFC0816C72AA29223AC6EA810CA2262316 | |
2347 | 4E7AF26429DA8E7A8C0C9C76D54DE98150D94A24A44E19C8C33FADC69BC146B8 | |
2348 | 1A0C4E676C3835B1C43817DB3513F2366E2105527CD2AF5BD1D06821292BCD91 | |
2349 | 93CABE6F6E4FF381D35492E6D83C21645650E52EAB1D2C2E396264BB3721AEE3 | |
2350 | ADD93B3183961B1F1382CE896E4324D0E113D1427DCA1DFF23E7475D31A866D7 | |
2351 | 854BF0B6AF6E7E49CFAEF5F75CD92C3ED123B3CE6ED9B1673ABC5F74829B0C17 | |
2352 | 5B30B59AEBFAA4F925D790A9608900D05D332206338852516817CEA0529254C0 | |
2353 | D09F7CE1431E27469C14DB6DF763370FBF8F9AED3D5315F1C463D967CC26A75D | |
2354 | B1D3DFD5B5C3163304D2C5C05E1E9DF51B2CE1E02A42E28195349CCDECF8A798 | |
2355 | 949B49691312BF0C2A6B876BA470B4A687B302639BAEFB4AF896098EAF169644 | |
2356 | DEBBBB7908F6B2CB7B4B90B3BAC1B88CE0A68FB210411BE55DA9FEA6936E9BA3 | |
2357 | FCD10181D209B546D84876AED9374011CAAEBAF81F3F267EE4B006274D39E27B | |
2358 | F4CAD5E76E753D4B239CDB0968F2826A0AD40CC84E48B5D23783ABF374315F41 | |
2359 | FEB340E77DA6BC30E13B280F7B21B2D1543498E107C625DB4ED729A631D41948 | |
2360 | CEFC84927207FF77235FCC3F72E2BE779B6B60FFDA38B05A14EBFF0436708485 | |
2361 | A11EB6A7EB414994FC636E18CA5CFF432D4B7835CD3472010FFE226B178DAD46 | |
2362 | 6A0B0E2AC832D2D32B5994B21270FEAB62F95BCF2F870EAA79A9D5F3480E8F4D | |
2363 | 68EBA4265CAB5563295ADF1D54DDDC9071691D996D5D34C308F9E8C440831798 | |
2364 | B96CE92AE1711CFEEAF45FBC63F4ABD466BCEF2299209473238F302B3B441CD8 | |
2365 | 4640956EB3A6976F425FDD8A115EA00FBC420F49F00C5FB237013F502AA1C046 | |
2366 | 5D04AD291DBA5ECF1CBAD5681FFC89045BD55BA951DFA7B5407C688FB0C42262 | |
2367 | 7AF72CF53C3107F42C34FD968A0B2C4F30771A2DF688037B45A0488BD823BC4B | |
2368 | 0348ED7DFFE7161060DDE1117FB8B7D8883DB3AFB4C0E7FAC095869A593CA8D0 | |
2369 | D2851A6143FFCB3DDFB78A4C5B2795A7D3AB1355A1CA81133CA7CAC78F112759 | |
2370 | 13E7EA15C6C0399DC657B2BE607310747070FF8C3A7288C356E28EADB53AEC9B | |
2371 | 47DC9892AA4D9F3FE534083F2F725874F1B610EF85FC6462763AC476243F6749 | |
2372 | F24D18DA615FBA3E0E7CABC0555C5ACFA192C335517EE593D4F572B068DC1875 | |
2373 | 16E7143B1D286B6F9EAEEF9AD032357BF686B38DFE9614BED880B60D95757015 | |
2374 | 0DAAE0DB5A2AFEDB75628DD65332B0E3E6ED7C9F217D00B5D4748536CBA264B9 | |
2375 | D9AA6CB4C2F91C1F16E3881155C162CE45FB3FAAC36A8AE2395062BA4EF984B1 | |
2376 | 5BA305768358BC11B824816DC78C95446DFAC96234AB7D2C50D6C0B9BE90FE36 | |
2377 | 1A97EDE7F382702FC6C201C23D7499D88643C0370DB8F8E7762694260B81FE26 | |
2378 | 2E1002A9CAAF8ACDFDB6BECC91BC372A04F01E1A66AEACC16D9BB95374D5F050 | |
2379 | 6D1C67DABDA03EEB2111E4EE8468037314F4F53F786800511D067426BF09080B | |
2380 | 135EF9FB14FFB49935CA055EDEB99DF36284BD5F24D7224BE0936ECE727698AC | |
2381 | A7AE07B29F3F717FA4E8F31C3CA91D7F0497B0BF4D1A13B026CAF29902324471 | |
2382 | AECEDFFB9110B6D3F135E00B28054C9122979968E102141E1B3764C4E74DE1DA | |
2383 | 0E2D08B8FF6AA00000E295DE9B00891F016820A9CE091F959CE7FDD0B656C89C | |
2384 | 061971BCB9D12CC9938C309722621E2CC6988EB8EEA37D2C8237CE6D1995C073 | |
2385 | 168CED6EB4F49FCBD90D11CD1A424421431681242198618390299A8BB4DFB14D | |
2386 | 852196DED1751576B6A4B0C4B044560212BBDB44A13DBFFEDC5B55CE9E813AB5 | |
2387 | E59BB6474CB6498CF1372B540BAB62CDE9CB522221306984E4D4A93D66168FFC | |
2388 | 94D3D722AEC33B91887A9243A5D3DD6CD7666D6DC14CAB7EB508C0B5803A0F9D | |
2389 | BB6ACBC2C378AC52DEBD5AFA1EEA68B2070514AF8BA8B451247930F88A09C807 | |
2390 | 73AB0E8724E862B6E915266C0A77CC027602316C38AF0CB3E26312731125B516 | |
2391 | 0CB71820DAE1038D52981B29898E175B20A780A8228D1438085EE12A159C1EF9 | |
2392 | E86E9D2C43AA40936D0C5EC9AC52CFBD266A509E152F08D6D9A4B82EC5714FB8 | |
2393 | 04A101407320EE732C09BCA7CB8E7C476D5D89E046690B645F19B975C2F7C1C6 | |
2394 | 1AEDD047ABD0D6851263AA0C23BE521ED1A93B8C8914DEC57A12E6AF6652A95B | |
2395 | 4B5F74D32A31FC0F05EEB0EFA5841E5C42AFF8EBF4960054A930F1E1C93FB1C7 | |
2396 | 98AE63B1A79D04780DBF480BDA2CF13165D5A354D8CF051A2EFC44206FAC9341 | |
2397 | D43AC601DF80A80EEC9007AD0862186139B9F94BFEAD5B0A0457BB8D7B606DBC | |
2398 | 419225743817957AB44B5691CD6EA83EBF879D237516 | |
2399 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2400 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2401 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2402 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2403 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2404 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2405 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2406 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2407 | cleartomark | |
2408 | %%EndFont | |
2409 | %%BeginFont: CMCSC10 | |
2410 | %!PS-AdobeFont-1.1: CMCSC10 1.0 | |
2411 | %%CreationDate: 1991 Aug 18 17:46:49 | |
2412 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2413 | 11 dict begin | |
2414 | /FontInfo 7 dict dup begin | |
2415 | /version (1.0) readonly def | |
2416 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2417 | /FullName (CMCSC10) readonly def | |
2418 | /FamilyName (Computer Modern) readonly def | |
2419 | /Weight (Medium) readonly def | |
2420 | /ItalicAngle 0 def | |
2421 | /isFixedPitch false def | |
2422 | end readonly def | |
2423 | /FontName /CMCSC10 def | |
2424 | /PaintType 0 def | |
2425 | /FontType 1 def | |
2426 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2427 | /Encoding 256 array | |
2428 | 0 1 255 {1 index exch /.notdef put} for | |
2429 | dup 0 /.notdef put | |
2430 | readonly def | |
2431 | /FontBBox{14 -250 1077 750}readonly def | |
2432 | /UniqueID 5000772 def | |
2433 | currentdict end | |
2434 | currentfile eexec | |
2435 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
2436 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
2437 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
2438 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
2439 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
2440 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A30EB76029337 | |
2441 | 900ECFB1390CA5C0C3A04528044F266BA17BE487C79B94FAC6D6484684C5BFEA | |
2442 | 87BCCC77D40AD11552035E95E3007126418ED49B68468B38A14E88E68A267B98 | |
2443 | 076F1C9769A5AFBC285E5B158EAC9F926F1D6C0B8F1D57D9C31D25AE27123518 | |
2444 | 9D2CD92E5689E0213089BD268DA5E47525CB8EABAA4B78A15AEA34705889AB3A | |
2445 | FFB8953B5B3482E52BFA0940630ADF8C0AC2177D907324299EE980E850F203CD | |
2446 | B627962F43D5A678C44243CDE97853BDC6AB45FD5C09AD274DAF89929F583CC9 | |
2447 | CCC24BDFC68B92111055ABA5F26D2DC67C70906F71C2957701D65AE746A60C30 | |
2448 | 40E6CB24B97FCDAD0487AE38A201FBF0E41BABD2181981A71940F1E707F91E5D | |
2449 | C8CA50CB16D8702D188E56D014D92F76CE0B52ABDB9110E32438D2BBF3E6A40B | |
2450 | 7B005F10BB437812CAC6ED2996F7606DC962C4FDE207FF322782C343DF44CEC5 | |
2451 | FF06A55C630C20E9AE1B0D1C5673753C43BA0767D65D1B451CC6380D8BB3C4DC | |
2452 | 81E8FD8AA79BE993218686F29D3CD925566DD587F541A0DA1B1CC3BCEA2E6C7D | |
2453 | 5E1016F6917A871F1BBAD96AF9E867735017119A381FCF33EB2D3E1E7093FD90 | |
2454 | CDB0CED4818CFD9E201A03430CEC713620BE0D3254158931FB657C6877C1B3D2 | |
2455 | 24030F377820DA58F4B95CFE645109F3F1B80DB5FACFD7D05AE2909EEFCF95AD | |
2456 | 9CB286C8B6C075CA2267C101B736139863186C193E31085E7C9FD88EF8BBECE3 | |
2457 | 933542C85309013325B4BBFE9A5B606780C8580ABDA2F5D0064EBFC23939B307 | |
2458 | 08568C3B7F5F053BF367DEBA349FABB9F760C44D100BDEEFBB01F27BFC61FCD7 | |
2459 | 5EAC976CB24D67763C8CBC0CB43B872E68A0FAC1127FC65DE1D613223F947D89 | |
2460 | AAFB4FCD676359F7C3A0EE0BE2BF8A912E2E4CE58B7357A05CB75CFB62CD5F9B | |
2461 | 9A0FFD1BCCEA877E2C20231CFC0F7E31F536223146F955D34279086878748772 | |
2462 | 0C9D158E3B6CA92EA5C359C620FDBBDA421B3510FEE1D118024735E213B8F03F | |
2463 | B916582DB3B56D9E704FF55F61AE12B8000ABB7C2ED781978A31EE30C1658128 | |
2464 | F18A4B92BD9CFD1AE5D7BE8E0849AF3E1B762028BD1D1A57EC7EF6BB3EF342A9 | |
2465 | 82EE0D16724928E3A1BBEDE05FC967AB3C511578435D0D4958EBFA1FC32C6D2A | |
2466 | 5E1C7E62B8F4BFD82CC2340C95799F57D486E4929F07CBD1C86DB204156E344C | |
2467 | 74B191E911E9476486CCE4D2F0DF2A79ED8F8623DB218CE3E8AFD4B42AF7FDD4 | |
2468 | EFC3A7146816743DA8EC34E955861CCDA22AECF0C74D74FA6402503A2088C564 | |
2469 | D44A87245F246DDD847AB57D2AC8ABFF7045341C6D046045516B2E10B85E0637 | |
2470 | 814E135E13BE0439644B8FF8A46423EAA6CA3505F9152C19CE0FEAEB9242037F | |
2471 | AB2462A87EF274356B5A4F837542378C61EA932ECFB635E4F69628EB0B1C20A9 | |
2472 | 095107E0FE465057BD95C0EC8CEAFFF13F3EF5D9758E8BDA1D55C86A2C3D5985 | |
2473 | 1D3B67E8B1F5F93C4CFCC75A0BC8ACE6C7855767523DD6C79E253DFC2D49EC38 | |
2474 | B24AB1B7D2D0816542AAA408176C485E7C490CF18F8C73CFC82E449E0976D671 | |
2475 | 950C0C35170514AD6227A312BEA851982650498DE535949378ECF3AE72A0E761 | |
2476 | 7CC65648D33C5FFDB48C49AF27E9C7E8D8C22EC491197F1384698397F024EE32 | |
2477 | 01A97F70759B69AEB138CE12EA7C4E0F12B35DA8B723C43A525E461887234C67 | |
2478 | 243CE39372C4EABCB6B0A3521C7DB601708844C6062BC9A93024395B15519BEB | |
2479 | C56CEDB7898ADF92A9D675788DE3B50A97224C194756508E5C5A4E0B96D6372E | |
2480 | F27AAE34A3F1BA3389A222B51C2A1373135143B80B71EB4B42AB1F09F60ABBC2 | |
2481 | EBA97400A4398BCDAE99C85F0A9C03366E91F1A19FC22670D608F1097AFF502F | |
2482 | EFF30748B578FD8D750D28C60C4250896B87E841AABE6D442FDE4586B90FD905 | |
2483 | FC3D19C00DB4DB6719D58F750811B7EB3D5EC40B69E66CD7F5BCC4131B9CA194 | |
2484 | B27DBB7A30BB5121B7950EC6B453FCD5353F734FAA157D1F85B508B75087EE2A | |
2485 | EAE9ACE82CB3A7D7ECB3DBDD4263A01D128D83B23D3BE98865C90D47C78E0E05 | |
2486 | C28CF793FF756DE91683370E81CF7C36C58CEF19BAAF36A20664E0FF2DC74CD7 | |
2487 | A6271A46FC3848DB589C50A715BFD53716C0B46146CB2920DDCC525BF83D766C | |
2488 | 1E45F6690AB28C45CEFF4BF426E67B82E7CCEAC6A165977BA375D14EDE206067 | |
2489 | 56497B7E2D1C81ABBF7A5180067F1A698DDBD9E423ED67B72ECDCC2AB7DAF950 | |
2490 | 3385AAA4384490E369C9FFCD8F491EB372A80485DF57ABEE2995BA59C397A858 | |
2491 | 39318C7638B511AA9A40A8AD69D053A8B05E3DDF93FB876FA5007EFF920C370C | |
2492 | 368A2657C78F5ADD83890B4F6890C4BDD2041951D58021F5AF4CB5CF5F432E59 | |
2493 | C8A6F5971D354720EED8352B1FE32BCD231D33BC090BF7E1D731574C68FB8CD1 | |
2494 | FF9A7FFD70E3912B2A1181BDCAF989C9CD7FB3B30EF2D8280C7D3D202A7443BF | |
2495 | F8E44D21CBFD72671DF0D57ABD165A9B4A925E14669A6AB0AA33462ED7EDE70F | |
2496 | D88D4F43AA8A9326C69D94A76F236F85DBDC13DBDE75F590155CCDB0C18EAA74 | |
2497 | EEDEF95771CFF412D3C9DAC65DB3570D8211BE98C27CF0C2A536202FCA5948D8 | |
2498 | 7C83EFB774CC1261962F1C3C05467C2F8EA3E8C3E3BD82B1F39639DCEE46F6FB | |
2499 | 79700257DDB6172206C6CCDBDE82268E3B5E40CB8E1A33E7C87F386086A3B015 | |
2500 | 114433522F9D0CE343F1C7CC6E188A29FB93C2D246670D2F92EFC68178D35EDA | |
2501 | BB2A4BA8355CECBC97254E3CD52F188EADB5B5825FB109E94EACEBDB5597E939 | |
2502 | B7F2BF5A53BACFF6DD24ACCE2DD4597B7921EF21FF911C4812CD236D95C9AF68 | |
2503 | 7BDEC554C8B748301EF5BD6BB9C8CEA0F1E505574018CC2D599175E6A9A74285 | |
2504 | 1D3DC0E68B0579D9AAAD99EB49D518699990E0B4CD65F7CC8EAF7413ADFDF219 | |
2505 | CEB8F1234D70F6B66064AD518DCDB0BF9E90AB0EE016ED7C323ACA421416BC47 | |
2506 | 103D4ACEB453B8302BE7E8679DAC6FCC0BB614D9E312351964BFFD3AD356953F | |
2507 | 62F0B683EA75A83461F88B4303C046EDB518E74E09D19115E6064D62848F9E2E | |
2508 | 4942EEA7AB91DBFB7644390BF11B9E9DB49C4585B6427979F524419B3FD2E7F8 | |
2509 | 7517056C688D5F051C821EB196414E3D480420619B1910DD6F7A12B5E01CAB06 | |
2510 | FDDAE550C11E7AC395B1F480A73430D971889772110A806CCA9B5921BC37AE7B | |
2511 | 94105AF102A79E3CDD32C5682043D3EFBAEBDAF7AE922211E4C4C61D37966F56 | |
2512 | 17E3FD9A47D40FDDC45D21ADE80F6539AFD69C3AB8A01797FDBB9AC150FDFDAA | |
2513 | 736F3E4F149959C4AEE4B0E529F770E5E7EF9D30B040989201428F8399E3679A | |
2514 | 01D4FC61B6A4879D4764B23D424CBA11256ED3CE090F1D7F1328BCB5F800C705 | |
2515 | A19A1212A9662D86269420B6C7E6BB638DAA9460FAB9BB8545B427B417FF2A82 | |
2516 | 486C8D114468FFA2C45B530D59AE72E7FA365F41AE589E3E1957808F065A4A1C | |
2517 | 240AE545A87652356BE9068277BA0B9E79DC84698139D835F3F500348317BB43 | |
2518 | 2C59C0C0FF7CAF5CC8350D15CA59101A25E4F2E0CB2DA8E5C094B4934A189DB1 | |
2519 | 6288CE469B60FDC50280C232AE7EB1EE123CA4ACCFF7AF51DDE258CE52ED59EB | |
2520 | 36DC6C94893146505F3DAD8E3C838EB3C12B13B2AA38E7F43F3139C5BC1138D4 | |
2521 | F1F2F52B5AE4550D3A820BDCADF1989040DD77B8EF5FCD3AC42BF884FD02C1DD | |
2522 | 13B24556701E3CD43B48C9FB45E5758DC7571EA4ED3442022300FDC555A5E4C5 | |
2523 | 1456BAD59F0CB1D389F19E7868A4FE95AAE7D4236671B1E8B6A9FF51477D68A2 | |
2524 | BEF5BE4E86BE81F0A4C87948DFF006D1C2A47B650B9CBD121D388180721E4E1B | |
2525 | 7906582CE91A2A1666208B52728F1B5E4E4943ADDA5F7AA1B9487C207C86C30D | |
2526 | 9973327C8F600CA86DA892D70CF6E734552F6E773473FB5713759C730380F4FF | |
2527 | E440E57BE60050CF5C33BC1AE10220B0B9673C7BDE4F8BB596BD41CA7DC19CDA | |
2528 | F27465B9476961AAB3ACE28545F1D5DD855EB441751F838E356D69FD173205A6 | |
2529 | BB52BB602239F612F477DD641A44EA2D556CB113983A040CE61046AB7EB52927 | |
2530 | 681AA49626070EB91DA3E2A46FA4A8EAC0468D62BDC73C82073CE5E6BF0D1A93 | |
2531 | DC54F906002DEA32C39C713FAB8EC7342CFDB57485D3E41B7E5067A795D7AD43 | |
2532 | 5AA84210EF77C29A319562375A18F2DEF1B0B99A2BD7D5220371078E76DC6D7F | |
2533 | C4D37A486525C5DA69B34A710CC938AC53C17F5E2B1726F0E552F25750E9C1F9 | |
2534 | 5BC12260A0B42AF4710852D8537EA7301911AB40D5ADF26C6738DA192B1058D4 | |
2535 | B61FB1A84B12BE4916B85DD6A721BAB7035287AF68EAAB8B0D5AEF45F25E1E15 | |
2536 | 04E9C921235D33AE59996DA03B46A81EE6BFEE517E55F54FE65F509DD7F230DB | |
2537 | 67D4E212757C099E6DF94E27EEA41B54CBE7EEDE78594A07C86AF80957A4C241 | |
2538 | 67F5F5E04B0D190FEEA47562E98351B67AB35C513649FC7177C5EDD9BEDA8416 | |
2539 | B112E0A8C28A45CF9A05C6BFD9A09313413245F9D797CDB56E402EEF05C88A61 | |
2540 | 9E5108353115F1415FF014E1E9A3CAD6103926BD42945BE01D8EDF875A95AF4C | |
2541 | E5DB8A4DF4B25E7D25C3BF4CE69C171D21972619EB8DFBCADBEAF4201D299AB3 | |
2542 | FC79BE62A2E850F4FBCF04776398AA2769 | |
2543 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2544 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2545 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2546 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2547 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2548 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2549 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2550 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2551 | cleartomark | |
2552 | %%EndFont | |
2553 | %%BeginFont: CMTI10 | |
2554 | %!PS-AdobeFont-1.1: CMTI10 1.00B | |
2555 | %%CreationDate: 1992 Feb 19 19:56:16 | |
2556 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2557 | 11 dict begin | |
2558 | /FontInfo 7 dict dup begin | |
2559 | /version (1.00B) readonly def | |
2560 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2561 | /FullName (CMTI10) readonly def | |
2562 | /FamilyName (Computer Modern) readonly def | |
2563 | /Weight (Medium) readonly def | |
2564 | /ItalicAngle -14.04 def | |
2565 | /isFixedPitch false def | |
2566 | end readonly def | |
2567 | /FontName /CMTI10 def | |
2568 | /PaintType 0 def | |
2569 | /FontType 1 def | |
2570 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2571 | /Encoding 256 array | |
2572 | 0 1 255 {1 index exch /.notdef put} for | |
2573 | dup 0 /.notdef put | |
2574 | readonly def | |
2575 | /FontBBox{-163 -250 1146 969}readonly def | |
2576 | /UniqueID 5000828 def | |
2577 | currentdict end | |
2578 | currentfile eexec | |
2579 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
2580 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
2581 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
2582 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
2583 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
2584 | D919C2DDD26BDC0D99398B9F4D03D5993DFC0930297866E1CD0A319B6B1FD958 | |
2585 | 9E3948FFB0B4E70F212EC976D65099D84E0D37A7A771C3101D6AD26A0513378F | |
2586 | 21EC3643079EECE0C9AB54B4772E5DCA82D0D4ACC7F42FB493AA04A3BF4A1BD6 | |
2587 | 06ECE186315DBE9CFDCB1A0303E8D3E83027CD3AFA8F0BD466A8E8CA0E7164CF | |
2588 | 55B332FAD43482748DD4A1CB3F40CB1F5E67192B8216A0D8FE30F9F05BF016F5 | |
2589 | B5CC130A4B0796EE065495422FBA55BEE9BFD99D04464D987AC4D237C208FA86 | |
2590 | 0B112E55CE7B3782A34BC22E3DE31755D9AFF19E490C8E43B85E17ECE87FA8B9 | |
2591 | 1485831624D24F37C39BF9972D74E6EC4784727AC00B9C4A3AD3DA1C22BD6961 | |
2592 | 7E0ADAF55422F22ACA5E4DCD4DF9FCD187A566B7FB661D0530454D0DD6C6C50A | |
2593 | 7A3875C6CBF8EC7769F32A1F3F7FC1C072BADEC97794D4E90E0035282A170402 | |
2594 | 356E5A9CD9ABD80AC4342A5283E458A7269252F4541CBB6452B39ED54D336D0B | |
2595 | 19928E9CD1AB26AD83EB209E2EC75011A2643813053B5DBB0246097C4821B5F2 | |
2596 | C92554E9140BE35B2DBFCD98809A8EC9FC910FDE9E0D86457C70ACB056EBF90F | |
2597 | 244DC0A5BBD455E15D6E3180311D52CF50B0BF7D0A7F64F3A1821E0AEDBC2E7B | |
2598 | AEB549FE1D51088C153799C6E089B5D5D65E1C4E2D2B430CDF1FFA23CCB25D95 | |
2599 | 592943209E846E55B4CB54F6658CBA3C0B29796D69D0435D5431ABECF3448C15 | |
2600 | 98CA2F36F3659E29AEB79355EC2ADF835CF0886C21B766B9DEBC3950B5B3B496 | |
2601 | 2E06D980A8C60305B273232D4604F12632FB4F1B2F9703952C823C098543AED1 | |
2602 | CFB4ECF259A11985F0C944A57B5AFD853374FCF12305601200C2A393E2FC77FD | |
2603 | F78C2BEB83AB223A89D9E231D1BB561CE1F4D3312049F31CD544C39354493803 | |
2604 | D47CF45482054818E8621801A97461EC7BF53C6AF1C38AC90B38342D51C4615C | |
2605 | 59D45B92606D0479F43149F2579DEF5A20B4D7D10528E9750ADFC4C7DDD73DA8 | |
2606 | 432297E60ABBB72A637231049425393426F66BFC0851FE504E589F13351187A9 | |
2607 | D784ACC207B1F46537BAA5F2EBF637EB8DFD9D24982E2631F6D3A2DA47B4E9EA | |
2608 | 0C899DEF82A7DEB0ACDCE6043F36CE1F74BF1B00A1EE0765F497A67B95BE1871 | |
2609 | A8B3263B03D41ED8BD6B03CA5983912E094E2AE47DFDBF | |
2610 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2611 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2612 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2613 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2614 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2615 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2616 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2617 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2618 | cleartomark | |
2619 | %%EndFont | |
2620 | %%BeginFont: CMBXTI10 | |
2621 | %!PS-AdobeFont-1.1: CMBXTI10 1.0 | |
2622 | %%CreationDate: 1991 Aug 18 17:46:30 | |
2623 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2624 | 11 dict begin | |
2625 | /FontInfo 7 dict dup begin | |
2626 | /version (1.0) readonly def | |
2627 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2628 | /FullName (CMBXTI10) readonly def | |
2629 | /FamilyName (Computer Modern) readonly def | |
2630 | /Weight (Bold) readonly def | |
2631 | /ItalicAngle -14.04 def | |
2632 | /isFixedPitch false def | |
2633 | end readonly def | |
2634 | /FontName /CMBXTI10 def | |
2635 | /PaintType 0 def | |
2636 | /FontType 1 def | |
2637 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2638 | /Encoding 256 array | |
2639 | 0 1 255 {1 index exch /.notdef put} for | |
2640 | dup 0 /.notdef put | |
2641 | readonly def | |
2642 | /FontBBox{-29 -250 1274 754}readonly def | |
2643 | /UniqueID 5000771 def | |
2644 | currentdict end | |
2645 | currentfile eexec | |
2646 | D9D66F633B846A97B686A97E45A3D0AA0529731C99A784CCBE85B4993B2EEBDE | |
2647 | 3B12D472B7CF54651EF21185116A69AB1096ED4BAD2F646635E019B6417CC77B | |
2648 | 532F85D811C70D1429A19A5307EF63EB5C5E02C89FC6C20F6D9D89E7D91FE470 | |
2649 | B72BEFDA23F5DF76BE05AF4CE93137A219ED8A04A9D7D6FDF37E6B7FCDE0D90B | |
2650 | 986423E5960A5D9FBB4C956556E8DF90CBFAEC476FA36FD9A5C8175C9AF513FE | |
2651 | D919C2DDD26BDC0D99398B9F4D004B836D34E88C20EEB527CE1124209388A2DF | |
2652 | E27A8DF298A2693A9D529916AA0B2176E6ED237F69D84A8FEEB36861D1847207 | |
2653 | BE2BD61C6A412FFFEDFF13AFEC32AC7735BCCE5965F5966418A62ECB99112AB3 | |
2654 | 3BC938EC590FF6922659125EB67E260BF02885E49BA6019E696D33F0B53606A2 | |
2655 | F515E0C45F323311613A94B838491BAB9FE230C5CC79D22925E3D882799F2707 | |
2656 | C32975A494F0F9513E4D8332E7E54470D9721FBD345CDBB48286F2F19CC6D66E | |
2657 | BB631DD6476A509167A49CA525A72CA50E82C1D08C2B372DB54C5949C753B632 | |
2658 | 2009B761EB90492ACD3CBE6A35CE1B66F3BC4D8DC36827CE4261A703328451D1 | |
2659 | 879438479917C1647772999171DCCF1491A1C9086E0C6393506768F8757BD81D | |
2660 | 141C46EB9BF507EEC29962A0072B6C5D8C8588F3D68886CD2606DD3BD2FECCEF | |
2661 | 63245494E93EEA12AAFB06110E54ADC444C7E7619627A48A464394E5DE06EB46 | |
2662 | 4C76A2FF010318BBE48B3776C826A265C66515717F7F2E943C60EBAB23D96B5B | |
2663 | FD514A1C4E79BB3D3D2DEB936F90CD3FABF7B09FF7F564AB5CF4AF6A40E869FD | |
2664 | 395885A88F4A138B3CA6943A2D430BBE43D91F7F17621CAF52FB7161DA3B2003 | |
2665 | 82244FB6EE792DCA1722C03392C296C029A2DCC5BAAB3EA03F8DEB039DC83AE1 | |
2666 | 763AAB84776A2CCFFAE9EAF0BFDAE417E8BE682D237FFEDAF224AC09C9665019 | |
2667 | 165CE32F5349E857177D94AD6396570932E1657ADE4D3FF57A3419946CCD210E | |
2668 | 57E5A1D91CF708395942527D127606350924D71BC21C6F969288B1C8CA3404ED | |
2669 | E6219985F7301A20621368F74747EAD38990A4C9F2B62913B8FDB93657409FF5 | |
2670 | 178DAA7C97C35EAFA47778CE03E863303582D8A9900EF4F8DA879DED54BACD7A | |
2671 | 4A50C18AA2ED906FC4DC073B1E6CA1E3855AD5B7698EF4A96B77DBE19A12382A | |
2672 | CFA8717DE230CB6182F2250885B8E90AC42A66484A7B527061B223A6D1CC72D4 | |
2673 | 890359E7E04690BFFA99FAB5CC9999F0873A9DBE49E33F79E483FAD72313DF9A | |
2674 | 7B7D926461988C23CCE9F71AB7BB63BDB2B10B3F78176380AFFC154825C9BDCE | |
2675 | 82303FBFC3B59E070438984C28D12E8655BBBF049125BF56DD2B0DE8C0450E55 | |
2676 | 82832DA59EBEB001AAD86F2317460DD7ED264611B9043614221ECF | |
2677 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2678 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2679 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2680 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2681 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2682 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2683 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2684 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2685 | cleartomark | |
2686 | %%EndFont | |
2687 | %%BeginFont: CMSY10 | |
2688 | %!PS-AdobeFont-1.1: CMSY10 1.0 | |
2689 | %%CreationDate: 1991 Aug 15 07:20:57 | |
2690 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2691 | 11 dict begin | |
2692 | /FontInfo 7 dict dup begin | |
2693 | /version (1.0) readonly def | |
2694 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2695 | /FullName (CMSY10) readonly def | |
2696 | /FamilyName (Computer Modern) readonly def | |
2697 | /Weight (Medium) readonly def | |
2698 | /ItalicAngle -14.035 def | |
2699 | /isFixedPitch false def | |
2700 | end readonly def | |
2701 | /FontName /CMSY10 def | |
2702 | /PaintType 0 def | |
2703 | /FontType 1 def | |
2704 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2705 | /Encoding 256 array | |
2706 | 0 1 255 {1 index exch /.notdef put} for | |
2707 | dup 0 /.notdef put | |
2708 | readonly def | |
2709 | /FontBBox{-29 -960 1116 775}readonly def | |
2710 | /UniqueID 5000820 def | |
2711 | currentdict end | |
2712 | currentfile eexec | |
2713 | D9D66F633B846A97B686A97E45A3D0AA052F09F9C8ADE9D907C058B87E9B6964 | |
2714 | 7D53359E51216774A4EAA1E2B58EC3176BD1184A633B951372B4198D4E8C5EF4 | |
2715 | A213ACB58AA0A658908035BF2ED8531779838A960DFE2B27EA49C37156989C85 | |
2716 | E21B3ABF72E39A89232CD9F4237FC80C9E64E8425AA3BEF7DED60B122A52922A | |
2717 | 221A37D9A807DD01161779DDE7D31FF2B87F97C73D63EECDDA4C49501773468A | |
2718 | 27D1663E0B62F461F6E40A5D6676D1D12B51E641C1D4E8E2771864FC104F8CBF | |
2719 | 5B78EC1D88228725F1C453A678F58A7E1B7BD7CA700717D288EB8DA1F57C4F09 | |
2720 | 0ABF1D42C5DDD0C384C7E22F8F8047BE1D4C1CC8E33368FB1AC82B4E96146730 | |
2721 | DE3302B2E6B819CB6AE455B1AF3187FFE8071AA57EF8A6616B9CB7941D44EC7A | |
2722 | 71A7BB3DF755178D7D2E4BB69859EFA4BBC30BD6BB1531133FD4D9438FF99F09 | |
2723 | 4ECC068A324D75B5F696B8688EEB2F17E5ED34CCD6D047A4E3806D000C199D7C | |
2724 | 515DB70A8D4F6146FE068DC1E5DE8BC5703711DA090312BA3FC00A08C453C609 | |
2725 | C627A8BFEF75B4DEFAF34B44B356A516B765AFCDD3F5475B1F928731D09D2170 | |
2726 | B97E40F12CCEDF4F6BB3756C4734F6E98D74B7E942A954B1BAAB83D4AD727FF6 | |
2727 | DF6DC50B2223BCB5568A73A112E4860AD490554E64E780073FF3399CB4688D33 | |
2728 | 9E8829667CD6EAEF25E0C7D2D44F2BBFA40E999325F9561514844221B50BC8FC | |
2729 | 4C7AD68CA7220D69125C2AF06849A3E068D18733276F0C0A6A2936D3C2C87CDE | |
2730 | 59CD1AF148C44F85784A5DAD569F5FF53C061056C067CE29AEF1E3BD1FD8B0B8 | |
2731 | 71A0A638CDAC6AEEDBD5337D4683C084BB60B1859E600F59CB4E19C5FC5C6327 | |
2732 | EC544A68134496A9BD0B87D83AF6FDA3CB62FBF0B54FACE1F0E6A2D84B467AFF | |
2733 | 0F62DB | |
2734 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2735 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2736 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2737 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2738 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2739 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2740 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2741 | 0000000000000000000000000000000000000000000000000000000000000000 | |
2742 | cleartomark | |
2743 | %%EndFont | |
2744 | %%BeginFont: CMR10 | |
2745 | %!PS-AdobeFont-1.1: CMR10 1.00B | |
2746 | %%CreationDate: 1992 Feb 19 19:54:52 | |
2747 | % Copyright (C) 1997 American Mathematical Society. All Rights Reserved. | |
2748 | 11 dict begin | |
2749 | /FontInfo 7 dict dup begin | |
2750 | /version (1.00B) readonly def | |
2751 | /Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def | |
2752 | /FullName (CMR10) readonly def | |
2753 | /FamilyName (Computer Modern) readonly def | |
2754 | /Weight (Medium) readonly def | |
2755 | /ItalicAngle 0 def | |
2756 | /isFixedPitch false def | |
2757 | end readonly def | |
2758 | /FontName /CMR10 def | |
2759 | /PaintType 0 def | |
2760 | /FontType 1 def | |
2761 | /FontMatrix [0.001 0 0 0.001 0 0] readonly def | |
2762 | /Encoding 256 array | |
2763 | 0 1 255 {1 index exch /.notdef put} for | |
2764 | dup 0 /.notdef put | |
2765 | readonly def | |
2766 | /FontBBox{-251 -250 1009 969}readonly def | |
2767 | /UniqueID 5000793 def | |
2768 | currentdict end | |
2769 | currentfile eexec | |
2770 | D9D66F633B846A97B686A97E45A3D0AA052A014267B7904EB3C0D3BD0B83D891 | |
2771 | 016CA6CA4B712ADEB258FAAB9A130EE605E61F77FC1B738ABC7C51CD46EF8171 | |
2772 | 9098D5FEE67660E69A7AB91B58F29A4D79E57022F783EB0FBBB6D4F4EC35014F | |
2773 | D2DECBA99459A4C59DF0C6EBA150284454E707DC2100C15B76B4C19B84363758 | |
2774 | 469A6C558785B226332152109871A9883487DD7710949204DDCF837E6A8708B8 | |
2775 | 2BDBF16FBC7512FAA308A093FE5CF7158F1163BC1F3352E22A1452E73FECA8A4 | |
2776 | 87100FB1FFC4C8AF409B2067537220E605DA0852CA49839E1386AF9D7A1A455F | |
2777 | D1F017CE45884D76EF2CB9BC5821FD25365DDEA6E45F332B5F68A44AD8A530F0 | |
2778 | 92A36FAC8D27F9087AFEEA2096F839A2BC4B937F24E080EF7C0F9374A18D565C | |
2779 | 295A05210DB96A23175AC59A9BD0147A310EF49C551A417E0A22703F94FF7B75 | |
2780 | 409A5D417DA6730A69E310FA6A4229FC7E4F620B0FC4C63C50E99E179EB51E4C | |
2781 | 4BC45217722F1E8E40F1E1428E792EAFE05C5A50D38C52114DFCD24D54027CBF | |
2782 | 2512DD116F0463DE4052A7AD53B641A27E81E481947884CE35661B49153FA19E | |
2783 | 0A2A860C7B61558671303DE6AE06A80E4E450E17067676E6BBB42A9A24ACBC3E | |
2784 | B0CA7B7A3BFEA84FED39CCFB6D545BB2BCC49E5E16976407AB9D94556CD4F008 | |
2785 | 24EF579B6800B6DC3AAF840B3FC6822872368E3B4274DD06CA36AF8F6346C11B | |
2786 | 43C772CC242F3B212C4BD7018D71A1A74C9A94ED0093A5FB6557F4E0751047AF | |
2787 | D72098ECA301B8AE68110F983796E581F106144951DF5B750432A230FDA3B575 | |
2788 | 5A38B5E7972AABC12306A01A99FCF8189D71B8DBF49550BAEA9CF1B97CBFC7CC | |
2789 | 96498ECC938B1A1710B670657DE923A659DB8757147B140A48067328E7E3F9C3 | |
2790 | 7D1888B284904301450CE0BC15EEEA00E48CCD6388F3FC3BEFD8D9C400015B65 | |
2791 | 0F2F536D035626B1FF0A69D732C7A1836D635C30C06BED4327737029E5BA5830 | |
2792 | B9E88A4024C3326AD2F34F47B54739B48825AD6699F7D117EA4C4AEC4440BF6D | |
2793 | AA0099DEFD326235965C63647921828BF269ECC87A2B1C8CAD6C78B6E561B007 | |
2794 | 97BE2BC7CA32B4534075F6491BE959D1F635463E71679E527F4F456F774B2AF8 | |
2795 | FEF3D8C63B2F8B99FE0F73BA44B3CF15A613471EA3C7A1CD783D3EB41F4ACEE5 | |
2796 | 20759B6A4C4466E2D80EF7C7866BAD06E5DF0434D2C607FC82C9EBD4D8902EE4 | |
2797 | 0A7617C3AEACCB7CCE00319D0677AA6DB7E0250B51908F966977BD8C8D07FDBD | |
2798 | F4D058444E7D7D91788DEA997CBE0545902E67194B7BA3CD0BF454FCA60B9A20 | |
2799 | 3E6BB526D2D5B5321EE18DD2A0B15E53BCB8E3E01067B30ED2DD2CB9B06D3122 | |
2800 | A737435305D42DE9C6B614926BFD44DF10D14402EBEDFF0B144B1C9BD22D7379 | |
2801 | 5262FEEAFE31C8A721C2D46AA00C10681BA9970D09F1EA4FA1566B96E221864A | |
2802 | 45A24ADAEC63F61C9FD18376D3984449A1F998C318A8FE36D0D5020E18A49625 | |
2803 | 0F3BB603BA1F3E66FF412F6A32433FF8BD2968D79CE4273AD0E0CDDA5153C2BF | |
2804 | F8A46A2244F9394A49D339F763F5A7411A3C29336B21CCB01723705AF589B078 | |
2805 | 3763035411FE36AB5D744E81379106890688CB5BC41184548B7FEBA08DE7288E | |
2806 | E6570FEA20C51FACE8E8F824BB61A4A038AB817C47B87391611B77928B2565A9 | |
2807 | 3B27A573C05D36ED01D8F27CB2C793370FA9B90021B5696280A55F2CB6117B64 | |
2808 | 293EAE0EA5A243F56FD007773CA35DF71B3D28643C25210CCE25F37A5095D6E5 | |
2809 | 9CAFD99DD1DB0D7EAD454C13464DF6FF5DD42339797AE5AE467084550FC00139 | |
2810 | 6EE818C6365007B2FD6E26285B832CFE6EA7E99665A224C9813C036CED262639 | |
2811 | 3FB39C1F05FF8F31D2DEF37BB9B883334F51EA1243332FE1E3FC91864C8AEA79 | |
2812 | 16A726F924AFD84F2F4215FB795FC41DCFFC835C90B9E31D291E47AA4BB8C05C | |
2813 | 620F69DF31E91A0FBA8E217CDBFAD7C4D480EBC1EB396029CDE615C227A367AD | |
2814 | 72834BA95539D39A38EA0CA3CF7F1123F70792CF315BAAA38BBCB6DFA80B4493 | |
2815 | 5025F33C3696DAD6A0ADF584C71BCB1D29E523EA4B81FFCE15F3204022BBBEA0 | |
2816 | A9483EE8EAC07D581162672A0D66199174821ABD097561A263C0C0F24066FBE6 | |
2817 | 0951F31FBBF2675141F3FB4457CC2A94A40191EA0AB2A606CF540BBB8887B6DE | |
2818 | 715EDB1041EBB9D05D0F4A4672F534397B9529EF8743BE88BBA10C81E0A46259 | |
2819 | 2F2AA7B638E20C9C8A3A827977AB58ABF7525BE15DB66CE8E9B81457552073B5 | |
2820 | 85DF3FA70B5231C447C5724E14730B90FA35ED1B5723036F1658CA8E19EF5A6D | |
2821 | D333B78E91E4D7032EFBFD40A5A2269B0DFD9F7C3438DB58F94B507EB93032F9 | |
2822 | 99E5F15D9F5D8CB031BBBFBCA8A15A617ACEDDE70DD9C2D9EE21179FB17AD913 | |
2823 | B4BF577A9046994689D1BC6A6985FF5F5A67D699C2FD288FD9E5BCAD5453EEC5 | |
2824 | 68287BD7B8872726C28CD288B4DED2246B843577173450B6E5760852CF2E1727 | |
2825 | 01FDB0FFFBE12CA13ACF6434AEF4B59EFF3E0DB1E87D35075B1D55AC12633167 | |
2826 | 5A83A39056C077EAE6F2F7D1DDED300BA43830B8034F0A6AEC562D3023270601 | |
2827 | 6C594D0359DF6F230F7B80B54EBAE4880AF338956B813E3B8DB8BC778BE0F612 | |
2828 | 7D84939C2878B43EAA45BF10E257F22C28C2C148FF48843D2B52626148E3CAA7 | |
2829 | 4527B9F246C17BDE21C6E7EAB4906BB6D9E84906CD1832C4BD9E405AFFE33AA2 | |
2830 | AE086C25EA26BC23D68986639366B99C87359915EBB76D7162AA667ADE4954D0 | |
2831 | B1E18027FAC2468CB2FEA2568E23DBC201E9B6A1151FBF21129A088D89E3E728 | |
2832 | 28B2785C1A8B2637F368A93EAB459F80506435BE23A85396969E2AC4E0D6E4B0 | |
2833 | 8B12EACD150049EF8942C108B96843159D4408424394B33603F565D1622FCB78 | |
2834 | 00330551E05952C8D01D6B77BDF9B395EEC38BA6CF29DA605BA159C93AA7CFC1 | |
2835 | 86D03DDEA1C88962B558766182851A4B4E5DA0EC868B177BDA6D3FB0B8E901BD | |
2836 | 9FF2F5BC9D4D2737DDF8C96559C4A0E7578726726F1709A09C2E420823F6B53A | |
2837 | 9B44DE1FFAFC6E105C887050309530B59A11B6B71475427DC210181D49A49CD5 | |
2838 | C620EE0BCC09A206C90E2894669EC12E5927870FF50E0849E2E2B7885D7C204A | |
2839 | 28918B5EF93F7D8A5FE47AD4190DF3348B1E9B7F372E376699F727D6DAC59D6F | |
2840 | 562A989175F66D55F099E3621FC212AB6C2EEDF6B6321DAA777734BBC90BA04E | |
2841 | 0F6C6546D02C02EC0D6CFEFDAA29F3728AC9C94815A94B609AD7EB2AA24EFE23 | |
2842 | 954E82008CE6F53FAE7234423348A6E94CF6E22F4AF3E332D702A195B0D36477 | |
2843 | DADF48F6A003463FBB6DC396DD72DBC3F007ED7DF4A432BCBB12867B04467939 | |
2844 | 0D1BF98DC45ECABBD047397F91027FA81ECF39907B70095A28FA750E8CBA9348 | |
2845 | EF74CA986897122F5E1DF25347790569B3207167EE79141C01E6D567F7199BE7 | |
2846 | 0522AE7C432AA161A83811AC478D8F55D730B96B1D4BB2F50DF5FA4E9C16F95A | |
2847 | 155200B9B406526D05C1A33EA1B6D3ED723E852FCEEA4D77872860FBC2BB998F | |
2848 | E5EF409C708C5F1497B01BD632C41B63F491BA9D96F12F8F397C3C0E4A46BA36 | |
2849 | 33A9CF5CEE2CAA55ACF3823A120893D3FF5554DE1B1F5EBC33B3DF5194275847 | |
2850 | EA8C2BC55B285B393B00F66A3F171A21F1DD6CD8E71C4D93ACB3EE9F8B530957 | |
2851 | DD74644B5163AEFFCCE992338E406CFCCC23E9FB1FE2B4987FAFEE49D7F2A947 | |
2852 | BEC88F6B8F6770D5598191EEAF87737A69A0CFECEBB3CABC19AF1E67F331B5F5 | |
2853 | 7C4076FEA887C44A74EDB7DAE9BE5BC0E25B52825E166E3FFE29F8D9E6912BCA | |
2854 | 029AA5CEE2EEE1EE3848A6DE34D86CA3903E11A5FA8EA60C65FFF56091F76F4B | |
2855 | 540C5B437E522A354441E3D5444DC27EFBB63CDA3959622B2329E8C7E5703703 | |
2856 | CE384B9DD89DA4A3D97AE8C0FCE182C7387B37190099014399C8F94EAE897528 | |
2857 | 3B52B591725E32EC9CC263603990A2C94C85C979169F31A1B47AB0FD00AE3C60 | |
2858 | 046229CEBD812151B0B1651DC705466099F64A88764D40B4E7DBFE5361FAD73D | |
2859 | 29291E83D53F0B7DE595EF311E7EBE0FD3B9953DEAF8E33F571764C8D7ABB362 | |
2860 | FD9632E010F7129DF91AB58C0F9B72562F686DA51BDE657E68CAB6C5CC316C29 | |
2861 | ADAC2F00B63E62F67D28F8D2CF73279A0BF964B9FC9085CB93CCCD7B793690CD | |
2862 | 6F1E19275CCE6299EB3089F1EF286473228191FB5DE46966262CDD0001CB25F6 | |
2863 | 32FC206CB3AC71BF17F39A634809A503D2D72AF48B084CB7848A586923DE34BE | |
2864 | 9D90BE94E1D2F1217DF47FD55D3DF4679BD6BB63776F4DD2EB74D25ED7ACD07B | |
2865 | 5261A26615B8C46B08880D3D042E78DCFE83238017FB57BB0B11AC08708FA18B | |
2866 | AC3C645F2DE6E0825BBE507CCDAD2EB5A66D1C9B1A4EA1C22E9A186A4D266625 | |
2867 | F65E2E4956D78F2FF5C6E07D79A7701CBC6DBA6D7B370F2CB1D8DF7FC5C217EF | |
2868 | 903579058F26B251ECFEB873093DB1E67D2DCD3087A28D9F056E750C276DE42A | |
2869 | 97C2393EC37B70D21B2415D754911BCC6B361A16E6DC0BC7CE89762BB1CF8F07 | |
2870 | 4464571FCAB29F29BF5D3E4245DF60164E657F37C0809972103FA09663F397B0 | |
2871 | 15FD59BAF59AD8314118BFBEA0A42F8C99B5A376AD009E3834677F0D74321F6D | |
2872 | 7816F94F6E66C56DBBF0F16721ED8BDFF9CECCE7DA91EC3FD945FD98EEC90C85 | |
2873 | 0EB836966EFB6233538C28B222FB9752C3364C6EC347165EA2E18C2EC4FE32BB | |
2874 | 27B158CA196E4078FE6A01FC09DB419B0CBB6585518628312D53C471CEF69E68 | |
2875 | 48F22A64CCF75DA2EE5C624A118EB52F4D8775228922B65E9A9D9108D2CF4B1B | |
2876 | 696EEDFBAB4A917179089C29D892DE323E983FEEC70E57D071E186021CE9602B | |
2877 | EF326A933BD677A4E1CF275D78CFE1E9F0B94F8BFBE06920F605BB31CCD8C5DD | |
2878 | F730870BBD567D53AFE3526C589B68A68875A0F6DB65F7BDD5D722047C7B0CCC | |
2879 | 229D27C0E2B56E47C95C8FC174B08BC1853ED8C1A9D91DA9D0CFE9FA049D77C8 | |
2880 | D27E017C8EAF54C7EBCBA32F7DD3FB44844A57C4E06305F4C9B64B7BFAB4D7AE | |
2881 | BED0EC1C3C3593BD768DC1E820A7265B9FA826A7295BC81E2AAFE420FEF720DE | |
2882 | FFDEA87CE4E58CA40ABE280ED790F00D39232538C0C59708098463D602D93BFC | |
2883 | C02F709EA3E033C76D7C1EF396083E2FD93AF713FF79D6F8181D8D7A7473EEEA | |
2884 | 4897AA7C68F2D33BB963F91F46E36A40E6FAFB67D1C65E03FF42BB53612E8DBA | |
2885 | 2E17AEE373E5409D732947D75FB2DB6AF863D96393B4072187AAEB720DEE98EB | |
2886 | 7CF0B0B631F7AA75D26B451C6D5E559DF79D44C614F9ABC3A78A68B1392180B0 | |
2887 | 04622765735BE5BD54600A612B09076D975F46E11E8C7A1CA41C318A627E7AF0 | |
2888 | 6DB96ED1E9E550078CF180B09AFA5E94ECFFA4C6826454A3D4E1C580E728EA4D | |
2889 | 7963BC6EB15FDB223DB7162D817EE33F3682D7BCF2A943616838B9EA417B8976 | |
2890 | F4070366DFF22019265C30BB251DBF0975ACF5FF73AE1D7C39FFC9269775DE33 | |
2891 | EAA2E3AC5E180D5B4262323782879EA4DA51516E607893B4DF1A13B9366C710B | |
2892 | 855BF8354095A722A0E8C8482716C950A855C1EC6A148EF354417D28DFA07126 | |
2893 | 711D2588BB27D8AA4E0456E02BF8B51B7D253C60C01FF59AC57DB5C8CE4EC7D5 | |
2894 | 2C4DA1257EDADC8F7FA3D0FC93ECD2832671C2A55C05DB5AA7F312B3A6C34973 | |
2895 | FA0928A452DC18D9CAAD07DE7D80867A40129AFD28EDD3249991FA538896058B | |
2896 | FCEA5768DC046796EC6CAC9036FAB816DEAF1FCEE746B2EC3D8855DA0A0D1EFF | |
2897 | D349151B13F85A32CF849F8FDDAC29D517F68E212E5596F1212261B23ACA33A5 | |
2898 | 31D745FB4FEB3F54BFD666AC661D9F87B8563BBDD0B86FFBA9A629CEF10FC074 | |
2899 | B8E22F40C62E1E51280646655B7362AFBE6549DB21148F694F569FB2610A6441 | |
2900 | 2B43F73766D0C8887DCCF6B89F25BB85E94D59E4FD7C48787CBE33BFB15C83B6 | |
2901 | E3C4BAB8903D16B544CC5AFACC08F89D7E312C1DFDFB3361119C21FE80F4C4D3 | |
2902 | 3224FDDE9062885B67CBBF4A736AA7B20CFD9828C74ABA7EFE4E66D403483C6D | |
2903 | C244C5DCBE07A2829F2C1E49C30DFCFFC34A847442163279DF034255EC660EE5 | |
2904 | B664F09F9561DE4D8AAC4484A48062972F5FB76436D5FC1A3EC9A54D7DD3DC46 | |
2905 | 53037E1009062463D084E9131E605F26E8877D5E36900C099AC5E5A8A82863A5 | |
2906 | C4FF988F1F54DC3E97BB2A680F8ED58F76442B4AE9232CC5E9839AEB31824C5E | |
2907 | B63F8881AAA55648D0141351DECEB681877FEBA16B59B760596F3A53B4928EB5 | |
2908 | F0FA3F6EE26849DE99907D71A942F9F13D0F6F6B2C77543938339A064ED2B1CF | |
2909 | C0C4D420D72523582AAC915D9FEF0518951222BF71EF72F0E46EBB68A19C9644 | |
2910 | 11A27BF23958169529DC8A2AD216DD89D89FF47E767998C03AC3F85861E94128 | |
2911 | 972FE775F64D78DC156B8910552D4CC2CB533A18DB2D0FFF3BD8ED38EF27CC88 | |
2912 | 93281D84BF82CC469A89EA63DBF00BEB03F6DEA03D19D1E477B04587E3558B38 | |
2913 | F837D4479ABA7F16966CEA01E54C70678FEF81258481FB448D0DF5A68711E0C1 | |
2914 | 261996A25B77AEC76809B1E43FF01D4197FBAFF47D16B1F2CF805F594A0A633F | |
2915 | FC91B5AACEB32A162AB522A490C3DBF0A4CA85BF29EE489BAAAF9EB8DAA04498 | |
2916 | 711C19FC9308D517CCCAA224B31596706BD9402B94CFE5D618B742CE1A418E7D | |
2917 | 7F3222AC04B6A511CBD90BDF5CC9E47E3963C97C5BA77A71A5B05CED9E86CB2E | |
2918 | 5D77AC74F5F7C41D8D957C881321BC6AD6EDC45F022D4B9981B361CC8BD83475 | |
2919 | 1691EC11496800BF5051A97F95A8A723CD352A04BE99E57FB04B4974B32D3BE4 | |
2920 | 656CB075C80EE9790F06F9EF05EC8440456A01584A56DB18BBCAC48AB3D02B70 | |
2921 | 2900A908465DE2225DDEED8CD32A9A80D671CAAE386F73EEB7BCF90D27028978 | |
2922 | FDC638E7CC6E0CB90230AB5E3AD3AA06476A9F7703DEC2967E80F0D9E94A1936 | |
2923 | 6CC8FBE9A446EBE6B31A8DF89ADA1187B89C7CCB051369E6626F718A297371F8 | |
2924 | 6081FF9B597F4B13D0AA792B0849633CF72D82CB7269AF97B999769031CCD1B2 | |
2925 | 8E4F037259F08E7D6B2D820F5F65F8AAE7EC0983377B883B16DAA9613C960D61 | |
2926 | 67C6B7AD02C62CBA505F6B26C9CD43D3E2E82FAB30DDD3929CD7206DEBB0F9AF | |
2927 | 84FECCB93ECF13878368D1A3D4141C67513A50C16D5CDB20EF2D1CC293928069 | |
2928 | D2C02E28C363A3E2F13C14901C3AEEBBF4019135AFAC3E5065351E0EA91FD39F | |
2929 | 03AFF76D68AB384C754BEA597CC5C148A29EED791D4370D999EAC2F54ECCD572 | |
2930 | C67AFADD474D5973907A843D0DE7107E5C14A0271126A66933CBA0A62B6686B7 | |
2931 | BD075C03B8B36181C9FD2DE1AAF841E66CEA8B706C84F14B45DB5C966AC1CBE8 | |
2932 | AB9F51330510A6C24257772A63E9FE0108ADB557C7AE17C89F57DC38BF81C482 | |
2933 | 3292DC03EA0E2033AFDC75681B975BD55A7F89DBBD0ACA11AD6F4381F6204289 | |
2934 | 3C0628C3938E3E533F2757713D047834D2F74BBEC8D29847D3C4C062206C3BA9 | |
2935 | 7C005CD4F4119491EEE3370D1FB4FC349CBA44647AA72B10DCE0335C832BA484 | |
2936 | 5B963674F092DA2BE6E19462482D31F77B1C69BC819CCE14B4413957964189CE | |
2937 | 98FE7560C575C007FCF6D8B9DE8C742C76294D8662583560E1694F609DFFC7BB | |
2938 | 0B18D9E7354A1204F4A2E58F7031D7FFDB60EC974451CB657356CB1D9CBF65AB | |
2939 | 4D91F275DFEA4D49EC1DD476BF4AD8B33778CBA59456A3C89F1530234A5035BB | |
2940 | 3E36AFA409954B1451BE27E6A73052419B1FA2BF4C880FD664C0CA486B8BC414 | |
2941 | AB5F5DF1AC760079FF643D4AA1E9C044502C7D34F625771F6C6699B1CC4758F5 | |
2942 | B041EEB19E919155F5444F1E2A3C8104E80D18FAB1CDAE66474129E792CA285F | |
2943 | 2096BC90DD37B394293E799031126C9BB7D1F436EB7B2695CC8132FD95CBABE9 | |
2944 | 573A56FB129A97458CEC07683315ED4DFAF84033ECDD7FA77E000D36256C4C5A | |
2945 | A8E61878065D555C9C6D085118D20E0E0B211000725D48AC785CF52EECEE0B83 | |
2946 | EBDE306E95B03448E68A65E89CF66E605D68A51587B46EE39AC733FD7DE618C3 | |
2947 | DA6FE3243753645256EBCE05029587EF9505240E07CBCDFC7E976F9183E3CA28 | |
2948 | A1157AE7D0C201360A1BCF23798B243814ADEC4B617D064ECDACDE6D673360E0 | |
2949 | F3B9A166F61345BD6D85AC42D251E4ACFA83BA7990424DF293234CCE443B5FB9 | |
2950 | E25FC59D2EFB5A240913BD1D1D950B1983562A9BF18474F3AD6FD1FB110F1E5F | |
2951 | CA22B56AC544DC576FFD31A6E3092C2AE4E14F742A349D7C51EAF98364A9B1DB | |
2952 | B259D6FC5BA5BF9286F31026A7CBDCAAEC5B3869554A05171CC648504FA3D782 | |
2953 | 21DE731F39017B40076846129FB8D25A47851BBBD03645AFA43104A66E07A167 | |
2954 | 94E19867E8C016ECF70C24D593815DA93752E2E84B96C3C8ACADEF7A933BC57E | |
2955 | 3FF6BE85807C13FA68327F991071CD6F2B5767CEBBA75B4966FBFF4843ACD1DD | |
2956 | 28995BB456C8D4836A7B5395CE5134CC447C4695356335D6164F235160BEDEFF | |
2957 | 90E431DF6D10F9CA3B0968FEE23AFFC04933F8D1F8B5640FE34848A672C35076 | |
2958 | F4588C04A916005362958DB33E2DE22DBCFAF495E46CC5A5E4FE607ED07CEAEE | |
2959 | BB7A5F523F5B88C6BD54C73D6805EC51E80F5876EBCC353DF1C0893A37F02B87 | |
2960 | C03ED3439ADCD2EBDB3FABA6358E7F9225238A56541C9D8B285E07EC6B92A4D7 | |
2961 | 38BBD0FFCBEB36123FF69945B0C59C053A51841DB7DE08918D27DF0C9547E2A4 | |
2962 | 5C6B72878148DE3C0E120C5D6C3F82B708E9CD2908B8076AF772FB050EEAAA30 | |
2963 | 129D7EB87BCF3F693E1328FA94CA0263F14EFD722C58A9B87E761D947A920779 | |
2964 | 63257BA269148683377E55FE27F99413D48899F7B952492FCE667183DBABBABD | |
2965 | CD2716B316DE06E606D4E6DC654B137AFD56C90FE8E6C72C91028A83583FBEB1 | |
2966 | 33A129ECAF6849EBCB9AD7A8DFDFD32BB4486E150D6F4D1381C07F4686BE6A8E | |
2967 | C297DA3FE9443943D5C8C419AB5A3ED919E0B22C4A45F1E61BD33EFD1BBB609F | |
2968 | 15DB256670C85432A1F190054303003128643C25213C9C988E344AA219E36945 | |
2969 | 2201D049084234E69BA29543860A0F1930E6BFF21305F847245440EDFAF8CFC0 | |
2970 | 5C8E01B35929206FEE61707DCF115517577B6CAF6ADE359D2935550941CB741B | |
2971 | 9F15C25EEE1214A2796FF5E13B9018E3618D41F6B3A3F90728F318EDE7058E3F | |
2972 | 89B073A9E70E15FD9DDCA998B8D07B802478CB5289348F46C68173A32D9B0B46 | |
2973 | DC560471B8A48F652E942E78F520AB36B13F8B1F8361617D9DE4E639B85FEF10 | |
2974 | E81A944EB5AE91BE8F58D22F9236ACD43B0B00088C747CBC10890E8440E025FF | |
2975 | 8F9B489B9F7B7BDB911591792940C6ADD30E247280122D2045CDDCEFE3E98439 | |
2976 | 22D4D75F42DF135C5E341F6BEA914BD45FD29876C3BA23BA910545669F636647 | |
2977 | 5F098E7798F2268788B03A0907E653DD766BBFE61BC544D37388D1709A239A28 | |
2978 | 1CA12BC80F24E38D40B197B12460798F0C9A4EBBC80F0EA9EF5858DBE81B57B1 | |
2979 | FD7006635215E7F985BCDE7A59009D9A3EA2D95ED2A8369782BB1DEB1E033244 | |
2980 | C16FB707E95EA293593A4271EC372835E2FBAEC067160B3CC7D31692110B9523 | |
2981 | 39CCB82C6F7CC74B0D6F789ADC5248D01D5F1E82BBEEF82B9993622CAD459BFF | |
2982 | 5EAAB41982FFCA324227779F869A76D157DBAB2C70D8C371FAD498D5A22ADC12 | |
2983 | 5A093E7BB63E6918EC5090F1AF9D39C9B68FFF5C4B88A8E864F96EED5564BD91 | |
2984 | 8F407BDF6318E2EC6D850092E6103FAAFCFD450AD5094E23BA68C2CF181D2CFA | |
2985 | 6392A5A15415A309371E3FD98772E2534D5B214726FE42E24DB99986F20B8B6B | |
2986 | BCB57650B4504DF9C107FCC4E695A2E8A2DDE5DC5A05A26AFB33712F8AC2E517 | |
2987 | 3202ABFB245EF5BFF4C5D7C3C0280D688C0CA04DC283E178233023D9C97021FD | |
2988 | 336DBD040048EE3E6A87249F113DC8AE4F203B1AD6D350955D84990A860B23F6 | |
2989 | B8968F0B68DACB0BA456F26723DD9B87CA4C128276844BADF062539FD19311D9 | |
2990 | BAC598ACB475AE2FD8A96510F0DC5C60120A33FE0B6DC34341638EA75184E4BC | |
2991 | F4F681C9464762224A73C22F637D881BD6A01943D5A3D3ADED72551D2124EE38 | |
2992 | 987A9BF1B596D8871D8990EF361310FC81CAE28F9E8D9A05F4D432248C7A7E3D | |
2993 | 3F211493334182D7A44540E24A6F716E785E4CCB0E31DD2CBF99387DB4ADBCA5 | |
2994 | 2A1FF7A0676A58EC6E902D1B9C1D59B3ED82451392F8D93D461005058FEA44CA | |
2995 | DD0FC204958134D67CC2F547B8A1CAE234AA7C789AD515C7331552D59813F306 | |
2996 | 49C17C81B6876F43E4161C4C2F51534FD8FD9032A0FC80317B200E8875C2127E | |
2997 | 7D4AEE9DF1B81ACE6CE4C4C5A76092E8528DD961CBC9B7C23E853F8627395781 | |
2998 | 932AD6C0FCEB397B7550B43E9F12E330DAD88D7AAFDFD36F0473F502E563D66C | |
2999 | CEF6EE1100EDBD2C8B4173CCFB8AE19C8C981EF20D56F693EA5B661B94F61785 | |
3000 | 6640112BDFB1559D639BF14DD1EDBC49FEF2FA3E8D61AA9BF0FB545DF8C89048 | |
3001 | F036D83A1AF078099E3EBA246EB8140FC8DF5CB75B0D2F7987AA35CC2BA1CC63 | |
3002 | 386F339C0E762A4F4215A3175A4D93322F6C73742B2022AD1524F29F56C32C23 | |
3003 | 2FEBF56FEDE4C5883E3C3552B3EBDB777D852558D17C21A5AC4DE320FBA7CE93 | |
3004 | 10F4D37C94F6F85C1EFB2FD31BC49F5958142BEEEF277A76865666089FCD68A6 | |
3005 | 53C9D945A4D2BD7DC1D532F53D635ED808D3FB0E79890494262B380DFAFB385A | |
3006 | 16EC10A1CA5BDA07787BCAB77D9F56FC2B03A1C500226C4DBB7829B875284602 | |
3007 | 0DE17A3B52BA701D24CED02C433109983769121182177EB3E5D579A2DAC7E42E | |
3008 | 376A65997657D435EF8D5F67101A9C6B6E11A1F1D1D1BCEC3DC37DF1D111CB29 | |
3009 | 02D1124747CF0AAAFDC4DF3D6BDD23858C0708AF09D1EE6B8E53B6DECB0EC43E | |
3010 | CFF549F348290E1F53FCBAF6288D614F2DD291E95CD5A80070B0455C422BF31A | |
3011 | B93580FDAC4FBB599A8800984F75170FAB0BBB4790DF4E1B2C087ADA4A15BCAA | |
3012 | 06FE319FE4715E721691D3E230C57DCB7B9285FA3C0005BA9806BC9AE55224D5 | |
3013 | F501F1B43A11181B263C9E12B16704A7241B17E680B3B69C0219E2390612A43D | |
3014 | 081FEF00A897C6EE3A06F24E24253D4228C7B86F1C13DD9B1791F130B455D833 | |
3015 | 11970B10412BC386A5969A00D65DE09BC14D246E40D88B3A066F2C958D2579FF | |
3016 | 72FE992616514C8CC5CEF074D1A20B2032C88B14EA66B2A7062D996098CD786A | |
3017 | 1112F1E9ACF2B9C47FD7BAFC0078DA49F915BAFD32988D086127969A7069BF98 | |
3018 | 02B2D0002CF452500FEE691E042911946874B6D7FE30E7AEC280A0BFAE6DF67B | |
3019 | 17623B633107AD4F4868B3DCDC82CFCB098C97A28B9640D8933EE31A875EF639 | |
3020 | B21B9E9D50011B8CE5696241802BD18F9A76F7798F9CDBCDE5A5C6E6C275CED2 | |
3021 | BD1F5A3D1421F14455F363C60EAF0DC65BAB9D5D33DC0BAF346E1EF7CD5B1E11 | |
3022 | 061AEE11D0309FDC80F691389312A17DD335496E916BAC06AF60D5E0045B2CD0 | |
3023 | 4889A722C581F42AD54D4A9801CB4A50B21A39ECC7A72E9DCE0C8EF26EFECD24 | |
3024 | B70AD3BE3A57A3DFA294C8B35CA9C4103E63B53923B2D9C749D7A75A0159FA9C | |
3025 | D0038ADC336B78CB3D1F63CE7908A69CF18DBA3F503CEF844022CA366AC8CED6 | |
3026 | B1A5C4F4E6276D2D1C03898495707086DD1EA658CDDFA69A5850C4C00F2B4A24 | |
3027 | 089AB4B6A91B9018060B20BC8EBA00919EEFE9E845C8376C94AC35E30C140EA2 | |
3028 | 9CEA7C0BF0A5ED1C552C2A1458FAC076E8390F88E157DA1DDE5138C773022376 | |
3029 | 0E7CBF3F2621E9620CC1A0D4A03835DCF3368293F2B1A820A3DEE998A1FA7AF4 | |
3030 | 7DD73D6B790F6DF789FE29906817F21A808A3F96F45F68EA841AD5600456A270 | |
3031 | E6B13F573797942F51F08E26309C3EA859BB4A8284CECEACD522FE6F5236E174 | |
3032 | B244F493518AFDEFFCDEEBB2B272667CE3AE0CAD031EF9C00F01CB740357630E | |
3033 | CCB89A894EED041358CC5E709976D5B5532F775ADC37533CA06D114E689B8E28 | |
3034 | D6B282E9098BA1A0C60D5090F630752A2220BEA561E951FE7B4FA1B4862C2787 | |
3035 | 2BA9DF98AB161BC0F71CD8BCBCA4910CE692FC321303892419B6CE1EC8FBB8CE | |
3036 | A01F550638020E1416B638F618F484AED3F0C6F9DB6FF0B5E43808C5A5411141 | |
3037 | BB67E24987386FB84ED503DF168FDF5DD498AA151727AABAF57B9069244E8F1B | |
3038 | 315011AFE51D846D6223A6988FECE00B8A871F047A33DC87A3F896E7B7EDC7B1 | |
3039 | 9E0198F35AD796C8AA6E65877E9B8364E1B08ED36469D35859C8F8D2144BDDF9 | |
3040 | 097A38D8DB6F165023B93DF4CAB8BAF62A002DAB367311FFCEF16A3644C93097 | |
3041 | 67E553E015799D4EBFFCE4877FEC09A99EDC169D258F70DEF8B03C99B4DA93C4 | |
3042 | D026C1FD6656B46A2B9BAAD12ECE95CE43E91B02E1C7C17060A083FD6EBCF506 | |
3043 | 89D27FEC0201CDCB33224ABEA32CFE73DB2594DC15E8EF564E7B9F66C8C52747 | |
3044 | 95A4BBCC0CF3D3FDB5F2CDC4C8B532EFDC4113A63B54500541BD127646FCAE13 | |
3045 | AD58095D2C65182941AA783EFB2C627F2BE24E423C7AE0C323925A4AA124CC85 | |
3046 | A65CEE1F2B9FFB73B977D8D0FE829B649818DFE26667FB3E118EBB24DFE74F12 | |
3047 | EA03099B17C2A498449E935DEA064AF19B32EE8A81934AC4FE2916C70E81DF39 | |
3048 | 65B37773E57C0C66D468A860E04852EDC436ADFC0F7F8C9AD6B3BCDACF9E08FB | |
3049 | 9A5C159E0B335E080F6F51BDA7F53D1EF45B5EEF8647970D19AE63877147693F | |
3050 | E7C9DD6721CBE6D954A4B784060978BB0C69A8F3FEBE95FF6B48461F7E50DAC8 | |
3051 | 236C408E8BF692596EE3D3BAD30D7C90407678594FDCEFBB01C3545DBE5ACE68 | |
3052 | 32A7DEE951D5BD1C728EA22990BA511C5240E6AD578D2E8589084E792E2332D0 | |
3053 | F22E1C1C691B9F58D81F999AAD9BB89E16C7A172BBC787D2559A6FD4AF02DF10 | |
3054 | C7621FB38EAF47450633592F350E55D068E248BFA3716666EB2995EAF352838F | |
3055 | 6B43C56C6AB4D1ACC51EFDBE3CDDF2707F423BEE10778809468B0B298F4DF228 | |
3056 | DCB3C2FCA77B53749798BFA306E85C6EC23CEB468D07466D00A73FD16F85848B | |
3057 | D4806AE5BEB30E2B9259FDAF28588F6931AD231865526A82CB52CE85F8C4E55B | |
3058 | 5422536B5B37A58E5CBE4D082A80565DBF727F78282E5BA118E7EF61DA240A48 | |
3059 | 2DF41F320E5B8C16EBE8811E5ADFCEA06F031C5EF40C32A4A8673067F3D05BCD | |
3060 | D12423D695B89FCA8BF9974001E3349C4EAB5E47E0E93AC884BD3900F382DD74 | |
3061 | 583553446FF13995555D4335D6A5BAD8A81D9183B3CB4500AEC276234002190A | |
3062 | 79F3DB3682974A55AA45B8611E8E4256EBDB74DB1F43BF0954D32293B9E74C5F | |
3063 | 3C7576A1DF054E75AC20A0F77C1BD50A92AD0755B7ADEF119A47D9281631C244 | |
3064 | 3AEB8745F8B768B6DF18AE893B6C81788EA1F4669A1FE024E9BC91715221DFC5 | |
3065 | 01C6F01CFEFFFD670C16ECAA2C21A635341A43F4923BFC4284D71F88533C63E2 | |
3066 | E185E405851DA5A73EC49F6BDDDD1210D90B330A5899D3BC37BF7629700E6C69 | |
3067 | 354E61BC87B45477BE4B98C03A8F5360A79E092F5FB7A93D82C94C609C0C5B97 | |
3068 | 1CD4BF3CBCF553462BE84671F4E0A4347C7F8C4FC793197AAC17513E15CB7321 | |
3069 | 586620A55D501D00120CA1C3855CECDA6BB7C80AD901ACF86EF338C9BD0A3CD5 | |
3070 | C68C7FDCFEEFA3A397C359D91AA1F3B32FC133FD54A7DD6034AB963E8E834A9A | |
3071 | 3CBCEC6D3E66B326958EAC8EE6E2992FD36D3F4C104EC7C80A19B80773C6BE99 | |
3072 | 5C69EE6DA0B2ADD514B1330A78B7C4FC361C8F7262EC74B22F2285B864266EB3 | |
3073 | 4A5951931B6E40635D27D3A95549609241B86F650DE4EA77EC12483ECA2EA912 | |
3074 | 1FCB113BAD6D3AD003FF51340043D39ED67A4E3AB48CC8ABAEDE295F9911EEB8 | |
3075 | 96F169EBB43F80665D8E2BC62E17BD752FF9FA78642500177B00E1BF8478941A | |
3076 | BAF83ED4D53F13165CBE9B84D537D5D65E1C8768B27812A61DF8BC8232541AAE | |
3077 | 77A19209C668E201BC23CFB2C8914437BF3B15CDDF4F65A9AB4A9BC8354900A8 | |
3078 | 10B14F217E81324083626E760CCF0B09A8EAAA701749867FF69CD8DF4C0C8229 | |
3079 | 43C58016CE1F9649595DE4A8BDEC2D1B06F4B3D4FB0F32055A66FC917A1AA7E3 | |
3080 | B42D9F014EC5831532E4E1AFDD7BE18C9834300D48FF476D2A5D5511D344EB63 | |
3081 | EB6014E883C9ACAC1F79CB671DFB55B0ED4404B555D6C6DEC091EBE5FF5FFCAD | |
3082 | 8EF6D6FD105ED2C15BBD3D22F5E2A1CCAAF7C0C102F3E55968C9D7F308B298F2 | |
3083 | 042BDA17F4827850B2255927A67D7C77A51F83B869D171A27FC60E622CE3F99D | |
3084 | 44403C9572D583BCE449A64289B5A1D24CB3CB9044427DCA7ED653F2470FE275 | |
3085 | B97A890E17777B3A2AC27781125440337A7ED2D49897466B6A3B5348C013B879 | |
3086 | 398251E2C69AB29183AA581EE0B9C65B459C7AB5010A9837A500600C2F24F8D8 | |
3087 | F811A719468C3B0AF50EA90CC7E39488E95EE556A5E77438C43F757FF92BA2BB | |
3088 | 5006340D06139608D9A6A38BD61E61FEE01277BA739E835FD453575CA1B5995C | |
3089 | 5A50B617B127CD0D03980919C0CEF8BE085808585CC7B8EFE1CF7F002593D677 | |
3090 | 6D83A5E09EBF5F49BE4EE35047C2BF6E65FB640DD841A00CBE273042B38E2A16 | |
3091 | 3D529CF43EF4D3C5A9E03A6499BFCA8D7387EDC499D9B914EFFE78AB2BD08EF9 | |
3092 | B1B7CFA34B522A28A66C28BF1277EA53EC78D599E4A7F8C2F77BA622EAFD6518 | |
3093 | BDE03DB16D00D6A81AB5ED23EB1D83D4E857B07FDEF93C52219B04F87C9738ED | |
3094 | B32CA58800749953696271604A7736605CB8EAA8CC84594A7E5338A4F97E60DF | |
3095 | 35172668DAA235EA44404B97E2E010468C08A07AB4E4852C5B9578F07A9DDD58 | |
3096 | 6113BBA937088BBDCE82D20DD292E3FB139AE178D3548B66297DA4E1488C340A | |
3097 | 225DDF131F6BE565C153A7670174FD9E3F61B87EE3ADDE9C5B2293C004637A1C | |
3098 | 62166EEB161C837FFB0730B1645C01C6B192B781F1C4BDEA0A3ED9D98270FD93 | |
3099 | 94C1C7FC7361FB15C30BBD45AB78AEA8B8E298D56C48F0DDB6C99EEA94CBCD2F | |
3100 | 7D6D3B54E6CBDEC56683D28F613749D516BAB9FE1C2062BB614DDB39D2FADD5B | |
3101 | 3111C9763B201E416B9E378C8EC5C99F6ACBE9017E712769D97639CD44E97E4B | |
3102 | AE9CF83D6C92E804B427F6BCE8E662C2E3E0E3848A9FC7164F99603D47F7438E | |
3103 | 8BB37377662FFC325E475CD2008CF67DD9D2F5C73FA0673E8156051A34511C3F | |
3104 | 357318865F53C486CDDE9257903923B877C457587A5E53162952DD3C803A6D62 | |
3105 | DC22EB72B362DE0580346B1BE72DEBD91B50131C5F68CF4FEADEFB18E379DC8F | |
3106 | 9BB6DECE1C15E739EB4500C86896A5BCA045B114C36154F11EC1CB31B4E9A267 | |
3107 | 415331B68B92FE68284CDF648A9C3D3EA08E718DBC0EE742FEA192EBA63BD40D | |
3108 | 5CE6A2048B564B92CBB411036D66FE76C9FED37602102FF3F89BA7C1ADDBE03E | |
3109 | DE29D86197A79D938200ED3CB988E30EF612D41D964F1F88EAF2BB18CC924A85 | |
3110 | E5993C07BC003C2CCC6747A9FD651523EA3D1A624530F2DB0E3C8720CC399DF4 | |
3111 | 8FF3585485C4EA7F3E16F6B3564684BC84CC107C933B4C38B3C23A1B790713DA | |
3112 | BEEE1FE5DA79C93CB84AAF800A68F8AE79FBECAFA01D6AE59AE2234BABFEDF0F | |
3113 | 0E8D5473B56C41AAE49C9DCA4EA50B16CBA50A2E92DA0CB5DCF6A917A97277D6 | |
3114 | FA120A7676E9FDF5C768686EBC3268214371FD2FB186968F8A4B61242B4B39C2 | |
3115 | 0198BAB835E632DB42974319B5EBD9669342F1F3EC1E49F3AA42461C0182C7C6 | |
3116 | 1F0707AB61E448A966698F2D07994CF77A982031466E8778F9BA2C85DD8FE339 | |
3117 | 95BDA5FD9DD9E9FFD1E1CF18D3B2F1048E4B0849E92767E83FCA8CA1CE85B9ED | |
3118 | D2F8DA34E13D2A44F6311C4FCA04FF75E1BC9C72041A0AA1DBE45825B9EBDC3E | |
3119 | D234C8FE32CC448B9B8A3AAC6BF131D536A1321D21D0733EF62F3237709B77DE | |
3120 | 315D7FB3E52E2AB94AFA14F0C92F699C89DA8278D93DB29DD6D5B390FC9953FA | |
3121 | 52630F9E74F340890B299EC8B1A6531BB5D4DE78897FF8EC1215B84B0B30C709 | |
3122 | F4DE3F9BBF8A7240B739D860AA9C159484DFDDD946FC71987C16A105DD44BDF0 | |
3123 | DEBDADBDE3D10A72B4FB3141D262EA5D1090934DFB40B8E2A53A1C817CB8C708 | |
3124 | A101B0907DE55FE007FBBA36FE644B0AE5C28E0385E13B9CF57FCBC7214113A6 | |
3125 | 0554115E85A47F8702CA04A05EA149DCA460D872DB78669DBE0951DFE501C2A7 | |
3126 | 9056C2A55F432B8E9B13523AFA2DDB569B854446FA5A530B8D2AEAE92588D36D | |
3127 | 56012B7C82916AF129712003AE4E8E850EB46227D677832578622FA5A55793FF | |
3128 | 6F9439674DE166C9FA586C8877B4A93CB9ECFA21C26A86E1673C7810BA529547 | |
3129 | 0934B328E503A49E4CBD88231F29D02EFE40E47D51BD79A027F55107FF4A3BC1 | |
3130 | 69A45161A37C9158B595BE3BF540F929F8A29ACED690854B4C4ECB97670CC263 | |
3131 | 83E242F32B1B930D5FADC52CB1AB3E0E0117716FBCF419E96BA3799075DA5000 | |
3132 | A8206C5D0AA64476FD80D9EA461A7E5588AB51879AB782D524598B9D1A0C25FC | |
3133 | 46BDEBE7AA35D103CB8568FEDCA4A66006ABB0B9E42D3F9FC53DC343B4E56FE3 | |
3134 | 382758F171BB4541756071EAB6FFC31518DD1B45C971138D2E6BF0B98045FA2C | |
3135 | 8D5E5F1FD28DAA0950A2E2CDBB8803939388D3945A56D8F9E9FC1B3AA2A9A418 | |
3136 | 9ACE9E76BAD82AAC330B8F0816F8FAD26CF66489498028D7FBB03889263F6B2E | |
3137 | 6B766A11AA56A4F0C719363D168B3873BE6D8922957AE6D57A868CCC9B262946 | |
3138 | F65CE35C3043E3E8B5C6CC40BFCBC30A501E152340CF1EB75C57CC972DA5805E | |
3139 | EA766382478487E412FD33D7EDF9E00926041C7840F4C986AA1CE59F8484F62E | |
3140 | ADBA0F244E32990714EE644D7C8A689DE876F1BC166CD8FE59768D10CBCD2425 | |
3141 | 1EFBE57E249C183407261094F6B58AC225F695E7A24508FF270245DD05683E64 | |
3142 | 5EEAE9A77C90F327DE9DCB1DB242476F11EAD3F7348A2712CBE05622505A8DC3 | |
3143 | 7A5C032629C804047B8D3A2E752BC6D9EC4C930227EA9B27AC28E5B9B515B866 | |
3144 | 44B177ED4D46DE42751CE13EE826F98A4B964E3C6295C58E1936F8211CF4B483 | |
3145 | BC74ED74463CF98AF1EB8F50F892DB7F66E64DE51D306DB67E9D158412D5E940 | |
3146 | 0BDE560C0B2CB9BA1974EC56979678455A74ABB0E096CADF110E7045B956AC95 | |
3147 | C10278C5FA3720BA56F4F8C0547E526482B40BED3D2B9AAA9B2B625FC249D0D6 | |
3148 | F5338247B706A69C6946547E6820E5E8FB56CD83CA9216A1E5DDEA8EB2F008E1 | |
3149 | 9DBE852D06D586271AB7C7CB92C310DC3A26DEABF082CE5777011E77E001AA59 | |
3150 | 221E14535634DAC9EEA02841DB7BDD3A1EEBD9D630DBAD037F62B7C151CE666F | |
3151 | 51C8911B1E7F57118AAB96F465F4CE7E8AE9ED9E8F91047944342315976E47BF | |
3152 | 8ADF6A1266F3FDCE43DE8C2C770DBB2EA74EC55081171A5B5CA88C402BB976DE | |
3153 | A049C29AF9202710BF665C74CDCE4E17F4BAB05A2A0CF1D6141227D792123DF9 | |
3154 | ABB0422CBE1A20DB23C3BFFF699E51F858B35D6B679CF3D7A5DE0142EF0E87AF | |
3155 | 8829ABC6AD657D63EE703C1F4F3AE149E9A15C17905C280F6DDDAA2C4CCD0E8F | |
3156 | ED862C0F5484DE9DAC5292E26761BFF8788A03250E3143238CBF09B807A84285 | |
3157 | CEBC78E4A1040FAF5E29CA92CFA0E4C8BCD3517E86153F5759D2D31E86BB5477 | |
3158 | CD853634460A8BAA79828A1A14F93CC950D9A82D63713EE17CC05983461A2FD4 | |
3159 | D6407786E2D46D16DD6A2F64CCEBAA695649967AD1797AA909F10019C4CC6D2B | |
3160 | 2BF595AE4FD5D05DA3B7B8FF7981E8BA041CFA32998CB7C717783D35802E4872 | |
3161 | 3BD9CF2B9F10F0D76BDE330C0B4CB59343411BD03A40682E86CAA27636D5807C | |
3162 | D2E2C6564A4391496EEAF2FCBA8425CC4B34BB93C01D8B2D8E887603D531E84C | |
3163 | C7E2675C3E633D28001FBBD8B6D812CE0AFB3CFB9001385B51DE42D0A82154DE | |
3164 | 07195A6CC8914489C3435A7E7885B8497F66E9A404C0BFFCB4E424305A549135 | |
3165 | 9DC544B4015BFA1D360E846260DDC0F6DB49C00A3074144A03A5A3D972D397F7 | |
3166 | D61B428A618151C0A10CDCB1514AA0F065B83149016465438DB8CEC4A0B74F21 | |
3167 | DBADB5CD37533E482BF0A59916E5996462E83F405F518E302BBD63C7E543A200 | |
3168 | 51634BA387AADD4C10F6A95C86E434E1FB93DB9AE8FD55951AA338E0B58978D9 | |
3169 | B66321DF92C10C83B76449C42B6EBD7F5421D1DAD4935FEDD019B5996CD179BB | |
3170 | 75CB30BBD4E3E4C26D42CC21A741189E4707176CC0C6767EE886E5B88B3D3582 | |
3171 | 2B52528B62990E6400F4E584B15611B2E9A7D2684454B8379225C6A6B9490EE2 | |
3172 | C88B9727FE6FE59FD0B9408CB4C4824F8214DE015DB3C935BBA4F250840BA928 | |
3173 | B89A03C4F3B4237551CB69D04B3AE08FE4C86171D305665C6F26DC457FCD2665 | |
3174 | D27801BFE49394D690CB6B5B00BAE77B3841A660E8697EA0190B3ABA01CE132E | |
3175 | 7BB3309686CE6007D322B1CD44CFC025F2B32284DFD5AC1C907DABAA840F13CE | |
3176 | 823CE3CF8EA3D397BA9BDFBFA2DA4DFEF2EC1ED5B3614EEB9C22587D7B0D0D74 | |
3177 | 997144A082426B0BA78C4A6989CE4C1160370CB0F4AF3E8D48CACBB05F4F2594 | |
3178 | EE00090A25625EE644820271401DFA4FB2A779890F24F70C091786ADEFD54000 | |
3179 | 46D94B45562AF88A7813569805945A3DEEE0099D7DEEF04BD07AECE5127F4F8E | |
3180 | F30B0A7DF29535D48310B57204FF1814897B55729540B321BBEC4D2157DA22DF | |
3181 | 8E10633D2EFD3C63B473D532F0AFD8D8923EE2164DE6AB4DF537219944D4ACD3 | |
3182 | C9F08A3359111DF6FF662C82059C550535911B7212FA8A1FC1269DB40501D2DB | |
3183 | 3F11383CA84651BD0B18F1668F66B25E15978A424B42B5B44C53102BB9867E4B | |
3184 | F4DABFD8EBB06FE75FFE8B35BC319542B1B6135AE93997C567CC25F9969AD517 | |
3185 | 4C9EC354E3AD7CDD9E3B15E802DBC1170599E45329E7D7FBB01F1B70F8F336D3 | |
3186 | 5243E9DA91DDBFF2DB37E6D1790E0AB61B124C8DA9CC011CFFB0C16D57C8F935 | |
3187 | 386E9E9016B2ED0AC95508CE6FD54E95D44D14DE4EFA77E00B8D51DBF58DAE0E | |
3188 | EF1F050F120CF510823F90311415236B5430FE0A1A2CEABB91B01B2F3CD6BFF7 | |
3189 | 7F523DEB2A545E62CA65E6AA2CDA21DB273D238B2A319647769E30FC81E5D975 | |
3190 | 4886B129F6541181E631F94B11A99D7ADB2EB9BC0E63FA77C169CBE57E8D6FCF | |
3191 | 6CDCF6E0AC94F69295F47821352D2A90647F206B8BAB9410F0DBF4DD6143138C | |
3192 | 8F97959418D9B0C886777401924A948778B0EBBFEA50CF045F8D117714DDF7AB | |
3193 | 44B77A17A69ECA11FC0631D2B73F2C3DBBC690F0848616EC779A3581AAC18BF4 | |
3194 | 66E81DA60ED8618CC4DD5550681DF0F0E2A535E0E5F1338E10486C7AFB237093 | |
3195 | 1B130D98EAD1077DF16DE506D1181BE6C4B0A71DFFDD2CE49E58D21924195821 | |
3196 | A667A4A237702BBF3EBE714232A1AF00BD9C4FFDDF86E62B6DD50BB3BC1AD5B0 | |
3197 | D5F9AD86689D9148AB899003B3AAAAA186CF92C4CC6FF37BD72A14A68A7ED3D2 | |
3198 | 8BCDCF291FC8197EBB03E1F892631006CCD3ADD184DFCAEF37CC4E47925E71CE | |
3199 | 5073C16851A4A042BBC81A8632296CEF049811FAF6D1399E5D827CFA7D3F1208 | |
3200 | A50984CFD55ED7F3821E2F4BA985A2EA207943485F0B5BEAFD4F012957D2D708 | |
3201 | C5152259B8530578A8A7E0C005E82F193900882F61B22675AE940DA9CD55B2F1 | |
3202 | A8EC1C69B0CF9CE47A6627BC13054CE4D00D92D44187F5B7A6C7D8101903102A | |
3203 | 580D69D2DD91958C6F4DD78DE9C2B00D236A891CFB2C7D3A242DC0F1CF6555A7 | |
3204 | 8CF6DC94B93472738758A358A67CB88C84F30AC5DF55448237F2B73974619A62 | |
3205 | 81DD7B1F524743879D3CB0800BA9A3CBC1CFE2B40134BBEF838BAA25B861E4EF | |
3206 | E05428DE02E4608A24E468514394266AE4F3978E0F78E4689939331974B22AD9 | |
3207 | A7ED4CE0D140984F4C30EA38E11960DA525BCB57855FEE8109E77ED123803AC8 | |
3208 | A3AF0275BC5C8E9A77E182C10975EE99AADAF9ADED8BB121D11BF2E8A4E99510 | |
3209 | 78D8E8F0BA4A41A3B95E961C1350FBB0803F18384B223CDA16005A9F17E88AD8 | |
3210 | EEB6CEE1D3F6FFB14C0EB982A99B3D88E42CF860E015F378DA89D432080616B7 | |
3211 | B59C053200D6A135D2D931B80C6570E87F3725E4A447A99F40F226DDDFA4F94F | |
3212 | C4E2D8E6AAB62E4ABABC0600154F2C537138FB0677B5EC2260D7018870315E0F | |
3213 | 7DE3FB600537DE5D5412A25E08D5CDD2D6296C8EE0FC46E770A7CC967210A64F | |
3214 | AB9FA013369CDFFF0D32286D8C79AED8F36DCEB2170B8ACE3F5412AF0B3912BA | |
3215 | B1ACE2985983D388E0C676C81E329B9B11D6BBA66F580A74162AF6A322A3E696 | |
3216 | FE25676B87BF50A91FE0776E4FE061B46F49650DC7182732A6B0960E754B878E | |
3217 | D5BD037C79EA9D7351166A2592AA94479FC1FDCB2E1BBCB6C05A2DBE29543AA2 | |
3218 | 64C64A7DAE4A0B8C1987463EDEC83EA9E970DAD0FBEBECD47B1DC23198C5592C | |
3219 | AF2BDC00A08D42C8D05FDC59F4ACD3555927C70BE903D05C6514C223458B064A | |
3220 | FE25BFB8944878B78C0D816E89F04FF0F040838EFE2D958565F3FA3B5E8A8474 | |
3221 | 23635E65D85170F3950BAC5F8C2E37924AD59B23090AFBC30F7F7014D13721BB | |
3222 | 064211D5AF389C58673F562E73C7A7BCC25E232FFF01C555B58AA5BCEBDA898C | |
3223 | D4ADF8463759574879827CB6232875B9FCA5E1BA2FD426BAC550C2EC8309D1E0 | |
3224 | 69D4ACA702C1312D22A141505F79DFE0316DB918F4A1D0753658D679AA071189 | |
3225 | 3C6D0D5CDF8D322D2966AC66CCE5268EAB3CAC8B0C2DBF3CB60F03B282585D23 | |
3226 | F93703F0394FAF77344685A86EDA35E1CEB43243B002BD29CAF512F2B16ED359 | |
3227 | 36EF8A8B249A53F5204EA8F9E18660C69585BDFA02CF4FB56A3FC3676041FC29 | |
3228 | 0857A261D87DA78D9D84B9FE65BFCB7FB98183B987F43298A8C9E87B26B257E1 | |
3229 | 82206711EDFF4347ED4A7540EEF397FE5F2EEE19FA3E09458554624E18455FC7 | |
3230 | 8CF42E439E3944EB0ADC032EC00011926633513376EB46726AEE12A0F1B7FBEB | |
3231 | 1EB593651D32C27A4A4A07CC1FDF1BF1A9164B673BADACD5FD5C46BCC1AC45B3 | |
3232 | C3A7D76F2106AE8FDDB52B15652126DEF8BD87200C129FDAC00352688727709A | |
3233 | 7DE7EC08BCA9E736E87FDBF6ADCBFE1F62BFBE9EA4A0D7E87BDFA0EE2C29110D | |
3234 | 51B49E36BBCF76EC9F0DAF975938656DC73DEC3D909346BC09BACA2FFE357692 | |
3235 | DA3F60DF14CFDDBB82331A8B22CCAC3987A0F485B8BFE11CF371BE600B60C175 | |
3236 | AA2EC00826A07F068F31FF21B8B5BB5DD3AB729E5EDD2355C7E654984B50E668 | |
3237 | 08BE76D12DF93632EC1018E1D558592F3E85BE2737A2D5C13DE23021715FC1CA | |
3238 | E332FCFDCE37333888533833BFEE6525BB9BEE05 | |
3239 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3240 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3241 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3242 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3243 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3244 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3245 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3246 | 0000000000000000000000000000000000000000000000000000000000000000 | |
3247 | cleartomark | |
3248 | %%EndFont | |
3249 | TeXDict begin 40258431 52099146 1000 600 600 (history.dvi) | |
3250 | @start /Fa 209[24 46[{ TeX74afc74cEncoding ReEncodeFont }1 | |
3251 | 74.7198 /CMTI9 rf /Fb 134[41 41 1[41 43 30 30 30 1[43 | |
3252 | 38 43 64 3[21 43 38 1[34 43 34 1[38 11[58 1[43 4[58 1[48 | |
3253 | 3[58 60 50 1[59 10[38 38 38 38 2[38 1[38 38 3[21 44[{ | |
3254 | TeXf7b6d320Encoding ReEncodeFont }34 74.7198 /CMR9 rf | |
3255 | /Fc 134[39 3[39 39 39 39 2[39 39 39 39 2[39 39 2[39 3[39 | |
3256 | 97[{ TeX09fbbfacEncoding ReEncodeFont }13 74.7198 /CMSLTT10 | |
3257 | rf /Fd 130[39 39 39 39 39 39 39 39 39 39 39 39 39 39 | |
3258 | 39 39 39 39 39 1[39 39 39 39 39 39 39 39 39 39 39 1[39 | |
3259 | 39 39 1[39 2[39 39 39 39 39 1[39 1[39 1[39 2[39 39 39 | |
3260 | 39 39 39 39 39 39 2[39 39 39 39 39 3[39 1[39 1[39 39 | |
3261 | 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 39 33[{ | |
3262 | TeX09fbbfacEncoding ReEncodeFont }76 74.7198 /CMTT9 | |
3263 | rf /Fe 214[35 35 40[{ TeXf7b6d320Encoding ReEncodeFont }2 | |
3264 | 90.9091 /CMSS10 rf /Ff 133[51 60 60 83 60 64 45 45 47 | |
3265 | 60 64 57 64 95 32 60 1[32 64 57 35 53 64 51 64 56 83[64 | |
3266 | 64 12[{ TeXf7b6d320Encoding ReEncodeFont }27 99.6264 | |
3267 | /CMBX10 rf /Fg 137[52 52 52 52 52 2[52 52 52 52 2[52 | |
3268 | 52 1[52 52 52 52 52 52 1[52 5[52 4[52 52 52 2[52 52 4[52 | |
3269 | 52 2[52 3[52 22[52 42[{ TeX09fbbfacEncoding ReEncodeFont }29 | |
3270 | 99.6264 /CMTT10 rf /Fh 134[48 48 48 1[48 48 48 48 2[48 | |
3271 | 48 1[48 2[48 1[48 48 48 48 49[48 48 49[{ | |
3272 | TeX09fbbfacEncoding ReEncodeFont }17 90.9091 /CMSLTT10 | |
3273 | rf /Fi 133[55 65 65 89 65 68 48 48 50 1[68 61 68 102 | |
3274 | 34 2[34 68 61 37 56 68 55 68 60 9[127 1[94 1[68 4[96 | |
3275 | 116 74 2[46 96 1[77 81 94 2[93 6[34 2[61 61 61 61 61 | |
3276 | 61 61 2[34 33[68 12[{ TeXf7b6d320Encoding ReEncodeFont }45 | |
3277 | 109.091 /CMBX12 rf /Fj 134[48 48 66 48 51 35 36 36 48 | |
3278 | 51 45 51 76 25 2[25 51 45 28 40 51 40 1[45 3[25 1[25 | |
3279 | 40[45 45 6[45 29[51 53 11[{ TeXf7b6d320Encoding ReEncodeFont }29 | |
3280 | 90.9091 /CMSL10 rf /Fk 135[56 2[56 54 42 2[51 1[56 68 | |
3281 | 47 1[39 27 56 58 49 1[57 54 1[56 97[{ TeX0ef0afcaEncoding ReEncodeFont } | |
3282 | 16 90.9091 /CMCSC10 rf /Fl 209[28 46[{ | |
3283 | TeX74afc74cEncoding ReEncodeFont }1 90.9091 /CMTI10 | |
3284 | rf /Fm 209[43 46[{ TeX74afc74cEncoding ReEncodeFont }1 | |
3285 | 119.552 /CMBXTI10 rf /Fn 134[85 85 117 85 90 63 64 66 | |
3286 | 1[90 81 90 134 45 2[45 90 81 49 74 90 72 90 78 10[122 | |
3287 | 124 112 3[110 1[126 153 3[60 126 127 101 2[117 115 122 | |
3288 | 14[81 81 49[{ TeXf7b6d320Encoding ReEncodeFont }37 143.462 | |
3289 | /CMBX12 rf /Fo 242[91 13[{ TeXbbad153fEncoding ReEncodeFont }1 | |
3290 | 90.9091 /CMSY10 rf /Fp 134[71 71 97 71 75 52 53 55 1[75 | |
3291 | 67 75 112 37 2[37 75 67 41 61 75 60 75 65 9[139 102 103 | |
3292 | 94 75 100 1[92 1[105 128 81 2[50 105 106 85 88 103 97 | |
3293 | 96 102 11[67 67 67 67 67 2[37 1[37 44[{ | |
3294 | TeXf7b6d320Encoding ReEncodeFont }48 119.552 /CMBX12 | |
3295 | rf /Fq 129[48 48 48 48 48 48 48 48 48 48 48 48 48 48 | |
3296 | 48 48 48 48 48 48 1[48 48 48 48 48 48 48 48 48 1[48 48 | |
3297 | 48 48 48 1[48 3[48 48 48 48 1[48 48 48 1[48 2[48 48 48 | |
3298 | 48 48 48 2[48 1[48 48 48 48 48 48 7[48 48 48 48 48 48 | |
3299 | 48 48 48 48 48 1[48 48 48 48 48 48 33[{ | |
3300 | TeX09fbbfacEncoding ReEncodeFont }73 90.9091 /CMTT10 | |
3301 | rf /Fr 131[91 1[40 48 48 66 48 51 35 36 36 48 51 45 51 | |
3302 | 76 25 48 28 25 51 45 28 40 51 40 51 45 25 2[25 45 25 | |
3303 | 56 68 68 93 68 68 66 51 67 71 62 71 68 83 57 71 47 33 | |
3304 | 68 71 59 62 69 66 64 68 5[25 25 45 45 45 45 45 45 45 | |
3305 | 45 45 45 45 25 30 25 2[35 35 25 4[45 19[76 51 51 53 11[{ | |
3306 | TeXf7b6d320Encoding ReEncodeFont }81 90.9091 /CMR10 | |
3307 | rf /Fs 134[102 4[75 76 79 2[97 5[54 6[108 94 11[149 6[151 | |
3308 | 1[116 3[151 152 71[{ TeXf7b6d320Encoding ReEncodeFont }13 | |
3309 | 172.154 /CMBX12 rf end | |
a44161c3 EZ |
3310 | %%EndProlog |
3311 | %%BeginSetup | |
b585a9fa | 3312 | %%Feature: *Resolution 600dpi |
a44161c3 | 3313 | TeXDict begin |
f9267e15 EZ |
3314 | %%BeginPaperSize: Letter |
3315 | letter | |
3316 | %%EndPaperSize | |
b585a9fa | 3317 | end |
a44161c3 EZ |
3318 | %%EndSetup |
3319 | %%Page: 1 1 | |
b585a9fa EZ |
3320 | TeXDict begin 1 0 bop 150 1318 a Fs(GNU)65 b(History)h(Library)p |
3321 | 150 1418 3600 34 v 1420 1515 a Fr(Edition)31 b(5.1-b)s(eta1,)i(for)d | |
3322 | Fq(History)e(Library)h Fr(V)-8 b(ersion)31 b(5.1-b)s(eta1.)3139 | |
3323 | 1623 y(No)m(v)m(em)m(b)s(er)g(2005)150 4935 y Fp(Chet)45 | |
3324 | b(Ramey)-11 b(,)46 b(Case)g(W)-11 b(estern)46 b(Reserv)l(e)g(Univ)l | |
3325 | (ersit)l(y)150 5068 y(Brian)f(F)-11 b(o)l(x,)45 b(F)-11 | |
3326 | b(ree)45 b(Soft)l(w)l(are)h(F)-11 b(oundation)p 150 5141 | |
3327 | 3600 17 v eop end | |
a44161c3 | 3328 | %%Page: 2 2 |
b585a9fa EZ |
3329 | TeXDict begin 2 1 bop 150 3024 a Fr(This)31 b(do)s(cumen)m(t)g(describ) |
3330 | s(es)g(the)g(GNU)h(History)g(library)f(\(v)m(ersion)i(5.1-b)s(eta1,)h | |
3331 | (11)e(No)m(v)m(em)m(b)s(er)h(2005\),)150 3133 y(a)26 | |
3332 | b(programming)g(to)s(ol)h(that)g(pro)m(vides)f(a)g(consisten)m(t)i | |
3333 | (user)d(in)m(terface)i(for)f(recalling)i(lines)e(of)g(previously)150 | |
3334 | 3243 y(t)m(yp)s(ed)k(input.)150 3377 y(Cop)m(yrigh)m(t)602 | |
3335 | 3374 y(c)577 3377 y Fo(\015)g Fr(1988-2004)k(F)-8 b(ree)32 | |
3336 | b(Soft)m(w)m(are)f(F)-8 b(oundation,)32 b(Inc.)150 3512 | |
3337 | y(P)m(ermission)g(is)h(gran)m(ted)g(to)f(mak)m(e)i(and)d(distribute)h | |
3338 | (v)m(erbatim)h(copies)g(of)f(this)g(man)m(ual)h(pro)m(vided)f(the)150 | |
3339 | 3621 y(cop)m(yrigh)m(t)g(notice)f(and)f(this)g(p)s(ermission)g(notice)h | |
3340 | (are)g(preserv)m(ed)f(on)h(all)g(copies.)390 3756 y(P)m(ermission)k(is) | |
3341 | h(gran)m(ted)f(to)h(cop)m(y)-8 b(,)38 b(distribute)d(and/or)g(mo)s | |
3342 | (dify)f(this)h(do)s(cumen)m(t)g(under)390 3866 y(the)j(terms)g(of)g | |
3343 | (the)g(GNU)h(F)-8 b(ree)39 b(Do)s(cumen)m(tation)h(License,)g(V)-8 | |
3344 | b(ersion)39 b(1.1)g(or)f(an)m(y)g(later)390 3975 y(v)m(ersion)28 | |
3345 | b(published)d(b)m(y)j(the)f(F)-8 b(ree)29 b(Soft)m(w)m(are)f(F)-8 | |
3346 | b(oundation;)30 b(with)d(no)g(In)m(v)-5 b(arian)m(t)28 | |
3347 | b(Sections,)390 4085 y(with)i(the)h(F)-8 b(ron)m(t-Co)m(v)m(er)33 | |
3348 | b(texts)e(b)s(eing)g(\\A)g(GNU)g(Man)m(ual,")h(and)e(with)g(the)h(Bac)m | |
3349 | (k-Co)m(v)m(er)390 4194 y(T)-8 b(exts)33 b(as)g(in)f(\(a\))h(b)s(elo)m | |
3350 | (w.)47 b(A)33 b(cop)m(y)g(of)f(the)h(license)g(is)g(included)e(in)h | |
3351 | (the)h(section)g(en)m(titled)390 4304 y(\\GNU)e(F)-8 | |
3352 | b(ree)32 b(Do)s(cumen)m(tation)g(License.")390 4438 y(\(a\))39 | |
3353 | b(The)f(FSF's)g(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext)39 b(is:)56 | |
3354 | b(\\Y)-8 b(ou)39 b(ha)m(v)m(e)g(freedom)f(to)h(cop)m(y)f(and)g(mo)s | |
3355 | (dify)390 4548 y(this)32 b(GNU)i(Man)m(ual,)g(lik)m(e)g(GNU)f(soft)m(w) | |
3356 | m(are.)49 b(Copies)32 b(published)f(b)m(y)h(the)h(F)-8 | |
3357 | b(ree)34 b(Soft)m(w)m(are)390 4658 y(F)-8 b(oundation)31 | |
3358 | b(raise)g(funds)d(for)j(GNU)g(dev)m(elopmen)m(t.")150 | |
3359 | 4902 y(Published)e(b)m(y)h(the)h(F)-8 b(ree)31 b(Soft)m(w)m(are)h(F)-8 | |
3360 | b(oundation)150 5011 y(59)31 b(T)-8 b(emple)31 b(Place,)h(Suite)e(330,) | |
3361 | 150 5121 y(Boston,)i(MA)e(02111-1307)150 5230 y(USA)p | |
3362 | eop end | |
3363 | %%Page: -1 3 | |
3364 | TeXDict begin -1 2 bop 3725 -116 a Fr(i)150 299 y Fn(T)-13 | |
3365 | b(able)53 b(of)h(Con)l(ten)l(ts)150 641 y Fp(1)135 b(Using)45 | |
3366 | b(History)h(In)l(teractiv)l(ely)18 b Fm(.)23 b(.)c(.)g(.)h(.)f(.)h(.)f | |
3367 | (.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)63 b Fp(1)449 | |
3368 | 778 y Fr(1.1)92 b(History)31 b(Expansion)9 b Fl(.)15 | |
3369 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3370 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3371 | g(.)g(.)g(.)39 b Fr(1)748 888 y(1.1.1)93 b(Ev)m(en)m(t)31 | |
3372 | b(Designators)25 b Fl(.)15 b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3373 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3374 | (.)54 b Fr(1)748 997 y(1.1.2)93 b(W)-8 b(ord)30 b(Designators)9 | |
3375 | b Fl(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g | |
3376 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)39 | |
3377 | b Fr(1)748 1107 y(1.1.3)93 b(Mo)s(di\014ers)9 b Fl(.)14 | |
3378 | b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3379 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.) | |
3380 | g(.)g(.)g(.)38 b Fr(2)150 1349 y Fp(2)135 b(Programming)46 | |
3381 | b(with)f(GNU)g(History)33 b Fm(.)19 b(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h | |
3382 | (.)f(.)76 b Fp(5)449 1486 y Fr(2.1)92 b(In)m(tro)s(duction)30 | |
3383 | b(to)h(History)19 b Fl(.)d(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3384 | (.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3385 | g(.)g(.)g(.)g(.)49 b Fr(5)449 1596 y(2.2)92 b(History)31 | |
3386 | b(Storage)25 b Fl(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3387 | g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3388 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)54 b Fr(5)449 | |
3389 | 1705 y(2.3)92 b(History)31 b(F)-8 b(unctions)24 b Fl(.)15 | |
3390 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3391 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3392 | g(.)g(.)g(.)53 b Fr(6)748 1815 y(2.3.1)93 b(Initializing)32 | |
3393 | b(History)f(and)e(State)j(Managemen)m(t)f Fl(.)15 b(.)g(.)g(.)g(.)g(.)g | |
3394 | (.)59 b Fr(6)748 1924 y(2.3.2)93 b(History)31 b(List)f(Managemen)m(t)h | |
3395 | Fl(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3396 | (.)g(.)g(.)g(.)g(.)h(.)f(.)58 b Fr(6)748 2034 y(2.3.3)93 | |
3397 | b(Information)30 b(Ab)s(out)g(the)g(History)h(List)23 | |
3398 | b Fl(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)52 | |
3399 | b Fr(7)748 2144 y(2.3.4)93 b(Mo)m(ving)31 b(Around)e(the)i(History)g | |
3400 | (List)21 b Fl(.)15 b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3401 | g(.)g(.)g(.)51 b Fr(7)748 2253 y(2.3.5)93 b(Searc)m(hing)30 | |
3402 | b(the)h(History)g(List)15 b Fl(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3403 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)44 | |
3404 | b Fr(8)748 2363 y(2.3.6)93 b(Managing)31 b(the)g(History)g(File)11 | |
3405 | b Fl(.)16 b(.)f(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3406 | (.)g(.)g(.)g(.)g(.)g(.)g(.)41 b Fr(8)748 2472 y(2.3.7)93 | |
3407 | b(History)31 b(Expansion)18 b Fl(.)c(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3408 | g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3409 | (.)g(.)g(.)48 b Fr(9)449 2582 y(2.4)92 b(History)31 b(V)-8 | |
3410 | b(ariables)11 b Fl(.)17 b(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3411 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3412 | g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)40 b Fr(10)449 2692 | |
3413 | y(2.5)92 b(History)31 b(Programming)f(Example)13 b Fl(.)j(.)f(.)g(.)g | |
3414 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3415 | g(.)h(.)f(.)g(.)42 b Fr(11)150 2934 y Fp(App)t(endix)i(A)99 | |
3416 | b(Cop)l(ying)46 b(This)e(Man)l(ual)29 b Fm(.)20 b(.)g(.)f(.)h(.)f(.)g | |
3417 | (.)h(.)f(.)h(.)f(.)74 b Fp(13)449 3071 y Fr(A.1)92 b(GNU)31 | |
3418 | b(F)-8 b(ree)31 b(Do)s(cumen)m(tation)h(License)c Fl(.)15 | |
3419 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3420 | (.)g(.)g(.)g(.)56 b Fr(13)748 3181 y(A.1.1)92 b(ADDENDUM:)33 | |
3421 | b(Ho)m(w)e(to)g(use)f(this)g(License)h(for)g(y)m(our)930 | |
3422 | 3290 y(do)s(cumen)m(ts)c Fl(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
3423 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
3424 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)57 b Fr(19)150 | |
3425 | 3533 y Fp(App)t(endix)44 b(B)105 b(Concept)46 b(Index)16 | |
3426 | b Fm(.)j(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.) | |
3427 | f(.)61 b Fp(21)150 3802 y(App)t(endix)44 b(C)104 b(F)-11 | |
3428 | b(unction)44 b(and)h(V)-11 b(ariable)46 b(Index)13 b | |
3429 | Fm(.)19 b(.)g(.)h(.)f(.)58 b Fp(23)p eop end | |
3430 | %%Page: -2 4 | |
3431 | TeXDict begin -2 3 bop 150 -116 a Fr(ii)2691 b(GNU)31 | |
3432 | b(History)g(Library)p eop end | |
3433 | %%Page: 1 5 | |
3434 | TeXDict begin 1 4 bop 150 -116 a Fr(Chapter)30 b(1:)41 | |
3435 | b(Using)30 b(History)h(In)m(teractiv)m(ely)2016 b(1)150 | |
3436 | 299 y Fn(1)80 b(Using)53 b(History)g(In)l(teractiv)l(ely)275 | |
3437 | 562 y Fr(This)32 b(c)m(hapter)i(describ)s(es)e(ho)m(w)h(to)h(use)f(the) | |
3438 | g Fk(gnu)g Fr(History)h(Library)e(in)m(teractiv)m(ely)-8 | |
3439 | b(,)37 b(from)c(a)h(user's)150 672 y(standp)s(oin)m(t.)76 | |
3440 | b(It)42 b(should)f(b)s(e)h(considered)g(a)g(user's)g(guide.)76 | |
3441 | b(F)-8 b(or)43 b(information)f(on)g(using)g(the)g Fk(gnu)150 | |
3442 | 781 y Fr(History)36 b(Library)e(in)h(y)m(our)f(o)m(wn)i(programs,)g | |
3443 | (see)f(Chapter)g(2)g([Programming)g(with)g(GNU)h(History],)150 | |
3444 | 891 y(page)31 b(5.)150 1172 y Fp(1.1)68 b(History)46 | |
3445 | b(Expansion)275 1426 y Fr(The)35 b(History)h(library)f(pro)m(vides)h(a) | |
3446 | g(history)f(expansion)h(feature)g(that)g(is)g(similar)g(to)g(the)g | |
3447 | (history)150 1536 y(expansion)22 b(pro)m(vided)f(b)m(y)h | |
3448 | Fq(csh)p Fr(.)37 b(This)22 b(section)h(describ)s(es)e(the)h(syn)m(tax)h | |
3449 | (used)e(to)h(manipulate)h(the)f(history)150 1645 y(information.)275 | |
3450 | 1789 y(History)31 b(expansions)f(in)m(tro)s(duce)g(w)m(ords)g(from)g | |
3451 | (the)h(history)f(list)h(in)m(to)g(the)g(input)f(stream,)h(making)150 | |
3452 | 1899 y(it)g(easy)g(to)g(rep)s(eat)g(commands,)f(insert)g(the)h(argumen) | |
3453 | m(ts)f(to)h(a)g(previous)f(command)g(in)m(to)i(the)e(curren)m(t)150 | |
3454 | 2009 y(input)f(line,)i(or)g(\014x)f(errors)f(in)h(previous)g(commands)g | |
3455 | (quic)m(kly)-8 b(.)275 2153 y(History)37 b(expansion)f(tak)m(es)i | |
3456 | (place)g(in)e(t)m(w)m(o)i(parts.)59 b(The)36 b(\014rst)g(is)h(to)g | |
3457 | (determine)g(whic)m(h)f(line)h(from)150 2262 y(the)42 | |
3458 | b(history)f(list)h(should)e(b)s(e)h(used)f(during)g(substitution.)74 | |
3459 | b(The)40 b(second)i(is)f(to)h(select)h(p)s(ortions)e(of)150 | |
3460 | 2372 y(that)31 b(line)g(for)f(inclusion)h(in)m(to)g(the)g(curren)m(t)f | |
3461 | (one.)42 b(The)30 b(line)h(selected)h(from)e(the)h(history)f(is)h | |
3462 | (called)h(the)150 2481 y Fj(ev)m(en)m(t)p Fr(,)e(and)c(the)i(p)s | |
3463 | (ortions)e(of)i(that)f(line)h(that)g(are)f(acted)i(up)s(on)c(are)j | |
3464 | (called)g Fj(w)m(ords)p Fr(.)39 b(V)-8 b(arious)28 b | |
3465 | Fj(mo)s(di\014ers)150 2591 y Fr(are)33 b(a)m(v)-5 b(ailable)36 | |
3466 | b(to)d(manipulate)h(the)f(selected)h(w)m(ords.)48 b(The)32 | |
3467 | b(line)i(is)f(brok)m(en)f(in)m(to)i(w)m(ords)f(in)f(the)i(same)150 | |
3468 | 2701 y(fashion)23 b(that)g(Bash)g(do)s(es,)h(so)f(that)h(sev)m(eral)g | |
3469 | (w)m(ords)e(surrounded)e(b)m(y)j(quotes)g(are)g(considered)g(one)g(w)m | |
3470 | (ord.)150 2810 y(History)37 b(expansions)g(are)g(in)m(tro)s(duced)f(b)m | |
3471 | (y)h(the)g(app)s(earance)g(of)g(the)g(history)f(expansion)h(c)m | |
3472 | (haracter,)150 2920 y(whic)m(h)30 b(is)h(`)p Fq(!)p Fr(')f(b)m(y)g | |
3473 | (default.)150 3163 y Fi(1.1.1)63 b(Ev)m(en)m(t)39 b(Designators)275 | |
3474 | 3417 y Fr(An)30 b(ev)m(en)m(t)h(designator)h(is)e(a)h(reference)g(to)g | |
3475 | (a)f(command)h(line)f(en)m(try)h(in)f(the)h(history)f(list.)150 | |
3476 | 3591 y Fq(!)432 b Fr(Start)34 b(a)f(history)h(substitution,)g(except)g | |
3477 | (when)f(follo)m(w)m(ed)i(b)m(y)e(a)h(space,)h(tab,)f(the)g(end)f(of)630 | |
3478 | 3701 y(the)e(line,)g(or)f(`)p Fq(=)p Fr('.)150 3870 y | |
3479 | Fq(!)p Fh(n)384 b Fr(Refer)30 b(to)i(command)e(line)g | |
3480 | Fj(n)p Fr(.)150 4039 y Fq(!-)p Fh(n)336 b Fr(Refer)30 | |
3481 | b(to)i(the)e(command)g Fj(n)g Fr(lines)h(bac)m(k.)150 | |
3482 | 4208 y Fq(!!)384 b Fr(Refer)30 b(to)i(the)e(previous)g(command.)40 | |
3483 | b(This)30 b(is)g(a)h(synon)m(ym)f(for)g(`)p Fq(!-1)p | |
3484 | Fr('.)150 4377 y Fq(!)p Fh(string)144 b Fr(Refer)30 b(to)i(the)e(most)h | |
3485 | (recen)m(t)g(command)f(starting)i(with)e Fj(string)p | |
3486 | Fr(.)150 4546 y Fq(!?)p Fh(string)11 b Fq([?])630 4655 | |
3487 | y Fr(Refer)34 b(to)g(the)f(most)h(recen)m(t)h(command)e(con)m(taining)i | |
3488 | Fj(string)p Fr(.)50 b(The)33 b(trailing)i(`)p Fq(?)p | |
3489 | Fr(')e(ma)m(y)i(b)s(e)630 4765 y(omitted)c(if)g(the)f | |
3490 | Fj(string)38 b Fr(is)31 b(follo)m(w)m(ed)h(immediately)g(b)m(y)e(a)h | |
3491 | (newline.)150 4934 y Fq(^)p Fh(string1)11 b Fq(^)p Fh(string2)g | |
3492 | Fq(^)630 5044 y Fr(Quic)m(k)32 b(Substitution.)44 b(Rep)s(eat)32 | |
3493 | b(the)g(last)h(command,)f(replacing)g Fj(string1)40 b | |
3494 | Fr(with)31 b Fj(string2)p Fr(.)630 5153 y(Equiv)-5 b(alen)m(t)31 | |
3495 | b(to)g Fq(!!:s/)p Fh(string1)11 b Fq(/)p Fh(string2)g | |
3496 | Fq(/)p Fr(.)150 5322 y Fq(!#)384 b Fr(The)30 b(en)m(tire)h(command)f | |
3497 | (line)h(t)m(yp)s(ed)f(so)h(far.)p eop end | |
3498 | %%Page: 2 6 | |
3499 | TeXDict begin 2 5 bop 150 -116 a Fr(2)2696 b(GNU)31 b(History)g | |
3500 | (Library)150 299 y Fi(1.1.2)63 b(W)-10 b(ord)41 b(Designators)275 | |
3501 | 542 y Fr(W)-8 b(ord)35 b(designators)g(are)g(used)f(to)h(select)h | |
3502 | (desired)e(w)m(ords)h(from)f(the)h(ev)m(en)m(t.)55 b(A)34 | |
3503 | b(`)p Fq(:)p Fr(')h(separates)h(the)150 652 y(ev)m(en)m(t)41 | |
3504 | b(sp)s(eci\014cation)f(from)g(the)f(w)m(ord)g(designator.)69 | |
3505 | b(It)40 b(ma)m(y)g(b)s(e)f(omitted)i(if)e(the)h(w)m(ord)f(designator) | |
3506 | 150 761 y(b)s(egins)33 b(with)h(a)h(`)p Fq(^)p Fr(',)g(`)p | |
3507 | Fq($)p Fr(',)g(`)p Fq(*)p Fr(',)h(`)p Fq(-)p Fr(',)f(or)f(`)p | |
3508 | Fq(\045)p Fr('.)52 b(W)-8 b(ords)35 b(are)f(n)m(um)m(b)s(ered)f(from)g | |
3509 | (the)i(b)s(eginning)e(of)h(the)g(line,)150 871 y(with)39 | |
3510 | b(the)h(\014rst)f(w)m(ord)g(b)s(eing)g(denoted)h(b)m(y)g(0)g(\(zero\).) | |
3511 | 70 b(W)-8 b(ords)39 b(are)h(inserted)g(in)m(to)g(the)g(curren)m(t)g | |
3512 | (line)150 980 y(separated)31 b(b)m(y)f(single)h(spaces.)275 | |
3513 | 1114 y(F)-8 b(or)31 b(example,)150 1272 y Fq(!!)384 b | |
3514 | Fr(designates)37 b(the)f(preceding)g(command.)57 b(When)35 | |
3515 | b(y)m(ou)i(t)m(yp)s(e)f(this,)h(the)f(preceding)g(com-)630 | |
3516 | 1381 y(mand)30 b(is)g(rep)s(eated)g(in)g(toto.)150 1539 | |
3517 | y Fq(!!:$)288 b Fr(designates)23 b(the)g(last)g(argumen)m(t)g(of)f(the) | |
3518 | h(preceding)f(command.)38 b(This)22 b(ma)m(y)h(b)s(e)e(shortened)630 | |
3519 | 1648 y(to)31 b Fq(!$)p Fr(.)150 1806 y Fq(!fi:2)240 b | |
3520 | Fr(designates)30 b(the)g(second)f(argumen)m(t)h(of)f(the)h(most)f | |
3521 | (recen)m(t)i(command)e(starting)h(with)f(the)630 1916 | |
3522 | y(letters)j Fq(fi)p Fr(.)275 2073 y(Here)e(are)h(the)g(w)m(ord)f | |
3523 | (designators:)150 2231 y Fq(0)g(\(zero\))114 b Fr(The)30 | |
3524 | b Fq(0)p Fr(th)g(w)m(ord.)40 b(F)-8 b(or)31 b(man)m(y)g(applications,)h | |
3525 | (this)e(is)g(the)h(command)f(w)m(ord.)150 2388 y Fh(n)432 | |
3526 | b Fr(The)30 b Fj(n)p Fr(th)g(w)m(ord.)150 2546 y Fq(^)432 | |
3527 | b Fr(The)30 b(\014rst)f(argumen)m(t;)j(that)f(is,)f(w)m(ord)g(1.)150 | |
3528 | 2703 y Fq($)432 b Fr(The)30 b(last)h(argumen)m(t.)150 | |
3529 | 2861 y Fq(\045)432 b Fr(The)30 b(w)m(ord)g(matc)m(hed)h(b)m(y)f(the)h | |
3530 | (most)g(recen)m(t)g(`)p Fq(?)p Fh(string)11 b Fq(?)p | |
3531 | Fr(')28 b(searc)m(h.)150 3019 y Fh(x)p Fq(-)p Fh(y)336 | |
3532 | b Fr(A)30 b(range)h(of)g(w)m(ords;)f(`)p Fq(-)p Fh(y)11 | |
3533 | b Fr(')30 b(abbreviates)h(`)p Fq(0-)p Fh(y)11 b Fr('.)150 | |
3534 | 3176 y Fq(*)432 b Fr(All)28 b(of)g(the)g(w)m(ords,)g(except)h(the)e | |
3535 | Fq(0)p Fr(th.)40 b(This)27 b(is)g(a)h(synon)m(ym)f(for)h(`)p | |
3536 | Fq(1-$)p Fr('.)39 b(It)28 b(is)g(not)g(an)f(error)630 | |
3537 | 3286 y(to)j(use)g(`)p Fq(*)p Fr(')f(if)h(there)g(is)g(just)f(one)h(w)m | |
3538 | (ord)f(in)g(the)h(ev)m(en)m(t;)i(the)d(empt)m(y)i(string)e(is)h | |
3539 | (returned)e(in)630 3395 y(that)j(case.)150 3553 y Fh(x)11 | |
3540 | b Fq(*)373 b Fr(Abbreviates)31 b(`)p Fh(x)p Fq(-$)p Fr(')150 | |
3541 | 3711 y Fh(x)p Fq(-)384 b Fr(Abbreviates)31 b(`)p Fh(x)p | |
3542 | Fq(-$)p Fr(')f(lik)m(e)h(`)p Fh(x)11 b Fq(*)p Fr(',)31 | |
3543 | b(but)e(omits)i(the)g(last)g(w)m(ord.)275 3868 y(If)i(a)h(w)m(ord)g | |
3544 | (designator)g(is)g(supplied)f(without)h(an)g(ev)m(en)m(t)h(sp)s | |
3545 | (eci\014cation,)h(the)e(previous)f(command)150 3978 y(is)d(used)g(as)h | |
3546 | (the)f(ev)m(en)m(t.)150 4199 y Fi(1.1.3)63 b(Mo)s(di\014ers)275 | |
3547 | 4442 y Fr(After)20 b(the)h(optional)h(w)m(ord)f(designator,)i(y)m(ou)e | |
3548 | (can)g(add)f(a)h(sequence)g(of)g(one)g(or)g(more)g(of)g(the)f(follo)m | |
3549 | (wing)150 4552 y(mo)s(di\014ers,)29 b(eac)m(h)j(preceded)e(b)m(y)g(a)h | |
3550 | (`)p Fq(:)p Fr('.)150 4710 y Fq(h)432 b Fr(Remo)m(v)m(e)32 | |
3551 | b(a)f(trailing)g(pathname)g(comp)s(onen)m(t,)g(lea)m(ving)h(only)e(the) | |
3552 | h(head.)150 4867 y Fq(t)432 b Fr(Remo)m(v)m(e)32 b(all)f(leading)h | |
3553 | (pathname)e(comp)s(onen)m(ts,)h(lea)m(ving)h(the)e(tail.)150 | |
3554 | 5025 y Fq(r)432 b Fr(Remo)m(v)m(e)32 b(a)f(trailing)g(su\016x)f(of)g | |
3555 | (the)h(form)f(`)p Fq(.)p Fh(suffix)11 b Fr(',)28 b(lea)m(ving)33 | |
3556 | b(the)d(basename.)150 5182 y Fq(e)432 b Fr(Remo)m(v)m(e)32 | |
3557 | b(all)f(but)f(the)h(trailing)g(su\016x.)150 5340 y Fq(p)432 | |
3558 | b Fr(Prin)m(t)30 b(the)h(new)f(command)g(but)g(do)g(not)g(execute)i | |
3559 | (it.)p eop end | |
3560 | %%Page: 3 7 | |
3561 | TeXDict begin 3 6 bop 150 -116 a Fr(Chapter)30 b(1:)41 | |
3562 | b(Using)30 b(History)h(In)m(teractiv)m(ely)2016 b(3)150 | |
3563 | 299 y Fq(s/)p Fh(old)11 b Fq(/)p Fh(new)g Fq(/)630 408 | |
3564 | y Fr(Substitute)32 b Fj(new)40 b Fr(for)32 b(the)h(\014rst)f(o)s | |
3565 | (ccurrence)h(of)f Fj(old)37 b Fr(in)32 b(the)h(ev)m(en)m(t)h(line.)48 | |
3566 | b(An)m(y)32 b(delimiter)630 518 y(ma)m(y)25 b(b)s(e)g(used)f(in)g | |
3567 | (place)i(of)f(`)p Fq(/)p Fr('.)39 b(The)24 b(delimiter)h(ma)m(y)h(b)s | |
3568 | (e)e(quoted)h(in)f Fj(old)29 b Fr(and)24 b Fj(new)32 | |
3569 | b Fr(with)25 b(a)630 628 y(single)k(bac)m(kslash.)40 | |
3570 | b(If)28 b(`)p Fq(&)p Fr(')g(app)s(ears)g(in)f Fj(new)p | |
3571 | Fr(,)i(it)f(is)h(replaced)f(b)m(y)g Fj(old)p Fr(.)40 | |
3572 | b(A)28 b(single)h(bac)m(kslash)630 737 y(will)35 b(quote)g(the)g(`)p | |
3573 | Fq(&)p Fr('.)54 b(The)34 b(\014nal)g(delimiter)i(is)e(optional)i(if)f | |
3574 | (it)g(is)f(the)h(last)h(c)m(haracter)g(on)630 847 y(the)31 | |
3575 | b(input)e(line.)150 1006 y Fq(&)432 b Fr(Rep)s(eat)31 | |
3576 | b(the)f(previous)g(substitution.)150 1166 y Fq(g)150 | |
3577 | 1275 y(a)432 b Fr(Cause)38 b(c)m(hanges)i(to)f(b)s(e)f(applied)h(o)m(v) | |
3578 | m(er)h(the)f(en)m(tire)g(ev)m(en)m(t)h(line.)66 b(Used)39 | |
3579 | b(in)f(conjunction)630 1385 y(with)30 b(`)p Fq(s)p Fr(',)h(as)f(in)h | |
3580 | Fq(gs/)p Fh(old)11 b Fq(/)p Fh(new)g Fq(/)p Fr(,)26 b(or)k(with)h(`)p | |
3581 | Fq(&)p Fr('.)150 1544 y Fq(G)432 b Fr(Apply)30 b(the)g(follo)m(wing)i | |
3582 | (`)p Fq(s)p Fr(')f(mo)s(di\014er)e(once)i(to)g(eac)m(h)h(w)m(ord)e(in)g | |
3583 | (the)g(ev)m(en)m(t.)p eop end | |
3584 | %%Page: 4 8 | |
3585 | TeXDict begin 4 7 bop 150 -116 a Fr(4)2696 b(GNU)31 b(History)g | |
3586 | (Library)p eop end | |
3587 | %%Page: 5 9 | |
3588 | TeXDict begin 5 8 bop 150 -116 a Fr(Chapter)30 b(2:)41 | |
3589 | b(Programming)30 b(with)g(GNU)h(History)1780 b(5)150 | |
3590 | 299 y Fn(2)80 b(Programming)54 b(with)f(GNU)h(History)275 | |
3591 | 525 y Fr(This)31 b(c)m(hapter)i(describ)s(es)f(ho)m(w)g(to)h(in)m | |
3592 | (terface)h(programs)e(that)h(y)m(ou)g(write)g(with)f(the)g | |
3593 | Fk(gnu)g Fr(History)150 634 y(Library)-8 b(.)48 b(It)33 | |
3594 | b(should)e(b)s(e)i(considered)f(a)h(tec)m(hnical)i(guide.)48 | |
3595 | b(F)-8 b(or)34 b(information)f(on)g(the)g(in)m(teractiv)m(e)i(use)150 | |
3596 | 744 y(of)c Fk(gnu)f Fr(History)-8 b(,)31 b(see)g(Chapter)f(1)h([Using)g | |
3597 | (History)g(In)m(teractiv)m(ely],)i(page)e(1.)150 996 | |
3598 | y Fp(2.1)68 b(In)l(tro)t(duction)45 b(to)g(History)275 | |
3599 | 1239 y Fr(Man)m(y)23 b(programs)f(read)h(input)f(from)g(the)h(user)f(a) | |
3600 | h(line)g(at)g(a)g(time.)39 b(The)23 b Fk(gnu)f Fr(History)h(library)g | |
3601 | (is)f(able)150 1348 y(to)29 b(k)m(eep)h(trac)m(k)g(of)f(those)g(lines,) | |
3602 | h(asso)s(ciate)g(arbitrary)f(data)g(with)g(eac)m(h)h(line,)f(and)g | |
3603 | (utilize)h(information)150 1458 y(from)g(previous)g(lines)g(in)g(comp)s | |
3604 | (osing)h(new)f(ones.)275 1591 y(The)d(programmer)g(using)g(the)g | |
3605 | (History)h(library)f(has)h(a)m(v)-5 b(ailable)29 b(functions)e(for)h | |
3606 | (remem)m(b)s(ering)f(lines)150 1700 y(on)21 b(a)g(history)f(list,)k | |
3607 | (asso)s(ciating)e(arbitrary)e(data)i(with)e(a)h(line,)i(remo)m(ving)f | |
3608 | (lines)f(from)f(the)h(list,)i(searc)m(hing)150 1810 y(through)35 | |
3609 | b(the)g(list)h(for)f(a)h(line)f(con)m(taining)i(an)e(arbitrary)g(text)h | |
3610 | (string,)h(and)e(referencing)g(an)m(y)h(line)f(in)150 | |
3611 | 1919 y(the)c(list)g(directly)-8 b(.)43 b(In)30 b(addition,)h(a)g | |
3612 | (history)g Fj(expansion)g Fr(function)f(is)h(a)m(v)-5 | |
3613 | b(ailable)33 b(whic)m(h)d(pro)m(vides)h(for)g(a)150 2029 | |
3614 | y(consisten)m(t)h(user)d(in)m(terface)j(across)f(di\013eren)m(t)g | |
3615 | (programs.)275 2162 y(The)c(user)g(using)g(programs)h(written)g(with)g | |
3616 | (the)g(History)g(library)g(has)f(the)h(b)s(ene\014t)f(of)h(a)h | |
3617 | (consisten)m(t)150 2271 y(user)38 b(in)m(terface)j(with)e(a)g(set)g(of) | |
3618 | h(w)m(ell-kno)m(wn)f(commands)g(for)g(manipulating)g(the)g(text)h(of)f | |
3619 | (previous)150 2381 y(lines)28 b(and)f(using)g(that)h(text)g(in)g(new)f | |
3620 | (commands.)39 b(The)27 b(basic)h(history)g(manipulation)f(commands)h | |
3621 | (are)150 2491 y(similar)j(to)g(the)f(history)h(substitution)f(pro)m | |
3622 | (vided)g(b)m(y)g Fq(csh)p Fr(.)275 2623 y(If)f(the)g(programmer)g | |
3623 | (desires,)h(he)g(can)f(use)h(the)f(Readline)i(library)-8 | |
3624 | b(,)30 b(whic)m(h)f(includes)g(some)h(history)150 2733 | |
3625 | y(manipulation)h(b)m(y)f(default,)h(and)e(has)i(the)f(added)g(adv)-5 | |
3626 | b(an)m(tage)32 b(of)f(command)f(line)g(editing.)275 2866 | |
3627 | y(Before)39 b(declaring)f(an)m(y)h(functions)e(using)h(an)m(y)g | |
3628 | (functionalit)m(y)i(the)e(History)h(library)e(pro)m(vides)h(in)150 | |
3629 | 2976 y(other)29 b(co)s(de,)g(an)g(application)h(writer)f(should)e | |
3630 | (include)i(the)g(\014le)f Fq(<readline/history.h>)23 | |
3631 | b Fr(in)29 b(an)m(y)g(\014le)150 3085 y(that)c(uses)e(the)h(History)h | |
3632 | (library's)e(features.)39 b(It)24 b(supplies)f(extern)h(declarations)i | |
3633 | (for)d(all)i(of)f(the)g(library's)150 3195 y(public)30 | |
3634 | b(functions)g(and)f(v)-5 b(ariables,)32 b(and)d(declares)j(all)f(of)f | |
3635 | (the)h(public)f(data)h(structures.)150 3447 y Fp(2.2)68 | |
3636 | b(History)46 b(Storage)275 3689 y Fr(The)29 b(history)i(list)g(is)f(an) | |
3637 | g(arra)m(y)h(of)g(history)f(en)m(tries.)42 b(A)30 b(history)g(en)m(try) | |
3638 | h(is)f(declared)h(as)g(follo)m(ws:)390 3822 y Fq(typedef)46 | |
3639 | b(void)g(*histdata_t;)390 4042 y(typedef)g(struct)g(_hist_entry)f({)485 | |
3640 | 4151 y(char)i(*line;)485 4261 y(char)g(*timestamp;)485 | |
3641 | 4370 y(histdata_t)e(data;)390 4480 y(})i(HIST_ENTRY;)275 | |
3642 | 4613 y Fr(The)29 b(history)i(list)g(itself)g(migh)m(t)g(therefore)g(b)s | |
3643 | (e)f(declared)g(as)390 4746 y Fq(HIST_ENTRY)45 b(**the_history_list;) | |
3644 | 275 4878 y Fr(The)29 b(state)j(of)f(the)f(History)h(library)f(is)h | |
3645 | (encapsulated)g(in)m(to)g(a)g(single)g(structure:)390 | |
3646 | 5011 y Fq(/*)438 5121 y(*)47 b(A)h(structure)d(used)i(to)g(pass)f | |
3647 | (around)g(the)h(current)f(state)h(of)g(the)g(history.)438 | |
3648 | 5230 y(*/)390 5340 y(typedef)f(struct)g(_hist_state)f({)p | |
3649 | eop end | |
3650 | %%Page: 6 10 | |
3651 | TeXDict begin 6 9 bop 150 -116 a Fr(6)2696 b(GNU)31 b(History)g | |
3652 | (Library)485 299 y Fq(HIST_ENTRY)45 b(**entries;)g(/*)j(Pointer)d(to)j | |
3653 | (the)f(entries)e(themselves.)g(*/)485 408 y(int)i(offset;)523 | |
3654 | b(/*)48 b(The)f(location)e(pointer)h(within)g(this)h(array.)f(*/)485 | |
3655 | 518 y(int)h(length;)523 b(/*)48 b(Number)e(of)h(elements)e(within)i | |
3656 | (this)f(array.)g(*/)485 628 y(int)h(size;)619 b(/*)48 | |
3657 | b(Number)e(of)h(slots)f(allocated)g(to)h(this)f(array.)g(*/)485 | |
3658 | 737 y(int)h(flags;)390 847 y(})g(HISTORY_STATE;)275 985 | |
3659 | y Fr(If)29 b(the)i(\015ags)g(mem)m(b)s(er)e(includes)h | |
3660 | Fq(HS_STIFLED)p Fr(,)e(the)j(history)f(has)g(b)s(een)g(sti\015ed.)150 | |
3661 | 1252 y Fp(2.3)68 b(History)46 b(F)-11 b(unctions)275 | |
3662 | 1500 y Fr(This)23 b(section)j(describ)s(es)e(the)h(calling)h(sequence)f | |
3663 | (for)f(the)h(v)-5 b(arious)25 b(functions)f(exp)s(orted)g(b)m(y)g(the)h | |
3664 | Fk(gnu)150 1610 y Fr(History)31 b(library)-8 b(.)150 | |
3665 | 1842 y Fi(2.3.1)63 b(Initializing)40 b(History)i(and)f(State)f | |
3666 | (Managemen)m(t)275 2090 y Fr(This)33 b(section)j(describ)s(es)e | |
3667 | (functions)g(used)g(to)h(initialize)i(and)d(manage)h(the)g(state)h(of)f | |
3668 | (the)f(History)150 2200 y(library)c(when)f(y)m(ou)i(w)m(an)m(t)g(to)g | |
3669 | (use)f(the)h(history)f(functions)g(in)g(y)m(our)h(program.)3350 | |
3670 | 2392 y([F)-8 b(unction])-3599 b Fg(void)39 b Ff(using)p | |
3671 | 667 2392 35 5 v 50 w(history)46 b Fe(\()p Fq(void)p Fe(\))390 | |
3672 | 2501 y Fr(Begin)41 b(a)f(session)g(in)g(whic)m(h)f(the)h(history)g | |
3673 | (functions)f(migh)m(t)i(b)s(e)e(used.)69 b(This)39 b(initializes)j(the) | |
3674 | 390 2611 y(in)m(teractiv)m(e)33 b(v)-5 b(ariables.)3350 | |
3675 | 2803 y([F)d(unction])-3599 b Fg(HISTORY_STATE)42 b(*)d | |
3676 | Ff(history)p 1317 2803 V 50 w(get)p 1522 2803 V 50 w(history)p | |
3677 | 1922 2803 V 51 w(state)k Fe(\()p Fq(void)p Fe(\))390 | |
3678 | 2913 y Fr(Return)30 b(a)g(structure)g(describing)g(the)h(curren)m(t)f | |
3679 | (state)i(of)e(the)h(input)e(history)-8 b(.)3350 3105 | |
3680 | y([F)g(unction])-3599 b Fg(void)39 b Ff(history)p 755 | |
3681 | 3105 V 51 w(set)p 949 3105 V 50 w(history)p 1349 3105 | |
3682 | V 50 w(state)44 b Fe(\()p Fq(HISTORY_STATE)27 b(*state)p | |
3683 | Fe(\))390 3215 y Fr(Set)k(the)f(state)i(of)e(the)h(history)f(list)h | |
3684 | (according)h(to)f Fj(state)p Fr(.)150 3447 y Fi(2.3.2)63 | |
3685 | b(History)41 b(List)g(Managemen)m(t)275 3695 y Fr(These)21 | |
3686 | b(functions)g(manage)h(individual)f(en)m(tries)h(on)g(the)f(history)h | |
3687 | (list,)i(or)d(set)h(parameters)g(managing)150 3804 y(the)31 | |
3688 | b(list)g(itself.)3350 3996 y([F)-8 b(unction])-3599 b | |
3689 | Fg(void)39 b Ff(add)p 589 3996 V 50 w(history)45 b Fe(\()p | |
3690 | Fq(const)30 b(char)f(*string)p Fe(\))390 4106 y Fr(Place)i | |
3691 | Fj(string)38 b Fr(at)31 b(the)f(end)f(of)h(the)g(history)g(list.)42 | |
3692 | b(The)29 b(asso)s(ciated)i(data)g(\014eld)f(\(if)g(an)m(y\))h(is)f(set) | |
3693 | g(to)390 4216 y Fq(NULL)p Fr(.)3350 4408 y([F)-8 b(unction])-3599 | |
3694 | b Fg(void)39 b Ff(add)p 589 4408 V 50 w(history)p 989 | |
3695 | 4408 V 50 w(time)45 b Fe(\()p Fq(const)29 b(char)h(*string)p | |
3696 | Fe(\))390 4517 y Fr(Change)g(the)h(time)g(stamp)f(asso)s(ciated)i(with) | |
3697 | e(the)h(most)f(recen)m(t)i(history)e(en)m(try)h(to)g | |
3698 | Fj(string)p Fr(.)3350 4709 y([F)-8 b(unction])-3599 b | |
3699 | Fg(HIST_ENTRY)41 b(*)e Ff(remo)m(v)m(e)p 1169 4709 V | |
3700 | 50 w(history)46 b Fe(\()p Fq(int)30 b(which)p Fe(\))390 | |
3701 | 4819 y Fr(Remo)m(v)m(e)47 b(history)f(en)m(try)f(at)i(o\013set)f | |
3702 | Fj(whic)m(h)f Fr(from)g(the)h(history)-8 b(.)86 b(The)45 | |
3703 | b(remo)m(v)m(ed)i(elemen)m(t)g(is)390 4929 y(returned)29 | |
3704 | b(so)i(y)m(ou)g(can)f(free)h(the)f(line,)h(data,)h(and)d(con)m(taining) | |
3705 | j(structure.)3350 5121 y([F)-8 b(unction])-3599 b Fg(histdata_t)41 | |
3706 | b Ff(free)p 907 5121 V 50 w(history)p 1307 5121 V 50 | |
3707 | w(en)m(try)k Fe(\()p Fq(HIST_ENTRY)28 b(*histent)p Fe(\))390 | |
3708 | 5230 y Fr(F)-8 b(ree)29 b(the)f(history)g(en)m(try)g | |
3709 | Fj(histen)m(t)j Fr(and)c(an)m(y)i(history)e(library)h(priv)-5 | |
3710 | b(ate)28 b(data)h(asso)s(ciated)g(with)f(it.)390 5340 | |
3711 | y(Returns)h(the)i(application-sp)s(eci\014c)h(data)f(so)g(the)f(caller) | |
3712 | i(can)e(disp)s(ose)g(of)h(it.)p eop end | |
3713 | %%Page: 7 11 | |
3714 | TeXDict begin 7 10 bop 150 -116 a Fr(Chapter)30 b(2:)41 | |
3715 | b(Programming)30 b(with)g(GNU)h(History)1780 b(7)3350 | |
3716 | 299 y([F)-8 b(unction])-3599 b Fg(HIST_ENTRY)41 b(*)e | |
3717 | Ff(replace)p 1166 299 35 5 v 48 w(history)p 1564 299 | |
3718 | V 51 w(en)m(try)45 b Fe(\()p Fq(int)29 b(which,)g(const)g(char)565 | |
3719 | 408 y(*line,)g(histdata_t)e(data)p Fe(\))390 518 y Fr(Mak)m(e)i(the)f | |
3720 | (history)f(en)m(try)h(at)h(o\013set)f Fj(whic)m(h)g Fr(ha)m(v)m(e)g | |
3721 | Fj(line)33 b Fr(and)27 b Fj(data)p Fr(.)41 b(This)27 | |
3722 | b(returns)f(the)i(old)g(en)m(try)390 628 y(so)37 b(the)h(caller)g(can)f | |
3723 | (disp)s(ose)g(of)g(an)m(y)g(application-sp)s(eci\014c)i(data.)61 | |
3724 | b(In)37 b(the)g(case)h(of)f(an)g(in)m(v)-5 b(alid)390 | |
3725 | 737 y Fj(whic)m(h)p Fr(,)30 b(a)h Fq(NULL)e Fr(p)s(oin)m(ter)i(is)f | |
3726 | (returned.)3350 957 y([F)-8 b(unction])-3599 b Fg(void)39 | |
3727 | b Ff(clear)p 644 957 V 50 w(history)46 b Fe(\()p Fq(void)p | |
3728 | Fe(\))390 1067 y Fr(Clear)31 b(the)f(history)h(list)g(b)m(y)f(deleting) | |
3729 | h(all)h(the)e(en)m(tries.)3350 1287 y([F)-8 b(unction])-3599 | |
3730 | b Fg(void)39 b Ff(sti\015e)p 644 1287 V 50 w(history)45 | |
3731 | b Fe(\()p Fq(int)30 b(max)p Fe(\))390 1396 y Fr(Sti\015e)g(the)h | |
3732 | (history)f(list,)h(remem)m(b)s(ering)f(only)h(the)f(last)i | |
3733 | Fj(max)k Fr(en)m(tries.)3350 1616 y([F)-8 b(unction])-3599 | |
3734 | b Fg(int)39 b Ff(unsti\015e)p 720 1616 V 49 w(history)45 | |
3735 | b Fe(\()p Fq(void)p Fe(\))390 1726 y Fr(Stop)27 b(sti\015ing)h(the)f | |
3736 | (history)-8 b(.)40 b(This)27 b(returns)f(the)h(previously-set)h(maxim)m | |
3737 | (um)f(n)m(um)m(b)s(er)f(of)i(history)390 1836 y(en)m(tries)g(\(as)f | |
3738 | (set)g(b)m(y)g Fq(stifle_history\(\))p Fr(\).)35 b(The)27 | |
3739 | b(v)-5 b(alue)27 b(is)g(p)s(ositiv)m(e)g(if)g(the)g(history)g(w)m(as)g | |
3740 | (sti\015ed,)390 1945 y(negativ)m(e)33 b(if)d(it)h(w)m(asn't.)3350 | |
3741 | 2165 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(history)p | |
3742 | 703 2165 V 51 w(is)p 831 2165 V 50 w(sti\015ed)44 b Fe(\()p | |
3743 | Fq(void)p Fe(\))390 2275 y Fr(Returns)29 b(non-zero)i(if)g(the)f | |
3744 | (history)h(is)f(sti\015ed,)g(zero)i(if)e(it)h(is)f(not.)150 | |
3745 | 2535 y Fi(2.3.3)63 b(Information)42 b(Ab)s(out)f(the)g(History)g(List) | |
3746 | 275 2797 y Fr(These)25 b(functions)g(return)g(information)h(ab)s(out)f | |
3747 | (the)h(en)m(tire)g(history)g(list)g(or)g(individual)f(list)h(en)m | |
3748 | (tries.)3350 3017 y([F)-8 b(unction])-3599 b Fg(HIST_ENTRY)41 | |
3749 | b(**)e Ff(history)p 1212 3017 V 51 w(list)44 b Fe(\()p | |
3750 | Fq(void)p Fe(\))390 3126 y Fr(Return)30 b(a)h Fq(NULL)e | |
3751 | Fr(terminated)i(arra)m(y)g(of)f Fq(HIST_ENTRY)e(*)i Fr(whic)m(h)g(is)h | |
3752 | (the)g(curren)m(t)f(input)f(history)-8 b(.)390 3236 y(Elemen)m(t)31 | |
3753 | b(0)g(of)g(this)f(list)h(is)f(the)h(b)s(eginning)f(of)g(time.)42 | |
3754 | b(If)29 b(there)i(is)f(no)h(history)-8 b(,)31 b(return)e | |
3755 | Fq(NULL)p Fr(.)3350 3456 y([F)-8 b(unction])-3599 b Fg(int)39 | |
3756 | b Ff(where)p 653 3456 V 49 w(history)46 b Fe(\()p Fq(void)p | |
3757 | Fe(\))390 3565 y Fr(Returns)29 b(the)i(o\013set)g(of)g(the)g(curren)m | |
3758 | (t)f(history)g(elemen)m(t.)3350 3786 y([F)-8 b(unction])-3599 | |
3759 | b Fg(HIST_ENTRY)41 b(*)e Ff(curren)m(t)p 1178 3786 V | |
3760 | 49 w(history)45 b Fe(\()p Fq(void)p Fe(\))390 3895 y | |
3761 | Fr(Return)24 b(the)h(history)g(en)m(try)g(at)h(the)f(curren)m(t)f(p)s | |
3762 | (osition,)j(as)e(determined)f(b)m(y)h Fq(where_history\(\))p | |
3763 | Fr(.)390 4005 y(If)30 b(there)g(is)h(no)f(en)m(try)h(there,)g(return)e | |
3764 | (a)i Fq(NULL)e Fr(p)s(oin)m(ter.)3350 4225 y([F)-8 b(unction])-3599 | |
3765 | b Fg(HIST_ENTRY)41 b(*)e Ff(history)p 1160 4225 V 50 | |
3766 | w(get)45 b Fe(\()p Fq(int)30 b(offset)p Fe(\))390 4334 | |
3767 | y Fr(Return)41 b(the)g(history)h(en)m(try)g(at)g(p)s(osition)g | |
3768 | Fj(o\013set)p Fr(,)j(starting)e(from)e Fq(history_base)d | |
3769 | Fr(\(see)k(Sec-)390 4444 y(tion)30 b(2.4)g([History)h(V)-8 | |
3770 | b(ariables],)31 b(page)f(10\).)42 b(If)28 b(there)i(is)f(no)h(en)m(try) | |
3771 | f(there,)h(or)g(if)f Fj(o\013set)j Fr(is)e(greater)390 | |
3772 | 4553 y(than)g(the)h(history)f(length,)h(return)e(a)i | |
3773 | Fq(NULL)e Fr(p)s(oin)m(ter.)3350 4774 y([F)-8 b(unction])-3599 | |
3774 | b Fg(time_t)40 b Ff(history)p 860 4774 V 51 w(get)p 1066 | |
3775 | 4774 V 49 w(time)45 b Fe(\()p Fq(HIST_ENTRY)28 b(*entry)p | |
3776 | Fe(\))390 4883 y Fr(Return)i(the)g(time)h(stamp)f(asso)s(ciated)i(with) | |
3777 | e(the)h(history)f(en)m(try)h Fj(en)m(try)p Fr(.)3350 | |
3778 | 5103 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(history)p | |
3779 | 703 5103 V 51 w(total)p 989 5103 V 49 w(b)m(ytes)45 b | |
3780 | Fe(\()p Fq(void)p Fe(\))390 5213 y Fr(Return)27 b(the)h(n)m(um)m(b)s | |
3781 | (er)e(of)i(b)m(ytes)g(that)g(the)g(primary)e(history)i(en)m(tries)g | |
3782 | (are)g(using.)39 b(This)27 b(function)390 5322 y(returns)i(the)i(sum)e | |
3783 | (of)i(the)f(lengths)h(of)f(all)i(the)e(lines)h(in)f(the)g(history)-8 | |
3784 | b(.)p eop end | |
3785 | %%Page: 8 12 | |
3786 | TeXDict begin 8 11 bop 150 -116 a Fr(8)2696 b(GNU)31 | |
3787 | b(History)g(Library)150 299 y Fi(2.3.4)63 b(Mo)m(ving)41 | |
3788 | b(Around)h(the)f(History)g(List)275 544 y Fr(These)30 | |
3789 | b(functions)g(allo)m(w)h(the)g(curren)m(t)f(index)g(in)m(to)h(the)g | |
3790 | (history)f(list)h(to)g(b)s(e)f(set)h(or)f(c)m(hanged.)3350 | |
3791 | 730 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(history)p | |
3792 | 703 730 35 5 v 51 w(set)p 897 730 V 49 w(p)s(os)46 b | |
3793 | Fe(\()p Fq(int)30 b(pos)p Fe(\))390 839 y Fr(Set)37 b(the)g(curren)m(t) | |
3794 | f(history)g(o\013set)i(to)f Fj(p)s(os)p Fr(,)h(an)f(absolute)g(index)f | |
3795 | (in)m(to)i(the)e(list.)60 b(Returns)36 b(1)h(on)390 949 | |
3796 | y(success,)31 b(0)g(if)f Fj(p)s(os)j Fr(is)e(less)f(than)h(zero)g(or)f | |
3797 | (greater)i(than)e(the)g(n)m(um)m(b)s(er)f(of)i(history)f(en)m(tries.) | |
3798 | 3350 1135 y([F)-8 b(unction])-3599 b Fg(HIST_ENTRY)41 | |
3799 | b(*)e Ff(previous)p 1232 1135 V 50 w(history)46 b Fe(\()p | |
3800 | Fq(void)p Fe(\))390 1244 y Fr(Bac)m(k)30 b(up)e(the)h(curren)m(t)g | |
3801 | (history)f(o\013set)i(to)g(the)f(previous)f(history)h(en)m(try)-8 | |
3802 | b(,)30 b(and)e(return)g(a)h(p)s(oin)m(ter)390 1354 y(to)i(that)g(en)m | |
3803 | (try)-8 b(.)41 b(If)30 b(there)h(is)f(no)h(previous)f(en)m(try)-8 | |
3804 | b(,)31 b(return)e(a)i Fq(NULL)e Fr(p)s(oin)m(ter.)3350 | |
3805 | 1540 y([F)-8 b(unction])-3599 b Fg(HIST_ENTRY)41 b(*)e | |
3806 | Ff(next)p 1032 1540 V 49 w(history)46 b Fe(\()p Fq(void)p | |
3807 | Fe(\))390 1649 y Fr(Mo)m(v)m(e)38 b(the)d(curren)m(t)h(history)f | |
3808 | (o\013set)i(forw)m(ard)e(to)h(the)g(next)f(history)h(en)m(try)-8 | |
3809 | b(,)37 b(and)e(return)g(the)h(a)390 1759 y(p)s(oin)m(ter)30 | |
3810 | b(to)h(that)g(en)m(try)-8 b(.)42 b(If)30 b(there)g(is)h(no)f(next)h(en) | |
3811 | m(try)-8 b(,)31 b(return)e(a)i Fq(NULL)e Fr(p)s(oin)m(ter.)150 | |
3812 | 1985 y Fi(2.3.5)63 b(Searc)m(hing)40 b(the)h(History)h(List)275 | |
3813 | 2230 y Fr(These)26 b(functions)g(allo)m(w)i(searc)m(hing)g(of)f(the)g | |
3814 | (history)f(list)i(for)e(en)m(tries)i(con)m(taining)g(a)f(sp)s(eci\014c) | |
3815 | g(string.)150 2339 y(Searc)m(hing)h(ma)m(y)g(b)s(e)f(p)s(erformed)f(b)s | |
3816 | (oth)h(forw)m(ard)f(and)h(bac)m(kw)m(ard)h(from)f(the)h(curren)m(t)f | |
3817 | (history)h(p)s(osition.)150 2449 y(The)j(searc)m(h)h(ma)m(y)g(b)s(e)e | |
3818 | Fj(anc)m(hored)p Fr(,)i(meaning)g(that)g(the)f(string)h(m)m(ust)f(matc) | |
3819 | m(h)h(at)g(the)g(b)s(eginning)e(of)i(the)150 2558 y(history)e(en)m(try) | |
3820 | -8 b(.)3350 2744 y([F)g(unction])-3599 b Fg(int)39 b | |
3821 | Ff(history)p 703 2744 V 51 w(searc)m(h)44 b Fe(\()p Fq(const)29 | |
3822 | b(char)h(*string,)e(int)h(direction)p Fe(\))390 2854 | |
3823 | y Fr(Searc)m(h)g(the)g(history)g(for)g Fj(string)p Fr(,)g(starting)h | |
3824 | (at)f(the)g(curren)m(t)g(history)g(o\013set.)41 b(If)28 | |
3825 | b Fj(direction)i Fr(is)f(less)390 2963 y(than)40 b(0,)j(then)c(the)h | |
3826 | (searc)m(h)h(is)f(through)f(previous)h(en)m(tries,)j(otherwise)d | |
3827 | (through)g(subsequen)m(t)390 3073 y(en)m(tries.)i(If)30 | |
3828 | b Fj(string)38 b Fr(is)30 b(found,)g(then)g(the)g(curren)m(t)h(history) | |
3829 | f(index)g(is)g(set)h(to)h(that)f(history)f(en)m(try)-8 | |
3830 | b(,)390 3183 y(and)33 b(the)g(v)-5 b(alue)34 b(returned)e(is)i(the)g | |
3831 | (o\013set)g(in)f(the)h(line)f(of)h(the)g(en)m(try)f(where)g | |
3832 | Fj(string)41 b Fr(w)m(as)34 b(found.)390 3292 y(Otherwise,)c(nothing)h | |
3833 | (is)f(c)m(hanged,)h(and)f(a)h(-1)g(is)f(returned.)3350 | |
3834 | 3478 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(history)p | |
3835 | 703 3478 V 51 w(searc)m(h)p 1067 3478 V 49 w(pre\014x)45 | |
3836 | b Fe(\()p Fq(const)29 b(char)g(*string,)g(int)g(direction)p | |
3837 | Fe(\))390 3588 y Fr(Searc)m(h)41 b(the)g(history)f(for)g | |
3838 | Fj(string)p Fr(,)k(starting)d(at)g(the)g(curren)m(t)f(history)h | |
3839 | (o\013set.)72 b(The)40 b(searc)m(h)h(is)390 3697 y(anc)m(hored:)f(matc) | |
3840 | m(hing)31 b(lines)f(m)m(ust)f(b)s(egin)g(with)g Fj(string)p | |
3841 | Fr(.)40 b(If)29 b Fj(direction)h Fr(is)g(less)f(than)g(0,)i(then)e(the) | |
3842 | 390 3807 y(searc)m(h)j(is)f(through)g(previous)g(en)m(tries,)h | |
3843 | (otherwise)g(through)e(subsequen)m(t)h(en)m(tries.)44 | |
3844 | b(If)31 b Fj(string)39 b Fr(is)390 3916 y(found,)33 b(then)f(the)h | |
3845 | (curren)m(t)g(history)g(index)g(is)g(set)g(to)h(that)g(en)m(try)-8 | |
3846 | b(,)34 b(and)f(the)g(return)f(v)-5 b(alue)33 b(is)g(0.)390 | |
3847 | 4026 y(Otherwise,)d(nothing)h(is)f(c)m(hanged,)h(and)f(a)h(-1)g(is)f | |
3848 | (returned.)3350 4212 y([F)-8 b(unction])-3599 b Fg(int)39 | |
3849 | b Ff(history)p 703 4212 V 51 w(searc)m(h)p 1067 4212 | |
3850 | V 49 w(p)s(os)46 b Fe(\()p Fq(const)29 b(char)g(*string,)f(int)i | |
3851 | (direction,)d(int)565 4321 y(pos)p Fe(\))390 4431 y Fr(Searc)m(h)34 | |
3852 | b(for)g Fj(string)42 b Fr(in)34 b(the)h(history)f(list,)i(starting)f | |
3853 | (at)g Fj(p)s(os)p Fr(,)g(an)f(absolute)h(index)e(in)m(to)j(the)e(list.) | |
3854 | 390 4541 y(If)i Fj(direction)g Fr(is)g(negativ)m(e,)k(the)c(searc)m(h)h | |
3855 | (pro)s(ceeds)f(bac)m(kw)m(ard)g(from)g Fj(p)s(os)p Fr(,)h(otherwise)f | |
3856 | (forw)m(ard.)390 4650 y(Returns)43 b(the)h(absolute)h(index)f(of)g(the) | |
3857 | g(history)g(elemen)m(t)h(where)f Fj(string)52 b Fr(w)m(as)44 | |
3858 | b(found,)i(or)e(-1)390 4760 y(otherwise.)150 4986 y Fi(2.3.6)63 | |
3859 | b(Managing)41 b(the)g(History)h(File)275 5230 y Fr(The)31 | |
3860 | b(History)h(library)f(can)h(read)f(the)h(history)g(from)f(and)g(write)h | |
3861 | (it)g(to)g(a)g(\014le.)45 b(This)31 b(section)h(do)s(cu-)150 | |
3862 | 5340 y(men)m(ts)f(the)f(functions)g(for)g(managing)h(a)g(history)f | |
3863 | (\014le.)p eop end | |
3864 | %%Page: 9 13 | |
3865 | TeXDict begin 9 12 bop 150 -116 a Fr(Chapter)30 b(2:)41 | |
3866 | b(Programming)30 b(with)g(GNU)h(History)1780 b(9)3350 | |
3867 | 299 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(read)p | |
3868 | 573 299 35 5 v 50 w(history)45 b Fe(\()p Fq(const)29 | |
3869 | b(char)h(*filename)p Fe(\))390 408 y Fr(Add)f(the)h(con)m(ten)m(ts)h | |
3870 | (of)f Fj(\014lename)k Fr(to)d(the)f(history)f(list,)i(a)f(line)g(at)g | |
3871 | (a)g(time.)41 b(If)29 b Fj(\014lename)35 b Fr(is)30 b | |
3872 | Fq(NULL)p Fr(,)390 518 y(then)g(read)g(from)g(`)p Fq(~/.history)p | |
3873 | Fr('.)39 b(Returns)29 b(0)i(if)f(successful,)h(or)f Fq(errno)f | |
3874 | Fr(if)h(not.)3350 717 y([F)-8 b(unction])-3599 b Fg(int)39 | |
3875 | b Ff(read)p 573 717 V 50 w(history)p 973 717 V 50 w(range)45 | |
3876 | b Fe(\()p Fq(const)29 b(char)g(*filename,)f(int)h(from,)g(int)h(to)p | |
3877 | Fe(\))390 826 y Fr(Read)e(a)g(range)h(of)f(lines)g(from)f | |
3878 | Fj(\014lename)p Fr(,)i(adding)e(them)h(to)h(the)f(history)g(list.)40 | |
3879 | b(Start)28 b(reading)g(at)390 936 y(line)f Fj(from)e | |
3880 | Fr(and)h(end)f(at)i Fj(to)p Fr(.)41 b(If)25 b Fj(from)h | |
3881 | Fr(is)g(zero,)i(start)f(at)g(the)f(b)s(eginning.)39 b(If)26 | |
3882 | b Fj(to)31 b Fr(is)c(less)f(than)g Fj(from)p Fr(,)390 | |
3883 | 1045 y(then)k(read)g(un)m(til)g(the)g(end)g(of)g(the)g(\014le.)41 | |
3884 | b(If)30 b Fj(\014lename)35 b Fr(is)30 b Fq(NULL)p Fr(,)g(then)f(read)h | |
3885 | (from)g(`)p Fq(~/.history)p Fr('.)390 1155 y(Returns)f(0)i(if)g | |
3886 | (successful,)f(or)g Fq(errno)f Fr(if)i(not.)3350 1353 | |
3887 | y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(write)p 613 | |
3888 | 1353 V 49 w(history)46 b Fe(\()p Fq(const)29 b(char)g(*filename)p | |
3889 | Fe(\))390 1463 y Fr(W)-8 b(rite)36 b(the)f(curren)m(t)g(history)g(to)g | |
3890 | Fj(\014lename)p Fr(,)h(o)m(v)m(erwriting)h Fj(\014lename)j | |
3891 | Fr(if)35 b(necessary)-8 b(.)54 b(If)35 b Fj(\014lename)390 | |
3892 | 1573 y Fr(is)d Fq(NULL)p Fr(,)g(then)g(write)g(the)h(history)f(list)h | |
3893 | (to)g(`)p Fq(~/.history)p Fr('.)44 b(Returns)31 b(0)i(on)f(success,)h | |
3894 | (or)f Fq(errno)390 1682 y Fr(on)e(a)h(read)f(or)h(write)f(error.)3350 | |
3895 | 1881 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(app)s(end)p | |
3896 | 721 1881 V 48 w(history)46 b Fe(\()p Fq(int)30 b(nelements,)e(const)g | |
3897 | (char)i(*filename)p Fe(\))390 1990 y Fr(App)s(end)j(the)i(last)g | |
3898 | Fj(nelemen)m(ts)k Fr(of)c(the)g(history)f(list)i(to)f | |
3899 | Fj(\014lename)p Fr(.)54 b(If)34 b Fj(\014lename)40 b | |
3900 | Fr(is)34 b Fq(NULL)p Fr(,)h(then)390 2100 y(app)s(end)29 | |
3901 | b(to)i(`)p Fq(~/.history)p Fr('.)38 b(Returns)30 b(0)g(on)h(success,)g | |
3902 | (or)f Fq(errno)f Fr(on)h(a)h(read)f(or)h(write)f(error.)3350 | |
3903 | 2299 y([F)-8 b(unction])-3599 b Fg(int)39 b Ff(history)p | |
3904 | 703 2299 V 51 w(truncate)p 1179 2299 V 48 w(\014le)44 | |
3905 | b Fe(\()p Fq(const)30 b(char)f(*filename,)e(int)j(nlines)p | |
3906 | Fe(\))390 2408 y Fr(T)-8 b(runcate)39 b(the)f(history)h(\014le)f | |
3907 | Fj(\014lename)p Fr(,)j(lea)m(ving)f(only)f(the)g(last)g | |
3908 | Fj(nlines)j Fr(lines.)65 b(If)38 b Fj(\014lename)44 b | |
3909 | Fr(is)390 2518 y Fq(NULL)p Fr(,)29 b(then)i(`)p Fq(~/.history)p | |
3910 | Fr(')d(is)i(truncated.)41 b(Returns)29 b(0)i(on)f(success,)h(or)f | |
3911 | Fq(errno)f Fr(on)i(failure.)150 2756 y Fi(2.3.7)63 b(History)41 | |
3912 | b(Expansion)275 3007 y Fr(These)30 b(functions)g(implemen)m(t)h | |
3913 | (history)f(expansion.)3350 3206 y([F)-8 b(unction])-3599 | |
3914 | b Fg(int)39 b Ff(history)p 703 3206 V 51 w(expand)44 | |
3915 | b Fe(\()p Fq(char)29 b(*string,)f(char)i(**output)p Fe(\))390 | |
3916 | 3315 y Fr(Expand)j Fj(string)p Fr(,)j(placing)f(the)f(result)h(in)m(to) | |
3917 | g Fj(output)p Fr(,)g(a)g(p)s(oin)m(ter)f(to)h(a)g(string)f(\(see)i | |
3918 | (Section)f(1.1)390 3425 y([History)c(In)m(teraction],)i(page)e(1\).)41 | |
3919 | b(Returns:)390 3595 y Fq(0)432 b Fr(If)37 b(no)g(expansions)g(to)s(ok)i | |
3920 | (place)f(\(or,)i(if)d(the)h(only)f(c)m(hange)i(in)e(the)g(text)i(w)m | |
3921 | (as)f(the)870 3705 y(remo)m(v)-5 b(al)31 b(of)g(escap)s(e)f(c)m | |
3922 | (haracters)i(preceding)e(the)g(history)g(expansion)g(c)m(haracter\);) | |
3923 | 390 3871 y Fq(1)432 b Fr(if)30 b(expansions)g(did)g(tak)m(e)i(place;) | |
3924 | 390 4038 y Fq(-1)384 b Fr(if)30 b(there)h(w)m(as)g(an)f(error)g(in)g | |
3925 | (expansion;)390 4204 y Fq(2)432 b Fr(if)28 b(the)f(returned)g(line)g | |
3926 | (should)g(b)s(e)g(displa)m(y)m(ed,)i(but)e(not)h(executed,)h(as)f(with) | |
3927 | f(the)h Fq(:p)870 4314 y Fr(mo)s(di\014er)h(\(see)j(Section)f(1.1.3)h | |
3928 | ([Mo)s(di\014ers],)e(page)i(2\).)390 4484 y(If)e(an)g(error)g(o)s | |
3929 | (curred)f(in)i(expansion,)f(then)g Fj(output)i Fr(con)m(tains)g(a)e | |
3930 | (descriptiv)m(e)i(error)e(message.)3350 4682 y([F)-8 | |
3931 | b(unction])-3599 b Fg(char)39 b(*)g Ff(get)p 651 4682 | |
3932 | V 50 w(history)p 1051 4682 V 50 w(ev)m(en)m(t)44 b Fe(\()p | |
3933 | Fq(const)29 b(char)h(*string,)e(int)h(*cindex,)f(int)565 | |
3934 | 4792 y(qchar)p Fe(\))390 4902 y Fr(Returns)45 b(the)g(text)i(of)e(the)h | |
3935 | (history)f(ev)m(en)m(t)i(b)s(eginning)e(at)h Fj(string)53 | |
3936 | b Fq(+)45 b Fj(*cindex)p Fr(.)87 b Fj(*cindex)52 b Fr(is)390 | |
3937 | 5011 y(mo)s(di\014ed)28 b(to)i(p)s(oin)m(t)f(to)h(after)g(the)g(ev)m | |
3938 | (en)m(t)h(sp)s(eci\014er.)39 b(A)m(t)31 b(function)e(en)m(try)-8 | |
3939 | b(,)30 b Fj(cindex)36 b Fr(p)s(oin)m(ts)29 b(to)h(the)390 | |
3940 | 5121 y(index)35 b(in)m(to)i Fj(string)44 b Fr(where)35 | |
3941 | b(the)h(history)g(ev)m(en)m(t)h(sp)s(eci\014cation)g(b)s(egins.)57 | |
3942 | b Fj(qc)m(har)42 b Fr(is)36 b(a)g(c)m(haracter)390 5230 | |
3943 | y(that)27 b(is)g(allo)m(w)m(ed)i(to)f(end)e(the)h(ev)m(en)m(t)h(sp)s | |
3944 | (eci\014cation)g(in)f(addition)g(to)g(the)g(\\normal")h(terminating)390 | |
3945 | 5340 y(c)m(haracters.)p eop end | |
3946 | %%Page: 10 14 | |
3947 | TeXDict begin 10 13 bop 150 -116 a Fr(10)2651 b(GNU)31 | |
3948 | b(History)g(Library)3350 299 y([F)-8 b(unction])-3599 | |
3949 | b Fg(char)39 b(**)g Ff(history)p 898 299 35 5 v 51 w(tok)m(enize)44 | |
3950 | b Fe(\()p Fq(const)29 b(char)g(*string)p Fe(\))390 408 | |
3951 | y Fr(Return)h(an)h(arra)m(y)g(of)g(tok)m(ens)h(parsed)e(out)h(of)g | |
3952 | Fj(string)p Fr(,)h(m)m(uc)m(h)e(as)i(the)f(shell)g(migh)m(t.)43 | |
3953 | b(The)30 b(tok)m(ens)390 518 y(are)h(split)g(on)f(the)h(c)m(haracters)h | |
3954 | (in)e(the)h Fj(history)p 2006 518 28 4 v 40 w(w)m(ord)p | |
3955 | 2241 518 V 39 w(delimiters)k Fr(v)-5 b(ariable,)32 b(and)e(shell)g | |
3956 | (quoting)390 628 y(con)m(v)m(en)m(tions)i(are)f(ob)s(ey)m(ed.)3350 | |
3957 | 818 y([F)-8 b(unction])-3599 b Fg(char)39 b(*)g Ff(history)p | |
3958 | 846 818 35 5 v 50 w(arg)p 1056 818 V 51 w(extract)44 | |
3959 | b Fe(\()p Fq(int)30 b(first,)f(int)g(last,)g(const)g(char)565 | |
3960 | 927 y(*string)p Fe(\))390 1037 y Fr(Extract)41 b(a)g(string)f(segmen)m | |
3961 | (t)i(consisting)f(of)f(the)h Fj(\014rst)g Fr(through)f | |
3962 | Fj(last)j Fr(argumen)m(ts)e(presen)m(t)f(in)390 1146 | |
3963 | y Fj(string)p Fr(.)h(Argumen)m(ts)30 b(are)h(split)f(using)g | |
3964 | Fq(history_tokenize)p Fr(.)150 1411 y Fp(2.4)68 b(History)46 | |
3965 | b(V)-11 b(ariables)275 1658 y Fr(This)33 b(section)i(describ)s(es)e | |
3966 | (the)h(externally-visible)i(v)-5 b(ariables)35 b(exp)s(orted)e(b)m(y)h | |
3967 | (the)g Fk(gnu)g Fr(History)h(Li-)150 1767 y(brary)-8 | |
3968 | b(.)3371 1957 y([V)g(ariable])-3598 b Fg(int)39 b Ff(history)p | |
3969 | 703 1957 V 51 w(base)390 2067 y Fr(The)30 b(logical)j(o\013set)e(of)g | |
3970 | (the)f(\014rst)g(en)m(try)g(in)h(the)f(history)g(list.)3371 | |
3971 | 2257 y([V)-8 b(ariable])-3598 b Fg(int)39 b Ff(history)p | |
3972 | 703 2257 V 51 w(length)390 2366 y Fr(The)30 b(n)m(um)m(b)s(er)f(of)h | |
3973 | (en)m(tries)i(curren)m(tly)e(stored)h(in)f(the)g(history)g(list.)3371 | |
3974 | 2556 y([V)-8 b(ariable])-3598 b Fg(int)39 b Ff(history)p | |
3975 | 703 2556 V 51 w(max)p 965 2556 V 51 w(en)m(tries)390 | |
3976 | 2666 y Fr(The)45 b(maxim)m(um)h(n)m(um)m(b)s(er)f(of)h(history)g(en)m | |
3977 | (tries.)88 b(This)45 b(m)m(ust)h(b)s(e)f(c)m(hanged)i(using)e | |
3978 | Fq(stifle_)390 2776 y(history\(\))p Fr(.)3371 2966 y([V)-8 | |
3979 | b(ariable])-3598 b Fg(int)39 b Ff(history)p 703 2966 | |
3980 | V 51 w(write)p 1014 2966 V 49 w(timestamps)390 3075 y | |
3981 | Fr(If)44 b(non-zero,)49 b(timestamps)c(are)g(written)g(to)g(the)g | |
3982 | (history)f(\014le,)49 b(so)c(they)f(can)h(b)s(e)f(preserv)m(ed)390 | |
3983 | 3185 y(b)s(et)m(w)m(een)31 b(sessions.)41 b(The)30 b(default)g(v)-5 | |
3984 | b(alue)31 b(is)f(0,)h(meaning)g(that)g(timestamps)g(are)g(not)f(sa)m(v) | |
3985 | m(ed.)3371 3375 y([V)-8 b(ariable])-3598 b Fg(char)39 | |
3986 | b Ff(history)p 755 3375 V 51 w(expansion)p 1301 3375 | |
3987 | V 49 w(c)m(har)390 3484 y Fr(The)c(c)m(haracter)i(that)e(in)m(tro)s | |
3988 | (duces)g(a)h(history)f(ev)m(en)m(t.)57 b(The)34 b(default)i(is)f(`)p | |
3989 | Fq(!)p Fr('.)56 b(Setting)35 b(this)h(to)g(0)390 3594 | |
3990 | y(inhibits)30 b(history)g(expansion.)3371 3784 y([V)-8 | |
3991 | b(ariable])-3598 b Fg(char)39 b Ff(history)p 755 3784 | |
3992 | V 51 w(subst)p 1069 3784 V 50 w(c)m(har)390 3893 y Fr(The)h(c)m | |
3993 | (haracter)i(that)g(in)m(v)m(ok)m(es)g(w)m(ord)f(substitution)f(if)h | |
3994 | (found)e(at)i(the)g(start)g(of)g(a)g(line.)72 b(The)390 | |
3995 | 4003 y(default)31 b(is)f(`)p Fq(^)p Fr('.)3371 4193 y([V)-8 | |
3996 | b(ariable])-3598 b Fg(char)39 b Ff(history)p 755 4193 | |
3997 | V 51 w(commen)m(t)p 1263 4193 V 50 w(c)m(har)390 4303 | |
3998 | y Fr(During)e(tok)m(enization,)43 b(if)38 b(this)f(c)m(haracter)j(is)e | |
3999 | (seen)f(as)h(the)g(\014rst)f(c)m(haracter)j(of)e(a)g(w)m(ord,)h(then) | |
4000 | 390 4412 y(it)44 b(and)e(all)j(subsequen)m(t)d(c)m(haracters)j(up)d(to) | |
4001 | i(a)g(newline)f(are)h(ignored,)i(suppressing)c(history)390 | |
4002 | 4522 y(expansion)30 b(for)g(the)h(remainder)f(of)g(the)h(line.)41 | |
4003 | b(This)29 b(is)i(disabled)f(b)m(y)g(default.)3371 4712 | |
4004 | y([V)-8 b(ariable])-3598 b Fg(char)39 b(*)g Ff(history)p | |
4005 | 846 4712 V 50 w(w)m(ord)p 1144 4712 V 51 w(delimiters)390 | |
4006 | 4821 y Fr(The)27 b(c)m(haracters)i(that)f(separate)h(tok)m(ens)f(for)f | |
4007 | Fq(history_tokenize\(\))p Fr(.)35 b(The)27 b(default)h(v)-5 | |
4008 | b(alue)28 b(is)f Fq(")390 4931 y(\\t\\n\(\)<>;&|")p Fr(.)3371 | |
4009 | 5121 y([V)-8 b(ariable])-3598 b Fg(char)39 b(*)g Ff(history)p | |
4010 | 846 5121 V 50 w(searc)m(h)p 1209 5121 V 50 w(delimiter)p | |
4011 | 1712 5121 V 49 w(c)m(hars)390 5230 y Fr(The)26 b(list)g(of)g | |
4012 | (additional)h(c)m(haracters)h(whic)m(h)e(can)g(delimit)h(a)f(history)g | |
4013 | (searc)m(h)h(string,)g(in)f(addition)390 5340 y(to)31 | |
4014 | b(space,)g(T)-8 b(AB,)32 b(`)p Fq(:)p Fr(')e(and)g(`)p | |
4015 | Fq(?)p Fr(')g(in)g(the)h(case)g(of)g(a)g(substring)e(searc)m(h.)41 | |
4016 | b(The)30 b(default)h(is)f(empt)m(y)-8 b(.)p eop end | |
4017 | %%Page: 11 15 | |
4018 | TeXDict begin 11 14 bop 150 -116 a Fr(Chapter)30 b(2:)41 | |
4019 | b(Programming)30 b(with)g(GNU)h(History)1734 b(11)3371 | |
4020 | 299 y([V)-8 b(ariable])-3598 b Fg(char)39 b(*)g Ff(history)p | |
4021 | 846 299 35 5 v 50 w(no)p 1017 299 V 51 w(expand)p 1429 | |
4022 | 299 V 49 w(c)m(hars)390 408 y Fr(The)29 b(list)i(of)f(c)m(haracters)h | |
4023 | (whic)m(h)e(inhibit)h(history)g(expansion)f(if)h(found)e(immediately)j | |
4024 | (follo)m(wing)390 518 y Fj(history)p 672 518 28 4 v 40 | |
4025 | w(expansion)p 1104 518 V 40 w(c)m(har)p Fr(.)41 b(The)30 | |
4026 | b(default)g(is)h(space,)g(tab,)g(newline,)f(carriage)i(return,)e(and)g | |
4027 | (`)p Fq(=)p Fr('.)3371 707 y([V)-8 b(ariable])-3598 b | |
4028 | Fg(int)39 b Ff(history)p 703 707 35 5 v 51 w(quotes)p | |
4029 | 1078 707 V 50 w(inhibit)p 1461 707 V 48 w(expansion)390 | |
4030 | 817 y Fr(If)29 b(non-zero,)h(single-quoted)g(w)m(ords)f(are)g(not)h | |
4031 | (scanned)f(for)g(the)g(history)g(expansion)g(c)m(haracter.)390 | |
4032 | 927 y(The)h(default)g(v)-5 b(alue)31 b(is)g(0.)3371 1116 | |
4033 | y([V)-8 b(ariable])-3598 b Fg(rl_linebuf_func_t)43 b(*)c | |
4034 | Ff(history)p 1526 1116 V 50 w(inhibit)p 1909 1116 V 49 | |
4035 | w(expansion)p 2453 1116 V 49 w(function)390 1226 y Fr(This)32 | |
4036 | b(should)h(b)s(e)f(set)i(to)g(the)g(address)e(of)i(a)f(function)g(that) | |
4037 | h(tak)m(es)h(t)m(w)m(o)g(argumen)m(ts:)46 b(a)34 b Fq(char)29 | |
4038 | b(*)390 1335 y Fr(\()p Fj(string)8 b Fr(\))27 b(and)f(an)g | |
4039 | Fq(int)g Fr(index)g(in)m(to)i(that)f(string)f(\()p Fj(i)5 | |
4040 | b Fr(\).)40 b(It)27 b(should)f(return)f(a)i(non-zero)g(v)-5 | |
4041 | b(alue)27 b(if)g(the)390 1445 y(history)i(expansion)g(starting)h(at)g | |
4042 | Fj(string[i])j Fr(should)28 b(not)i(b)s(e)e(p)s(erformed;)h(zero)h(if)f | |
4043 | (the)g(expansion)390 1554 y(should)i(b)s(e)g(done.)45 | |
4044 | b(It)32 b(is)g(in)m(tended)g(for)g(use)g(b)m(y)f(applications)i(lik)m | |
4045 | (e)h(Bash)e(that)g(use)g(the)g(history)390 1664 y(expansion)e(c)m | |
4046 | (haracter)i(for)e(additional)i(purp)s(oses.)39 b(By)30 | |
4047 | b(default,)h(this)f(v)-5 b(ariable)31 b(is)g(set)g(to)g | |
4048 | Fq(NULL)p Fr(.)150 1928 y Fp(2.5)68 b(History)46 b(Programming)g | |
4049 | (Example)275 2174 y Fr(The)29 b(follo)m(wing)j(program)e(demonstrates)h | |
4050 | (simple)g(use)f(of)g(the)h Fk(gnu)f Fr(History)h(Library)-8 | |
4051 | b(.)390 2289 y Fd(#include)41 b(<stdio.h>)390 2376 y(#include)g | |
4052 | (<readline/history.h>)390 2550 y(main)f(\(argc,)h(argv\))586 | |
4053 | 2638 y(int)f(argc;)586 2725 y(char)g(**argv;)390 2812 | |
4054 | y({)468 2899 y(char)h(line[1024],)g(*t;)468 2986 y(int)f(len,)g(done)h | |
4055 | (=)e(0;)468 3161 y(line[0])i(=)f(0;)468 3335 y(using_history)j(\(\);) | |
4056 | 468 3422 y(while)e(\(!done\))547 3509 y({)625 3597 y(printf)g | |
4057 | (\("history$)g("\);)625 3684 y(fflush)g(\(stdout\);)625 | |
4058 | 3771 y(t)f(=)f(fgets)i(\(line,)f(sizeof)h(\(line\))f(-)g(1,)g(stdin\);) | |
4059 | 625 3858 y(if)g(\(t)g(&&)f(*t\))704 3945 y({)782 4032 | |
4060 | y(len)h(=)g(strlen)g(\(t\);)782 4120 y(if)g(\(t[len)h(-)e(1])h(==)f | |
4061 | ('\\n'\))861 4207 y(t[len)h(-)g(1])f(=)h('\\0';)704 4294 | |
4062 | y(})625 4468 y(if)g(\(!t\))704 4555 y(strcpy)g(\(line,)h("quit"\);)625 | |
4063 | 4730 y(if)f(\(line[0]\))704 4817 y({)782 4904 y(char)g(*expansion;)782 | |
4064 | 4991 y(int)g(result;)782 5166 y(result)h(=)e(history_expand)k(\(line,)d | |
4065 | (&expansion\);)782 5253 y(if)g(\(result\))861 5340 y(fprintf)h | |
4066 | (\(stderr,)g("\045s\\n",)f(expansion\);)p eop end | |
4067 | %%Page: 12 16 | |
4068 | TeXDict begin 12 15 bop 150 -116 a Fr(12)2651 b(GNU)31 | |
4069 | b(History)g(Library)782 386 y Fd(if)40 b(\(result)h(<)e(0)h(||)f | |
4070 | (result)i(==)f(2\))861 473 y({)939 560 y(free)g(\(expansion\);)939 | |
4071 | 648 y(continue;)861 735 y(})782 909 y(add_history)i(\(expansion\);)782 | |
4072 | 996 y(strncpy)f(\(line,)g(expansion,)g(sizeof)g(\(line\))f(-)g(1\);)782 | |
4073 | 1083 y(free)g(\(expansion\);)704 1171 y(})625 1345 y(if)g(\(strcmp)h | |
4074 | (\(line,)f("quit"\))h(==)f(0\))704 1432 y(done)g(=)f(1;)625 | |
4075 | 1519 y(else)h(if)g(\(strcmp)h(\(line,)g("save"\))f(==)g(0\))704 | |
4076 | 1606 y(write_history)i(\("history_file"\);)625 1694 y(else)e(if)g | |
4077 | (\(strcmp)h(\(line,)g("read"\))f(==)g(0\))704 1781 y(read_history)i | |
4078 | (\("history_file"\);)625 1868 y(else)e(if)g(\(strcmp)h(\(line,)g | |
4079 | ("list"\))f(==)g(0\))704 1955 y({)782 2042 y(register)h(HIST_ENTRY)h | |
4080 | (**the_list;)782 2130 y(register)f(int)f(i;)782 2304 | |
4081 | y(the_list)h(=)f(history_list)i(\(\);)782 2391 y(if)e(\(the_list\))861 | |
4082 | 2478 y(for)g(\(i)f(=)h(0;)f(the_list[i];)j(i++\))939 | |
4083 | 2565 y(printf)f(\("\045d:)f(\045s\\n",)h(i)e(+)h(history_base,)i | |
4084 | (the_list[i]->line\);)704 2653 y(})625 2740 y(else)e(if)g(\(strncmp)h | |
4085 | (\(line,)g("delete",)g(6\))f(==)f(0\))704 2827 y({)782 | |
4086 | 2914 y(int)h(which;)782 3001 y(if)g(\(\(sscanf)h(\(line)f(+)g(6,)g | |
4087 | ("\045d",)g(&which\)\))h(==)f(1\))861 3088 y({)939 3176 | |
4088 | y(HIST_ENTRY)i(*entry)e(=)g(remove_history)i(\(which\);)939 | |
4089 | 3263 y(if)e(\(!entry\))1018 3350 y(fprintf)g(\(stderr,)i("No)d(such)i | |
4090 | (entry)f(\045d\\n",)h(which\);)939 3437 y(else)1018 3524 | |
4091 | y({)1096 3611 y(free)f(\(entry->line\);)1096 3699 y(free)g(\(entry\);) | |
4092 | 1018 3786 y(})861 3873 y(})782 3960 y(else)861 4047 y({)939 | |
4093 | 4134 y(fprintf)h(\(stderr,)g("non-numeric)h(arg)e(given)g(to)g | |
4094 | (`delete'\\n"\);)861 4222 y(})704 4309 y(})547 4396 y(})390 | |
4095 | 4483 y(})p eop end | |
4096 | %%Page: 13 17 | |
4097 | TeXDict begin 13 16 bop 150 -116 a Fr(App)s(endix)29 | |
4098 | b(A:)h(Cop)m(ying)h(This)f(Man)m(ual)2105 b(13)150 299 | |
4099 | y Fn(App)t(endix)52 b(A)40 b(Cop)l(ying)51 b(This)j(Man)l(ual)150 | |
4100 | 690 y Fp(A.1)67 b(GNU)45 b(F)-11 b(ree)45 b(Do)t(cumen)l(tation)h | |
4101 | (License)1396 909 y Fr(V)-8 b(ersion)31 b(1.2,)h(No)m(v)m(em)m(b)s(er)g | |
4102 | (2002)390 1052 y(Cop)m(yrigh)m(t)842 1049 y(c)817 1052 | |
4103 | y Fo(\015)e Fr(2000,2001,2002)36 b(F)-8 b(ree)32 b(Soft)m(w)m(are)f(F) | |
4104 | -8 b(oundation,)32 b(Inc.)390 1161 y(59)f(T)-8 b(emple)31 | |
4105 | b(Place,)h(Suite)e(330,)i(Boston,)g(MA)61 b(02111-1307,)35 | |
4106 | b(USA)390 1380 y(Ev)m(ery)m(one)c(is)g(p)s(ermitted)f(to)h(cop)m(y)g | |
4107 | (and)f(distribute)g(v)m(erbatim)h(copies)390 1490 y(of)g(this)f | |
4108 | (license)h(do)s(cumen)m(t,)g(but)e(c)m(hanging)j(it)f(is)f(not)h(allo)m | |
4109 | (w)m(ed.)199 1632 y(0.)61 b(PREAMBLE)330 1770 y(The)37 | |
4110 | b(purp)s(ose)e(of)i(this)g(License)h(is)f(to)h(mak)m(e)g(a)g(man)m | |
4111 | (ual,)h(textb)s(o)s(ok,)h(or)d(other)g(functional)h(and)330 | |
4112 | 1880 y(useful)29 b(do)s(cumen)m(t)h Fj(free)36 b Fr(in)29 | |
4113 | b(the)i(sense)f(of)g(freedom:)41 b(to)31 b(assure)e(ev)m(ery)m(one)j | |
4114 | (the)e(e\013ectiv)m(e)j(freedom)330 1990 y(to)f(cop)m(y)g(and)f | |
4115 | (redistribute)g(it,)h(with)g(or)f(without)g(mo)s(difying)g(it,)i | |
4116 | (either)f(commercially)h(or)e(non-)330 2099 y(commercially)-8 | |
4117 | b(.)56 b(Secondarily)-8 b(,)36 b(this)f(License)g(preserv)m(es)g(for)f | |
4118 | (the)h(author)f(and)g(publisher)f(a)i(w)m(a)m(y)330 2209 | |
4119 | y(to)i(get)g(credit)g(for)f(their)g(w)m(ork,)i(while)e(not)g(b)s(eing)g | |
4120 | (considered)g(resp)s(onsible)f(for)h(mo)s(di\014cations)330 | |
4121 | 2318 y(made)30 b(b)m(y)h(others.)330 2457 y(This)22 b(License)i(is)f(a) | |
4122 | h(kind)e(of)i(\\cop)m(yleft",)j(whic)m(h)c(means)g(that)h(deriv)-5 | |
4123 | b(ativ)m(e)24 b(w)m(orks)f(of)h(the)f(do)s(cumen)m(t)330 | |
4124 | 2566 y(m)m(ust)34 b(themselv)m(es)h(b)s(e)e(free)h(in)g(the)g(same)g | |
4125 | (sense.)51 b(It)34 b(complemen)m(ts)h(the)f(GNU)g(General)h(Public)330 | |
4126 | 2676 y(License,)c(whic)m(h)f(is)h(a)f(cop)m(yleft)i(license)g(designed) | |
4127 | e(for)g(free)h(soft)m(w)m(are.)330 2814 y(W)-8 b(e)31 | |
4128 | b(ha)m(v)m(e)f(designed)g(this)f(License)h(in)f(order)g(to)i(use)e(it)h | |
4129 | (for)f(man)m(uals)h(for)f(free)h(soft)m(w)m(are,)h(b)s(ecause)330 | |
4130 | 2924 y(free)42 b(soft)m(w)m(are)i(needs)e(free)g(do)s(cumen)m(tation:) | |
4131 | 65 b(a)42 b(free)h(program)f(should)f(come)i(with)f(man)m(uals)330 | |
4132 | 3033 y(pro)m(viding)29 b(the)g(same)g(freedoms)f(that)i(the)f(soft)m(w) | |
4133 | m(are)h(do)s(es.)40 b(But)29 b(this)f(License)i(is)f(not)g(limited)g | |
4134 | (to)330 3143 y(soft)m(w)m(are)j(man)m(uals;)f(it)g(can)g(b)s(e)f(used)g | |
4135 | (for)g(an)m(y)h(textual)h(w)m(ork,)f(regardless)g(of)g(sub)5 | |
4136 | b(ject)30 b(matter)i(or)330 3252 y(whether)f(it)h(is)f(published)f(as)i | |
4137 | (a)f(prin)m(ted)g(b)s(o)s(ok.)44 b(W)-8 b(e)32 b(recommend)f(this)h | |
4138 | (License)g(principally)f(for)330 3362 y(w)m(orks)f(whose)h(purp)s(ose)d | |
4139 | (is)j(instruction)f(or)g(reference.)199 3500 y(1.)61 | |
4140 | b(APPLICABILITY)29 b(AND)j(DEFINITIONS)330 3639 y(This)39 | |
4141 | b(License)i(applies)f(to)g(an)m(y)h(man)m(ual)f(or)g(other)g(w)m(ork,)i | |
4142 | (in)e(an)m(y)g(medium,)i(that)e(con)m(tains)i(a)330 3748 | |
4143 | y(notice)h(placed)f(b)m(y)f(the)h(cop)m(yrigh)m(t)h(holder)e(sa)m(ying) | |
4144 | h(it)g(can)g(b)s(e)f(distributed)f(under)g(the)i(terms)330 | |
4145 | 3858 y(of)c(this)f(License.)62 b(Suc)m(h)37 b(a)h(notice)h(gran)m(ts)f | |
4146 | (a)g(w)m(orld-wide,)h(ro)m(y)m(alt)m(y-free)i(license,)f(unlimited)d | |
4147 | (in)330 3967 y(duration,)49 b(to)d(use)f(that)g(w)m(ork)h(under)d(the)j | |
4148 | (conditions)f(stated)h(herein.)85 b(The)45 b(\\Do)s(cumen)m(t",)330 | |
4149 | 4077 y(b)s(elo)m(w,)29 b(refers)f(to)h(an)m(y)g(suc)m(h)f(man)m(ual)h | |
4150 | (or)f(w)m(ork.)40 b(An)m(y)29 b(mem)m(b)s(er)e(of)i(the)f(public)g(is)g | |
4151 | (a)h(licensee,)i(and)330 4187 y(is)25 b(addressed)f(as)h(\\y)m(ou".)40 | |
4152 | b(Y)-8 b(ou)26 b(accept)g(the)f(license)h(if)f(y)m(ou)h(cop)m(y)-8 | |
4153 | b(,)27 b(mo)s(dify)d(or)h(distribute)g(the)g(w)m(ork)330 | |
4154 | 4296 y(in)30 b(a)h(w)m(a)m(y)g(requiring)f(p)s(ermission)f(under)g(cop) | |
4155 | m(yrigh)m(t)j(la)m(w.)330 4435 y(A)i(\\Mo)s(di\014ed)f(V)-8 | |
4156 | b(ersion")35 b(of)f(the)g(Do)s(cumen)m(t)g(means)g(an)m(y)g(w)m(ork)f | |
4157 | (con)m(taining)j(the)e(Do)s(cumen)m(t)g(or)330 4544 y(a)k(p)s(ortion)f | |
4158 | (of)h(it,)i(either)e(copied)g(v)m(erbatim,)i(or)d(with)h(mo)s | |
4159 | (di\014cations)f(and/or)h(translated)g(in)m(to)330 4654 | |
4160 | y(another)31 b(language.)330 4792 y(A)26 b(\\Secondary)g(Section")h(is) | |
4161 | f(a)h(named)e(app)s(endix)f(or)i(a)h(fron)m(t-matter)g(section)g(of)f | |
4162 | (the)g(Do)s(cumen)m(t)330 4902 y(that)c(deals)g(exclusiv)m(ely)h(with)e | |
4163 | (the)g(relationship)h(of)f(the)h(publishers)d(or)i(authors)g(of)h(the)f | |
4164 | (Do)s(cumen)m(t)330 5011 y(to)38 b(the)f(Do)s(cumen)m(t's)i(o)m(v)m | |
4165 | (erall)g(sub)5 b(ject)37 b(\(or)h(to)g(related)g(matters\))g(and)f(con) | |
4166 | m(tains)h(nothing)f(that)330 5121 y(could)j(fall)h(directly)g(within)f | |
4167 | (that)h(o)m(v)m(erall)i(sub)5 b(ject.)70 b(\(Th)m(us,)42 | |
4168 | b(if)e(the)h(Do)s(cumen)m(t)g(is)f(in)g(part)h(a)330 | |
4169 | 5230 y(textb)s(o)s(ok)24 b(of)g(mathematics,)j(a)d(Secondary)f(Section) | |
4170 | h(ma)m(y)g(not)g(explain)g(an)m(y)g(mathematics.\))40 | |
4171 | b(The)330 5340 y(relationship)28 b(could)f(b)s(e)g(a)g(matter)i(of)e | |
4172 | (historical)i(connection)f(with)f(the)h(sub)5 b(ject)27 | |
4173 | b(or)g(with)g(related)p eop end | |
4174 | %%Page: 14 18 | |
4175 | TeXDict begin 14 17 bop 150 -116 a Fr(14)2651 b(GNU)31 | |
4176 | b(History)g(Library)330 299 y(matters,)38 b(or)d(of)h(legal,)i | |
4177 | (commercial,)h(philosophical,)f(ethical)f(or)e(p)s(olitical)i(p)s | |
4178 | (osition)f(regarding)330 408 y(them.)330 549 y(The)25 | |
4179 | b(\\In)m(v)-5 b(arian)m(t)27 b(Sections")g(are)f(certain)g(Secondary)g | |
4180 | (Sections)g(whose)f(titles)i(are)f(designated,)i(as)330 | |
4181 | 659 y(b)s(eing)e(those)h(of)g(In)m(v)-5 b(arian)m(t)27 | |
4182 | b(Sections,)i(in)d(the)h(notice)h(that)f(sa)m(ys)g(that)g(the)g(Do)s | |
4183 | (cumen)m(t)g(is)g(released)330 769 y(under)f(this)i(License.)40 | |
4184 | b(If)27 b(a)h(section)h(do)s(es)f(not)f(\014t)h(the)g(ab)s(o)m(v)m(e)h | |
4185 | (de\014nition)e(of)h(Secondary)f(then)h(it)g(is)330 878 | |
4186 | y(not)k(allo)m(w)m(ed)i(to)e(b)s(e)g(designated)g(as)g(In)m(v)-5 | |
4187 | b(arian)m(t.)46 b(The)31 b(Do)s(cumen)m(t)i(ma)m(y)f(con)m(tain)i(zero) | |
4188 | e(In)m(v)-5 b(arian)m(t)330 988 y(Sections.)39 b(If)25 | |
4189 | b(the)f(Do)s(cumen)m(t)i(do)s(es)e(not)h(iden)m(tify)g(an)m(y)g(In)m(v) | |
4190 | -5 b(arian)m(t)25 b(Sections)h(then)e(there)h(are)g(none.)330 | |
4191 | 1129 y(The)36 b(\\Co)m(v)m(er)i(T)-8 b(exts")38 b(are)f(certain)g | |
4192 | (short)g(passages)g(of)g(text)g(that)h(are)f(listed,)i(as)d(F)-8 | |
4193 | b(ron)m(t-Co)m(v)m(er)330 1238 y(T)g(exts)26 b(or)f(Bac)m(k-Co)m(v)m | |
4194 | (er)j(T)-8 b(exts,)27 b(in)d(the)h(notice)i(that)e(sa)m(ys)h(that)g | |
4195 | (the)f(Do)s(cumen)m(t)h(is)f(released)g(under)330 1348 | |
4196 | y(this)h(License.)40 b(A)25 b(F)-8 b(ron)m(t-Co)m(v)m(er)29 | |
4197 | b(T)-8 b(ext)26 b(ma)m(y)h(b)s(e)e(at)i(most)f(5)g(w)m(ords,)g(and)g(a) | |
4198 | g(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext)26 b(ma)m(y)330 1457 | |
4199 | y(b)s(e)k(at)h(most)g(25)g(w)m(ords.)330 1598 y(A)36 | |
4200 | b(\\T)-8 b(ransparen)m(t")36 b(cop)m(y)g(of)g(the)f(Do)s(cumen)m(t)h | |
4201 | (means)g(a)g(mac)m(hine-readable)h(cop)m(y)-8 b(,)38 | |
4202 | b(represen)m(ted)330 1708 y(in)d(a)h(format)g(whose)g(sp)s | |
4203 | (eci\014cation)g(is)g(a)m(v)-5 b(ailable)38 b(to)f(the)f(general)g | |
4204 | (public,)h(that)f(is)g(suitable)g(for)330 1817 y(revising)c(the)g(do)s | |
4205 | (cumen)m(t)f(straigh)m(tforw)m(ardly)i(with)e(generic)i(text)g(editors) | |
4206 | f(or)f(\(for)h(images)h(com-)330 1927 y(p)s(osed)23 b(of)h(pixels\))g | |
4207 | (generic)h(pain)m(t)f(programs)g(or)f(\(for)h(dra)m(wings\))g(some)g | |
4208 | (widely)g(a)m(v)-5 b(ailable)26 b(dra)m(wing)330 2037 | |
4209 | y(editor,)k(and)f(that)g(is)g(suitable)h(for)f(input)f(to)i(text)g | |
4210 | (formatters)f(or)g(for)g(automatic)i(translation)f(to)330 | |
4211 | 2146 y(a)d(v)-5 b(ariet)m(y)28 b(of)f(formats)g(suitable)h(for)e(input) | |
4212 | g(to)i(text)g(formatters.)40 b(A)27 b(cop)m(y)g(made)g(in)g(an)g | |
4213 | (otherwise)330 2256 y(T)-8 b(ransparen)m(t)37 b(\014le)h(format)g | |
4214 | (whose)f(markup,)i(or)e(absence)h(of)g(markup,)g(has)g(b)s(een)f | |
4215 | (arranged)g(to)330 2365 y(th)m(w)m(art)27 b(or)g(discourage)g | |
4216 | (subsequen)m(t)f(mo)s(di\014cation)h(b)m(y)g(readers)f(is)g(not)h(T)-8 | |
4217 | b(ransparen)m(t.)39 b(An)27 b(image)330 2475 y(format)35 | |
4218 | b(is)f(not)h(T)-8 b(ransparen)m(t)34 b(if)g(used)g(for)g(an)m(y)g | |
4219 | (substan)m(tial)h(amoun)m(t)g(of)g(text.)53 b(A)35 b(cop)m(y)g(that)g | |
4220 | (is)330 2585 y(not)c(\\T)-8 b(ransparen)m(t")31 b(is)f(called)i | |
4221 | (\\Opaque".)330 2725 y(Examples)53 b(of)g(suitable)h(formats)f(for)g(T) | |
4222 | -8 b(ransparen)m(t)53 b(copies)h(include)f(plain)g Fk(asci)r(i)g | |
4223 | Fr(without)330 2835 y(markup,)41 b(T)-8 b(exinfo)40 b(input)f(format,)j | |
4224 | (LaT)1775 2855 y(E)1826 2835 y(X)d(input)g(format,)k | |
4225 | Fk(sgml)c Fr(or)g Fk(xml)g Fr(using)g(a)h(publicly)330 | |
4226 | 2945 y(a)m(v)-5 b(ailable)34 b Fk(dtd)p Fr(,)d(and)g | |
4227 | (standard-conforming)g(simple)h Fk(html)p Fr(,)f(P)m(ostScript)h(or)f | |
4228 | Fk(pdf)g Fr(designed)g(for)330 3054 y(h)m(uman)37 b(mo)s(di\014cation.) | |
4229 | 65 b(Examples)38 b(of)g(transparen)m(t)g(image)i(formats)e(include)g | |
4230 | Fk(png)p Fr(,)i Fk(x)n(cf)e Fr(and)330 3164 y Fk(jpg)p | |
4231 | Fr(.)63 b(Opaque)38 b(formats)g(include)g(proprietary)g(formats)g(that) | |
4232 | h(can)f(b)s(e)g(read)g(and)f(edited)i(only)330 3273 y(b)m(y)g | |
4233 | (proprietary)g(w)m(ord)g(pro)s(cessors,)j Fk(sgml)c Fr(or)i | |
4234 | Fk(xml)e Fr(for)i(whic)m(h)f(the)g Fk(dtd)g Fr(and/or)g(pro)s(cessing) | |
4235 | 330 3383 y(to)s(ols)32 b(are)f(not)g(generally)h(a)m(v)-5 | |
4236 | b(ailable,)34 b(and)c(the)h(mac)m(hine-generated)i Fk(html)p | |
4237 | Fr(,)d(P)m(ostScript)i(or)f Fk(pdf)330 3493 y Fr(pro)s(duced)e(b)m(y)h | |
4238 | (some)h(w)m(ord)f(pro)s(cessors)g(for)g(output)g(purp)s(oses)e(only)-8 | |
4239 | b(.)330 3634 y(The)34 b(\\Title)h(P)m(age")i(means,)e(for)f(a)h(prin)m | |
4240 | (ted)f(b)s(o)s(ok,)h(the)f(title)i(page)f(itself,)h(plus)e(suc)m(h)f | |
4241 | (follo)m(wing)330 3743 y(pages)28 b(as)g(are)g(needed)g(to)g(hold,)g | |
4242 | (legibly)-8 b(,)30 b(the)e(material)h(this)f(License)g(requires)f(to)h | |
4243 | (app)s(ear)f(in)h(the)330 3853 y(title)g(page.)40 b(F)-8 | |
4244 | b(or)28 b(w)m(orks)e(in)g(formats)h(whic)m(h)g(do)f(not)h(ha)m(v)m(e)h | |
4245 | (an)m(y)e(title)j(page)e(as)g(suc)m(h,)g(\\Title)h(P)m(age")330 | |
4246 | 3962 y(means)j(the)f(text)i(near)e(the)h(most)g(prominen)m(t)g(app)s | |
4247 | (earance)f(of)h(the)g(w)m(ork's)g(title,)h(preceding)f(the)330 | |
4248 | 4072 y(b)s(eginning)f(of)g(the)h(b)s(o)s(dy)e(of)h(the)h(text.)330 | |
4249 | 4213 y(A)f(section)h(\\En)m(titled)g(XYZ")f(means)f(a)h(named)g | |
4250 | (subunit)e(of)h(the)h(Do)s(cumen)m(t)h(whose)e(title)i(either)330 | |
4251 | 4322 y(is)d(precisely)g(XYZ)g(or)f(con)m(tains)i(XYZ)f(in)f(paren)m | |
4252 | (theses)i(follo)m(wing)g(text)g(that)f(translates)h(XYZ)e(in)330 | |
4253 | 4432 y(another)e(language.)40 b(\(Here)26 b(XYZ)f(stands)f(for)h(a)g | |
4254 | (sp)s(eci\014c)g(section)h(name)f(men)m(tioned)h(b)s(elo)m(w,)g(suc)m | |
4255 | (h)330 4542 y(as)i(\\Ac)m(kno)m(wledgemen)m(ts",)33 b(\\Dedications",)e | |
4256 | (\\Endorsemen)m(ts",)e(or)f(\\History".\))42 b(T)-8 b(o)29 | |
4257 | b(\\Preserv)m(e)330 4651 y(the)34 b(Title")h(of)e(suc)m(h)h(a)g | |
4258 | (section)g(when)f(y)m(ou)h(mo)s(dify)e(the)i(Do)s(cumen)m(t)h(means)e | |
4259 | (that)h(it)g(remains)g(a)330 4761 y(section)e(\\En)m(titled)f(XYZ")g | |
4260 | (according)g(to)g(this)g(de\014nition.)330 4902 y(The)c(Do)s(cumen)m(t) | |
4261 | i(ma)m(y)f(include)f(W)-8 b(arran)m(t)m(y)30 b(Disclaimers)f(next)f(to) | |
4262 | g(the)g(notice)h(whic)m(h)e(states)i(that)330 5011 y(this)34 | |
4263 | b(License)g(applies)g(to)h(the)f(Do)s(cumen)m(t.)52 b(These)33 | |
4264 | b(W)-8 b(arran)m(t)m(y)36 b(Disclaimers)f(are)g(considered)e(to)330 | |
4265 | 5121 y(b)s(e)k(included)g(b)m(y)g(reference)h(in)g(this)f(License,)j | |
4266 | (but)d(only)h(as)g(regards)f(disclaiming)i(w)m(arran)m(ties:)330 | |
4267 | 5230 y(an)m(y)e(other)g(implication)i(that)e(these)g(W)-8 | |
4268 | b(arran)m(t)m(y)39 b(Disclaimers)f(ma)m(y)g(ha)m(v)m(e)g(is)f(v)m(oid)g | |
4269 | (and)f(has)h(no)330 5340 y(e\013ect)32 b(on)e(the)h(meaning)f(of)h | |
4270 | (this)f(License.)p eop end | |
4271 | %%Page: 15 19 | |
4272 | TeXDict begin 15 18 bop 150 -116 a Fr(App)s(endix)29 | |
4273 | b(A:)h(Cop)m(ying)h(This)f(Man)m(ual)2105 b(15)199 299 | |
4274 | y(2.)61 b(VERBA)-8 b(TIM)31 b(COPYING)330 445 y(Y)-8 | |
4275 | b(ou)39 b(ma)m(y)f(cop)m(y)h(and)e(distribute)h(the)g(Do)s(cumen)m(t)h | |
4276 | (in)f(an)m(y)g(medium,)h(either)g(commercially)h(or)330 | |
4277 | 555 y(noncommercially)-8 b(,)48 b(pro)m(vided)42 b(that)h(this)f | |
4278 | (License,)47 b(the)42 b(cop)m(yrigh)m(t)i(notices,)j(and)42 | |
4279 | b(the)h(license)330 664 y(notice)37 b(sa)m(ying)g(this)e(License)i | |
4280 | (applies)e(to)i(the)f(Do)s(cumen)m(t)g(are)g(repro)s(duced)e(in)i(all)g | |
4281 | (copies,)j(and)330 774 y(that)27 b(y)m(ou)g(add)f(no)h(other)f | |
4282 | (conditions)h(whatso)s(ev)m(er)h(to)f(those)g(of)g(this)f(License.)40 | |
4283 | b(Y)-8 b(ou)27 b(ma)m(y)g(not)g(use)330 883 y(tec)m(hnical)35 | |
4284 | b(measures)d(to)i(obstruct)f(or)g(con)m(trol)h(the)f(reading)g(or)g | |
4285 | (further)e(cop)m(ying)j(of)f(the)g(copies)330 993 y(y)m(ou)25 | |
4286 | b(mak)m(e)g(or)g(distribute.)38 b(Ho)m(w)m(ev)m(er,)28 | |
4287 | b(y)m(ou)d(ma)m(y)g(accept)h(comp)s(ensation)f(in)f(exc)m(hange)j(for)d | |
4288 | (copies.)330 1103 y(If)32 b(y)m(ou)g(distribute)g(a)h(large)g(enough)f | |
4289 | (n)m(um)m(b)s(er)f(of)h(copies)h(y)m(ou)f(m)m(ust)h(also)g(follo)m(w)g | |
4290 | (the)f(conditions)330 1212 y(in)e(section)i(3.)330 1358 | |
4291 | y(Y)-8 b(ou)21 b(ma)m(y)h(also)f(lend)g(copies,)i(under)d(the)h(same)g | |
4292 | (conditions)g(stated)h(ab)s(o)m(v)m(e,)i(and)c(y)m(ou)h(ma)m(y)g | |
4293 | (publicly)330 1468 y(displa)m(y)31 b(copies.)199 1614 | |
4294 | y(3.)61 b(COPYING)30 b(IN)g(QUANTITY)330 1760 y(If)25 | |
4295 | b(y)m(ou)g(publish)f(prin)m(ted)g(copies)i(\(or)g(copies)g(in)f(media)g | |
4296 | (that)h(commonly)g(ha)m(v)m(e)g(prin)m(ted)f(co)m(v)m(ers\))i(of)330 | |
4297 | 1870 y(the)32 b(Do)s(cumen)m(t,)h(n)m(um)m(b)s(ering)e(more)h(than)f | |
4298 | (100,)j(and)d(the)h(Do)s(cumen)m(t's)h(license)f(notice)h(requires)330 | |
4299 | 1979 y(Co)m(v)m(er)i(T)-8 b(exts,)36 b(y)m(ou)f(m)m(ust)f(enclose)i | |
4300 | (the)e(copies)h(in)f(co)m(v)m(ers)i(that)f(carry)-8 b(,)36 | |
4301 | b(clearly)f(and)f(legibly)-8 b(,)37 b(all)330 2089 y(these)j(Co)m(v)m | |
4302 | (er)g(T)-8 b(exts:)59 b(F)-8 b(ron)m(t-Co)m(v)m(er)41 | |
4303 | b(T)-8 b(exts)40 b(on)f(the)g(fron)m(t)g(co)m(v)m(er,)44 | |
4304 | b(and)38 b(Bac)m(k-Co)m(v)m(er)k(T)-8 b(exts)40 b(on)330 | |
4305 | 2198 y(the)29 b(bac)m(k)h(co)m(v)m(er.)42 b(Both)30 b(co)m(v)m(ers)h(m) | |
4306 | m(ust)e(also)h(clearly)g(and)f(legibly)h(iden)m(tify)f(y)m(ou)h(as)f | |
4307 | (the)h(publisher)330 2308 y(of)k(these)h(copies.)53 b(The)34 | |
4308 | b(fron)m(t)h(co)m(v)m(er)h(m)m(ust)e(presen)m(t)g(the)h(full)f(title)i | |
4309 | (with)d(all)j(w)m(ords)d(of)i(the)f(title)330 2418 y(equally)e | |
4310 | (prominen)m(t)e(and)g(visible.)43 b(Y)-8 b(ou)31 b(ma)m(y)g(add)g | |
4311 | (other)g(material)h(on)f(the)g(co)m(v)m(ers)h(in)e(addition.)330 | |
4312 | 2527 y(Cop)m(ying)36 b(with)g(c)m(hanges)h(limited)g(to)g(the)g(co)m(v) | |
4313 | m(ers,)i(as)d(long)h(as)g(they)f(preserv)m(e)g(the)h(title)g(of)g(the) | |
4314 | 330 2637 y(Do)s(cumen)m(t)h(and)e(satisfy)i(these)f(conditions,)j(can)d | |
4315 | (b)s(e)g(treated)h(as)f(v)m(erbatim)h(cop)m(ying)g(in)f(other)330 | |
4316 | 2746 y(resp)s(ects.)330 2892 y(If)32 b(the)h(required)f(texts)i(for)e | |
4317 | (either)h(co)m(v)m(er)i(are)e(to)s(o)g(v)m(oluminous)g(to)g(\014t)g | |
4318 | (legibly)-8 b(,)35 b(y)m(ou)e(should)f(put)330 3002 y(the)h(\014rst)f | |
4319 | (ones)h(listed)g(\(as)h(man)m(y)f(as)g(\014t)g(reasonably\))g(on)g(the) | |
4320 | g(actual)h(co)m(v)m(er,)h(and)e(con)m(tin)m(ue)h(the)330 | |
4321 | 3112 y(rest)d(on)m(to)g(adjacen)m(t)h(pages.)330 3258 | |
4322 | y(If)27 b(y)m(ou)g(publish)e(or)i(distribute)g(Opaque)f(copies)i(of)f | |
4323 | (the)h(Do)s(cumen)m(t)f(n)m(um)m(b)s(ering)f(more)i(than)e(100,)330 | |
4324 | 3367 y(y)m(ou)i(m)m(ust)g(either)h(include)e(a)i(mac)m(hine-readable)g | |
4325 | (T)-8 b(ransparen)m(t)28 b(cop)m(y)h(along)g(with)e(eac)m(h)i(Opaque) | |
4326 | 330 3477 y(cop)m(y)-8 b(,)38 b(or)d(state)h(in)f(or)g(with)g(eac)m(h)h | |
4327 | (Opaque)e(cop)m(y)i(a)g(computer-net)m(w)m(ork)g(lo)s(cation)h(from)d | |
4328 | (whic)m(h)330 3587 y(the)24 b(general)i(net)m(w)m(ork-using)f(public)e | |
4329 | (has)h(access)i(to)f(do)m(wnload)f(using)g(public-standard)f(net)m(w)m | |
4330 | (ork)330 3696 y(proto)s(cols)40 b(a)f(complete)h(T)-8 | |
4331 | b(ransparen)m(t)39 b(cop)m(y)g(of)g(the)h(Do)s(cumen)m(t,)i(free)d(of)g | |
4332 | (added)f(material.)67 b(If)330 3806 y(y)m(ou)39 b(use)g(the)g(latter)h | |
4333 | (option,)h(y)m(ou)f(m)m(ust)e(tak)m(e)j(reasonably)e(pruden)m(t)e | |
4334 | (steps,)k(when)d(y)m(ou)h(b)s(egin)330 3915 y(distribution)f(of)g | |
4335 | (Opaque)g(copies)h(in)e(quan)m(tit)m(y)-8 b(,)43 b(to)38 | |
4336 | b(ensure)g(that)h(this)f(T)-8 b(ransparen)m(t)38 b(cop)m(y)h(will)330 | |
4337 | 4025 y(remain)30 b(th)m(us)g(accessible)i(at)f(the)f(stated)h(lo)s | |
4338 | (cation)h(un)m(til)e(at)h(least)h(one)e(y)m(ear)h(after)g(the)f(last)h | |
4339 | (time)330 4134 y(y)m(ou)37 b(distribute)f(an)h(Opaque)f(cop)m(y)i | |
4340 | (\(directly)g(or)e(through)g(y)m(our)h(agen)m(ts)h(or)f(retailers\))h | |
4341 | (of)f(that)330 4244 y(edition)31 b(to)g(the)g(public.)330 | |
4342 | 4390 y(It)k(is)f(requested,)i(but)e(not)h(required,)g(that)g(y)m(ou)g | |
4343 | (con)m(tact)h(the)f(authors)f(of)h(the)g(Do)s(cumen)m(t)g(w)m(ell)330 | |
4344 | 4500 y(b)s(efore)28 b(redistributing)g(an)m(y)h(large)h(n)m(um)m(b)s | |
4345 | (er)d(of)i(copies,)h(to)f(giv)m(e)h(them)f(a)g(c)m(hance)h(to)f(pro)m | |
4346 | (vide)g(y)m(ou)330 4609 y(with)h(an)g(up)s(dated)f(v)m(ersion)i(of)g | |
4347 | (the)f(Do)s(cumen)m(t.)199 4755 y(4.)61 b(MODIFICA)-8 | |
4348 | b(TIONS)330 4902 y(Y)g(ou)26 b(ma)m(y)g(cop)m(y)g(and)f(distribute)g(a) | |
4349 | h(Mo)s(di\014ed)f(V)-8 b(ersion)26 b(of)g(the)g(Do)s(cumen)m(t)g(under) | |
4350 | e(the)h(conditions)330 5011 y(of)c(sections)h(2)g(and)e(3)h(ab)s(o)m(v) | |
4351 | m(e,)k(pro)m(vided)20 b(that)i(y)m(ou)f(release)i(the)e(Mo)s(di\014ed)f | |
4352 | (V)-8 b(ersion)22 b(under)d(precisely)330 5121 y(this)29 | |
4353 | b(License,)h(with)f(the)g(Mo)s(di\014ed)f(V)-8 b(ersion)30 | |
4354 | b(\014lling)f(the)g(role)h(of)f(the)g(Do)s(cumen)m(t,)h(th)m(us)f | |
4355 | (licensing)330 5230 y(distribution)k(and)h(mo)s(di\014cation)g(of)h | |
4356 | (the)f(Mo)s(di\014ed)f(V)-8 b(ersion)35 b(to)g(who)s(ev)m(er)f(p)s | |
4357 | (ossesses)f(a)i(cop)m(y)g(of)330 5340 y(it.)41 b(In)30 | |
4358 | b(addition,)h(y)m(ou)f(m)m(ust)h(do)f(these)h(things)f(in)g(the)h(Mo)s | |
4359 | (di\014ed)e(V)-8 b(ersion:)p eop end | |
4360 | %%Page: 16 20 | |
4361 | TeXDict begin 16 19 bop 150 -116 a Fr(16)2651 b(GNU)31 | |
4362 | b(History)g(Library)357 299 y(A.)60 b(Use)33 b(in)f(the)h(Title)h(P)m | |
4363 | (age)g(\(and)f(on)f(the)h(co)m(v)m(ers,)i(if)e(an)m(y\))g(a)g(title)h | |
4364 | (distinct)f(from)g(that)g(of)g(the)510 408 y(Do)s(cumen)m(t,)j(and)d | |
4365 | (from)g(those)i(of)f(previous)f(v)m(ersions)h(\(whic)m(h)g(should,)g | |
4366 | (if)g(there)g(w)m(ere)g(an)m(y)-8 b(,)510 518 y(b)s(e)31 | |
4367 | b(listed)h(in)f(the)g(History)h(section)g(of)g(the)f(Do)s(cumen)m(t\).) | |
4368 | 45 b(Y)-8 b(ou)32 b(ma)m(y)g(use)f(the)g(same)h(title)h(as)510 | |
4369 | 628 y(a)e(previous)f(v)m(ersion)g(if)h(the)f(original)i(publisher)d(of) | |
4370 | h(that)h(v)m(ersion)g(giv)m(es)h(p)s(ermission.)360 758 | |
4371 | y(B.)61 b(List)31 b(on)f(the)h(Title)g(P)m(age,)i(as)d(authors,)h(one)g | |
4372 | (or)f(more)h(p)s(ersons)e(or)h(en)m(tities)j(resp)s(onsible)c(for)510 | |
4373 | 867 y(authorship)c(of)h(the)h(mo)s(di\014cations)f(in)g(the)g(Mo)s | |
4374 | (di\014ed)f(V)-8 b(ersion,)28 b(together)g(with)d(at)i(least)h(\014v)m | |
4375 | (e)510 977 y(of)c(the)g(principal)g(authors)f(of)i(the)f(Do)s(cumen)m | |
4376 | (t)g(\(all)h(of)g(its)f(principal)g(authors,)h(if)f(it)g(has)g(few)m | |
4377 | (er)510 1087 y(than)30 b(\014v)m(e\),)h(unless)f(they)h(release)g(y)m | |
4378 | (ou)g(from)f(this)g(requiremen)m(t.)359 1217 y(C.)60 | |
4379 | b(State)32 b(on)e(the)h(Title)h(page)f(the)g(name)g(of)g(the)g | |
4380 | (publisher)e(of)i(the)g(Mo)s(di\014ed)f(V)-8 b(ersion,)32 | |
4381 | b(as)f(the)510 1326 y(publisher.)355 1456 y(D.)61 b(Preserv)m(e)31 | |
4382 | b(all)g(the)g(cop)m(yrigh)m(t)h(notices)f(of)g(the)f(Do)s(cumen)m(t.) | |
4383 | 363 1587 y(E.)60 b(Add)30 b(an)i(appropriate)f(cop)m(yrigh)m(t)i | |
4384 | (notice)f(for)g(y)m(our)f(mo)s(di\014cations)g(adjacen)m(t)i(to)f(the)g | |
4385 | (other)510 1696 y(cop)m(yrigh)m(t)g(notices.)365 1826 | |
4386 | y(F.)61 b(Include,)28 b(immediately)h(after)f(the)h(cop)m(yrigh)m(t)g | |
4387 | (notices,)h(a)e(license)h(notice)g(giving)g(the)f(public)510 | |
4388 | 1936 y(p)s(ermission)23 b(to)j(use)e(the)g(Mo)s(di\014ed)g(V)-8 | |
4389 | b(ersion)25 b(under)e(the)i(terms)f(of)h(this)f(License,)j(in)d(the)g | |
4390 | (form)510 2045 y(sho)m(wn)30 b(in)g(the)g(Addendum)f(b)s(elo)m(w.)353 | |
4391 | 2176 y(G.)61 b(Preserv)m(e)23 b(in)g(that)g(license)h(notice)g(the)f | |
4392 | (full)g(lists)g(of)g(In)m(v)-5 b(arian)m(t)23 b(Sections)h(and)e | |
4393 | (required)g(Co)m(v)m(er)510 2285 y(T)-8 b(exts)31 b(giv)m(en)g(in)f | |
4394 | (the)h(Do)s(cumen)m(t's)g(license)h(notice.)357 2415 | |
4395 | y(H.)60 b(Include)30 b(an)g(unaltered)g(cop)m(y)h(of)g(this)f(License.) | |
4396 | 392 2545 y(I.)60 b(Preserv)m(e)33 b(the)f(section)h(En)m(titled)g | |
4397 | (\\History",)h(Preserv)m(e)f(its)f(Title,)i(and)d(add)h(to)h(it)f(an)g | |
4398 | (item)510 2655 y(stating)d(at)g(least)g(the)g(title,)h(y)m(ear,)g(new)d | |
4399 | (authors,)i(and)e(publisher)f(of)j(the)f(Mo)s(di\014ed)f(V)-8 | |
4400 | b(ersion)510 2765 y(as)32 b(giv)m(en)g(on)f(the)h(Title)g(P)m(age.)45 | |
4401 | b(If)31 b(there)h(is)f(no)g(section)i(En)m(titled)f(\\History")h(in)e | |
4402 | (the)g(Do)s(cu-)510 2874 y(men)m(t,)37 b(create)f(one)f(stating)h(the)f | |
4403 | (title,)i(y)m(ear,)g(authors,)f(and)e(publisher)f(of)i(the)g(Do)s | |
4404 | (cumen)m(t)510 2984 y(as)h(giv)m(en)h(on)f(its)h(Title)g(P)m(age,)i | |
4405 | (then)d(add)g(an)g(item)g(describing)g(the)g(Mo)s(di\014ed)g(V)-8 | |
4406 | b(ersion)37 b(as)510 3093 y(stated)31 b(in)f(the)h(previous)f(sen)m | |
4407 | (tence.)378 3224 y(J.)60 b(Preserv)m(e)33 b(the)g(net)m(w)m(ork)g(lo)s | |
4408 | (cation,)i(if)d(an)m(y)-8 b(,)34 b(giv)m(en)f(in)g(the)f(Do)s(cumen)m | |
4409 | (t)h(for)g(public)e(access)j(to)510 3333 y(a)e(T)-8 b(ransparen)m(t)30 | |
4410 | b(cop)m(y)i(of)g(the)f(Do)s(cumen)m(t,)h(and)f(lik)m(ewise)h(the)g(net) | |
4411 | m(w)m(ork)g(lo)s(cations)g(giv)m(en)g(in)510 3443 y(the)g(Do)s(cumen)m | |
4412 | (t)g(for)g(previous)f(v)m(ersions)h(it)g(w)m(as)g(based)f(on.)45 | |
4413 | b(These)31 b(ma)m(y)h(b)s(e)f(placed)h(in)g(the)510 3552 | |
4414 | y(\\History")27 b(section.)40 b(Y)-8 b(ou)25 b(ma)m(y)h(omit)g(a)f(net) | |
4415 | m(w)m(ork)h(lo)s(cation)g(for)f(a)h(w)m(ork)f(that)g(w)m(as)h | |
4416 | (published)510 3662 y(at)36 b(least)h(four)e(y)m(ears)i(b)s(efore)e | |
4417 | (the)h(Do)s(cumen)m(t)h(itself,)h(or)d(if)h(the)g(original)h(publisher) | |
4418 | d(of)i(the)510 3771 y(v)m(ersion)31 b(it)g(refers)f(to)h(giv)m(es)h(p)s | |
4419 | (ermission.)354 3902 y(K.)60 b(F)-8 b(or)24 b(an)m(y)h(section)f(En)m | |
4420 | (titled)h(\\Ac)m(kno)m(wledgemen)m(ts")i(or)d(\\Dedications",)k | |
4421 | (Preserv)m(e)c(the)g(Title)510 4011 y(of)j(the)f(section,)j(and)d | |
4422 | (preserv)m(e)h(in)f(the)h(section)g(all)h(the)e(substance)h(and)f(tone) | |
4423 | h(of)f(eac)m(h)i(of)f(the)510 4121 y(con)m(tributor)k(ac)m(kno)m | |
4424 | (wledgemen)m(ts)i(and/or)d(dedications)h(giv)m(en)h(therein.)368 | |
4425 | 4251 y(L.)60 b(Preserv)m(e)36 b(all)g(the)g(In)m(v)-5 | |
4426 | b(arian)m(t)36 b(Sections)g(of)f(the)h(Do)s(cumen)m(t,)h(unaltered)f | |
4427 | (in)f(their)g(text)i(and)510 4361 y(in)f(their)g(titles.)58 | |
4428 | b(Section)37 b(n)m(um)m(b)s(ers)d(or)i(the)g(equiv)-5 | |
4429 | b(alen)m(t)38 b(are)e(not)g(considered)g(part)g(of)g(the)510 | |
4430 | 4470 y(section)c(titles.)341 4600 y(M.)61 b(Delete)33 | |
4431 | b(an)m(y)e(section)h(En)m(titled)f(\\Endorsemen)m(ts".)42 | |
4432 | b(Suc)m(h)30 b(a)i(section)f(ma)m(y)h(not)f(b)s(e)f(included)510 | |
4433 | 4710 y(in)g(the)h(Mo)s(di\014ed)e(V)-8 b(ersion.)357 | |
4434 | 4840 y(N.)60 b(Do)29 b(not)g(retitle)h(an)m(y)e(existing)i(section)f | |
4435 | (to)g(b)s(e)f(En)m(titled)h(\\Endorsemen)m(ts")g(or)f(to)h(con\015ict)g | |
4436 | (in)510 4950 y(title)j(with)e(an)m(y)h(In)m(v)-5 b(arian)m(t)31 | |
4437 | b(Section.)354 5080 y(O.)60 b(Preserv)m(e)31 b(an)m(y)g(W)-8 | |
4438 | b(arran)m(t)m(y)32 b(Disclaimers.)330 5230 y(If)h(the)g(Mo)s(di\014ed)g | |
4439 | (V)-8 b(ersion)34 b(includes)f(new)g(fron)m(t-matter)i(sections)f(or)f | |
4440 | (app)s(endices)g(that)h(qualify)330 5340 y(as)28 b(Secondary)g | |
4441 | (Sections)g(and)f(con)m(tain)j(no)d(material)j(copied)e(from)f(the)h | |
4442 | (Do)s(cumen)m(t,)i(y)m(ou)e(ma)m(y)g(at)p eop end | |
4443 | %%Page: 17 21 | |
4444 | TeXDict begin 17 20 bop 150 -116 a Fr(App)s(endix)29 | |
4445 | b(A:)h(Cop)m(ying)h(This)f(Man)m(ual)2105 b(17)330 299 | |
4446 | y(y)m(our)32 b(option)h(designate)h(some)e(or)h(all)g(of)f(these)h | |
4447 | (sections)h(as)e(in)m(v)-5 b(arian)m(t.)48 b(T)-8 b(o)33 | |
4448 | b(do)f(this,)h(add)f(their)330 408 y(titles)37 b(to)f(the)f(list)h(of)g | |
4449 | (In)m(v)-5 b(arian)m(t)36 b(Sections)g(in)f(the)h(Mo)s(di\014ed)f(V)-8 | |
4450 | b(ersion's)36 b(license)g(notice.)57 b(These)330 518 | |
4451 | y(titles)32 b(m)m(ust)e(b)s(e)g(distinct)h(from)e(an)m(y)i(other)g | |
4452 | (section)g(titles.)330 650 y(Y)-8 b(ou)43 b(ma)m(y)g(add)f(a)g(section) | |
4453 | i(En)m(titled)f(\\Endorsemen)m(ts",)j(pro)m(vided)c(it)h(con)m(tains)g | |
4454 | (nothing)g(but)330 759 y(endorsemen)m(ts)30 b(of)g(y)m(our)f(Mo)s | |
4455 | (di\014ed)g(V)-8 b(ersion)31 b(b)m(y)e(v)-5 b(arious)30 | |
4456 | b(parties|for)g(example,)g(statemen)m(ts)i(of)330 869 | |
4457 | y(p)s(eer)27 b(review)g(or)g(that)h(the)f(text)i(has)d(b)s(een)h(appro) | |
4458 | m(v)m(ed)g(b)m(y)g(an)h(organization)h(as)e(the)h(authoritativ)m(e)330 | |
4459 | 978 y(de\014nition)i(of)h(a)f(standard.)330 1110 y(Y)-8 | |
4460 | b(ou)29 b(ma)m(y)g(add)e(a)i(passage)g(of)g(up)e(to)i(\014v)m(e)g(w)m | |
4461 | (ords)e(as)i(a)g(F)-8 b(ron)m(t-Co)m(v)m(er)30 b(T)-8 | |
4462 | b(ext,)30 b(and)e(a)g(passage)i(of)e(up)330 1219 y(to)g(25)g(w)m(ords)e | |
4463 | (as)i(a)f(Bac)m(k-Co)m(v)m(er)j(T)-8 b(ext,)29 b(to)f(the)f(end)f(of)i | |
4464 | (the)f(list)h(of)f(Co)m(v)m(er)h(T)-8 b(exts)27 b(in)g(the)h(Mo)s | |
4465 | (di\014ed)330 1329 y(V)-8 b(ersion.)58 b(Only)35 b(one)h(passage)h(of)f | |
4466 | (F)-8 b(ron)m(t-Co)m(v)m(er)38 b(T)-8 b(ext)36 b(and)g(one)g(of)g(Bac)m | |
4467 | (k-Co)m(v)m(er)j(T)-8 b(ext)36 b(ma)m(y)h(b)s(e)330 1439 | |
4468 | y(added)27 b(b)m(y)g(\(or)h(through)f(arrangemen)m(ts)h(made)g(b)m(y\)) | |
4469 | g(an)m(y)g(one)f(en)m(tit)m(y)-8 b(.)42 b(If)27 b(the)h(Do)s(cumen)m(t) | |
4470 | g(already)330 1548 y(includes)34 b(a)g(co)m(v)m(er)h(text)g(for)f(the)g | |
4471 | (same)h(co)m(v)m(er,)h(previously)e(added)f(b)m(y)h(y)m(ou)g(or)g(b)m | |
4472 | (y)g(arrangemen)m(t)330 1658 y(made)h(b)m(y)g(the)h(same)f(en)m(tit)m | |
4473 | (y)i(y)m(ou)f(are)f(acting)i(on)e(b)s(ehalf)f(of,)j(y)m(ou)f(ma)m(y)g | |
4474 | (not)f(add)g(another;)j(but)330 1767 y(y)m(ou)c(ma)m(y)h(replace)g(the) | |
4475 | f(old)g(one,)i(on)e(explicit)h(p)s(ermission)e(from)g(the)i(previous)e | |
4476 | (publisher)f(that)330 1877 y(added)e(the)g(old)h(one.)330 | |
4477 | 2008 y(The)25 b(author\(s\))h(and)f(publisher\(s\))f(of)i(the)f(Do)s | |
4478 | (cumen)m(t)h(do)g(not)f(b)m(y)h(this)f(License)h(giv)m(e)h(p)s | |
4479 | (ermission)330 2118 y(to)k(use)f(their)g(names)h(for)f(publicit)m(y)g | |
4480 | (for)h(or)f(to)h(assert)g(or)f(imply)g(endorsemen)m(t)g(of)h(an)m(y)g | |
4481 | (Mo)s(di\014ed)330 2228 y(V)-8 b(ersion.)199 2359 y(5.)61 | |
4482 | b(COMBINING)31 b(DOCUMENTS)330 2491 y(Y)-8 b(ou)39 b(ma)m(y)g(com)m | |
4483 | (bine)h(the)f(Do)s(cumen)m(t)g(with)g(other)f(do)s(cumen)m(ts)h | |
4484 | (released)g(under)f(this)g(License,)330 2600 y(under)f(the)h(terms)g | |
4485 | (de\014ned)f(in)h(section)h(4)g(ab)s(o)m(v)m(e)g(for)f(mo)s(di\014ed)f | |
4486 | (v)m(ersions,)k(pro)m(vided)d(that)h(y)m(ou)330 2710 | |
4487 | y(include)25 b(in)g(the)g(com)m(bination)i(all)f(of)g(the)f(In)m(v)-5 | |
4488 | b(arian)m(t)26 b(Sections)g(of)g(all)g(of)f(the)h(original)g(do)s | |
4489 | (cumen)m(ts,)330 2819 y(unmo)s(di\014ed,)g(and)g(list)h(them)g(all)g | |
4490 | (as)g(In)m(v)-5 b(arian)m(t)28 b(Sections)f(of)g(y)m(our)g(com)m(bined) | |
4491 | g(w)m(ork)f(in)h(its)g(license)330 2929 y(notice,)32 | |
4492 | b(and)e(that)h(y)m(ou)f(preserv)m(e)h(all)g(their)g(W)-8 | |
4493 | b(arran)m(t)m(y)32 b(Disclaimers.)330 3061 y(The)e(com)m(bined)g(w)m | |
4494 | (ork)h(need)e(only)i(con)m(tain)g(one)g(cop)m(y)g(of)f(this)g(License,) | |
4495 | i(and)d(m)m(ultiple)i(iden)m(tical)330 3170 y(In)m(v)-5 | |
4496 | b(arian)m(t)33 b(Sections)g(ma)m(y)g(b)s(e)f(replaced)h(with)f(a)h | |
4497 | (single)g(cop)m(y)-8 b(.)48 b(If)32 b(there)h(are)g(m)m(ultiple)g(In)m | |
4498 | (v)-5 b(arian)m(t)330 3280 y(Sections)27 b(with)g(the)g(same)g(name)g | |
4499 | (but)f(di\013eren)m(t)h(con)m(ten)m(ts,)i(mak)m(e)f(the)f(title)h(of)f | |
4500 | (eac)m(h)h(suc)m(h)f(section)330 3389 y(unique)33 b(b)m(y)h(adding)f | |
4501 | (at)i(the)f(end)g(of)g(it,)h(in)f(paren)m(theses,)i(the)e(name)g(of)g | |
4502 | (the)g(original)h(author)f(or)330 3499 y(publisher)23 | |
4503 | b(of)i(that)h(section)g(if)f(kno)m(wn,)h(or)f(else)h(a)f(unique)f(n)m | |
4504 | (um)m(b)s(er.)38 b(Mak)m(e)26 b(the)g(same)f(adjustmen)m(t)330 | |
4505 | 3608 y(to)g(the)g(section)g(titles)h(in)e(the)h(list)g(of)f(In)m(v)-5 | |
4506 | b(arian)m(t)26 b(Sections)f(in)f(the)g(license)i(notice)g(of)e(the)h | |
4507 | (com)m(bined)330 3718 y(w)m(ork.)330 3850 y(In)41 b(the)g(com)m | |
4508 | (bination,)46 b(y)m(ou)41 b(m)m(ust)g(com)m(bine)h(an)m(y)g(sections)g | |
4509 | (En)m(titled)g(\\History")h(in)e(the)g(v)-5 b(ari-)330 | |
4510 | 3959 y(ous)32 b(original)h(do)s(cumen)m(ts,)g(forming)f(one)g(section)h | |
4511 | (En)m(titled)g(\\History";)i(lik)m(ewise)f(com)m(bine)f(an)m(y)330 | |
4512 | 4069 y(sections)g(En)m(titled)f(\\Ac)m(kno)m(wledgemen)m(ts",)k(and)31 | |
4513 | b(an)m(y)h(sections)h(En)m(titled)g(\\Dedications".)47 | |
4514 | b(Y)-8 b(ou)330 4178 y(m)m(ust)30 b(delete)i(all)f(sections)h(En)m | |
4515 | (titled)f(\\Endorsemen)m(ts.")199 4310 y(6.)61 b(COLLECTIONS)28 | |
4516 | b(OF)i(DOCUMENTS)330 4441 y(Y)-8 b(ou)32 b(ma)m(y)h(mak)m(e)g(a)f | |
4517 | (collection)i(consisting)f(of)f(the)g(Do)s(cumen)m(t)g(and)g(other)g | |
4518 | (do)s(cumen)m(ts)f(released)330 4551 y(under)41 b(this)h(License,)k | |
4519 | (and)c(replace)h(the)g(individual)f(copies)h(of)f(this)g(License)h(in)f | |
4520 | (the)h(v)-5 b(arious)330 4661 y(do)s(cumen)m(ts)42 b(with)g(a)h(single) | |
4521 | g(cop)m(y)h(that)f(is)f(included)g(in)g(the)h(collection,)48 | |
4522 | b(pro)m(vided)42 b(that)i(y)m(ou)330 4770 y(follo)m(w)38 | |
4523 | b(the)g(rules)e(of)h(this)g(License)h(for)f(v)m(erbatim)h(cop)m(ying)g | |
4524 | (of)f(eac)m(h)h(of)f(the)h(do)s(cumen)m(ts)e(in)h(all)330 | |
4525 | 4880 y(other)31 b(resp)s(ects.)330 5011 y(Y)-8 b(ou)32 | |
4526 | b(ma)m(y)g(extract)h(a)f(single)g(do)s(cumen)m(t)f(from)g(suc)m(h)g(a)h | |
4527 | (collection,)i(and)d(distribute)g(it)h(individu-)330 | |
4528 | 5121 y(ally)k(under)d(this)i(License,)i(pro)m(vided)e(y)m(ou)g(insert)g | |
4529 | (a)g(cop)m(y)h(of)f(this)g(License)g(in)m(to)h(the)g(extracted)330 | |
4530 | 5230 y(do)s(cumen)m(t,)d(and)f(follo)m(w)i(this)e(License)h(in)g(all)g | |
4531 | (other)g(resp)s(ects)f(regarding)h(v)m(erbatim)g(cop)m(ying)h(of)330 | |
4532 | 5340 y(that)d(do)s(cumen)m(t.)p eop end | |
4533 | %%Page: 18 22 | |
4534 | TeXDict begin 18 21 bop 150 -116 a Fr(18)2651 b(GNU)31 | |
4535 | b(History)g(Library)199 299 y(7.)61 b(A)m(GGREGA)-8 b(TION)32 | |
4536 | b(WITH)e(INDEPENDENT)h(W)m(ORKS)330 428 y(A)d(compilation)i(of)e(the)g | |
4537 | (Do)s(cumen)m(t)h(or)f(its)g(deriv)-5 b(ativ)m(es)30 | |
4538 | b(with)d(other)i(separate)g(and)e(indep)s(enden)m(t)330 | |
4539 | 538 y(do)s(cumen)m(ts)33 b(or)g(w)m(orks,)h(in)f(or)h(on)f(a)g(v)m | |
4540 | (olume)h(of)g(a)f(storage)i(or)e(distribution)g(medium,)g(is)h(called) | |
4541 | 330 648 y(an)c(\\aggregate")k(if)c(the)g(cop)m(yrigh)m(t)i(resulting)e | |
4542 | (from)f(the)i(compilation)g(is)f(not)h(used)e(to)i(limit)g(the)330 | |
4543 | 757 y(legal)d(righ)m(ts)f(of)g(the)g(compilation's)h(users)e(b)s(ey)m | |
4544 | (ond)g(what)g(the)h(individual)f(w)m(orks)g(p)s(ermit.)39 | |
4545 | b(When)330 867 y(the)28 b(Do)s(cumen)m(t)g(is)g(included)f(an)g | |
4546 | (aggregate,)32 b(this)27 b(License)h(do)s(es)g(not)g(apply)f(to)h(the)g | |
4547 | (other)g(w)m(orks)330 976 y(in)i(the)h(aggregate)i(whic)m(h)d(are)h | |
4548 | (not)f(themselv)m(es)i(deriv)-5 b(ativ)m(e)32 b(w)m(orks)e(of)h(the)f | |
4549 | (Do)s(cumen)m(t.)330 1106 y(If)22 b(the)h(Co)m(v)m(er)h(T)-8 | |
4550 | b(ext)23 b(requiremen)m(t)g(of)g(section)h(3)f(is)g(applicable)h(to)f | |
4551 | (these)h(copies)f(of)g(the)g(Do)s(cumen)m(t,)330 1215 | |
4552 | y(then)f(if)g(the)h(Do)s(cumen)m(t)g(is)g(less)f(than)g(one)h(half)f | |
4553 | (of)h(the)g(en)m(tire)g(aggregate,)k(the)c(Do)s(cumen)m(t's)g(Co)m(v)m | |
4554 | (er)330 1325 y(T)-8 b(exts)27 b(ma)m(y)g(b)s(e)f(placed)h(on)g(co)m(v)m | |
4555 | (ers)h(that)f(brac)m(k)m(et)h(the)f(Do)s(cumen)m(t)g(within)f(the)h | |
4556 | (aggregate,)j(or)d(the)330 1435 y(electronic)37 b(equiv)-5 | |
4557 | b(alen)m(t)36 b(of)g(co)m(v)m(ers)g(if)f(the)g(Do)s(cumen)m(t)h(is)f | |
4558 | (in)g(electronic)i(form.)54 b(Otherwise)35 b(they)330 | |
4559 | 1544 y(m)m(ust)30 b(app)s(ear)g(on)g(prin)m(ted)g(co)m(v)m(ers)i(that)f | |
4560 | (brac)m(k)m(et)h(the)f(whole)f(aggregate.)199 1674 y(8.)61 | |
4561 | b(TRANSLA)-8 b(TION)330 1803 y(T)g(ranslation)41 b(is)f(considered)f(a) | |
4562 | i(kind)e(of)h(mo)s(di\014cation,)j(so)d(y)m(ou)g(ma)m(y)h(distribute)e | |
4563 | (translations)330 1913 y(of)45 b(the)f(Do)s(cumen)m(t)h(under)e(the)h | |
4564 | (terms)h(of)f(section)i(4.)83 b(Replacing)45 b(In)m(v)-5 | |
4565 | b(arian)m(t)45 b(Sections)g(with)330 2022 y(translations)h(requires)f | |
4566 | (sp)s(ecial)h(p)s(ermission)f(from)g(their)g(cop)m(yrigh)m(t)i | |
4567 | (holders,)i(but)c(y)m(ou)g(ma)m(y)330 2132 y(include)24 | |
4568 | b(translations)i(of)e(some)h(or)g(all)g(In)m(v)-5 b(arian)m(t)25 | |
4569 | b(Sections)g(in)f(addition)h(to)g(the)g(original)h(v)m(ersions)330 | |
4570 | 2242 y(of)32 b(these)f(In)m(v)-5 b(arian)m(t)33 b(Sections.)44 | |
4571 | b(Y)-8 b(ou)32 b(ma)m(y)g(include)f(a)h(translation)g(of)g(this)f | |
4572 | (License,)i(and)d(all)j(the)330 2351 y(license)42 b(notices)g(in)f(the) | |
4573 | h(Do)s(cumen)m(t,)j(and)40 b(an)m(y)i(W)-8 b(arran)m(t)m(y)42 | |
4574 | b(Disclaimers,)k(pro)m(vided)41 b(that)h(y)m(ou)330 2461 | |
4575 | y(also)f(include)f(the)g(original)h(English)f(v)m(ersion)g(of)g(this)g | |
4576 | (License)h(and)e(the)h(original)h(v)m(ersions)g(of)330 | |
4577 | 2570 y(those)35 b(notices)g(and)e(disclaimers.)53 b(In)33 | |
4578 | b(case)i(of)g(a)f(disagreemen)m(t)h(b)s(et)m(w)m(een)g(the)f | |
4579 | (translation)i(and)330 2680 y(the)f(original)i(v)m(ersion)e(of)h(this)f | |
4580 | (License)h(or)f(a)g(notice)i(or)e(disclaimer,)i(the)f(original)g(v)m | |
4581 | (ersion)g(will)330 2790 y(prev)-5 b(ail.)330 2919 y(If)28 | |
4582 | b(a)h(section)h(in)e(the)h(Do)s(cumen)m(t)h(is)e(En)m(titled)i(\\Ac)m | |
4583 | (kno)m(wledgemen)m(ts",)i(\\Dedications",)g(or)d(\\His-)330 | |
4584 | 3029 y(tory",)f(the)f(requiremen)m(t)f(\(section)i(4\))f(to)g(Preserv)m | |
4585 | (e)g(its)f(Title)i(\(section)f(1\))g(will)g(t)m(ypically)h(require)330 | |
4586 | 3138 y(c)m(hanging)j(the)g(actual)h(title.)199 3268 y(9.)61 | |
4587 | b(TERMINA)-8 b(TION)330 3397 y(Y)g(ou)30 b(ma)m(y)h(not)f(cop)m(y)-8 | |
4588 | b(,)31 b(mo)s(dify)-8 b(,)30 b(sublicense,)g(or)g(distribute)f(the)h | |
4589 | (Do)s(cumen)m(t)g(except)h(as)f(expressly)330 3507 y(pro)m(vided)41 | |
4590 | b(for)h(under)e(this)i(License.)75 b(An)m(y)42 b(other)g(attempt)h(to)g | |
4591 | (cop)m(y)-8 b(,)46 b(mo)s(dify)-8 b(,)44 b(sublicense)e(or)330 | |
4592 | 3616 y(distribute)36 b(the)h(Do)s(cumen)m(t)g(is)g(v)m(oid,)i(and)d | |
4593 | (will)h(automatically)i(terminate)f(y)m(our)e(righ)m(ts)h(under)330 | |
4594 | 3726 y(this)28 b(License.)40 b(Ho)m(w)m(ev)m(er,)31 b(parties)d(who)f | |
4595 | (ha)m(v)m(e)i(receiv)m(ed)g(copies,)h(or)d(righ)m(ts,)i(from)f(y)m(ou)g | |
4596 | (under)e(this)330 3836 y(License)37 b(will)g(not)g(ha)m(v)m(e)h(their)f | |
4597 | (licenses)g(terminated)h(so)f(long)g(as)g(suc)m(h)f(parties)h(remain)g | |
4598 | (in)f(full)330 3945 y(compliance.)154 4075 y(10.)61 b(FUTURE)30 | |
4599 | b(REVISIONS)f(OF)i(THIS)e(LICENSE)330 4204 y(The)41 b(F)-8 | |
4600 | b(ree)43 b(Soft)m(w)m(are)f(F)-8 b(oundation)43 b(ma)m(y)f(publish)e | |
4601 | (new,)k(revised)d(v)m(ersions)h(of)g(the)g(GNU)g(F)-8 | |
4602 | b(ree)330 4314 y(Do)s(cumen)m(tation)34 b(License)e(from)g(time)h(to)g | |
4603 | (time.)46 b(Suc)m(h)31 b(new)h(v)m(ersions)g(will)h(b)s(e)e(similar)h | |
4604 | (in)g(spirit)330 4423 y(to)j(the)g(presen)m(t)f(v)m(ersion,)i(but)e(ma) | |
4605 | m(y)h(di\013er)f(in)g(detail)h(to)g(address)f(new)g(problems)f(or)i | |
4606 | (concerns.)330 4533 y(See)c Fq(http://www.gnu.org/copy)o(left)o(/)p | |
4607 | Fr(.)330 4663 y(Eac)m(h)f(v)m(ersion)g(of)g(the)f(License)h(is)g(giv)m | |
4608 | (en)g(a)g(distinguishing)f(v)m(ersion)h(n)m(um)m(b)s(er.)39 | |
4609 | b(If)29 b(the)g(Do)s(cumen)m(t)330 4772 y(sp)s(eci\014es)45 | |
4610 | b(that)h(a)g(particular)f(n)m(um)m(b)s(ered)f(v)m(ersion)i(of)f(this)g | |
4611 | (License)h(\\or)g(an)m(y)g(later)g(v)m(ersion")330 4882 | |
4612 | y(applies)33 b(to)g(it,)h(y)m(ou)e(ha)m(v)m(e)i(the)f(option)g(of)f | |
4613 | (follo)m(wing)i(the)f(terms)f(and)g(conditions)h(either)g(of)f(that)330 | |
4614 | 4991 y(sp)s(eci\014ed)37 b(v)m(ersion)i(or)e(of)h(an)m(y)h(later)g(v)m | |
4615 | (ersion)f(that)g(has)g(b)s(een)f(published)f(\(not)j(as)f(a)g(draft\))g | |
4616 | (b)m(y)330 5101 y(the)33 b(F)-8 b(ree)34 b(Soft)m(w)m(are)f(F)-8 | |
4617 | b(oundation.)49 b(If)32 b(the)h(Do)s(cumen)m(t)g(do)s(es)g(not)g(sp)s | |
4618 | (ecify)f(a)h(v)m(ersion)g(n)m(um)m(b)s(er)f(of)330 5210 | |
4619 | y(this)i(License,)j(y)m(ou)d(ma)m(y)i(c)m(ho)s(ose)f(an)m(y)g(v)m | |
4620 | (ersion)g(ev)m(er)g(published)e(\(not)i(as)g(a)f(draft\))h(b)m(y)f(the) | |
4621 | h(F)-8 b(ree)330 5320 y(Soft)m(w)m(are)31 b(F)-8 b(oundation.)p | |
4622 | eop end | |
4623 | %%Page: 19 23 | |
4624 | TeXDict begin 19 22 bop 150 -116 a Fr(App)s(endix)29 | |
4625 | b(A:)h(Cop)m(ying)h(This)f(Man)m(ual)2105 b(19)150 299 | |
4626 | y Fi(A.1.1)62 b(ADDENDUM:)41 b(Ho)m(w)g(to)g(use)g(this)g(License)g | |
4627 | (for)h(y)m(our)f(do)s(cumen)m(ts)275 543 y Fr(T)-8 b(o)27 | |
4628 | b(use)g(this)g(License)h(in)f(a)h(do)s(cumen)m(t)f(y)m(ou)h(ha)m(v)m(e) | |
4629 | g(written,)g(include)f(a)h(cop)m(y)g(of)f(the)h(License)g(in)f(the)150 | |
4630 | 653 y(do)s(cumen)m(t)j(and)g(put)g(the)g(follo)m(wing)i(cop)m(yrigh)m | |
4631 | (t)g(and)e(license)h(notices)g(just)f(after)h(the)g(title)h(page:)468 | |
4632 | 765 y Fd(Copyright)42 b(\(C\))79 b Fc(year)88 b(your)40 | |
4633 | b(name)p Fd(.)468 852 y(Permission)i(is)e(granted)g(to)g(copy,)h | |
4634 | (distribute)g(and/or)g(modify)f(this)g(document)468 939 | |
4635 | y(under)h(the)f(terms)g(of)g(the)g(GNU)g(Free)g(Documentation)i | |
4636 | (License,)f(Version)g(1.2)468 1026 y(or)f(any)g(later)g(version)h | |
4637 | (published)h(by)d(the)h(Free)g(Software)h(Foundation;)468 | |
4638 | 1113 y(with)g(no)e(Invariant)j(Sections,)f(no)f(Front-Cover)h(Texts,)g | |
4639 | (and)f(no)f(Back-Cover)j(Texts.)468 1200 y(A)e(copy)g(of)g(the)g | |
4640 | (license)g(is)g(included)h(in)f(the)g(section)h(entitled)g(``GNU)468 | |
4641 | 1288 y(Free)g(Documentation)h(License''.)275 1410 y Fr(If)d(y)m(ou)h | |
4642 | (ha)m(v)m(e)h(In)m(v)-5 b(arian)m(t)41 b(Sections,)i(F)-8 | |
4643 | b(ron)m(t-Co)m(v)m(er)42 b(T)-8 b(exts)41 b(and)e(Bac)m(k-Co)m(v)m(er)k | |
4644 | (T)-8 b(exts,)43 b(replace)e(the)150 1520 y(\\with...T)-8 | |
4645 | b(exts.")43 b(line)30 b(with)h(this:)547 1632 y Fd(with)40 | |
4646 | b(the)g(Invariant)h(Sections)g(being)g Fc(list)f(their)g(titles)p | |
4647 | Fd(,)h(with)547 1719 y(the)f(Front-Cover)i(Texts)e(being)g | |
4648 | Fc(list)p Fd(,)h(and)f(with)g(the)g(Back-Cover)h(Texts)547 | |
4649 | 1806 y(being)f Fc(list)p Fd(.)275 1929 y Fr(If)34 b(y)m(ou)i(ha)m(v)m | |
4650 | (e)g(In)m(v)-5 b(arian)m(t)36 b(Sections)g(without)f(Co)m(v)m(er)h(T)-8 | |
4651 | b(exts,)38 b(or)d(some)g(other)h(com)m(bination)g(of)g(the)150 | |
4652 | 2038 y(three,)31 b(merge)g(those)g(t)m(w)m(o)g(alternativ)m(es)i(to)e | |
4653 | (suit)f(the)h(situation.)275 2173 y(If)23 b(y)m(our)h(do)s(cumen)m(t)f | |
4654 | (con)m(tains)i(non)m(trivial)g(examples)g(of)f(program)f(co)s(de,)j(w)m | |
4655 | (e)e(recommend)g(releasing)150 2283 y(these)44 b(examples)f(in)g | |
4656 | (parallel)h(under)e(y)m(our)h(c)m(hoice)i(of)e(free)g(soft)m(w)m(are)h | |
4657 | (license,)k(suc)m(h)43 b(as)g(the)g(GNU)150 2392 y(General)31 | |
4658 | b(Public)f(License,)i(to)f(p)s(ermit)e(their)i(use)f(in)g(free)g(soft)m | |
4659 | (w)m(are.)p eop end | |
4660 | %%Page: 20 24 | |
4661 | TeXDict begin 20 23 bop 150 -116 a Fr(20)2651 b(GNU)31 | |
4662 | b(History)g(Library)p eop end | |
4663 | %%Page: 21 25 | |
4664 | TeXDict begin 21 24 bop 150 -116 a Fr(App)s(endix)29 | |
4665 | b(B:)i(Concept)f(Index)2391 b(21)150 299 y Fn(App)t(endix)52 | |
4666 | b(B)47 b(Concept)k(Index)150 638 y Fp(A)150 796 y Fb(anc)n(hored)26 | |
4667 | b(searc)n(h)7 b Fa(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4668 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4669 | g(.)33 b Fb(8)150 1138 y Fp(E)150 1296 y Fb(ev)n(en)n(t)25 | |
4670 | b(designators)d Fa(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4671 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
4672 | b Fb(1)2025 638 y Fp(F)2025 754 y Fb(FDL,)25 b(GNU)g(F)-6 | |
4673 | b(ree)26 b(Do)r(cumen)n(tation)g(License)11 b Fa(.)i(.)g(.)f(.)g(.)h(.) | |
4674 | f(.)37 b Fb(13)2025 1005 y Fp(H)2025 1121 y Fb(history)25 | |
4675 | b(ev)n(en)n(ts)d Fa(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4676 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4677 | f(.)g(.)49 b Fb(1)2025 1209 y(history)25 b(expansion)15 | |
4678 | b Fa(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
4679 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b | |
4680 | Fb(1)2025 1296 y(History)25 b(Searc)n(hing)12 b Fa(.)h(.)f(.)h(.)f(.)g | |
4681 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
4682 | f(.)g(.)h(.)f(.)g(.)h(.)38 b Fb(8)p eop end | |
4683 | %%Page: 22 26 | |
4684 | TeXDict begin 22 25 bop 150 -116 a Fr(22)2651 b(GNU)31 | |
4685 | b(History)g(Library)p eop end | |
4686 | %%Page: 23 27 | |
4687 | TeXDict begin 23 26 bop 150 -116 a Fr(App)s(endix)29 | |
4688 | b(C:)h(F)-8 b(unction)31 b(and)f(V)-8 b(ariable)32 b(Index)1832 | |
4689 | b(23)150 299 y Fn(App)t(endix)52 b(C)45 b(F)-13 b(unction)52 | |
4690 | b(and)h(V)-13 b(ariable)53 b(Index)150 638 y Fp(A)150 | |
4691 | 755 y Fd(add_history)24 b Fa(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4692 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.) | |
4693 | f(.)g(.)h(.)f(.)g(.)48 b Fb(6)150 842 y Fd(add_history_time)14 | |
4694 | b Fa(.)i(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4695 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 b Fb(6)150 | |
4696 | 929 y Fd(append_history)17 b Fa(.)f(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4697 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4698 | g(.)h(.)43 b Fb(9)150 1182 y Fp(C)150 1299 y Fd(clear_history)22 | |
4699 | b Fa(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h | |
4700 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 | |
4701 | b Fb(7)150 1386 y Fd(current_history)16 b Fa(.)f(.)e(.)f(.)g(.)h(.)f(.) | |
4702 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4703 | (.)g(.)h(.)f(.)g(.)42 b Fb(7)150 1639 y Fp(F)150 1755 | |
4704 | y Fd(free_history_entry)11 b Fa(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f | |
4705 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4706 | 37 b Fb(6)150 2008 y Fp(G)150 2124 y Fd(get_history_event)13 | |
4707 | b Fa(.)j(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4708 | g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fb(9)150 | |
4709 | 2377 y Fp(H)150 2494 y Fd(history_arg_extract)9 b Fa(.)17 | |
4710 | b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4711 | f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(10)150 2581 y Fd(history_base)22 | |
4712 | b Fa(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4713 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)45 | |
4714 | b Fb(10)150 2669 y Fd(history_comment_char)7 b Fa(.)17 | |
4715 | b(.)c(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
4716 | (.)f(.)g(.)h(.)f(.)33 b Fb(10)150 2756 y Fd(history_expand)17 | |
4717 | b Fa(.)f(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4718 | f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 | |
4719 | b Fb(9)150 2843 y Fd(history_expansion_char)28 b Fa(.)12 | |
4720 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4721 | (.)f(.)48 b Fb(10)150 2931 y Fd(history_get)24 b Fa(.)12 | |
4722 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4723 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 | |
4724 | b Fb(7)150 3018 y Fd(history_get_history_state)25 b Fa(.)12 | |
4725 | b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 | |
4726 | b Fb(6)150 3106 y Fd(history_get_time)14 b Fa(.)i(.)d(.)f(.)g(.)h(.)f | |
4727 | (.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4728 | h(.)f(.)g(.)h(.)40 b Fb(7)150 3193 y Fd(history_inhibit_expansion_fun)q | |
4729 | (ctio)q(n)29 b Fa(.)12 b(.)h(.)f(.)g(.)h(.)f(.)49 b Fb(11)150 | |
4730 | 3280 y Fd(history_is_stifled)11 b Fa(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)h | |
4731 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4732 | h(.)37 b Fb(7)150 3368 y Fd(history_length)16 b Fa(.)g(.)c(.)g(.)h(.)f | |
4733 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4734 | h(.)f(.)g(.)h(.)f(.)g(.)42 b Fb(10)150 3455 y Fd(history_list)23 | |
4735 | b Fa(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4736 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)46 | |
4737 | b Fb(7)150 3543 y Fd(history_max_entries)9 b Fa(.)17 | |
4738 | b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4739 | f(.)g(.)h(.)f(.)g(.)h(.)34 b Fb(10)150 3630 y Fd | |
4740 | (history_no_expand_chars)26 b Fa(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4741 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)47 b Fb(11)150 | |
4742 | 3718 y Fd(history_quotes_inhibit_expans)q(ion)9 b Fa(.)18 | |
4743 | b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fb(11)150 | |
4744 | 3805 y Fd(history_search)17 b Fa(.)f(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4745 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
4746 | (.)g(.)h(.)43 b Fb(8)150 3892 y Fd(history_search_delimiter_char)q(s)11 | |
4747 | b Fa(.)18 b(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)37 | |
4748 | b Fb(10)150 3980 y Fd(history_search_pos)11 b Fa(.)17 | |
4749 | b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4750 | g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)37 b Fb(8)2025 638 y | |
4751 | Fd(history_search_prefix)7 b Fa(.)17 b(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f | |
4752 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33 | |
4753 | b Fb(8)2025 725 y Fd(history_set_history_state)25 b Fa(.)12 | |
4754 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)46 | |
4755 | b Fb(6)2025 813 y Fd(history_set_pos)16 b Fa(.)f(.)e(.)f(.)g(.)h(.)f(.) | |
4756 | g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4757 | (.)f(.)g(.)h(.)f(.)42 b Fb(8)2025 900 y Fd(history_subst_char)10 | |
4758 | b Fa(.)17 b(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4759 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)36 b Fb(10)2025 | |
4760 | 987 y Fd(history_tokenize)13 b Fa(.)j(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4761 | (.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4762 | 39 b Fb(10)2025 1074 y Fd(history_total_bytes)10 b Fa(.)16 | |
4763 | b(.)d(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h | |
4764 | (.)f(.)g(.)h(.)f(.)g(.)h(.)36 b Fb(7)2025 1162 y Fd | |
4765 | (history_truncate_file)7 b Fa(.)17 b(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g | |
4766 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33 | |
4767 | b Fb(9)2025 1249 y Fd(history_word_delimiters)26 b Fa(.)13 | |
4768 | b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4769 | (.)47 b Fb(10)2025 1336 y Fd(history_write_timestamps)25 | |
4770 | b Fa(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4771 | (.)g(.)46 b Fb(10)2025 1588 y Fp(N)2025 1704 y Fd(next_history)23 | |
4772 | b Fa(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4773 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
4774 | b Fb(8)2025 1956 y Fp(P)2025 2072 y Fd(previous_history)14 | |
4775 | b Fa(.)i(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4776 | g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fb(8)2025 | |
4777 | 2324 y Fp(R)2025 2440 y Fd(read_history)23 b Fa(.)12 | |
4778 | b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4779 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 | |
4780 | b Fb(9)2025 2527 y Fd(read_history_range)11 b Fa(.)17 | |
4781 | b(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.) | |
4782 | f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fb(9)2025 2614 y | |
4783 | Fd(remove_history)17 b Fa(.)e(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4784 | (.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4785 | g(.)44 b Fb(6)2025 2702 y Fd(replace_history_entry)7 | |
4786 | b Fa(.)17 b(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g | |
4787 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33 b Fb(7)2025 2953 y | |
4788 | Fp(S)2025 3069 y Fd(stifle_history)17 b Fa(.)e(.)e(.)f(.)g(.)h(.)f(.)g | |
4789 | (.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.) | |
4790 | g(.)h(.)f(.)g(.)g(.)44 b Fb(7)2025 3321 y Fp(U)2025 3437 | |
4791 | y Fd(unstifle_history)14 b Fa(.)i(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f | |
4792 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.) | |
4793 | 41 b Fb(7)2025 3525 y Fd(using_history)21 b Fa(.)13 b(.)f(.)g(.)h(.)f | |
4794 | (.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.) | |
4795 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(6)2025 3776 y | |
4796 | Fp(W)2025 3893 y Fd(where_history)21 b Fa(.)13 b(.)f(.)g(.)h(.)f(.)g(.) | |
4797 | h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f | |
4798 | (.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fb(7)2025 3980 y Fd(write_history)21 | |
4799 | b Fa(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h | |
4800 | (.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 | |
4801 | b Fb(9)p eop end | |
4802 | %%Page: 24 28 | |
4803 | TeXDict begin 24 27 bop 150 -116 a Fr(24)2651 b(GNU)31 | |
4804 | b(History)g(Library)p eop end | |
a44161c3 | 4805 | %%Trailer |
b585a9fa | 4806 | |
a44161c3 EZ |
4807 | userdict /end-hook known{end-hook}if |
4808 | %%EOF |