Commit | Line | Data |
---|---|---|
a44161c3 | 1 | %!PS-Adobe-2.0 |
f9267e15 | 2 | %%Creator: dvips(k) 5.82 Copyright 1998 Radical Eye Software |
a44161c3 | 3 | %%Title: history.dvi |
f9267e15 | 4 | %%Pages: 20 |
a44161c3 | 5 | %%PageOrder: Ascend |
f9267e15 | 6 | %%BoundingBox: 0 0 612 792 |
a44161c3 | 7 | %%EndComments |
f9267e15 EZ |
8 | %DVIPSWebPage: (www.radicaleye.com) |
9 | %DVIPSCommandLine: dvips -D 300 -t letter -o history.ps history.dvi | |
10 | %DVIPSParameters: dpi=300, compressed | |
11 | %DVIPSSource: TeX output 2000.01.19:1217 | |
12 | %%BeginProcSet: texc.pro | |
13 | %! | |
14 | /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S | |
15 | N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 | |
16 | mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 | |
17 | 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ | |
18 | landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize | |
19 | mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ | |
20 | matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round | |
21 | exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ | |
22 | statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] | |
23 | N/FBB[0 0 0 0]N/nn 0 N/IE 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin | |
24 | /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array | |
25 | /BitMaps X/BuildChar{CharBuilder}N/Encoding IE N end A{/foo setfont}2 | |
26 | array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N | |
27 | df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A | |
28 | definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get | |
29 | }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} | |
30 | B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr | |
31 | 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 | |
32 | 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx | |
33 | 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx | |
34 | sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ | |
35 | rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp | |
36 | gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B | |
37 | /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ | |
38 | /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ | |
39 | A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy | |
40 | get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} | |
41 | ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp | |
42 | fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 | |
43 | {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add | |
44 | chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ | |
45 | 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} | |
46 | forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn | |
47 | /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put | |
48 | }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ | |
49 | bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A | |
50 | mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ | |
51 | SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ | |
52 | userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X | |
53 | 1000 div/DVImag X/IE 256 array N 2 string 0 1 255{IE S A 360 add 36 4 | |
54 | index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N | |
55 | /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ | |
56 | /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) | |
57 | (LaserWriter 16/600)]{A length product length le{A length product exch 0 | |
58 | exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse | |
59 | end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask | |
60 | grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} | |
61 | imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round | |
62 | exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto | |
63 | fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p | |
64 | delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} | |
65 | B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ | |
66 | p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S | |
67 | rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end | |
68 | ||
a44161c3 | 69 | %%EndProcSet |
f9267e15 EZ |
70 | TeXDict begin 40258431 52099146 1000 300 300 (history.dvi) |
71 | @start | |
72 | %DVIPSBitmapFont: Fa cmti10 10.95 1 | |
73 | /Fa 1 47 df<127012F8A212F012E005057B840E>46 D E | |
74 | %EndDVIPSBitmapFont | |
75 | %DVIPSBitmapFont: Fb cmbxti10 14.4 1 | |
76 | /Fb 1 47 df<120E123FEA7F80A212FFA21300127E123C0909798815>46 | |
77 | D E | |
78 | %EndDVIPSBitmapFont | |
79 | %DVIPSBitmapFont: Fc cmtt9 9 26 | |
80 | /Fc 26 123 df<EAFFFEA30F037E7E14>95 D<EA1FC0EA7FF0EA7078EA2018EA001CA2EA | |
81 | 07FC121FEA3C1C127012E0A3EA707C383FFF80EA0F8F11107E8F14>97 | |
82 | D<12FCA2121CA513F8EA1DFEEA1F07EA1E03001C1380EB01C0A6EB0380001E1300EA1F0E | |
83 | EA1DFCEA0CF81217809614>I<EA03F8EA0FFEEA1C0EEA3804EA7000126012E0A4126012 | |
84 | 70EA380EEA1C1EEA0FFCEA03F00F107E8F14>I<137EA2130EA5EA07CEEA0FFEEA1C3EEA | |
85 | 301EEA700E12E0A61270EA301EEA383E381FEFC0EA07CF12177F9614>I<EA07E0EA0FF0 | |
86 | EA1C38EA301CEA700CEAE00EA2EAFFFEA2EAE00012601270EA380EEA1C1EEA0FFCEA03F0 | |
87 | 0F107E8F14>I<13FCEA01FEEA038EEA07041300A3EA7FFE12FFEA0700ACEAFFF8A20F17 | |
88 | 7F9614>I<EA07CF381FFF80EA383B38301800EA701CA3EA3018EA3838EA3FF0EA37C000 | |
89 | 70C7FCA2EA3FF86C7E487EEA700F38E00380A438700700EA3C1EEA1FFCEA07F011197F8F | |
90 | 14>I<12FCA2121CA51378EA1DFEEA1F86EA1E07121CAA38FF8FE0A21317809614>I<1206 | |
91 | 120FA21206C7FCA4B4FCA21207ACEAFFF8A20D187C9714>I<12FCA2121CA5EBFF80A2EB | |
92 | 1C005B5B5BEA1DC0EA1FE0A2EA1E70EA1C38133C131C7F38FF1F80A21117809614>107 | |
93 | D<EAFF80A21203B3EAFFFEA20F177E9614>I<EAFB8EEAFFDF383CF380A2EA38E3AA38FE | |
94 | FBE013791310808F14>I<EAFC78EAFDFEEA1F86EA1E07121CAA38FF8FE0A21310808F14> | |
95 | I<EA07C0EA1FF0EA3C78EA701CA2EAE00EA6EA701CEA783CEA3C78EA1FF0EA07C00F107E | |
96 | 8F14>I<EAFCF8EAFDFEEA1F07EA1E03001C1380EB01C0A6EB0380001E1300EA1F0EEA1D | |
97 | FCEA1CF890C7FCA6B47EA21218808F14>I<EA03E7EA0FF7EA1C1FEA300F1270487EA6EA | |
98 | 700F1230EA1C3FEA0FF7EA07C7EA0007A6EB3FE0A213187F8F14>I<EAFE1FEB7F80EA0E | |
99 | E3380F810090C7FCA2120EA8EAFFF0A211107F8F14>I<EA0FD8EA3FF8EA603812C0A2EA | |
100 | F000EA7F80EA3FF0EA07F8EA001CEA600612E012F0EAF81CEAFFF8EACFE00F107E8F14> | |
101 | I<1206120EA4EA7FFC12FFEA0E00A8130EA3131CEA07F8EA01F00F157F9414>I<EAFC3F | |
102 | A2EA1C07AB131F380FFFE0EA03E71310808F14>I<38FE3F80A2383C1E00EA1C1CA36C5A | |
103 | A3EA0630EA0770A36C5AA311107F8F14>I<38FE3F80A238700700EA380EA3EA39CEA3EA | |
104 | 1B6C121AA3EA1E7CA2EA0E3811107F8F14>I<EA7E3FA2EA1E3CEA0E78EA07705B12036C | |
105 | 5A12037FEA0770EA0E781338487E38FE3F80A211107F8F14>I<38FE3F80A2381C0E005B | |
106 | A2120E5BA212071330A2EA0370A25B1201A25BA3485A12730077C7FC127E123C11187F8F | |
107 | 14>I<EA3FFF5AEA700E131C1338EA007013E0EA01C0EA0380EA0700120EEA1C07123812 | |
108 | 70B5FCA210107F8F14>I E | |
109 | %EndDVIPSBitmapFont | |
110 | %DVIPSBitmapFont: Fd cmsl9 9 1 | |
111 | /Fd 1 47 df<1270A212F0126004047D830B>46 D E | |
112 | %EndDVIPSBitmapFont | |
113 | %DVIPSBitmapFont: Fe cmr9 9 24 | |
114 | /Fe 24 122 df<EA07E0EA1C38EA381CEA300CEA700EEA6006A2EAE007AAEA6006A2EA70 | |
115 | 0EEA300CEA381CEA1C38EA07E010187F9713>48 D<12035AB4FC1207B3A2EA7FF80D187D | |
116 | 9713>I<EA01F8EA0704EA0C06EA180E123013001270126012E0EAE3E0EAE418EAE80CEA | |
117 | F00EEAE0061307A31260A2EA7006EA300EEA180CEA0C38EA07E010187F9713>54 | |
118 | D<1240EA7FFF13FEA2EA4004EA80081310A2EA00201340A21380120113005AA25A1206A2 | |
119 | 120EA5120410197E9813>I<EA07E0EA1818EA300CEA20061260A21270EA780CEA3E18EA | |
120 | 1F30EA07C0EA03E0EA0CF8EA307CEA601E130FEAC0071303A3EA6002EA2004EA1818EA07 | |
121 | E010187F9713>I<EA07E0EA1C30EA3018EA700CEA600EEAE006A21307A31260EA700FEA | |
122 | 3017EA1827EA07C7EA00071306130E130C12701318EA6030EA3060EA0F8010187F9713> | |
123 | I<39FFE1FFC0390E001C00AB380FFFFC380E001CAC39FFE1FFC01A1A7F991D>72 | |
124 | D<EA0FC2EA1836EA200EEA600612C01302A3EAE0001270127EEA3FE0EA1FF8EA03FCEA00 | |
125 | 7E130E130713031280A3EAC0021306EAE004EAD818EA87E0101A7E9915>83 | |
126 | D<EA1FC0EA38707FEA101C1200A2EA03FCEA1E1C1238127012E01480A2133CEA705F381F | |
127 | 8F0011107F8F13>97 D<EA07F8EA1C1C1238EA700813005AA612701304EA3808EA1C18EA | |
128 | 07E00E107F8F11>99 D<133F1307A9EA03E7EA0C17EA180F487E127012E0A6126012706C | |
129 | 5AEA1C373807C7E0131A7F9915>I<EA07C0EA1C30EA30181270EA600C12E0EAFFFCEAE0 | |
130 | 00A41260EA7004EA3808EA1C18EA07E00E107F8F11>I<EA0FCF3818718038303000EA70 | |
131 | 38A4EA30306C5AEA2FC00060C7FCA21270EA3FF013FC6C7EEA600FEAC003A4EA6006EA38 | |
132 | 1CEA07E011187F8F13>103 D<12FC121CA9137CEA1D87381E0380A2121CAB38FF9FF014 | |
133 | 1A809915>I<1218123CA212181200A612FC121CAE12FF081A80990A>I<EAFC7CEA1D8738 | |
134 | 1E0380A2121CAB38FF9FF01410808F15>110 D<EA07E0EA1C38EA300CEA700EEA6006EA | |
135 | E007A6EA6006EA700EEA381CEA1C38EA07E010107F8F13>I<EAFCFCEA1D07381E038038 | |
136 | 1C01C0A2EB00E0A6EB01C01480381E0300EA1D06EA1CF890C7FCA6B47E1317808F15>I< | |
137 | EAFC78EA1D9CEA1E1C1308EA1C00ABEAFF800E10808F0F>114 D<EA1F20EA60E0EA4020 | |
138 | 12C0A2EAF000127FEA3FC0EA1FE0EA00F0EA8070133012C01320EAF040EA8F800C107F8F | |
139 | 0F>I<1208A41218A21238EAFFC0EA3800A81320A41218EA1C40EA07800B177F960F>I<38 | |
140 | FF0F80383C0700EA1C061304A26C5AA26C5AA3EA03A0A2EA01C0A36C5A11107F8F14> | |
141 | 118 D<38FE3F80383C1E00EA1C086C5AEA0F306C5A6C5A12017F1203EA0270487E1208EA | |
142 | 181CEA381E38FC3FC012107F8F14>120 D<38FF0F80383C0700EA1C061304A26C5AA26C | |
143 | 5AA3EA03A0A2EA01C0A36C5AA248C7FCA212E112E212E4127811177F8F14>I | |
144 | E | |
145 | %EndDVIPSBitmapFont | |
146 | %DVIPSBitmapFont: Ff cmss10 10.95 2 | |
147 | /Ff 2 42 df<13E0EA01C0EA0380120713005A121EA2121C123CA212381278A3127012F0 | |
148 | AE12701278A31238123CA2121C121EA27E7E13801203EA01C0EA00E00B2E7CA112>40 | |
149 | D<12E012707E123C121C121E7EA27E1380A2120313C0A3120113E0AE13C01203A3138012 | |
150 | 07A213005AA2121E121C123C12385A5A0B2E7EA112>I E | |
151 | %EndDVIPSBitmapFont | |
152 | %DVIPSBitmapFont: Fg cmbx10 12 27 | |
153 | /Fg 27 123 df<EB07F8EB7FFC3801FC0E3803F01F48485AEA0FC0A3141E140C91C7FCA2 | |
154 | ECFF80B6FCA2380FC01FB2397FF8FFF0A21C237FA220>12 D<90380FFF80137F3801FC1F | |
155 | 3803F03FEA07E0EA0FC0141FA7B6FCA2380FC01FB2397FF8FFF0A21C237FA220>I<EA07 | |
156 | FE381FFF80383F07E06D7E130180121E1200A2133FEA03FDEA1F81EA3E01127C12F8A4EA | |
157 | 7C02EA7E0C391FF87F803807E03F19167E951C>97 D<B47EA2121FABEB87F0EBBFFCEBF0 | |
158 | 3EEBC01F9038800F8015C0140715E0A715C0A2140F15809038C01F00381E707E381C3FFC | |
159 | 38180FE01B237EA220>I<EBFF80000713E0380F83F0EA1F03123E127E387C01E090C7FC | |
160 | 12FCA6127C127EA2003E13186C1330380FC0603807FFC0C6130015167E9519>I<49B4FC | |
161 | A2EB003FAB13FE3807FFBF380FC1FF48C67E003E7F127E127CA212FCA7127C127E123E6C | |
162 | 5B380F81FF3907FF3FE0EA01FC1B237EA220>I<13FE3807FF80380F83C0381E01E0383E | |
163 | 00F0127E007C13F8147812FCB512F8A200FCC7FCA3127CA26C1318A26C1330380F80E038 | |
164 | 03FFC0C6130015167E951A>I<EB1F80EBFFE03801F1F0EA03E31207EA0FC3EBC1E0EBC0 | |
165 | 00A6EAFFFEA2EA0FC0B2EA7FFCA214237EA212>I<9038FE0F803903FF9FC0380F83E338 | |
166 | 1F01F3391E00F000003E7FA5001E5BEA1F01380F83E0380BFF80D808FEC7FC0018C8FCA2 | |
167 | 121C381FFFE014FC6C13FF7E001F1480397C001FC00078130F00F81307A3007CEB0F806C | |
168 | EB1F00381F807E6CB45A000113E01A217F951D>I<B47EA2121FABEB83F0EB8FFCEB987E | |
169 | EBA03EEBC03FA21380AE39FFF1FFE0A21B237DA220>I<121E123FEA7F80A4EA3F00121E | |
170 | C7FCA6EAFF80A2121FB2EAFFF0A20C247EA30F>I<B47EA2121FABECFF80A2EC3C001430 | |
171 | 14E0EB81C00183C7FC1386139E13BE13FFEBDF80EB8FC01307806D7E6D7E130080147E39 | |
172 | FFE1FFC0A21A237EA21E>107 D<EAFF80A2121FB3ADEAFFF0A20C237EA20F>I<3AFF03F8 | |
173 | 03F890390FFE0FFE3A1F183F183F9039201F201F014001C01380A201801380AE3BFFF0FF | |
174 | F0FFF0A22C167D9531>I<38FF03F0EB0FFC381F187EEB203EEB403FA21380AE39FFF1FF | |
175 | E0A21B167D9520>I<13FF000713E0380F81F0381F00F8003E137C48133EA300FC133FA7 | |
176 | 007C133E007E137E003E137C6C13F8380F81F03807FFE0C6130018167E951D>I<38FF87 | |
177 | F0EBBFFC381FF07EEBC01F9038800F8015C0A2EC07E0A715C0140FA2EC1F8001C01300EB | |
178 | F07EEBBFFCEB8FE00180C7FCA8EAFFF0A21B207E9520>I<EBFE033807FF07380FC1CF38 | |
179 | 1F00DF48137F007E7FA2127C12FCA7127EA2003E5B6C5BEA0FC13807FF3FEA00FC1300A8 | |
180 | 903801FFE0A21B207E951E>I<38FF0F80EB1FE0381F33F013631343A2EBC1E0EB8000AD | |
181 | EAFFF8A214167E9518>I<3807F980EA1FFFEA3807EA7003EAF001A26CC7FCB4FC13F8EA | |
182 | 7FFE6C7E6C1380120738003FC0EAC007130312E0A200F0138038FC0F00EAEFFEEAC3F812 | |
183 | 167E9517>I<487EA41203A21207A2120F123FB5FCA2EA1F80ABEB8180A5380F830013C3 | |
184 | EA07FEEA01F811207F9F16>I<38FF81FFA2381F803FAF5C5C380FC1BF3907FF3FE0EA01 | |
185 | FC1B167D9520>I<39FFF01FE0A2391FC00700000F1306EBE00E0007130C13F000035BA2 | |
186 | 6C6C5AA26C6C5AA2EBFEE0EB7EC0137F6D5AA26DC7FCA2130EA21B167F951E>I<3AFFF3 | |
187 | FF83FCA23A1F807C00E0D80FC014C08001E013010007017F1380A2D803F0EB0300ECCF83 | |
188 | 01F81387D801F913C61487D800FD13ECEBFF0315FC017F5BEB7E01013E5BEB3C00A20118 | |
189 | 136026167F9529>I<39FFF07FC0A2390FC01C006C6C5A6D5A00035B6C6C5A3800FD8013 | |
190 | 7F91C7FC7F6D7E497EEB37E0EB67F013C33801C1F8380380FC48487E000E137F39FF81FF | |
191 | E0A21B167F951E>I<39FFF01FE0A2391FC00700000F1306EBE00E0007130C13F000035B | |
192 | A26C6C5AA26C6C5AA2EBFEE0EB7EC0137F6D5AA26DC7FCA2130EA2130CA25B1278EAFC38 | |
193 | 13305BEA69C0EA7F80001FC8FC1B207F951E>I<387FFFF0A2387C07E038700FC0EA601F | |
194 | 00E0138038C03F005B137EC65A1201485AEBF030EA07E0120FEBC070EA1F80003F1360EB | |
195 | 00E0EA7E03B5FCA214167E9519>I E | |
196 | %EndDVIPSBitmapFont | |
197 | %DVIPSBitmapFont: Fh cmtt10 12 24 | |
198 | /Fh 24 119 df<13E0A538F0E1E0EAFCE7387EEFC0381FFF00EA07FCEA01F0EA07FCEA1F | |
199 | FF387EEFC038FCE7E0EAF0E13800E000A513157D991A>42 D<1338137CA2136C13EEA313 | |
200 | C6A2EA01C7A438038380A4380701C0A213FFA24813E0EA0E00A4481370387F01FC38FF83 | |
201 | FE387F01FC171E7F9D1A>65 D<B512F8A3381C0038A51400A2130EA3EA1FFEA3EA1C0EA3 | |
202 | 90C7FCA3141CA5B512FCA3161E7E9D1A>69 D<387FFFFCB5FC7E380E001CA51400A2EB03 | |
203 | 80A3EA0FFFA3EA0E03A390C7FCA8EA7FE012FF127F161E7F9D1A>I<38FF83FEA3381C00 | |
204 | 70AA381FFFF0A3381C0070AB38FF83FEA3171E7F9D1A>72 D<B51280A33801C000B3A6B5 | |
205 | 1280A3111E7C9D1A>I<38FE03FE12FFA2381D8070A213C0121CA213E0A213601370A213 | |
206 | 301338A21318131CA2130C130EA21306A213071303A238FF81F0A21380171E7F9D1A>78 | |
207 | D<EA0FFE383FFF804813C0EA7C07EA700100F013E0EAE000B1EAF001A2007013C0EA7C07 | |
208 | EA7FFF6C1380380FFE00131E7D9D1A>I<EAFFFC13FF1480381C07C0EB01E0EB00F01470 | |
209 | A414F0EB01E0EB07C0381FFF8014001480381C07C01301EB00E0A514E214E7A338FF807E | |
210 | A21438181E7F9D1A>82 D<3803F1C0EA0FFDEA3FFFEA7C0FEA700312E01301A390C7FC12 | |
211 | 701278123FEA1FF0EA07FE3800FF80EB0FC0EB01E013001470A2126012E0A214E0EAF001 | |
212 | 38FC03C0B5128000EF1300EAE3FC141E7D9D1A>I<387FFFFEB5FCA238E0380EA5000013 | |
213 | 00B33803FF80A3171E7F9D1A>I<38FF01FEA3381C00706C13E0A2380701C0A213830003 | |
214 | 138013C700011300A2EA00EEA2137CA21338AA48B4FCA3171E7F9D1A>89 | |
215 | D<387FFFC0B512E0A26C13C013047D7E1A>95 D<EA1FF0EA3FFC487EEA780FEA30073800 | |
216 | 0380A2137FEA07FF121FEA3F83EA7803127012E0A3EA7007EA780F383FFFFCEA1FFDEA07 | |
217 | F016157D941A>97 D<EBFF80000313C0000F13E0EA1F01383C00C04813001270A25AA512 | |
218 | 70A2007813707E381F01F0380FFFE0000313C03800FE0014157D941A>99 | |
219 | D<EB1FC0A31301A6EA01F1EA07FDEA0FFFEA1E0FEA3C07EA7803EA700112E0A7EA7003A2 | |
220 | EA3807EA3E0F381FFFFCEA07FDEA01F1161E7E9D1A>I<12FEA3120EA6133EEBFF80000F | |
221 | 13C013C1EB80E01300120EAC38FFE3FE13E713E3171E7F9D1A>104 | |
222 | D<EA01C0487EA36C5AC8FCA5EA7FE0A31200AF387FFF80B512C06C1380121F7C9E1A>I< | |
223 | EAFE3EEBFF80B512C0EA0FC1EB80E01300120EAC38FFE3FE13E713E317157F941A>110 | |
224 | D<EA01F0EA07FCEA1FFF383E0F80EA3C07387803C0EA700138E000E0A6EAF001007013C0 | |
225 | EA7803383C0780EA3E0F381FFF00EA07FCEA01F013157D941A>I<387F81F838FF8FFC38 | |
226 | 7F9FFE3803FE1EEBF80CEBE000A25B5BAAEA7FFFB5FC7E17157F941A>114 | |
227 | D<487E1203A6387FFFE0B5FCA238038000AA1470A43801C1E013FF6C1380EB3F00141C7F | |
228 | 9B1A>116 D<38FE0FE0A3EA0E00AD1301EA0F033807FFFE7EEA00FC17157F941A>I<387F | |
229 | C7FC00FF13FE007F13FC380E00E0A3380701C0A338038380A33801C700A3EA00EEA3137C | |
230 | A2133817157F941A>I E | |
231 | %EndDVIPSBitmapFont | |
232 | %DVIPSBitmapFont: Fi cmbx12 13.14 41 | |
233 | /Fi 41 123 df<EB07FCEB3FFF9038FE0780D803F013C03807E00FA2EA0FC0A3EC030091 | |
234 | C7FCA3EC7FE0B6FCA2380FC007B3A239FFFC7FFEA21F267FA522>12 | |
235 | D<123C127E12FFA4127E123C08087C8711>46 D<131C133C13FC12FFA21200B3AA387FFF | |
236 | FCA216237CA21F>49 D<48B4FC000713C0381E07F0383803F8386001FC387C00FE12FE14 | |
237 | FF147FA2127C003813FFC7FC14FEA2EB01FC14F8EB03F0EB07E01480EB0F00131E5B1370 | |
238 | EBE003EA01C038038007380700061206380FFFFE5A5A4813FCB5FCA218237DA21F>I<48 | |
239 | B4FC000713E0381E03F0383801F8003C13FC387E00FEA3123EEA1C01000013FCA2EB03F8 | |
240 | EB07F0EB0FC03801FF00A2380007E0EB01F014F8EB00FC14FE14FFA21210127C12FEA214 | |
241 | FEA2387C01FC007013F8383E07F0380FFFC00001130018237DA21F>I<14381478A214F8 | |
242 | 1301130313071306130C131C13381330136013E0EA01C01380EA03005A120E5A12185A12 | |
243 | 705AB612C0A2390001F800A790387FFFC0A21A237EA21F>I<0018130C001F137CEBFFF8 | |
244 | 14F014E014C01480EBFC000018C7FCA513FF001B13E0381F03F0381C00F8000813FCC712 | |
245 | 7EA3147FA2127812FCA3147E5A006013FC1270383801F8381E07E03807FFC03801FE0018 | |
246 | 237DA21F>I<EB1FC0EB7FF03801F0383803E00C3807803E000F137EEA1F005AA2007E13 | |
247 | 3C1400A338FE3FC0EB7FF0EB80F800FF13FCEB007C147E5A147FA4127EA4003E137E123F | |
248 | 6C137C380F80F83807C1F03803FFC038007F0018237DA21F>I<1230123C003FB512C0A2 | |
249 | 15804814005C5C38600018A200E05B485B5CC6485AA249C7FC1306130EA25BA2133CA25B | |
250 | A213F8A41201A66C5A13601A257DA41F>I<141CA2143EA3147FA24A7EA39038019FC0A2 | |
251 | 9038031FE0140F01077FEB0607A2010C7F1403011C7FEB1801A2496C7EA2017FB5FCA290 | |
252 | 39E0007F8049133FA2484880151F00038190C7120FA2486E7ED8FFF090B51280A229257E | |
253 | A42E>65 D<B612E015FC3903F800FFED1FC0ED07E06F7E6F7E82150082A2167FA31780AA | |
254 | 1700A316FEA24B5A5E4B5A4B5AED1FC0EDFF80B648C7FC15E029257EA42F>68 | |
255 | D<B7FCA23903F8007FED0F8015071503A21501A3ED00C01406A21600A2140E141EEBFFFE | |
256 | A2EBF81E140E1406A21660A291C7FC16C0A415011503A2ED0F80153FB7FCA223257EA428 | |
257 | >I<B612FEA23803F800151F8181A281A3ED01801403A292C7FCA25C5C90B5FCA2EBF80F | |
258 | 8080A491C8FCAAB512F0A221257EA427>I<B500E0B512E0A23B03F80003F800AF90B6FC | |
259 | A29038F80003B0B500E0B512E0A22B257EA430>72 D<B512E0A23803F800B3AFB512E0A2 | |
260 | 13257EA417>I<B512F0A2D803F8C7FCB3A31503A31506A3150EA2151E153E157CEC03FC | |
261 | B6FCA220257EA425>76 D<D8FFF8EDFFF86D5C0003EEFE00017EEC037EA36D1406A26D6C | |
262 | 130CA26D6C1318A26D6C1330A36D6C1360A26D6C13C0A2903900FC0180A291387E0300A3 | |
263 | EC3F06A2EC1F8CA2EC0FD8A2EC07F0A36E5AEA07803CFFFC01C01FFFF8A235257EA43A> | |
264 | I<01FF1380000713E3380F80F7381E001F48130F481307140312F81401A27E91C7FCB4FC | |
265 | EA7FE013FE383FFFE014F86C13FE00077F6C1480C67E010313C0EB003FEC0FE01407A200 | |
266 | C01303A315C07E6C13076C14806CEB0F0038FFC03E38E3FFF838803FE01B257DA422>83 | |
267 | D<B53B81FFFE01FFF0A23D07F0001FC0000F007013066C6C010F5CA26F7E6C6C5EA26D49 | |
268 | 6C1338000017304B7E017F01195CA291388030FE013F5E829139C0607F01011F5E03E013 | |
269 | 8190280FE0C03F83C7FCA29139F1801FC3010715C617E69139FB000FEE010315EC02FF14 | |
270 | FC6D486D5AA24A130301005DA24A130102785CA202306D5A3C257FA43F>87 | |
271 | D<EA07FF001F13E0383E03F0383F00F880147E121EC7FCA3EB1FFE3803FE7EEA0FC0EA1F | |
272 | 00123E127E5AA314BEEA7E01383F073E391FFE1FE03807F00F1B187E971E>97 | |
273 | D<EAFFC0A2120FACEBC1FCEBCFFF9038FC0FC09038F007E09038C003F0A2EC01F8A215FC | |
274 | A815F8A2EC03F013E09038F007E090381C1F80390E0FFF00380C03F81E267FA522>I<EB | |
275 | 7FE03803FFF83807C07C381F80FC13005A007E1378140012FEA8127E127F6C130CEA1F80 | |
276 | EBC0183807E0703803FFE038007F0016187E971B>I<ECFFC0A2140FAC137F3803FFCF38 | |
277 | 0FE0FF381F803F383F000FA2127EA212FEA8127EA27E141F381F803F380FC0EF3903FFCF | |
278 | FC3800FE0F1E267EA522>I<137F3803FFC03807C1F0380F80F8EA1F0048137C127E147E | |
279 | 12FEA2B512FEA248C7FCA3127EA214067E6C130C380F80183807E0703803FFE038007F80 | |
280 | 17187E971C>I<EB1FC0EB7FF0EA01F83803E1F8120713C1380FC0F01400A7B5FCA2EA0F | |
281 | C0B3A2EAFFFEA215267EA513>I<3901FF07C00007EBDFE0380F83F1EA1F01393E00F800 | |
282 | 007E7FA6003E5B6C485A380F83E0EBFFC0001190C7FC0030C8FCA21238123C383FFFE06C | |
283 | 13FC806C7F481480383C003F48EB0FC000F81307A4007CEB0F806CEB1F00381F807E3807 | |
284 | FFF8C613C01B247E971F>I<EAFFC0A2120FAC14FE9038C3FF809038CE0FC013D89038D0 | |
285 | 07E013E0A213C0AF39FFFC7FFEA21F267EA522>I<120FEA1F80EA3FC0A4EA1F80EA0F00 | |
286 | C7FCA7EA7FC0A2120FB3A2EAFFF8A20D277EA611>I<EAFFC0A2120FB3B0EAFFFCA20E26 | |
287 | 7EA511>108 D<26FF80FE137F903A83FF81FFC03B0F8E0FC707E0019813CC903A9007E8 | |
288 | 03F001A013F0A201C013E0AF3BFFFC7FFE3FFFA230187E9733>I<38FF80FE903883FF80 | |
289 | 390F8E0FC0139890389007E013A0A213C0AF39FFFC7FFEA21F187E9722>I<EB7F803803 | |
290 | FFF03807C0F8381F807E48487EA2007EEB1F80A200FE14C0A8007E1480A26CEB3F00A238 | |
291 | 1F807E6C6C5A3803FFF038007F801A187E971F>I<38FFC1FCEBCFFF390FFC1FC09038F0 | |
292 | 07E001C013F0140315F8140115FCA8EC03F8A215F0EBE0079038F00FE09038DC1F809038 | |
293 | CFFF00EBC3F801C0C7FCA9EAFFFCA21E237F9722>I<38FF83E0EB8FF8380F8C7CEB90FC | |
294 | 13B013A01478EBE0005BAEEAFFFEA216187F9719>114 D<3807F8C0EA1FFFEA3C07EA70 | |
295 | 01EAF000A300FC1300B47EEA7FFC7F383FFF80000F13C0120338001FE01303EAC001A212 | |
296 | E014C0EAF00338FC078038EFFF00EAC3FC13187E9718>I<13C0A41201A312031207120F | |
297 | 121FB512C0A2380FC000AC1460A63807E0C013E13801FF8038007E0013237FA218>I<39 | |
298 | FFC07FE0A2000F1307B0140FA200071317EBE0673903FFC7FE38007F071F187E9722>I< | |
299 | 39FFF80FF8A2390FC001C015803907E00300A26D5A00031306EBF80E0001130C13FC0000 | |
300 | 5B13FEEB7E30A26D5AA214E06D5AA26D5AA26DC7FCA21D187F9720>I<39FFF83FF0A239 | |
301 | 0FC00F003807E00E6C6C5A6D5A6C6C5A00001360EB7EC06D5AA2131F6D7E497E80EB33F8 | |
302 | 1361EBE0FC3801C07E3803807F3907003F8048131F39FFC07FF8A21D187F9720>120 | |
303 | D<39FFF80FF8A2390FC001C015803907E00300A26D5A00031306EBF80E0001130C13FC00 | |
304 | 005B13FEEB7E30A26D5AA214E06D5AA26D5AA26DC7FCA21306A25B1230EA781CEAFC185B | |
305 | 1370EA68E0EA7FC0001FC8FC1D237F9720>I<387FFFF8A2387C03F0EA700738600FE000 | |
306 | E013C0EB1F80EAC03F1400137EEA00FE5B485A0003130C13F0EA07E0120FEBC01C381F80 | |
307 | 18003F1338387F0078387E01F8B5FCA216187E971B>I E | |
308 | %EndDVIPSBitmapFont | |
309 | %DVIPSBitmapFont: Fj cmsl10 10.95 30 | |
310 | /Fj 30 122 df<903803F07C90381E0DC69038380F0FEB701E01E0130EEC0C003801C01C | |
311 | A548485A007FB512C03903803800A448485AA6000E5BA648485A001E7F38FF8FFC20207E | |
312 | 9F1B>11 D<EB03E0EB1C181338EB703C13E014383801C000A5485A387FFFF038038070A4 | |
313 | 380700E0A6380E01C0A6381C0380001E13C038FF0FF016207E9F19>I<903803F03F9039 | |
314 | 1E09E0809039380F80C09039701F01E0EBE03E021E13C02601C01CC7FCA548485A007FB6 | |
315 | 12803903803803A43A0700700700A6000EEBE00EA64848485A001EEBE01E3AFF8FF8FFC0 | |
316 | 23207E9F26>14 D<13201360A4383061C0383C4380380E4E00EA0778EA01E0A2EA07B8EA | |
317 | 1C9CEA708FEAE083EA0180A490C7FC12147AA117>42 D<13181338EA01F8EA0E701200A5 | |
318 | 13E0A6EA01C0A6EA0380A6EA07001380EAFFFC0E1E7B9D17>49 D<EB3F80EBC1E0380100 | |
319 | 70000213785AA2000F137C1380A2EB00781206C712F814F0EB01E014C0EB0380EB070013 | |
320 | 0E5B5B13605B485A380300201206000813405A383FFFC0481380B5FC161E7E9D17>I<13 | |
321 | FFEA01FE1380A5EA0300A61206A65AA65AA65AA65AA6B4FCA2102D7EA10D>91 | |
322 | D<13FFEA01FEEA0006A5130CA61318A61330A61360A613C0A6EA0180A6EAFF00A2102D82 | |
323 | A10D>93 D<EA07F8EA0C0CEA1E061307121C1200A313FFEA07C7EA1E07EA3C0E127800F0 | |
324 | 1310A3131EEB2E2038784F40381F878014147D9317>97 D<13FEEA0383380E0780121C00 | |
325 | 38130090C7FC12785AA45AA37E5BEA70026C5AEA1C18EA07E011147D9314>99 | |
326 | D<1438EB01F8EB00781438A21470A614E013FCEA0382EA0601121CEA3C00383801C01278 | |
327 | 12F0A438E00380A412F0EA700738380F00381C37803807C7E015207D9F19>I<13F8EA07 | |
328 | 0EEA0E07121C383803801278127012F0A2B5FC00F0C7FC5AA46C5AEA7002EA3004EA1C18 | |
329 | EA07E011147D9314>I<EB07C0EB1C60EB30F01360EBE0E0EBC0001201A5485AEA3FFCEA | |
330 | 0380A448C7FCA6120EA65A121EEAFFC014207F9F0E>I<140EEB3E11EBE1A33801C1C238 | |
331 | 0381E0EA07801301120FA3380703C01480EB8700EA04FC48C7FCA21218121CEA0FFF14C0 | |
332 | 14E0381800F04813305A5AA3006013606C13C0381C0700EA07FC181F809417>I<13E012 | |
333 | 0712011200A2485AA6485AEB8F80EB90E013A0EBC0601380000713E01300A5380E01C0A6 | |
334 | 381C0380001E13C038FF8FF014207E9F19>I<EA01C0EA03E0A213C0EA0180C7FCA6EA03 | |
335 | 80121F12071203A2EA0700A6120EA65A121EEAFF800B1F7F9E0C>I<13E0120712011200 | |
336 | A2EA01C0A6EA0380A6EA0700A6120EA65A121EEAFF800B207F9F0C>108 | |
337 | D<390387C07C391F9861863907A072073903C03403EB80380007EB7807EB0070A5000EEB | |
338 | E00EA64848485A001EEBE01E3AFFCFFCFFC022147E9326>I<38038F80381F90E0EA07A0 | |
339 | 3803C0601380000713E01300A5380E01C0A6381C0380001E13C038FF8FF014147E9319> | |
340 | I<13FCEA0387380E0180381C00C04813E0A24813F012F0A438E001E0A214C0130300F013 | |
341 | 8038700700EA380E6C5AEA07E014147D9317>I<EBE3E03807EC383801F01C6C487E140F | |
342 | 48487E1580A53903800F00A2140E141E141C5C38074070EB61C0011FC7FC90C8FCA3120E | |
343 | A4121EEAFFC0191D809319>I<EBFC2038038260EA0702381E01E0123C003813C0127812 | |
344 | F0A438E00380A212F0A21307127038380F00EA1C37EA07C7EA0007A3130EA4131EEBFFC0 | |
345 | 131D7D9318>I<EA038E381FB380EA07C71203EB8300EA078090C7FCA5120EA65A121EEA | |
346 | FFC011147E9312>I<EA01F9EA0607EA080312181301EA3802EA3C00121F13F0EA07FCEA | |
347 | 01FEEA001FEA40071303A212601306EAF004EAC818EA87E010147F9312>I<1380EA0100 | |
348 | A35A5A5A121EEAFFF8EA0E00A45AA65A1310A41320A2EA1840EA0F800D1C7C9B12>I<38 | |
349 | 1C0380EAFC1FEA3C07EA1C03A238380700A6EA700EA4131EA25BEA305E381F9F8011147B | |
350 | 9319>I<38FF83F8381E00E0001C13C01480121E380E01005B13025B12075BA25BEA0390 | |
351 | 13A013E05B5B120190C7FC15147C9318>I<39FF9FE1FC393C078070391C030060148015 | |
352 | 401580EA0E0790380D81001309EB19C21311380F21C4EA0720EB40C814E8EB80F0A26C48 | |
353 | 5A1460000213401E147C9321>I<381FF0FF3803C0780001137014403800E0C0EBE180EB | |
354 | 73001376133CA2131C132E134E1387EA0107380203801204380C01C0383C03E038FE07FC | |
355 | 18147F9318>I<390FF83F803901E00E00EBC00C140813E000005B143014205C13705CA2 | |
356 | 0171C7FC1339133A133E133C133813181310A25BA25BEA70C0EAF08000F1C8FC12E61278 | |
357 | 191D809318>I E | |
358 | %EndDVIPSBitmapFont | |
359 | %DVIPSBitmapFont: Fk cmbx12 17.28 36 | |
360 | /Fk 36 122 df<EB01C01303130F137FEA1FFFB5FC13BFEAE03F1200B3B1007FB512F0A3 | |
361 | 1C2E7AAD28>49 D<EB3FE03801FFFE0007EBFF80D80F8013C0391E003FE00038EB1FF000 | |
362 | 7CEB0FF8007EEB07FCB4FC018013FEA21403A2EA7F00003E1307C7FC15FCA2EC0FF8A215 | |
363 | F0EC1FE015C0EC3F80EC7F00147E14F8495A495A495A49C7FC011E130E5B133849131E49 | |
364 | 131C485A48C7123C48B512FC5A5A5A4814F8B6FCA31F2E7CAD28>I<1578A215FCA34A7E | |
365 | A24A7EA24A7FA34A7FEC0E7F021E7FEC1C3FA202387F151F02787FEC700FA202E07F1507 | |
366 | 010180ECC003A249486C7EA201078191C7FC498191B6FCA24981011CC7123F013C810138 | |
367 | 141FA24981160F01F081491407A2484881486C1403B549B512FCA336317DB03D>65 | |
368 | D<B712C016FC16FFD801FEC77FEE7FE0707E161F707EA2831607A4160FA25FA24C5A4C5A | |
369 | 4C5A4B485ADB1FFEC7FC90B65AEEFF8049C7EA3FE0EE0FF0EE07FCA2707E83821880A718 | |
370 | 005E5F16074C5A4C5AEEFFF0B812C094C7FC16F831317DB039>I<913A03FF800180023F | |
371 | EBF00349B5EAFC0701079038003F0FD91FF8EB079FD93FC0EB01FFD9FF807F4848C8127F | |
372 | 4848153F0007161F49150F485A001F1607A2485A1703127FA24992C7FCA212FFA9127FA2 | |
373 | 7FEF0380123FA26C7E1707000F17006C7E6D150E0003161E6C6C151C6C6C6C1478D93FC0 | |
374 | 5CD91FF8EB03E0D907FFEB3F800101D9FFFEC7FCD9003F13F80203138031317CB03A>I< | |
375 | B812E0A3C6903880007FEE0FF016031601A21600A21770A31738A21507A21700A35D5D5D | |
376 | 91B5FCA3EC803F818181A592C8FCACB612C0A32D317EB033>70 D<DA03FF1303027FEBF0 | |
377 | 0749B5EAFC0F01079038007E1FD91FF0EB0FBFD97FC0EB03FF49487F4848C87E485A0007 | |
378 | 824848815B001F82A2484881A2127FA24992C7FC12FFAA0307B512F8127F7FDB00011300 | |
379 | 123FA26C7EA2120F7F6C7E12036C7E6C6C7E6D6C5BD91FF8497ED907FFEB3E3F01019038 | |
380 | FFFC1F6D6CEBF00F0203EB800335317CB03F>I<B6D8807FB512C0A3C60180C7387FC000 | |
381 | B391B7FCA30280C7127FB3A3B6D8807FB512C0A33A317EB03F>I<B61280A3C6EB8000B3 | |
382 | B3A7B61280A319317EB01E>I<B56C49B512C08080C66D90390003E0006E6E5AEBEFFC13 | |
383 | E780EBE3FF01E17F01E07F6E7E143F816E7E6E7E6E7E14036E7E16806E13C0ED7FE0ED3F | |
384 | F0151F16F8ED0FFCED07FEED03FF6F13818117C1EE7FE1EE3FF1EE1FF9EE0FFD160717FF | |
385 | 828282177F173FA2171F170F486C1507B500E014031701A23A317EB03F>78 | |
386 | D<B712E016FEEEFF80C6D9800013E0EE3FF0EE0FF8EE07FCA2EE03FEA217FFA717FEA2EE | |
387 | 07FC17F8160FEE3FE0EEFFC091B6120016F80280C8FCB3A2B67EA330317EB037>80 | |
388 | D<007FB8FCA39039C00FF801D87E00EC003F007C82007882A200708200F01780A3481603 | |
389 | A5C792C7FCB3AA017FB6FCA331307DAF38>84 D<B6D88003B51280A3C60180C73807C000 | |
390 | 715AB3AE137F4DC7FC80013F150EA26D6C5C6D6C5C6D6C5C6D6C495A903A00FF801FC002 | |
391 | 3FB55A020F49C8FC020013E039317EB03E>I<B500FC91B5FCA3000390C8EA03C06C1780 | |
392 | 6E14076C170080017F150EA26E141E013F151C6E143C011F153880010F5D8001075DA26E | |
393 | 130101035D6E13036D5D15806D4AC7FCA26F5A027F130EEDE01E023F131CEDF03C021F13 | |
394 | 3815F8020F5BA2EDFCF002075B15FF6E5BA26E5BA26E90C8FCA3157EA2153CA238317EB0 | |
395 | 3D>I<EBFFF0000313FF390F803F809038C00FE0486C6C7EA26E7ED80FC07FEA0780C7FC | |
396 | A414FF131FEBFFE33803FC03EA0FF0EA1FC0123FEA7F80A2EAFF00A31407A2387F800D39 | |
397 | 3FC01DFE3A1FE078FFF03907FFE07FC6EB803F24207E9F27>97 D<EA01F812FFA3120F12 | |
398 | 07ADEC3FE0ECFFFC9038FBE07F9039FF001F8049EB0FC04914E049EB07F016F8A2ED03FC | |
399 | A316FEA816FCA3ED07F8A216F06DEB0FE06D14C001E7EB3F809039C3C0FE00903880FFF8 | |
400 | 9038003FC027327EB12D>I<EB0FFF017F13C03901FC01F03803F0033907E007F8120FEA | |
401 | 1FC0003FEB03F0EC01E04848C7FCA312FFA8127FA36C6C131CA2001F14386C7E00071470 | |
402 | 3903F001E03901FC07C039007FFF00EB0FF81E207D9F24>I<ED0FC0EC07FFA3EC007F15 | |
403 | 3FADEB07F8EB3FFF9038FE07BF3903F801FF3907E0007F120F4848133F123FA2485AA312 | |
404 | FFA8127FA36C7EA2121F6C6C137F000714FF2603F00313E03A01FC0F3FFE38007FFEEB0F | |
405 | F027327DB12D>I<EB0FFC90387FFF803901FC0FC03903F003E03907E001F0000F14F839 | |
406 | 1FC000FC003F14FEA24848137E157FA212FFA290B6FCA20180C7FCA4127FA36C6C130712 | |
407 | 1F150E6C7E6C6C131C6C6C13783900FE03E090383FFFC0903807FE0020207E9F25>I<EB | |
408 | 01FE90380FFF8090381FC3C090387F07E09038FE0FF0120113FC1203EC07E0EC018091C7 | |
409 | FCA8B512FCA3D803FCC7FCB3A8387FFFF0A31C327EB119>I<90391FF007C09039FFFE3F | |
410 | E03A01F83F79F03907E00FC3000F14E19039C007E0E0001FECF000A2003F80A5001F5CA2 | |
411 | 000F5CEBE00F00075C2603F83FC7FC3806FFFE380E1FF090C9FC121EA2121F7F90B57E6C | |
412 | 14F015FC6C806C801680000F15C0003FC7127F007EEC1FE0007C140F00FC1407A4007EEC | |
413 | 0FC0003E1580003F141FD80FC0EB7E003907F803FC0001B512F0D8001F90C7FC242F7E9F | |
414 | 28>I<EA01F812FFA3120F1207ADEC07F8EC3FFEEC783F02C013809039F9801FC0EBFB00 | |
415 | 01FE14E05BA35BB3B500C3B5FCA328327DB12D>I<EA03C0487E487E487EA46C5A6C5A6C | |
416 | 5AC8FCA9EA01F8127FA31207B3A7B51280A311337DB217>I<EA01F812FFA3120F1207B3 | |
417 | B3A6B512C0A312327DB117>108 D<2703F007F8EB1FE000FFD93FFEEBFFF8913A783F01 | |
418 | E0FC02C090388300FE280FF1801FC6137F2607F30013CC01F602F8148001FC5CA3495CB3 | |
419 | B500C3B5380FFFFCA33E207D9F43>I<3903F007F800FFEB3FFEEC783F02C013803A0FF1 | |
420 | 801FC03807F30001F614E013FCA35BB3B500C3B5FCA328207D9F2D>I<EB07FC90387FFF | |
421 | C03901FC07F03903F001F848486C7E4848137E001F147F003F158049133F007F15C0A300 | |
422 | FF15E0A8007F15C0A36C6CEB7F80A2001F15006C6C13FE00075C3903F803F83901FE0FF0 | |
423 | 39007FFFC0D907FCC7FC23207E9F28>I<3901F83FE000FFEBFFFC9038FBE07F9039FF00 | |
424 | 3F80D80FFEEB1FC06C48EB0FE04914F0ED07F8A216FC1503A216FEA816FC1507A216F8A2 | |
425 | ED0FF06D14E06DEB1FC06DEB3F809039FBC0FE009038F8FFF8EC3FC091C8FCABB512C0A3 | |
426 | 272E7E9F2D>I<3803F03F00FFEB7FC09038F1C3E01487390FF30FF0EA07F6A29038FC07 | |
427 | E0EC03C091C7FCA25BB2B512E0A31C207E9F21>114 D<3801FF86000713FEEA1F00003C | |
428 | 133E48131E140E12F8A36C90C7FCB47E13FC387FFFC06C13F0806C7F00077F00017FEA00 | |
429 | 3F01001380143F0060131F00E0130FA27E15007E6C131E6C131C38FF807838F3FFF038C0 | |
430 | 7F8019207D9F20>I<131CA5133CA3137CA213FC120112031207381FFFFEB5FCA2D803FC | |
431 | C7FCB0EC0380A71201EC0700EA00FEEB7F0EEB3FFCEB07F0192E7FAD1F>I<D801F8EB07 | |
432 | E000FFEB03FFA3000FEB003F0007141FB3153FA20003147FA26C6CEBDFF03A00FE039FFF | |
433 | 90387FFF1FEB0FFC28207D9F2D>I<B5EB1FFCA3D80FF8EB03C0000715806D1307000315 | |
434 | 007F0001140E7F6C5CA2EC803C017F1338ECC078013F1370ECE0F0011F5B14F1010F5B14 | |
435 | F9903807FB80A214FF6D90C7FCA26D5AA26D5AA21478A226207E9F2B>I<B53A1FFFE03F | |
436 | F8A33C0FF000FE0007806D150300076EEB0700816D5D00039138FF800EA26C6C486D5A15 | |
437 | DF01FF153C6C9039038FE038A2D97F876D5A150702C714F0D93FCF6D5AECCE03D91FFEEB | |
438 | F9C09138FC01FD16FF010F5D4A7EA26D486DC7FCA20103147E4A133EA26D48131C35207E | |
439 | 9F3A>I<3A7FFF807FFCA33A03FC000F006C6C131E6C6C5BEC803890387FC078013F5B90 | |
440 | 381FE1E090380FF3C0ECFF806D90C7FC6D5A13016D7E81815B903803DFE09038078FF081 | |
441 | 90380F07FC90381E03FEEB3C01496C7E4914804848EB7FC00003EC3FE026FFFC01B5FCA3 | |
442 | 28207F9F2B>I<B5EB1FFCA3D80FF8EB03C0000715806D1307000315007F0001140E7F6C | |
443 | 5CA2EC803C017F1338ECC078013F1370ECE0F0011F5B14F1010F5B14F9903807FB80A214 | |
444 | FF6D90C7FCA26D5AA26D5AA21478A21470A214F05C1301007C5BEAFE035C49C8FC5BEAFC | |
445 | 1EEA787CEA3FF0EA0FC0262E7E9F2B>I E | |
446 | %EndDVIPSBitmapFont | |
447 | %DVIPSBitmapFont: Fl cmsy10 10.95 1 | |
448 | /Fl 1 14 df<14FF010713E090381F00F80178131E01E01307D80180EB018048C812C000 | |
449 | 061560481530A248151848150CA2481506A4481503A900601506A46C150CA26C15186C15 | |
450 | 30A26C15606C15C06C6CEB0180D800E0EB07000178131E011F13F8903807FFE0010090C7 | |
451 | FC282B7EA02D>13 D E | |
452 | %EndDVIPSBitmapFont | |
453 | %DVIPSBitmapFont: Fm cmbx12 14.4 45 | |
454 | /Fm 45 122 df<123C127FEAFF80A213C0A3127F123E1200A2EA0180A3EA0300A2120612 | |
455 | 0E5A5A12100A157B8813>44 D<121C127FA2EAFF80A3EA7F00A2121C09097B8813>46 | |
456 | D<130E131E137EEA07FE12FFA212F81200B3ABB512FEA317277BA622>49 | |
457 | D<EBFF80000713F04813FC381E03FE393800FF80007C133F00FE14C06C131F15E0140FA2 | |
458 | 127E003C131FC7FC15C0A2EC3F801500147E5C5C495A495AEB078049C7FC131E4913E013 | |
459 | 705B3901C001C0EA0380EA0600000FB5FC5A5A5AB61280A31B277DA622>I<EB7F803803 | |
460 | FFF04813FC380F81FE381F007FEA3F80EC3F80A3121F1300C7EA7F00A2147E5C495AEB07 | |
461 | F0EBFFC0A2EB01F8EB007E801580EC1FC0A215E0A2123C127EB4FCA215C0143F48148000 | |
462 | 7CEB7F00383F01FE6CB45A000713F0C613801B277DA622>I<140FA25C5C5C5C5BA2EB03 | |
463 | BFEB073F130E131C133C1338137013E0EA01C0EA038012071300120E5A5A5A12F0B612F8 | |
464 | A3C7EA7F00A890381FFFF8A31D277EA622>I<00181303381F801FEBFFFE5C5C5C14C091 | |
465 | C7FC001CC8FCA7EB7FC0381DFFF8381F80FC381E003F1208C7EA1F8015C0A215E0A21218 | |
466 | 127C12FEA315C05A0078EB3F80A26CEB7F00381F01FE6CB45A000313F0C613801B277DA6 | |
467 | 22>I<EC0780A24A7EA34A7EA24A7EA3EC77F8A2ECF7FC14E3A2903801C1FEA201037F14 | |
468 | 80A249486C7EA24980010E133FA2496D7EA2013FB57EA39039700007F8A201F080491303 | |
469 | 000181491301A2000381D8FFFE013F13FCA32E297EA833>65 D<B612F815FF16C03A03F8 | |
470 | 001FE0ED0FF0ED07F8150316FCA21501A3150316F8A2ED07F0150FED1FC0EDFF8090B5EA | |
471 | FE00EDFFC09039F8000FF0ED03F8ED01FC16FE1500A216FFA616FE1501ED03FC1507ED1F | |
472 | F8B712E016C0EDFE0028297DA830>I<91387FE003903907FFFC07011FEBFF0F90397FF0 | |
473 | 0F9F9039FF0001FFD801FC7F4848147F4848143F4848141F485A160F485A1607127FA290 | |
474 | C9FC5AA97E7F1607123FA26C7E160E6C7E6C6C141C6C6C143C6C6C14786CB4EB01F09039 | |
475 | 7FF007C0011FB512800107EBFE009038007FF028297CA831>I<B712E0A33903FC001FED | |
476 | 07F01501A215001670A3913801C0781638A302031300A2140F90B5FCA3EBFC0F1403A202 | |
477 | 01130EA3161C91C7FCA3163C1638167816F815011503151FB712F0A327297EA82C>69 | |
478 | D<B712C0A33903FC003FED0FE015031501A21500A316F0913801C070A316001403A2140F | |
479 | 90B5FCA3EBFC0F1403A21401A491C8FCA9B512FCA324297EA82A>I<91387FE003903907 | |
480 | FFFC07011FEBFF0F90397FF00F9F9039FF0001FFD801FC7F484880484880484880485A82 | |
481 | 485A82127FA290CAFC5AA892B512F87E7F03001300123FA26C7EA26C7E6C7E6C7E6C7E6C | |
482 | B45B90387FF007011FB5129F0107EBFE0F9039007FF0032D297CA835>I<B5D8F00FB5FC | |
483 | A3D803FCC7EA3FC0AF90B7FCA301FCC7123FB1B5D8F00FB5FCA330297EA835>I<B512F0 | |
484 | A33803FC00B3B1B512F0A314297EA819>I<D8FFFE92383FFF80A26D5D0003EFE000A2D9 | |
485 | BF8014EFA2D99FC0EB01CFA2D98FE0EB038FA3D987F0EB070FA2D983F8130EA2D981FC13 | |
486 | 1CA3D980FE1338A2027F1370A291383F80E0A391381FC1C0A291380FE380A2913807F700 | |
487 | A3EC03FEA26E5AA26E5AD8FFFE0203B51280A2157039297DA840>77 | |
488 | D<D8FFFCEC7FFF7F7F00036DEB01C080EBBFE0139F80EB8FF8EB87FCEB83FEEB81FF0180 | |
489 | 1380147F15C0EC3FE0EC1FF0EC0FF8EC07FC140315FEEC01FF6E1381ED7FC1ED3FE1ED1F | |
490 | F1150F16F9ED07FDED03FF8181167FA2163F161F160F1607D8FFFE14031601A230297EA8 | |
491 | 35>I<B612F815FF16C03A03FC003FE0ED07F0ED03F816FC150116FEA716FC150316F8ED | |
492 | 07F0ED3FE090B61280EDFE0001FCC8FCB0B512F0A327297EA82E>80 | |
493 | D<B612E015FE6F7E3A03FC003FE0ED0FF06F7E6F7E150182A65E4B5A1507ED0FE0ED3FC0 | |
494 | 90B500FEC7FCA29039FC00FF80ED3FC06F7E6F7E6F7EA9170EA21503923801FC1CB538F0 | |
495 | 00FEEE7FF8EE0FE02F297EA832>82 D<9038FF80600003EBF0E0000F13F8381F80FD383F | |
496 | 001F003E1307481303A200FC1301A214007EA26C140013C0EA7FFCEBFFE06C13F86C13FE | |
497 | 80000714806C14C0C6FC010F13E0EB007FEC1FF0140F140700E01303A46C14E0A26C1307 | |
498 | 6C14C0B4EB0F80EBE03F39E3FFFE0000E15B38C01FF01C297CA825>I<B500F0EBFFFEA3 | |
499 | D803FCC7EA0380B3AA0001ED07007F0000150E137F6D143CD91FC05B90390FF003F06DB5 | |
500 | 5A01001480DA1FFCC7FC2F297EA834>85 D<B500F0EB7FFFA3D803FEC7EA01C00001ED03 | |
501 | 80A26D14076C16006E5B017F140E80013F5CA26E133C011F14386E1378010F1470800107 | |
502 | 5CA26D6C485AA2ECFE0301015CECFF076D91C7FC1587EC7F8EA215DEEC3FDC15FC6E5AA2 | |
503 | 6E5AA36E5AA26E5AA230297FA833>I<B53CE07FFFE01FFFC0A32803FC0003FCC7EA7000 | |
504 | A26D6D7E000160A26D6E13016C604B138002801503017F5F4B13C0D93FC0013F49C7FCA2 | |
505 | 913AE00E1FE00F011F160E17F09126F01C0F131E010F161C033C13F8902707F838075BA2 | |
506 | 037813FC902703FC70035BA2913AFEE001FEF001015E02FF14FF4B7E6D5EA26E486D5AA3 | |
507 | 6EC76CC8FCA2023E80021E141EA242297FA845>I<3803FF80000F13F0381F01FC383F80 | |
508 | FE147F801580EA1F00C7FCA4EB3FFF3801FC3FEA0FE0EA1F80EA3F00127E5AA4145F007E | |
509 | 13DF393F839FFC381FFE0F3803FC031E1B7E9A21>97 D<EAFFE0A3120FACEBE1FE9038EF | |
510 | FF809038FE07E09038F803F09038F001F89038E000FCA2157EA2157FA8157EA315FCA290 | |
511 | 38F001F89038F803F090389C0FE090380FFF80390E01FC00202A7EA925>I<EB3FF03801 | |
512 | FFFC3803F03E380FC07FEA1F80EA3F00A248133E007E90C7FCA212FEA7127EA2127F6CEB | |
513 | 03801380001FEB0700380FE00E3803F83C3801FFF838003FC0191B7E9A1E>I<EC7FF0A3 | |
514 | 1407ACEB3F873801FFF73807F03F380FC00F381F8007EA3F00A2127EA312FEA8127EA27E | |
515 | A2381F800F380FC01F3907E07FFF3801FFE738007F87202A7EA925>I<EB3FC03801FFF0 | |
516 | 3803E07C380F803E001F7F130048EB0F80127E15C0A200FE1307A2B6FCA248C8FCA3127E | |
517 | A2127F6CEB01C07E390F8003803907C007003803F01E3800FFFCEB3FE01A1B7E9A1F>I< | |
518 | EB07F8EB3FFCEB7E3E3801FC7FEA03F813F01207143E1400A7B512C0A33807F000B3A338 | |
519 | 7FFF80A3182A7EA915>I<9038FF80F00003EBE3F8390FC1FE1C391F007C7C48137E003E | |
520 | EB3E10007EEB3F00A6003E133E003F137E6C137C380FC1F8380BFFE00018138090C8FC12 | |
521 | 38A2123C383FFFF814FF6C14C06C14E06C14F0121F383C0007007CEB01F8481300A4007C | |
522 | EB01F0A2003FEB07E0390FC01F806CB5120038007FF01E287E9A22>I<EAFFE0A3120FAC | |
523 | 147E9038E1FF809038E30FC001E413E0EBE80701F813F013F0A213E0B039FFFE3FFFA320 | |
524 | 2A7DA925>I<1207EA0F80EA1FC0EA3FE0A3EA1FC0EA0F80EA0700C7FCA7EAFFE0A3120F | |
525 | B3A3EAFFFEA30F2B7EAA12>I<EAFFE0A3120FB3B2EAFFFEA30F2A7EA912>108 | |
526 | D<26FFC07FEB1FC0903AC1FFC07FF0903AC307E0C1F8D80FC49038F101FC9039C803F200 | |
527 | 01D801FE7F01D05BA201E05BB03CFFFE3FFF8FFFE0A3331B7D9A38>I<38FFC07E9038C1 | |
528 | FF809038C30FC0D80FC413E0EBC80701D813F013D0A213E0B039FFFE3FFFA3201B7D9A25 | |
529 | >I<EB3FE03801FFFC3803F07E390FC01F80391F800FC0393F0007E0A2007EEB03F0A300 | |
530 | FE14F8A8007E14F0A26CEB07E0A2391F800FC0390FC01F803907F07F003801FFFC38003F | |
531 | E01D1B7E9A22>I<38FFE1FE9038EFFF809038FE0FE0390FF803F09038F001F801E013FC | |
532 | 140015FEA2157FA8157E15FEA215FC140101F013F89038F807F09038FC0FE09038EFFF80 | |
533 | 9038E1FC0001E0C7FCA9EAFFFEA320277E9A25>I<38FFC1F0EBC7FCEBC63E380FCC7F13 | |
534 | D813D0A2EBF03EEBE000B0B5FCA3181B7F9A1B>114 D<3803FE30380FFFF0EA3E03EA78 | |
535 | 00127000F01370A27E00FE1300EAFFE06CB4FC14C06C13E06C13F0000713F8C6FCEB07FC | |
536 | 130000E0137C143C7E14387E6C137038FF01E038E7FFC000C11300161B7E9A1B>I<13E0 | |
537 | A41201A31203A21207120F381FFFE0B5FCA2380FE000AD1470A73807F0E0000313C03801 | |
538 | FF8038007F0014267FA51A>I<39FFE07FF0A3000F1307B2140FA2000713173903F067FF | |
539 | 3801FFC738007F87201B7D9A25>I<39FFFC03FFA3390FF000F0000714E07F0003EB01C0 | |
540 | A2EBFC0300011480EBFE070000140013FFEB7F0EA2149EEB3F9C14FC6D5AA26D5AA36D5A | |
541 | A26D5AA2201B7F9A23>I<3BFFFC7FFC1FFCA33B0FE00FE001C02607F007EB0380A201F8 | |
542 | EBF00700031600EC0FF801FC5C0001150EEC1FFC2600FE1C5B15FE9039FF387E3C017F14 | |
543 | 38EC787F6D486C5A16F0ECE01F011F5CA26D486C5AA2EC800701075CA22E1B7F9A31>I< | |
544 | 39FFFC1FFEA33907F003803803F8079038FC0F003801FE1E00005BEB7F3814F86D5A6D5A | |
545 | 130F806D7E130F497EEB3CFEEB38FFEB787F9038F03F803901E01FC0D803C013E0EB800F | |
546 | 39FFF03FFFA3201B7F9A23>I<39FFFC03FFA3390FF000F0000714E07F0003EB01C0A2EB | |
547 | FC0300011480EBFE070000140013FFEB7F0EA2149EEB3F9C14FC6D5AA26D5AA36D5AA26D | |
548 | 5AA25CA21307003890C7FCEA7C0FEAFE0E131E131C5BEA74F0EA3FE0EA0F8020277F9A23 | |
549 | >I E | |
550 | %EndDVIPSBitmapFont | |
551 | %DVIPSBitmapFont: Fn cmtt10 10.95 75 | |
552 | /Fn 75 127 df<127012F8B012701200A5127012F8A31270051C779B18>33 | |
553 | D<EA4010EAE038EAF078EAE038AAEA60300D0E7B9C18>I<EA0306EA078FA6387FFFC0B5 | |
554 | 12E0A26C13C0380F1E00A6387FFFC0B512E0A26C13C0381E3C00A6EA0C18131C7E9B18> | |
555 | I<13C01201A3EA03F0EA0FFCEA3FFEEA7DCFEA71C738E1C38013C7A338F1C0001279123F | |
556 | 6C7EEA0FF8EA01FC13DE13CF13C73861C38012F1A212E1EBC7001271EA79DEEA3FFEEA1F | |
557 | F8EA07E0EA01C0A3120011247D9F18>I<EA3803387C0780A2EAEE0F1400A25B131EA213 | |
558 | 3EEA7C3CA2EA387CEA0078A213F85B12015BA212035BA21207EB8380EB87C0120FEB0EE0 | |
559 | A2121F121EA2123E383C07C0A23818038013247E9F18>I<EA01C0EA07E0487EEA0E7048 | |
560 | 7EA4EB73F813F313E3380FC1C0EBC38013831303381F0700EA3F87EA7B8EEA71CEEAE1FC | |
561 | 12E0137CEB7870A2EA70FE387FFFE0EA3FC7380F03C0151C7F9B18>I<1238127CA2127E | |
562 | 123E120EA3121CA2123812F812F012C0070E789B18>I<137013F0EA01E0EA03C0EA0780 | |
563 | EA0F00121E121C5AA25AA45AA81270A47EA27E121E7EEA0780EA03C0EA01F0120013700C | |
564 | 24799F18>I<126012F012787E7E7EEA07801203EA01C0A2EA00E0A41370A813E0A4EA01 | |
565 | C0A2EA03801207EA0F00121E5A5A5A12600C247C9F18>I<EA01C0A4EA41C138F1C780EA | |
566 | FDDF387FFF00EA1FFCEA07F0A2EA1FFCEA7FFF38FDDF80EAF1C73841C100EA01C0A41114 | |
567 | 7D9718>I<136013F0A7387FFFC0B512E0A26C13C03800F000A7136013147E9718>I<121C | |
568 | 123E127E127F123F121F1207120E121E127C12F81260080C788518>I<387FFFC0B512E0 | |
569 | A26C13C013047E8F18>I<1230127812FCA2127812300606778518>I<1303EB0780A2130F | |
570 | 14005B131EA2133E133C137C1378A213F85B12015B12035BA212075B120F90C7FCA25A12 | |
571 | 1E123E123CA2127C127812F85AA2126011247D9F18>I<EA01F0EA07FC487EEA1F1FEA1C | |
572 | 0738380380007813C0EA7001A238E000E0A9EAF001007013C0A2EA780300381380381C07 | |
573 | 00EA1F1FEA0FFE6C5AEA01F0131C7E9B18>I<EA01801203A21207120F123F12FF12FB12 | |
574 | 431203B0EA7FFCEAFFFEEA7FFC0F1C7B9B18>I<EA03F0EA0FFEEA3FFF387C0F80387003 | |
575 | C0EAE00138F000E0A21260C7FCA2EB01C0A21303EB0780EB0F00131E5B5B5B485AEA07C0 | |
576 | 485A381E00E05AEA7FFFB5FC7E131C7E9B18>I<131F5B1377A213E7120113C7EA038712 | |
577 | 071307120E121E123C1238127812F0B512F8A338000700A6EB7FF0A3151C7F9B18>52 | |
578 | D<137E48B4FC00071380380F83C0EA1E03121C3838018090C7FC5AA2EAE1F8EAE7FEB5FC | |
579 | 38FE078038F803C0EAF001EB00E05AA21270A3383801C0EA3C03381E0780380FFF006C5A | |
580 | EA01F8131C7E9B18>54 D<1230127812FCA2127812301200A81230127812FCA212781230 | |
581 | 0614779318>58 D<1218123C127EA2123C12181200A81218123C127EA2123E121E120E12 | |
582 | 1C123C127812F01260071A789318>I<14C0EB03E01307EB1FC0EB3F80EBFE00485AEA07 | |
583 | F0485AEA3F8048C7FC12FCA2127F6C7EEA0FE06C7EEA01FC6C7EEB3F80EB1FC0EB07E013 | |
584 | 03EB00C013187E9918>I<387FFFC0B512E0A26C13C0C8FCA4387FFFC0B512E0A26C13C0 | |
585 | 130C7E9318>I<126012F87E127F6C7EEA0FE06C7EEA01FC6C7EEB3F80EB1FC0EB07E0A2 | |
586 | EB1FC0EB3F80EBFE00485AEA07F0485AEA3F8048C7FC12FC5A126013187E9918>I<EA0F | |
587 | F0EA3FFC48B4FCEA700F38F00380A2EA600738000F00133E5BEA01F05B485AA55BC8FCA5 | |
588 | EA0380487EA36C5A111C7D9B18>I<137013F8A213D8A2EA01DCA3138CEA038EA4EA0707 | |
589 | A5380FFF80A3EA0E03381C01C0A3387F07F000FF13F8007F13F0151C7F9B18>65 | |
590 | D<EA7FF8EAFFFE6C7E381C0F80EB03C0A2EB01E01300A214F01470A814F014E0A2130114 | |
591 | C01303EB0F80387FFF00485AEA7FF8141C7F9B18>68 D<B512F0A3381C0070A41400A213 | |
592 | 0EA3EA1FFEA3EA1C0EA390C7FCA21438A5B512F8A3151C7F9B18>I<B512F8A3381C0038 | |
593 | A41400A21307A3EA1FFFA3EA1C07A390C7FCA7EAFFC0A3151C7F9B18>I<387F07F038FF | |
594 | 8FF8387F07F0381C01C0A9EA1FFFA3EA1C01AA387F07F038FF8FF8387F07F0151C7F9B18 | |
595 | >72 D<EA7FFFB512806C1300EA01C0B3A4EA7FFFB512806C1300111C7D9B18>I<EAFFC0 | |
596 | A3001CC7FCB114E0A5B5FCA3131C7E9B18>76 D<387E07F038FF0FF8387F07F0381D81C0 | |
597 | A313C1121CA213E1A313611371A213311339A31319A2131D130DA3EA7F07EAFF87EA7F03 | |
598 | 151C7F9B18>78 D<EA0FFE383FFF804813C0EA7803EA700100F013E0EAE000B0EAF00100 | |
599 | 7013C0EA7C07EA7FFF6C1380380FFE00131C7E9B18>I<EAFFFEEBFF8014C0EA1C03EB01 | |
600 | E013001470A514E01301EB03C0EA1FFF1480EBFE00001CC7FCA8B47EA3141C7F9B18>I< | |
601 | EA7FF8EAFFFE6C7E381C0F80130314C01301A313031480130F381FFF005BA2EA1C0F7FEB | |
602 | 0380A5149CA3387F01F8EAFF81387F00F0161C7F9B18>82 D<3803F1C0EA1FFF5AEA7C0F | |
603 | EA7003EAE001A390C7FC12701278123FEA1FF0EA07FEC67EEB0F80EB03C01301EB00E0A2 | |
604 | 126012E0130100F013C038F80780B5FCEBFE00EAE7F8131C7E9B18>I<387FFFF8B5FCA2 | |
605 | 38E07038A400001300B2EA07FFA3151C7F9B18>I<38FF83FEA3381C0070B36C13E0EA0F | |
606 | 01380783C03803FF806C1300EA007C171C809B18>I<38FE03F8EAFF07EAFE03381C01C0 | |
607 | EA1E03000E1380EA0F0700071300A2EA038EA2EA01DCA3EA00F8A21370A9EA01FC487E6C | |
608 | 5A151C7F9B18>89 D<EAFFF8A3EAE000B3ACEAFFF8A30D24779F18>91 | |
609 | D<126012F0A27E1278127C123CA2123E121E121F7EA27F12077F1203A27F12017F12007F | |
610 | 1378A2137C133C133E131EA2131F7F14801307A2EB030011247D9F18>I<EAFFF8A3EA00 | |
611 | 38B3ACEAFFF8A30D247F9F18>I<EA0180EA07C0EA1FF0EA7EFCEAF83EEAE00E0F067C9B | |
612 | 18>I<387FFFC0B512E0A26C13C013047E7F18>I<1206121E123E12381270A212E0A312F8 | |
613 | 12FC127CA21238070E789E18>I<EA0FF0EA1FFC487EEA3C0FEA180738000380A213FF12 | |
614 | 07121FEA7F03127812E0A3EAF007EA780F383FFFF8EA1FFDEA07F015147E9318>I<127E | |
615 | 12FE127E120EA5133EEBFF80000F13C0EBC1E01380EB0070120E1438A6000F1370A2EB80 | |
616 | E013C1EBFFC0000E138038063E00151C809B18>I<EA01FEEA07FF001F1380EA3E073838 | |
617 | 030048C7FCA25AA61270EB01C01238EA3E03381FFF8000071300EA01FC12147D9318>I< | |
618 | EB1F80133F131F1303A5EA03E3EA0FFBEA1FFFEA3C1FEA380FEA7007130312E0A6EA7007 | |
619 | A2EA380FEA3C1F381FFFF0380FFBF83803E3F0151C7E9B18>I<EA01F0EA07FCEA1FFEEA | |
620 | 3E0F38380780EA7003A238E001C0A2B5FCA300E0C7FC1270EB01C01238EA3E07381FFF80 | |
621 | 00071300EA01F812147D9318>I<EB1F80EB7FC0EBFFE013E13801C0C01400A3387FFFC0 | |
622 | B5FCA23801C000AEEA7FFFA3131C7F9B18>I<3801E1F03807FFF85A381E1E30381C0E00 | |
623 | 487EA5EA1C0EEA1E1EEA1FFC5BEA39E00038C7FC7EEA1FFEEBFFC04813E0387801F03870 | |
624 | 0070481338A4007813F0EA7E03381FFFC06C13803801FC00151F7F9318>I<127E12FE12 | |
625 | 7E120EA5133EEBFF80000F13C013C1EB80E01300120EAB387FC7FC38FFE7FE387FC7FC17 | |
626 | 1C809B18>I<EA0380EA07C0A3EA0380C7FCA4EA7FC012FF127F1201AEB5FCA3101D7C9C | |
627 | 18>I<EAFFC0A31201B3A4B51280A3111C7D9B18>108 D<38F9C1C038FFF7F013FF383E3E | |
628 | 38EA3C3CA2EA3838AB38FE3E3EEB7E7EEB3E3E1714809318>I<EA7E3E38FEFF80007F13 | |
629 | C0EA0FC1EB80E01300120EAB387FC7FC38FFE7FE387FC7FC1714809318>I<EA01F0EA0F | |
630 | FE487E383E0F80EA3803387001C0A238E000E0A5EAF001007013C0EA7803383C0780EA3E | |
631 | 0F381FFF006C5AEA01F013147E9318>I<EA7E3E38FEFF80007F13C0380FC1E01380EB00 | |
632 | 70120E1438A6000F1370A2EB80E013C1EBFFC0000E1380EB3E0090C7FCA7EA7FC0487E6C | |
633 | 5A151E809318>I<3801F380EA07FBEA1FFFEA3E1FEA380FEA7007A2EAE003A6EA7007A2 | |
634 | EA380FEA3C1FEA1FFFEA0FFBEA03E3EA0003A7EB1FF0EB3FF8EB1FF0151E7E9318>I<38 | |
635 | FF0FC0EB3FE0EB7FF0EA07F0EBE060EBC0005BA290C7FCA9EAFFFC7F5B14147E9318>I< | |
636 | EA07F7EA3FFF5AEA780FEAE007A3007CC7FCEA7FE0EA1FFCEA03FEEA001F38600780EAE0 | |
637 | 03A212F038F80F00B5FC13FCEAE7F011147D9318>I<487E1203A4387FFFC0B5FCA23803 | |
638 | 8000A9144014E0A33801C1C013FF6C1380EB3E0013197F9818>I<387E07E0EAFE0FEA7E | |
639 | 07EA0E00AC1301EA0F033807FFFC6C13FE3801FCFC1714809318>I<387F8FF000FF13F8 | |
640 | 007F13F0381C01C0380E0380A338070700A3138FEA038EA3EA01DCA3EA00F8A213701514 | |
641 | 7F9318>I<38FF07F8138F1307383800E0A4381C01C0137113F9A213D9EA1DDD000D1380 | |
642 | A3138DEA0F8FA23807070015147F9318>I<387F8FF0139F138F380F0700EA078EEA039E | |
643 | EA01DC13F81200137013F07FEA01DCEA039E138EEA0707000E1380387F8FF000FF13F800 | |
644 | 7F13F015147F9318>I<387F8FF000FF13F8007F13F0380E01C0EB0380A21207EB0700A2 | |
645 | EA0387A2138EEA01CEA213CC120013DC1378A31370A313F05B1279EA7BC0EA7F806CC7FC | |
646 | 121E151E7F9318>I<383FFFF05AA2387001E0EB03C0EB078038000F00131E5B13F8485A | |
647 | EA03C0485A380F0070121E5A5AB512F0A314147F9318>I<EB07E0131F137FEB780013E0 | |
648 | AB1201EA7FC0485AA26C7EEA01E01200AB1378EB7FE0131F130713247E9F18>I<126012 | |
649 | F0B3B012600424769F18>I<127CB4FC13C01203C67EAB7FEB7FC0EB3FE0A2EB7FC0EBF0 | |
650 | 005BABEA03C012FF90C7FC127C13247E9F18>I<EA060CEA1F1EEA3FBEEAFBF8EAF1F0EA | |
651 | 60C00F067C9B18>I E | |
652 | %EndDVIPSBitmapFont | |
653 | %DVIPSBitmapFont: Fo cmr10 10.95 75 | |
654 | /Fo 75 123 df<90381F83E09038F06E303901C07878380380F8903800F03048EB7000A7 | |
655 | B612803907007000B2383FE3FF1D20809F1B>11 D<133FEBE0C0EA01C0380381E0EA0701 | |
656 | A290C7FCA6B512E0EA0700B2383FC3FC1620809F19>I<EB3FE013E0EA01C1EA0381EA07 | |
657 | 00A8B5FCEA0700B2383FE7FC1620809F19>I<90381F81F89038F04F043901C07C063903 | |
658 | 80F80FEB00F05A0270C7FCA6B7FC3907007007B23A3FE3FE3FE02320809F26>I<EA7038 | |
659 | EAF87CEAFC7EA2EA743AEA0402A3EA0804A2EA1008A2EA2010EA40200F0E7F9F17>34 | |
660 | D<127012F812FCA212741204A31208A21210A212201240060E7C9F0D>39 | |
661 | D<13401380EA01005A12061204120C5AA212381230A212701260A412E0AC1260A4127012 | |
662 | 30A212381218A27E120412067E7EEA008013400A2E7BA112>I<7E12407E12307E120812 | |
663 | 0C7EA212077EA213801201A413C0AC1380A412031300A25A1206A25A120812185A12205A | |
664 | 5A0A2E7EA112>I<127012F012F8A212781208A31210A31220A21240050E7C840D>44 | |
665 | D<EAFFF0A20C02808A0F>I<127012F8A3127005057C840D>I<EA03F0EA0E1C487EEA1806 | |
666 | EA380738700380A400F013C0AD00701380A3EA780700381300EA1806EA1C0E6C5AEA03F0 | |
667 | 121F7E9D17>48 D<13801203120F12F31203B3A6EA07C0EAFFFE0F1E7C9D17>I<EA03F0 | |
668 | EA0C1CEA100E487E00401380128000F013C0EAF803A3EA200712001480A2EB0F00130E5B | |
669 | 5B5B13605B485A48C7FC000613405A5A00101380EA3FFF5AB5FC121E7E9D17>I<EA03F0 | |
670 | EA0C1CEA100EEA200F007813801307A2EA380F12001400A2131E131C1370EA07F0EA003C | |
671 | 130E130FEB0780A214C0122012F8A300F013801240EB0F00EA200EEA183CEA07F0121F7E | |
672 | 9D17>I<1306A2130EA2131E132EA2134E138EA2EA010E1202A212041208A212101220A2 | |
673 | 124012C0B512F038000E00A7EBFFE0141E7F9D17>I<EA1803EA1FFE5B5B13E00010C7FC | |
674 | A6EA11F0EA161CEA180EEA10071480EA0003A214C0A3127012F0A200E013801240EB0700 | |
675 | EA20066C5AEA0838EA07E0121F7E9D17>I<137CEA0182EA0701380E0380EA0C07121838 | |
676 | 38030090C7FC12781270A2EAF1F0EAF21CEAF406EAF807EB0380A200F013C0A51270A214 | |
677 | 801238EB07001218EA0C0E6C5AEA01F0121F7E9D17>I<1240387FFFE014C0A238400080 | |
678 | 38800100A21302485AA25B5BA25BA21360A213E05B1201A41203A76C5A131F7E9D17>I< | |
679 | EA03F0EA0C0CEA1006EA3003382001801260A3127038780300123EEA3F06EA1FC8EA0FF0 | |
680 | EA03F8487EEA0C7EEA103F38300F80EA6007EB01C012C01300A31480EA600100201300EA | |
681 | 1002EA0C0CEA03F0121F7E9D17>I<EA03F0EA0E18487E487E13071270EB038012F0A214 | |
682 | C0A5EA7007A21238EA180BEA0E13EA03E338000380A3EB07001230EA7806130EEA700CEA | |
683 | 2018EA1070EA0FC0121F7E9D17>I<127012F8A312701200AA127012F8A3127005147C93 | |
684 | 0D>I<127012F8A312701200AA127012F012F8A212781208A31210A31220A21240051D7C | |
685 | 930D>I<5B497EA3497EA3EB09E0A3EB10F0A3EB2078A3497EA2EBC03EEB801EA248B5FC | |
686 | EB000FA20002EB0780A348EB03C0A2120C001E14E039FF801FFE1F207F9F22>65 | |
687 | D<B512E0380F0078141EA2801580A515005C141E147CEBFFF0EB007C141FEC0F80EC07C0 | |
688 | 140315E0A515C014071580EC0F00143EB512F01B1F7E9E20>I<90380FE0109038381C30 | |
689 | 9038E002703803C00139078000F048C71270121E15305A1510127C127800F81400A91278 | |
690 | 007C1410123CA26C1420A27E6C6C13406C6C13803900E00300EB380CEB0FF01C217E9F21 | |
691 | >I<B512F83807801EEC0780EC03C0EC01E0EC00F015701578A2153CA3153EA8153CA215 | |
692 | 7C1578A215F0EC01E0EC03C0EC0780EC1E00B512F81F1F7F9E23>I<B61280380F000F14 | |
693 | 031401140015C01540A314401500A214C0130113FF130113001440A3EC0020A31540A315 | |
694 | C01401EC0380140FB6FC1B1F7E9E1F>I<B61280380780071401A2140015C01540A4EC20 | |
695 | 00A3146014E013FF138014601420A391C7FCA87FEAFFFE1A1F7F9E1E>I<90380FE01090 | |
696 | 38381C309038E002703803C00139078000F048C71270121E15305A1510127C127800F814 | |
697 | 00A7EC3FFEEC01F000781300127C123CA27EA27E6C7E3903C001703900E002309038380C | |
698 | 1090380FF0001F217E9F24>I<39FFF07FF8390F000780AD90B5FCEB0007AF39FFF07FF8 | |
699 | 1D1F7E9E22>I<EAFFF0EA0F00B3ABEAFFF00C1F7E9E10>I<3807FFC038003E00131EB3A3 | |
700 | 122012F8A3EAF01CEA403CEA6038EA1070EA0FC012207F9E17>I<EAFFF8EA0F8090C7FC | |
701 | B21402A414061404A2140C141C147CB512FC171F7E9E1C>76 D<B46CEB07FE000715C0A2 | |
702 | D805C0130BA2D804E01313A301701323A26D1343A36D1383A290380E0103A3EB0702A3EB | |
703 | 0384A2EB01C8A3EB00F0A21460121FD8FFE0EB7FFE271F7F9E2A>I<B4EB0FF8390F8003 | |
704 | E0EC0080EA0BC0EA09E0A2EA08F01378A27F7FA27FEB0780A2EB03C0EB01E0A2EB00F014 | |
705 | 78A2143C141EA2140F1407A214031401123E38FF80001D1F7E9E22>I<EB1FE0EB703838 | |
706 | 01C00E48487E39070003804814C0001EEB01E048EB00F0A2007C14F8A20078147800F814 | |
707 | 7CA900781478007C14F8A2003C14F0003E1301001E14E06CEB03C06C1480390380070038 | |
708 | 01E01E38007038EB1FE01E217E9F23>I<B512E0380F007C141E80EC0780A215C0A41580 | |
709 | A2EC0F00141E147CEBFFE090C8FCAEEAFFF01A1F7E9E1F>I<EB1FE0EB70383801C00E48 | |
710 | 487E39070003804814C0001EEB01E0003E14F0003C1300007C14F8A20078147800F8147C | |
711 | A900781478007C14F8A2003C14F0383E0781391E0841E0390F1023C00007148039039017 | |
712 | 003801D01E3900783804EB1FF8EB001CEC0C0CEC0E1CEC0FF8A2140715F0EC01E01E297E | |
713 | 9F23>I<B57E380F00F0143C8080A21580A41500A2141E5C14F0EBFF80EB01C0EB0070A2 | |
714 | 80143CA3143EA31504143F141FEC0F0839FFF00788C7EA01F01E207E9E21>I<3803F040 | |
715 | 380C0CC0EA1803EA3001EA6000A212E01440A36C13007E127CEA7F80EA3FF86CB4FC0007 | |
716 | 1380C613C0EB1FE013031301EB00F014707EA46C136014E06C13C038F8018038C60300EA | |
717 | 81FC14217E9F19>I<007FB512E038780F010060EB006000401420A200C0143000801410 | |
718 | A400001400B3497E3803FFFC1C1F7E9E21>I<39FFF00FF8390F0003E0EC0080B3A46CEB | |
719 | 01001380120314026C6C5A6C6C5AEB3830EB0FC01D207E9E22>I<39FFF003FE391F8000 | |
720 | F86CC7126015206C6C1340A36C6C1380A2EBE00100011400A23800F002A213F8EB7804A2 | |
721 | 6D5AA36D5AA2131F6D5AA2EB07C0A36D5AA36DC7FC1F207F9E22>I<3BFFF07FF81FF03B | |
722 | 1F000FC007C06C903907800180170015C001805C00071502EC09E013C000035DEC19F014 | |
723 | 10D801E05CA2EC2078D800F05CA2EC403C01785CA2EC801E017C1460013C144090383D00 | |
724 | 0F133F6D5CA2011E1307010E91C7FCA2010C7F010413022C207F9E2F>I<12FFA212C0B3 | |
725 | B3A512FFA2082D7CA10D>91 D<EA0804EA1008EA2010A2EA4020A2EA8040A3EAB85CEAFC | |
726 | 7EA2EA7C3EEA381C0F0E7A9F17>I<12FFA21203B3B3A512FFA2082D80A10D>I<12081210 | |
727 | 1220A21240A21280A312B812FCA2127C1238060E7D9F0D>96 D<EA1FE0EA3030EA781813 | |
728 | 1CEA300E1200A313FEEA078EEA1E0E1238127800F01310A3131E127838386720380F83C0 | |
729 | 14147E9317>I<121C12FC121CAA137CEA1D87381E0180EB00C0001C13E01470A21478A6 | |
730 | 147014F014E0001E13C0381A018038198700EA107C15207E9F19>I<EA01FCEA0706EA1C | |
731 | 0F123813060078C7FC127012F0A61270127800381380A2381C0100EA0706EA01F811147F | |
732 | 9314>I<EB01C0130F1301AAEA01F1EA070DEA0C03EA180112381278127012F0A61270A2 | |
733 | 1238EA1803120CEA070D3801F1F815207F9F19>I<EA03F0EA0E1C487E487EA21270EB03 | |
734 | 8012F0A2B5FC00F0C7FCA31270A26C1380A2381C0100EA0706EA01F811147F9314>I<13 | |
735 | 7CEA01C6EA030F1207EA0E061300A7EAFFF0EA0E00B2EA7FE01020809F0E>I<14E03803 | |
736 | E330EA0E3CEA1C1C38380E00EA780FA5EA380E6C5AEA1E38EA33E00020C7FCA21230A2EA | |
737 | 3FFE381FFF8014C0383001E038600070481330A4006013606C13C0381C03803803FC0014 | |
738 | 1F7F9417>I<121C12FC121CAA137C1386EA1D03001E1380A2121CAE38FF8FF014207E9F | |
739 | 19>I<1238127CA31238C7FCA6121C12FC121CB1EAFF80091F7F9E0C>I<13E0EA01F0A3EA | |
740 | 00E01300A61370EA07F012001370B3A31260EAF06013C0EA6180EA3F000C28829E0E>I< | |
741 | 121C12FC121CAAEB1FE0EB0780EB060013045B5B5B136013E0EA1DF0EA1E70EA1C38133C | |
742 | 131C7F130F7F148014C038FF9FF014207E9F18>I<121C12FC121CB3ABEAFF8009207F9F | |
743 | 0C>I<391C3E03E039FCC30C30391D039038391E01E01CA2001C13C0AE3AFF8FF8FF8021 | |
744 | 147E9326>I<EA1C7CEAFC86EA1D03001E1380A2121CAE38FF8FF014147E9319>I<EA01F8 | |
745 | EA070E381C0380383801C0A2387000E0A200F013F0A6007013E0A2383801C0A2381C0380 | |
746 | 38070E00EA01F814147F9317>I<EA1C7CEAFD87381E018014C0381C00E014F014701478 | |
747 | A6147014F014E0381E01C0EB0380381D8700EA1C7C90C7FCA8B47E151D7E9319>I<3801 | |
748 | F04038070CC0EA0E02EA1C03EA38011278127012F0A6127012781238EA1C03EA0C05EA07 | |
749 | 09EA01F1EA0001A8EB0FF8151D7F9318>I<EA1CF0EAFD18EA1E3CA21318EA1C00AEEAFF | |
750 | C00E147E9312>I<EA0FC8EA3038EA6018EAC008A3EAE000127CEA3FE0EA1FF0EA07F8EA | |
751 | 003CEA800E130612C0A21304EAE00CEAD818EA87E00F147F9312>I<1202A31206A2120E | |
752 | A2123EEAFFF8EA0E00AB1304A5EA07081203EA01F00E1C7F9B12>I<381C0380EAFC1FEA | |
753 | 1C03AE1307120CEA061B3803E3F014147E9319>I<38FF83F8383E00E0001C13C06C1380 | |
754 | A338070100A21383EA0382A2EA01C4A213E4EA00E8A21370A3132015147F9318>I<39FF | |
755 | 9FE1FC393C078070391C030060EC8020000E1440A214C0D80704138014E0A23903886100 | |
756 | 1471A23801D032143A143E3800E01CA2EB6018EB40081E147F9321>I<38FF87F8381E03 | |
757 | C0380E0180EB0300EA0702EA0384EA01C813D8EA00F01370137813F8139CEA010E1202EA | |
758 | 060738040380000C13C0003C13E038FE07FC16147F9318>I<38FF83F8383E00E0001C13 | |
759 | C06C1380A338070100A21383EA0382A2EA01C4A213E4EA00E8A21370A31320A25BA3EAF0 | |
760 | 80A200F1C7FC1262123C151D7F9318>I<EA7FFFEA700E1260EA401C133813781370EA00 | |
761 | E0120113C0EA038012071301120E121EEA1C03EA3802EA7006130EEAFFFE10147F9314> | |
762 | I E | |
763 | %EndDVIPSBitmapFont | |
764 | %DVIPSBitmapFont: Fp cmbx12 20.736 13 | |
765 | /Fp 13 122 df<DB1FFC14C00203B5EAC001021FECF003027FECFC07903B01FFFC00FE0F | |
766 | 010701C0EB1F9F4948C7EA07FFD93FF880494814004948157F485B4A153F4890C9121F48 | |
767 | 5A000F170F5B001F1707A2485A1803A2127FA24993C8FCA212FFAA041FB61280127FA27F | |
768 | DC0001EBC000123FA36C7EA26C7EA26C7E7E6C7F806C7F6D6C5CEB3FFCD90FFF5C6D01C0 | |
769 | EB1FBF010101FCEBFF1F6D6CB5EAFE0F021FECF8030203ECE0009126001FFEC9FC413D7B | |
770 | BB4C>71 D<B6D8F803B612E0A426007FF0C70001EBC000B3A491B8FCA402F0C71201B3A7 | |
771 | B6D8F803B612E0A4433B7CBA4C>I<B612FEA426007FF0C9FCB3ADEF03C0A517071880A3 | |
772 | 170FA3171FA2173F177F17FF5E04071300163FB9FCA4323B7DBA3A>76 | |
773 | D<B500F00207B512E0808080D8007F92390007E0006E6F5A81017B7F81137901787F6E7E | |
774 | 6E7E81141F6E7E6E7F6E7F82806E7F6F7E6F7E826F7E816F13806F13C017E06F13F081EE | |
775 | 7FF8EE3FFC17FEEE1FFF827013837013C318E37013F382EF7FFBEF3FFFA283838383A283 | |
776 | 83187F183FA201FC161FB500FC150F18071803A2433B7CBA4C>78 | |
777 | D<B600F80107B512E0A426007FF0C83807E000725AB3B3A3013F4C5AA280011F4CC7FCA2 | |
778 | 6D6C151E0107163E6E5D6D6C5D6D6D13019026007FE0EB0FE0DA3FFCEB7FC0020FB65A02 | |
779 | 034AC8FCDA007F13F003071380433C7DBA4A>85 D<EB3FFE48B512E0000714F8390FE007 | |
780 | FC9038F001FE486C6C7E6F7E82153F6C48806C5A6C5AC8FCA491B5FC131F90387FF83F38 | |
781 | 03FF803807FC00EA0FF0485A123F485AA2485AA4157F6C7E15DF3A3FE0039FF03B1FF80F | |
782 | 0FFFE03807FFFE0001497E39003FE0002B267DA52F>97 D<13FE12FFA412071203B04AB4 | |
783 | FC021F13F0027F13FC9138FC03FE9039FFF000FF02C0EB3F8091C7EA1FC04915E0EE0FF0 | |
784 | 17F8A2EE07FCA317FEA917FCA3160F17F817F0161F6D15E06EEB3FC06EEB7F80D9F9E0EB | |
785 | FF009039F0FC07FE91387FFFF8D9E01F13E09026C003FEC7FC2F3C7DBB36>I<EA01E0EA | |
786 | 07F8487EA2487EA46C5AA26C5AEA01E0C8FCAB13FE127FA412071203B3AAB512F0A4143D | |
787 | 7DBC1A>105 D<903801FFC0010F13F8017F13FFD9FF807F3A03FE003FE0D807F8EB0FF0 | |
788 | 48486D7EA248486D7E003F81A248486D7EA400FF1680A9007F1600A36C6C495AA2001F5D | |
789 | 6D1307000F5D6C6C495AD803FEEB3FE03A00FF80FF806DB5C7FC010F13F8010113C02926 | |
790 | 7DA530>111 D<3901FC03F000FFEB0FFC4AB4FC91383C3F80EC707F00079038E0FFC000 | |
791 | 035BEBFD80A201FFEB7F809138003F00151E92C7FC5BB3A3B512FCA422267DA528>114 | |
792 | D<90383FF0383903FFFE7848EBFFF8381FC00F383F0003003E13005A157812FCA27E6C14 | |
793 | 0013C013FC387FFFF06C13FEECFF806C14C06C14E0000314F0C614F8011F13FCEB007FEC | |
794 | 07FE0070130100F01300157E7EA27E157C6C14FC6C14F890388001F09038F00FE000F9B5 | |
795 | 12C0D8F07F130038C01FF81F267DA526>I<130FA55BA45BA25BA25B5A5A5A001FEBFFF0 | |
796 | B6FCA3000190C7FCB3153CA86C14781480017F13F090383FC1E090381FFFC06D13809038 | |
797 | 01FE001E377EB626>I<B500F0EBFFFCA4D803FEC7EA1F806D15006C151E806C5DA26E13 | |
798 | 7C017F14786E13F8013F5CECF001011F5CECF803010F5CA2ECFC0701075CECFE0F010391 | |
799 | C7FC6E5A6D131E15BE6D13BC15FC6E5AA36E5AA26E5AA26E5AA26E5AA2140F92C8FC5C14 | |
800 | 1E0008133E007F133C147C38FF807814F8EB81F0EB83E06C485A387C1F80D83FFFC9FCEA | |
801 | 1FFCEA07F02E377EA533>121 D E | |
802 | %EndDVIPSBitmapFont | |
803 | end | |
a44161c3 EZ |
804 | %%EndProlog |
805 | %%BeginSetup | |
806 | %%Feature: *Resolution 300dpi | |
807 | TeXDict begin | |
f9267e15 EZ |
808 | %%BeginPaperSize: Letter |
809 | letter | |
810 | %%EndPaperSize | |
a44161c3 EZ |
811 | |
812 | %%EndSetup | |
813 | %%Page: 1 1 | |
814 | 1 0 bop 75 693 a Fp(GNU)33 b(History)f(Library)p 75 743 | |
f9267e15 EZ |
815 | 1800 17 v 960 791 a Fo(Edition)16 b(4.1,)e(for)h Fn(History)f(Library)g |
816 | Fo(V)l(ersion)i(4.1.)1609 845 y(Jan)o(uary)f(2000)75 | |
a44161c3 EZ |
817 | 2467 y Fm(Brian)23 b(F)-6 b(o)n(x,)23 b(F)-6 b(ree)23 |
818 | b(Soft)n(w)n(are)f(F)-6 b(oundation)75 2534 y(Chet)22 | |
819 | b(Ramey)-6 b(,)23 b(Case)e(W)-6 b(estern)23 b(Reserv)n(e)f(Univ)n | |
820 | (ersit)n(y)p 75 2570 1800 9 v eop | |
821 | %%Page: 2 2 | |
822 | 2 1 bop 75 250 a Fo(This)21 b(do)q(cumen)o(t)g(describ)q(es)h(the)f | |
823 | (GNU)f(History)g(library)l(,)j(a)d(programming)g(to)q(ol)g(that)g(pro)o | |
824 | (vides)h(a)75 305 y(consisten)o(t)15 b(user)h(in)o(terface)f(for)g | |
825 | (recalling)i(lines)f(of)f(previously)i(t)o(yp)q(ed)e(input.)75 | |
826 | 373 y(Published)i(b)o(y)f(the)f(F)l(ree)g(Soft)o(w)o(are)f(F)l | |
f9267e15 EZ |
827 | (oundation)75 427 y(59)h(T)l(emple)h(Place,)f(Suite)i(330,)75 |
828 | 482 y(Boston,)d(MA)h(02111)f(USA)75 549 y(P)o(ermission)j(is)f(gran)o | |
829 | (ted)g(to)f(mak)o(e)h(and)g(distribute)i(v)o(erbatim)d(copies)i(of)f | |
830 | (this)h(man)o(ual)f(pro)o(vided)h(the)75 604 y(cop)o(yrigh)o(t)e | |
a44161c3 EZ |
831 | (notice)h(and)f(this)h(p)q(ermission)g(notice)g(are)f(preserv)o(ed)h |
832 | (on)f(all)h(copies.)75 671 y(P)o(ermission)c(is)h(gran)o(ted)e(to)g | |
833 | (cop)o(y)h(and)g(distribute)h(mo)q(di\014ed)g(v)o(ersions)f(of)f(this)h | |
834 | (man)o(ual)g(under)h(the)f(con-)75 726 y(ditions)k(for)e(v)o(erbatim)h | |
835 | (cop)o(ying,)g(pro)o(vided)h(that)e(the)h(en)o(tire)h(resulting)g | |
836 | (deriv)o(ed)g(w)o(ork)e(is)h(distributed)75 781 y(under)h(the)f(terms)g | |
837 | (of)g(a)f(p)q(ermission)j(notice)f(iden)o(tical)h(to)e(this)g(one.)75 | |
838 | 848 y(P)o(ermission)i(is)g(gran)o(ted)f(to)g(cop)o(y)h(and)f | |
839 | (distribute)i(translations)f(of)f(this)h(man)o(ual)g(in)o(to)f(another) | |
840 | g(lan-)75 903 y(guage,)e(under)h(the)f(ab)q(o)o(v)o(e)g(conditions)i | |
841 | (for)d(mo)q(di\014ed)j(v)o(ersions,)e(except)h(that)f(this)h(p)q | |
842 | (ermission)g(notice)75 958 y(ma)o(y)f(b)q(e)i(stated)f(in)h(a)f | |
843 | (translation)g(appro)o(v)o(ed)g(b)o(y)g(the)g(F)l(ree)h(Soft)o(w)o(are) | |
844 | d(F)l(oundation.)75 2661 y(Cop)o(yrigh)o(t)301 2660 y(c)289 | |
845 | 2661 y Fl(\015)i Fo(1988-1999)e(F)l(ree)i(Soft)o(w)o(are)f(F)l | |
846 | (oundation,)h(Inc.)p eop | |
847 | %%Page: 1 3 | |
848 | 1 2 bop 75 -58 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o | |
849 | (ely)1007 b(1)75 183 y Fk(1)41 b(Using)26 b(History)h(In)n(teractiv)n | |
850 | (ely)137 317 y Fo(This)16 b(c)o(hapter)f(describ)q(es)i(ho)o(w)d(to)h | |
851 | (use)g(the)g(GNU)g(History)g(Library)h(in)o(teractiv)o(ely)l(,)g(from)e | |
852 | (a)h(user's)75 372 y(standp)q(oin)o(t.)35 b(It)20 b(should)g(b)q(e)h | |
853 | (considered)h(a)d(user's)h(guide.)35 b(F)l(or)19 b(information)h(on)g | |
854 | (using)h(the)f(GNU)75 427 y(History)d(Library)h(in)h(y)o(our)e(o)o(wn)g | |
855 | (programs,)f(see)i(Chapter)f(2)h([Programming)e(with)i(GNU)f(History],) | |
f9267e15 | 856 | 75 482 y(page)e(5.)75 625 y Fm(1.1)33 b(History)22 b(Expansion)137 |
a44161c3 EZ |
857 | 727 y Fo(The)c(History)g(library)h(pro)o(vides)f(a)f(history)h |
858 | (expansion)h(feature)e(that)h(is)g(similar)h(to)e(the)h(history)75 | |
859 | 782 y(expansion)12 b(pro)o(vided)g(b)o(y)f Fn(csh)p Fo(.)18 | |
860 | b(This)11 b(section)h(describ)q(es)g(the)g(syn)o(tax)e(used)h(to)g | |
861 | (manipulate)h(the)f(history)75 836 y(information.)137 | |
862 | 909 y(History)k(expansions)h(in)o(tro)q(duce)h(w)o(ords)d(from)g(the)i | |
863 | (history)f(list)h(in)o(to)f(the)h(input)g(stream,)e(making)75 | |
864 | 964 y(it)h(easy)g(to)g(rep)q(eat)g(commands,)g(insert)h(the)f(argumen)o | |
865 | (ts)f(to)h(a)g(previous)h(command)f(in)o(to)g(the)g(curren)o(t)75 | |
866 | 1019 y(input)h(line,)h(or)d(\014x)i(errors)e(in)i(previous)g(commands)f | |
867 | (quic)o(kly)l(.)137 1092 y(History)j(expansion)i(tak)o(es)d(place)i(in) | |
868 | h(t)o(w)o(o)d(parts.)28 b(The)19 b(\014rst)f(is)g(to)g(determine)i | |
869 | (whic)o(h)f(line)h(from)75 1147 y(the)h(history)f(list)i(should)g(b)q | |
870 | (e)f(used)g(during)h(substitution.)37 b(The)21 b(second)g(is)g(to)f | |
871 | (select)i(p)q(ortions)e(of)75 1202 y(that)15 b(line)i(for)d(inclusion)k | |
872 | (in)o(to)d(the)h(curren)o(t)f(one.)20 b(The)c(line)g(selected)h(from)e | |
873 | (the)g(history)g(is)h(called)h(the)75 1256 y Fj(ev)o(en)o(t)p | |
874 | Fo(,)c(and)h(the)g(p)q(ortions)g(of)f(that)g(line)i(that)e(are)g(acted) | |
875 | h(up)q(on)g(are)f(called)j Fj(w)o(ords)p Fo(.)i(V)l(arious)c | |
876 | Fj(mo)q(di\014ers)75 1311 y Fo(are)i(a)o(v)m(ailable)i(to)e(manipulate) | |
877 | i(the)e(selected)i(w)o(ords.)23 b(The)17 b(line)h(is)f(brok)o(en)f(in)o | |
878 | (to)h(w)o(ords)e(in)j(the)e(same)75 1366 y(fashion)c(that)e(Bash)i(do)q | |
879 | (es,)g(so)f(that)g(sev)o(eral)g(w)o(ords)g(surrounded)h(b)o(y)f(quotes) | |
880 | h(are)f(considered)h(one)g(w)o(ord.)75 1421 y(History)18 | |
881 | b(expansions)h(are)g(in)o(tro)q(duced)g(b)o(y)f(the)h(app)q(earance)g | |
882 | (of)f(the)g(history)h(expansion)g(c)o(haracter,)75 1475 | |
883 | y(whic)o(h)d(is)g(`)p Fn(!)p Fo(')e(b)o(y)h(default.)75 | |
884 | 1599 y Fi(1.1.1)30 b(Ev)n(en)n(t)21 b(Designators)137 | |
885 | 1701 y Fo(An)16 b(ev)o(en)o(t)f(designator)g(is)g(a)g(reference)h(to)f | |
886 | (a)g(command)g(line)i(en)o(try)d(in)i(the)g(history)f(list.)75 | |
887 | 1789 y Fn(!)216 b Fo(Start)16 b(a)g(history)h(substitution,)g(except)h | |
888 | (when)f(follo)o(w)o(ed)g(b)o(y)f(a)h(space,)g(tab,)f(the)h(end)g(of)315 | |
889 | 1844 y(the)e(line,)i(`)p Fn(=)p Fo(')d(or)h(`)p Fn(\()p | |
890 | Fo('.)75 1929 y Fn(!)p Fj(n)191 b Fo(Refer)16 b(to)e(command)h(line)i | |
891 | Fj(n)p Fo(.)75 2015 y Fn(!-)p Fj(n)167 b Fo(Refer)16 | |
892 | b(to)e(the)i(command)f Fj(n)g Fo(lines)i(bac)o(k.)75 | |
893 | 2100 y Fn(!!)192 b Fo(Refer)16 b(to)e(the)i(previous)f(command.)20 | |
894 | b(This)c(is)g(a)f(synon)o(ym)g(for)f(`)p Fn(!-1)p Fo('.)75 | |
895 | 2186 y Fn(!)p Fj(string)102 b Fo(Refer)16 b(to)e(the)i(most)e(recen)o | |
896 | (t)h(command)g(starting)g(with)g Fj(string)p Fo(.)75 | |
897 | 2271 y Fn(!?)p Fj(string)t Fn([?])315 2326 y Fo(Refer)i(to)f(the)h | |
898 | (most)f(recen)o(t)h(command)g(con)o(taining)g Fj(string)p | |
899 | Fo(.)25 b(The)17 b(trailing)g(`)p Fn(?)p Fo(')f(ma)o(y)g(b)q(e)315 | |
900 | 2381 y(omitted)f(if)h(the)f Fj(string)k Fo(is)d(follo)o(w)o(ed)f | |
901 | (immediately)i(b)o(y)e(a)g(newline.)75 2466 y Fn(^)p | |
902 | Fj(string1)t Fn(^)p Fj(string2)t Fn(^)315 2521 y Fo(Quic)o(k)i | |
903 | (Substitution.)23 b(Rep)q(eat)17 b(the)f(last)f(command,)h(replacing)h | |
904 | Fj(string1)i Fo(with)e Fj(string2)p Fo(.)315 2576 y(Equiv)m(alen)o(t)g | |
905 | (to)d Fn(!!:s/)p Fj(string1)t Fn(/)p Fj(string2)t Fn(/)p | |
906 | Fo(.)75 2661 y Fn(!#)192 b Fo(The)15 b(en)o(tire)h(command)f(line)i(t)o | |
907 | (yp)q(ed)f(so)e(far.)p eop | |
908 | %%Page: 2 4 | |
909 | 2 3 bop 75 -58 a Fo(2)1347 b(GNU)15 b(History)g(Library)75 | |
910 | 183 y Fi(1.1.2)30 b(W)-5 b(ord)20 b(Designators)137 279 | |
911 | y Fo(W)l(ord)d(designators)g(are)g(used)h(to)f(select)h(desired)h(w)o | |
912 | (ords)d(from)h(the)g(ev)o(en)o(t.)26 b(A)18 b(`)p Fn(:)p | |
f9267e15 | 913 | Fo(')e(separates)h(the)75 334 y(ev)o(en)o(t)j(sp)q(eci\014cation)h |
a44161c3 | 914 | (from)e(the)h(w)o(ord)f(designator.)34 b(It)20 b(ma)o(y)f(b)q(e)h |
f9267e15 | 915 | (omitted)g(if)g(the)g(w)o(ord)f(designator)75 389 y(b)q(egins)f(with)g |
a44161c3 EZ |
916 | (a)e(`)p Fn(^)p Fo(',)h(`)p Fn($)p Fo(',)f(`)p Fn(*)p |
917 | Fo(',)g(`)p Fn(-)p Fo(',)g(or)h(`)p Fn(\045)p Fo('.)24 | |
918 | b(W)l(ords)17 b(are)g(n)o(um)o(b)q(ered)g(from)g(the)g(b)q(eginning)i | |
f9267e15 | 919 | (of)e(the)g(line,)75 444 y(with)j(the)g(\014rst)f(w)o(ord)h(b)q(eing)h |
a44161c3 EZ |
920 | (denoted)f(b)o(y)g(0)f(\(zero\).)33 b(W)l(ords)20 b(are)f(inserted)i |
921 | (in)o(to)f(the)g(curren)o(t)f(line)75 498 y(separated)c(b)o(y)g(single) | |
f9267e15 EZ |
922 | i(spaces.)137 574 y(F)l(or)e(example,)75 653 y Fn(!!)192 |
923 | b Fo(designates)18 b(the)g(preceding)i(command.)28 b(When)18 | |
924 | b(y)o(ou)g(t)o(yp)q(e)g(this,)h(the)f(preceding)h(com-)315 | |
925 | 708 y(mand)c(is)h(rep)q(eated)g(in)g(toto.)75 787 y Fn(!!:$)144 | |
926 | b Fo(designates)12 b(the)f(last)g(argumen)o(t)f(of)h(the)g(preceding)i | |
927 | (command.)19 b(This)11 b(ma)o(y)g(b)q(e)h(shortened)315 | |
928 | 842 y(to)j Fn(!$)p Fo(.)75 921 y Fn(!fi:2)120 b Fo(designates)15 | |
929 | b(the)g(second)g(argumen)o(t)f(of)g(the)h(most)f(recen)o(t)g(command)h | |
930 | (starting)f(with)h(the)315 976 y(letters)g Fn(fi)p Fo(.)137 | |
931 | 1055 y(Here)h(are)f(the)g(w)o(ord)f(designators:)75 1134 | |
932 | y Fn(0)h(\(zero\))57 b Fo(The)15 b Fn(0)p Fo(th)g(w)o(ord.)20 | |
933 | b(F)l(or)14 b(man)o(y)h(applications,)h(this)g(is)g(the)f(command)g(w)o | |
934 | (ord.)75 1214 y Fj(n)215 b Fo(The)15 b Fj(n)p Fo(th)h(w)o(ord.)75 | |
935 | 1293 y Fn(^)216 b Fo(The)15 b(\014rst)g(argumen)o(t;)f(that)h(is,)g(w)o | |
936 | (ord)g(1.)75 1372 y Fn($)216 b Fo(The)15 b(last)h(argumen)o(t.)75 | |
937 | 1451 y Fn(\045)216 b Fo(The)15 b(w)o(ord)g(matc)o(hed)g(b)o(y)g(the)g | |
938 | (most)g(recen)o(t)g(`)p Fn(?)p Fj(string)t Fn(?)p Fo(')f(searc)o(h.)75 | |
939 | 1530 y Fj(x)p Fn(-)p Fj(y)168 b Fo(A)15 b(range)g(of)g(w)o(ords;)f(`)p | |
a44161c3 | 940 | Fn(-)p Fj(y)t Fo(')g(abbreviates)i(`)p Fn(0-)p Fj(y)t |
f9267e15 | 941 | Fo('.)75 1610 y Fn(*)216 b Fo(All)15 b(of)f(the)f(w)o(ords,)g(except)i |
a44161c3 | 942 | (the)f Fn(0)p Fo(th.)19 b(This)14 b(is)h(a)e(synon)o(ym)h(for)f(`)p |
f9267e15 | 943 | Fn(1-$)p Fo('.)18 b(It)c(is)g(not)g(an)g(error)315 1664 |
a44161c3 EZ |
944 | y(to)g(use)h(`)p Fn(*)p Fo(')f(if)i(there)e(is)i(just)e(one)h(w)o(ord)f |
945 | (in)i(the)f(ev)o(en)o(t;)f(the)h(empt)o(y)g(string)g(is)g(returned)g | |
f9267e15 EZ |
946 | (in)315 1719 y(that)f(case.)75 1798 y Fj(x)s Fn(*)189 |
947 | b Fo(Abbreviates)16 b(`)p Fj(x)p Fn(-$)p Fo(')75 1878 | |
a44161c3 EZ |
948 | y Fj(x)p Fn(-)192 b Fo(Abbreviates)16 b(`)p Fj(x)p Fn(-$)p |
949 | Fo(')e(lik)o(e)i(`)p Fj(x)s Fn(*)p Fo(',)e(but)i(omits)f(the)g(last)g | |
f9267e15 | 950 | (w)o(ord.)137 1957 y(If)i(a)g(w)o(ord)f(designator)h(is)h(supplied)h |
a44161c3 | 951 | (without)e(an)g(ev)o(en)o(t)f(sp)q(eci\014cation,)j(the)e(previous)h |
f9267e15 EZ |
952 | (command)75 2012 y(is)e(used)f(as)g(the)h(ev)o(en)o(t.)75 |
953 | 2123 y Fi(1.1.3)30 b(Mo)r(di\014ers)137 2219 y Fo(After)10 | |
a44161c3 EZ |
954 | b(the)h(optional)g(w)o(ord)e(designator,)i(y)o(ou)f(can)h(add)f(a)g |
955 | (sequence)i(of)e(one)g(or)g(more)g(of)g(the)g(follo)o(wing)75 | |
f9267e15 EZ |
956 | 2274 y(mo)q(di\014ers,)16 b(eac)o(h)f(preceded)i(b)o(y)e(a)g(`)p |
957 | Fn(:)p Fo('.)75 2353 y Fn(h)216 b Fo(Remo)o(v)o(e)15 | |
a44161c3 | 958 | b(a)g(trailing)h(pathname)f(comp)q(onen)o(t,)g(lea)o(ving)h(only)g(the) |
f9267e15 | 959 | f(head.)75 2432 y Fn(t)216 b Fo(Remo)o(v)o(e)15 b(all)h(leading)h |
a44161c3 | 960 | (pathname)e(comp)q(onen)o(ts,)g(lea)o(ving)h(the)f(tail.)75 |
f9267e15 | 961 | 2512 y Fn(r)216 b Fo(Remo)o(v)o(e)15 b(a)g(trailing)h(su\016x)f(of)g |
a44161c3 | 962 | (the)g(form)g(`)p Fn(.)p Fj(su\016x)s Fo(',)f(lea)o(ving)i(the)f |
f9267e15 EZ |
963 | (basename.)75 2591 y Fn(e)216 b Fo(Remo)o(v)o(e)15 b(all)h(but)g(the)f |
964 | (trailing)h(su\016x.)75 2670 y Fn(p)216 b Fo(Prin)o(t)15 | |
965 | b(the)g(new)h(command)f(but)g(do)g(not)g(execute)h(it.)p | |
966 | eop | |
a44161c3 | 967 | %%Page: 3 5 |
f9267e15 EZ |
968 | 3 4 bop 75 -58 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o |
969 | (ely)1007 b(3)75 183 y Fn(s/)p Fj(old)r Fn(/)p Fj(new)t | |
970 | Fn(/)315 238 y Fo(Substitute)17 b Fj(new)j Fo(for)c(the)h(\014rst)e(o)q | |
971 | (ccurrence)j(of)e Fj(old)i Fo(in)f(the)g(ev)o(en)o(t)f(line.)25 | |
972 | b(An)o(y)16 b(delimiter)315 293 y(ma)o(y)c(b)q(e)h(used)g(in)g(place)g | |
973 | (of)f(`)p Fn(/)p Fo('.)18 b(The)13 b(delimiter)h(ma)o(y)e(b)q(e)h | |
974 | (quoted)f(in)i Fj(old)g Fo(and)f Fj(new)k Fo(with)12 | |
975 | b(a)315 348 y(single)j(bac)o(kslash.)20 b(If)15 b(`)p | |
976 | Fn(&)p Fo(')e(app)q(ears)h(in)h Fj(new)p Fo(,)f(it)g(is)h(replaced)g(b) | |
977 | o(y)f Fj(old)p Fo(.)20 b(A)14 b(single)i(bac)o(kslash)315 | |
978 | 402 y(will)j(quote)e(the)h(`)p Fn(&)p Fo('.)25 b(The)17 | |
979 | b(\014nal)i(delimiter)g(is)f(optional)g(if)f(it)h(is)g(the)f(last)g(c)o | |
980 | (haracter)g(on)315 457 y(the)e(input)h(line.)75 537 y | |
981 | Fn(&)216 b Fo(Rep)q(eat)16 b(the)f(previous)h(substitution.)75 | |
982 | 617 y Fn(g)216 b Fo(Cause)19 b(c)o(hanges)h(to)e(b)q(e)i(applied)h(o)o | |
983 | (v)o(er)e(the)g(en)o(tire)h(ev)o(en)o(t)f(line.)34 b(Used)20 | |
984 | b(in)g(conjunction)315 671 y(with)c(`)p Fn(s)p Fo(',)d(as)i(in)h | |
985 | Fn(gs/)p Fj(old)r Fn(/)p Fj(new)t Fn(/)p Fo(,)f(or)g(with)g(`)p | |
986 | Fn(&)p Fo('.)p eop | |
987 | %%Page: 4 6 | |
988 | 4 5 bop 75 -58 a Fo(4)1347 b(GNU)15 b(History)g(Library)p | |
989 | eop | |
990 | %%Page: 5 7 | |
991 | 5 6 bop 75 -58 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g | |
992 | (History)889 b(5)75 183 y Fk(2)41 b(Programming)28 b(with)e(GNU)i | |
993 | (History)137 282 y Fo(This)16 b(c)o(hapter)e(describ)q(es)j(ho)o(w)d | |
a44161c3 | 994 | (to)g(in)o(terface)h(programs)e(that)h(y)o(ou)h(write)g(with)g(the)g |
f9267e15 | 995 | (GNU)f(History)75 337 y(Library)l(.)24 b(It)17 b(should)g(b)q(e)g |
a44161c3 EZ |
996 | (considered)h(a)e(tec)o(hnical)i(guide.)25 b(F)l(or)15 |
997 | b(information)i(on)f(the)h(in)o(teractiv)o(e)g(use)75 | |
f9267e15 EZ |
998 | 391 y(of)e(GNU)g(History)l(,)g(see)g(Chapter)g(1)g([Using)g(History)g |
999 | (In)o(teractiv)o(ely],)h(page)f(1.)75 509 y Fm(2.1)33 | |
1000 | b(In)n(tro)r(duction)24 b(to)e(History)137 602 y Fo(Man)o(y)c(programs) | |
a44161c3 | 1001 | g(read)h(input)g(from)f(the)h(user)g(a)f(line)j(at)d(a)g(time.)31 |
f9267e15 | 1002 | b(The)19 b(GNU)g(History)f(library)75 656 y(is)k(able)g(to)e(k)o(eep)i |
a44161c3 | 1003 | (trac)o(k)e(of)h(those)g(lines,)j(asso)q(ciate)d(arbitrary)g(data)f |
f9267e15 | 1004 | (with)i(eac)o(h)f(line,)j(and)e(utilize)75 711 y(information)15 |
a44161c3 | 1005 | b(from)g(previous)h(lines)h(in)f(comp)q(osing)f(new)h(ones.)137 |
f9267e15 | 1006 | 775 y(The)e(programmer)f(using)h(the)g(History)g(library)g(has)g(a)o(v) |
a44161c3 | 1007 | m(ailable)h(functions)g(for)e(remem)o(b)q(ering)h(lines)75 |
f9267e15 | 1008 | 830 y(on)c(a)g(history)h(list,)g(asso)q(ciating)g(arbitrary)f(data)f |
a44161c3 | 1009 | (with)i(a)f(line,)j(remo)o(ving)d(lines)i(from)d(the)i(list,)h(searc)o |
f9267e15 | 1010 | (hing)75 884 y(through)17 b(the)h(list)g(for)f(a)h(line)h(con)o |
a44161c3 | 1011 | (taining)f(an)g(arbitrary)f(text)g(string,)h(and)g(referencing)h(an)o |
f9267e15 | 1012 | (y)e(line)i(in)75 939 y(the)c(list)i(directly)l(.)22 |
a44161c3 EZ |
1013 | b(In)16 b(addition,)g(a)f(history)g Fj(expansion)h Fo(function)h(is)e |
1014 | (a)o(v)m(ailable)i(whic)o(h)g(pro)o(vides)f(for)e(a)75 | |
f9267e15 EZ |
1015 | 994 y(consisten)o(t)h(user)h(in)o(terface)f(across)g(di\013eren)o(t)g |
1016 | (programs.)137 1058 y(The)f(user)h(using)f(programs)f(written)h(with)g | |
a44161c3 | 1017 | (the)g(History)g(library)h(has)f(the)g(b)q(ene\014t)h(of)e(a)h |
f9267e15 | 1018 | (consisten)o(t)75 1112 y(user)20 b(in)o(terface)f(with)h(a)f(set)h(of)f |
a44161c3 | 1019 | (w)o(ell-kno)o(wn)h(commands)g(for)e(manipulating)k(the)d(text)g(of)g |
f9267e15 | 1020 | (previous)75 1167 y(lines)c(and)f(using)h(that)e(text)g(in)i(new)f |
a44161c3 | 1021 | (commands.)19 b(The)14 b(basic)h(history)e(manipulation)j(commands)d |
f9267e15 EZ |
1022 | (are)75 1222 y(similar)j(to)f(the)g(history)g(substitution)h(pro)o |
1023 | (vided)g(b)o(y)g Fn(csh)p Fo(.)137 1286 y(If)f(the)g(programmer)f | |
a44161c3 | 1024 | (desires,)h(he)g(can)g(use)g(the)g(Readline)i(library)l(,)f(whic)o(h)f |
f9267e15 | 1025 | (includes)j(some)c(history)75 1340 y(manipulation)j(b)o(y)e(default,)g |
a44161c3 | 1026 | (and)h(has)f(the)g(added)h(adv)m(an)o(tage)f(of)f(command)h(line)i |
f9267e15 EZ |
1027 | (editing.)137 1404 y(Before)i(declaring)i(an)o(y)d(functions)i(using)g |
1028 | (an)o(y)f(functionalit)o(y)h(the)f(History)g(library)h(pro)o(vides)f | |
1029 | (in)75 1459 y(other)14 b(co)q(de,)h(an)f(application)i(writer)e(should) | |
1030 | i(include)g(the)f(\014le)g Fn(<readline/history.h>)d | |
1031 | Fo(in)j(an)o(y)f(\014le)75 1513 y(that)d(uses)h(the)h(History)e | |
1032 | (library's)i(features.)18 b(It)12 b(supplies)i(extern)e(declarations)h | |
1033 | (for)e(all)i(of)f(the)g(library's)75 1568 y(public)17 | |
1034 | b(functions)f(and)g(v)m(ariables,)g(and)f(declares)h(all)g(of)f(the)h | |
1035 | (public)h(data)d(structures.)75 1686 y Fm(2.2)33 b(History)22 | |
1036 | b(Storage)137 1778 y Fo(The)16 b(history)f(list)h(is)g(an)f(arra)o(y)f | |
1037 | (of)g(history)i(en)o(tries.)k(A)15 b(history)g(en)o(try)g(is)h | |
1038 | (declared)g(as)f(follo)o(ws:)195 1839 y Fn(typedef)23 | |
1039 | b(struct)g(_hist_entry)f({)243 1891 y(char)h(*line;)243 | |
1040 | 1943 y(char)g(*data;)195 1995 y(})h(HIST_ENTRY;)137 2058 | |
1041 | y Fo(The)16 b(history)f(list)h(itself)g(migh)o(t)f(therefore)g(b)q(e)h | |
1042 | (declared)g(as)195 2119 y Fn(HIST_ENTRY)22 b(**the_history_list;)137 | |
1043 | 2183 y Fo(The)16 b(state)e(of)h(the)g(History)g(library)h(is)g | |
1044 | (encapsulated)g(in)o(to)f(a)g(single)i(structure:)195 | |
1045 | 2243 y Fn(/*)24 b(A)f(structure)g(used)g(to)h(pass)f(the)h(current)f | |
1046 | (state)g(of)g(the)h(history)f(stuff)g(around.)g(*/)p | |
1047 | 2033 2253 21 42 v 195 2295 a(typedef)g(struct)g(_hist_state)f({)243 | |
1048 | 2347 y(HIST_ENTRY)g(**entries;)214 b(/*)23 b(Pointer)g(to)h(the)f | |
1049 | (entries)g(themselves.)f(*/)243 2399 y(int)h(offset;)453 | |
1050 | b(/*)23 b(The)h(location)e(pointer)h(within)g(this)h(array.)f(*/)p | |
1051 | 2033 2409 V 243 2451 a(int)g(length;)453 b(/*)23 b(Number)g(of)h | |
1052 | (elements)f(within)g(this)g(array.)g(*/)p 1985 2461 V | |
1053 | 243 2503 a(int)g(size;)501 b(/*)23 b(Number)g(of)h(slots)f(allocated)g | |
1054 | (to)g(this)h(array.)f(*/)p 2057 2513 V 243 2555 a(int)g(flags;)195 | |
1055 | 2606 y(})h(HISTORY_STATE;)137 2670 y Fo(If)16 b(the)f(\015ags)g(mem)o | |
1056 | (b)q(er)g(includes)j Fn(HS_STIFLED)p Fo(,)13 b(the)i(history)h(has)f(b) | |
1057 | q(een)h(sti\015ed.)p eop | |
1058 | %%Page: 6 8 | |
1059 | 6 7 bop 75 -58 a Fo(6)1347 b(GNU)15 b(History)g(Library)75 | |
a44161c3 EZ |
1060 | 183 y Fm(2.3)33 b(History)22 b(F)-6 b(unctions)137 278 |
1061 | y Fo(This)21 b(section)g(describ)q(es)h(the)f(calling)h(sequence)g(for) | |
1062 | e(the)g(v)m(arious)h(functions)g(presen)o(t)g(in)g(GNU)75 | |
1063 | 333 y(History)l(.)75 441 y Fi(2.3.1)30 b(Initializing)20 | |
1064 | b(History)h(and)f(State)g(Managemen)n(t)137 536 y Fo(This)e(section)g | |
1065 | (describ)q(es)h(functions)f(used)g(to)e(initialize)21 | |
1066 | b(and)c(manage)g(the)g(state)g(of)g(the)g(History)75 | |
1067 | 591 y(library)f(when)g(y)o(ou)f(w)o(an)o(t)f(to)g(use)i(the)f(history)g | |
1068 | (functions)h(in)g(y)o(our)f(program.)1650 679 y(F)l(unction)-1749 | |
1069 | b Fh(void)20 b Fg(using)p 333 679 18 3 v 20 w(history)j | |
1070 | Ff(\(\))195 734 y Fo(Begin)18 b(a)f(session)h(in)g(whic)o(h)g(the)g | |
1071 | (history)f(functions)h(migh)o(t)f(b)q(e)h(used.)27 b(This)18 | |
1072 | b(initializes)195 788 y(the)d(in)o(teractiv)o(e)h(v)m(ariables.)1650 | |
1073 | 877 y(F)l(unction)-1749 b Fh(HISTORY_STATE)21 b(*)e Fg(history)p | |
1074 | 657 877 V 21 w(get)p 755 877 V 21 w(history)p 951 877 | |
1075 | V 21 w(state)j Ff(\(\))195 931 y Fo(Return)16 b(a)f(structure)g | |
1076 | (describing)i(the)e(curren)o(t)g(state)f(of)h(the)g(input)i(history)l | |
1077 | (.)1650 1019 y(F)l(unction)-1749 b Fh(void)20 b Fg(history)p | |
1078 | 377 1019 V 20 w(set)p 468 1019 V 21 w(history)p 664 1019 | |
1079 | V 21 w(state)j Ff(\()p Fn(HISTORY_STATE)13 b(*state)p | |
1080 | Ff(\))195 1074 y Fo(Set)i(the)h(state)e(of)h(the)g(history)g(list)h | |
1081 | (according)g(to)e Fj(state)p Fo(.)75 1182 y Fi(2.3.2)30 | |
1082 | b(History)20 b(List)h(Managemen)n(t)137 1277 y Fo(These)11 | |
1083 | b(functions)h(manage)e(individual)k(en)o(tries)d(on)g(the)g(history)f | |
1084 | (list,)i(or)f(set)f(parameters)g(managing)75 1332 y(the)15 | |
1085 | b(list)h(itself.)1650 1420 y(F)l(unction)-1749 b Fh(void)20 | |
1086 | b Fg(add)p 294 1420 V 20 w(history)j Ff(\()p Fn(char)14 | |
1087 | b(*string)p Ff(\))195 1475 y Fo(Place)i Fj(string)j Fo(at)c(the)g(end)i | |
1088 | (of)d(the)i(history)f(list.)22 b(The)15 b(asso)q(ciated)h(data)f | |
1089 | (\014eld)h(\(if)g(an)o(y\))e(is)195 1530 y(set)h(to)g | |
1090 | Fn(NULL)p Fo(.)1650 1618 y(F)l(unction)-1749 b Fh(HIST_ENTRY)21 | |
1091 | b(*)e Fg(remo)n(v)n(e)p 584 1618 V 20 w(history)k Ff(\()p | |
1092 | Fn(int)14 b(which)p Ff(\))195 1673 y Fo(Remo)o(v)o(e)g(history)g(en)o | |
1093 | (try)f(at)h(o\013set)f Fj(whic)o(h)h Fo(from)g(the)g(history)l(.)19 | |
1094 | b(The)14 b(remo)o(v)o(ed)g(elemen)o(t)g(is)195 1727 y(returned)i(so)e | |
1095 | (y)o(ou)h(can)h(free)f(the)g(line,)i(data,)d(and)h(con)o(taining)h | |
1096 | (structure.)1650 1816 y(F)l(unction)-1749 b Fh(HIST_ENTRY)21 | |
1097 | b(*)e Fg(replace)p 580 1816 V 22 w(history)p 777 1816 | |
1098 | V 20 w(en)n(try)24 b Ff(\()p Fn(int)14 b(which,)g(char)283 | |
1099 | 1870 y(*line,)g(char)g(*data)p Ff(\))195 1925 y Fo(Mak)o(e)f(the)h | |
1100 | (history)f(en)o(try)g(at)g(o\013set)g Fj(whic)o(h)h Fo(ha)o(v)o(e)g | |
1101 | Fj(line)k Fo(and)13 b Fj(data)p Fo(.)19 b(This)14 b(returns)g(the)f | |
1102 | (old)195 1980 y(en)o(try)k(so)g(y)o(ou)g(can)g(disp)q(ose)i(of)d(the)i | |
1103 | (data.)25 b(In)18 b(the)f(case)h(of)f(an)g(in)o(v)m(alid)i | |
1104 | Fj(whic)o(h)p Fo(,)g(a)e Fn(NULL)195 2035 y Fo(p)q(oin)o(ter)f(is)f | |
1105 | (returned.)1650 2123 y(F)l(unction)-1749 b Fh(void)20 | |
1106 | b Fg(clear)p 320 2123 V 21 w(history)j Ff(\(\))195 2178 | |
1107 | y Fo(Clear)15 b(the)h(history)f(list)h(b)o(y)f(deleting)i(all)f(the)f | |
1108 | (en)o(tries.)1650 2266 y(F)l(unction)-1749 b Fh(void)20 | |
1109 | b Fg(sti\015e)p 320 2266 V 21 w(history)j Ff(\()p Fn(int)14 | |
1110 | b(max)p Ff(\))195 2321 y Fo(Sti\015e)i(the)f(history)h(list,)f(remem)o | |
1111 | (b)q(ering)h(only)g(the)f(last)g Fj(max)j Fo(en)o(tries.)1650 | |
1112 | 2409 y(F)l(unction)-1749 b Fh(int)20 b Fg(unsti\015e)p | |
1113 | 358 2409 V 21 w(history)i Ff(\(\))195 2463 y Fo(Stop)e(sti\015ing)i | |
1114 | (the)f(history)l(.)36 b(This)21 b(returns)g(the)f(previous)i(amoun)o(t) | |
1115 | e(the)g(history)h(w)o(as)195 2518 y(sti\015ed.)g(The)15 | |
1116 | b(v)m(alue)i(is)e(p)q(ositiv)o(e)i(if)e(the)g(history)h(w)o(as)e | |
1117 | (sti\015ed,)i(negativ)o(e)f(if)h(it)f(w)o(asn't.)1650 | |
1118 | 2606 y(F)l(unction)-1749 b Fh(int)20 b Fg(history)p 351 | |
1119 | 2606 V 20 w(is)p 409 2606 V 21 w(sti\015ed)k Ff(\(\))195 | |
1120 | 2661 y Fo(Returns)16 b(non-zero)f(if)h(the)f(history)g(is)h(sti\015ed,) | |
1121 | g(zero)f(if)g(it)h(is)g(not.)p eop | |
f9267e15 EZ |
1122 | %%Page: 7 9 |
1123 | 7 8 bop 75 -58 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g | |
1124 | (History)889 b(7)75 183 y Fi(2.3.3)30 b(Information)19 | |
a44161c3 EZ |
1125 | b(Ab)r(out)i(the)f(History)h(List)137 279 y Fo(These)13 |
1126 | b(functions)h(return)f(information)g(ab)q(out)f(the)h(en)o(tire)h | |
1127 | (history)e(list)i(or)e(individual)k(list)e(en)o(tries.)1650 | |
1128 | 371 y(F)l(unction)-1749 b Fh(HIST_ENTRY)21 b(**)e Fg(history)p | |
1129 | 605 371 18 3 v 21 w(list)24 b Ff(\(\))195 426 y Fo(Return)f(a)g | |
1130 | Fn(NULL)f Fo(terminated)g(arra)o(y)g(of)g Fn(HIST_ENTRY)f | |
1131 | Fo(whic)o(h)j(is)f(the)f(curren)o(t)h(input)195 481 y(history)l(.)j | |
1132 | (Elemen)o(t)18 b(0)e(of)h(this)h(list)g(is)f(the)h(b)q(eginning)h(of)e | |
1133 | (time.)26 b(If)17 b(there)g(is)h(no)f(history)l(,)195 | |
1134 | 535 y(return)e Fn(NULL)p Fo(.)1650 627 y(F)l(unction)-1749 | |
1135 | b Fh(int)20 b Fg(where)p 325 627 V 20 w(history)j Ff(\(\))195 | |
1136 | 682 y Fo(Returns)16 b(the)f(o\013set)f(of)h(the)g(curren)o(t)g(history) | |
1137 | g(elemen)o(t.)1650 773 y(F)l(unction)-1749 b Fh(HIST_ENTRY)21 | |
1138 | b(*)e Fg(curren)n(t)p 587 773 V 21 w(history)k Ff(\(\))195 | |
1139 | 828 y Fo(Return)g(the)f(history)g(en)o(try)g(at)f(the)h(curren)o(t)g(p) | |
1140 | q(osition,)j(as)c(determined)j(b)o(y)e Fn(where_)195 | |
1141 | 883 y(history)14 b(\(\))p Fo(.)20 b(If)15 b(there)g(is)h(no)f(en)o(try) | |
1142 | g(there,)g(return)g(a)g Fn(NULL)g Fo(p)q(oin)o(ter.)1650 | |
1143 | 975 y(F)l(unction)-1749 b Fh(HIST_ENTRY)21 b(*)e Fg(history)p | |
1144 | 579 975 V 21 w(get)j Ff(\()p Fn(int)15 b(offset)p Ff(\))195 | |
1145 | 1029 y Fo(Return)21 b(the)g(history)g(en)o(try)f(at)g(p)q(osition)i | |
1146 | Fj(o\013set)p Fo(,)e(starting)g(from)g Fn(history_base)p | |
1147 | Fo(.)35 b(If)195 1084 y(there)16 b(is)h(no)g(en)o(try)f(there,)g(or)g | |
1148 | (if)g Fj(o\013set)h Fo(is)g(greater)e(than)h(the)h(history)f(length,)h | |
1149 | (return)f(a)195 1139 y Fn(NULL)f Fo(p)q(oin)o(ter.)1650 | |
1150 | 1231 y(F)l(unction)-1749 b Fh(int)20 b Fg(history)p 351 | |
1151 | 1231 V 20 w(total)p 487 1231 V 22 w(b)n(ytes)j Ff(\(\))195 | |
1152 | 1285 y Fo(Return)c(the)f(n)o(um)o(b)q(er)g(of)g(b)o(ytes)g(that)f(the)h | |
1153 | (primary)h(history)f(en)o(tries)g(are)g(using.)29 b(This)195 | |
1154 | 1340 y(function)16 b(returns)f(the)g(sum)h(of)e(the)i(lengths)f(of)g | |
1155 | (all)h(the)g(lines)g(in)g(the)g(history)l(.)75 1452 y | |
1156 | Fi(2.3.4)30 b(Mo)n(ving)21 b(Around)f(the)h(History)g(List)137 | |
1157 | 1548 y Fo(These)16 b(functions)g(allo)o(w)f(the)g(curren)o(t)h(index)g | |
1158 | (in)o(to)f(the)h(history)f(list)h(to)e(b)q(e)i(set)f(or)g(c)o(hanged.) | |
1159 | 1650 1640 y(F)l(unction)-1749 b Fh(int)20 b Fg(history)p | |
1160 | 351 1640 V 20 w(set)p 442 1640 V 21 w(p)r(os)h Ff(\()p | |
1161 | Fn(int)15 b(pos)p Ff(\))195 1694 y Fo(Set)g(the)h(p)q(osition)g(in)g | |
1162 | (the)f(history)g(list)h(to)f Fj(p)q(os)p Fo(,)g(an)g(absolute)g(index)i | |
1163 | (in)o(to)e(the)g(list.)1650 1786 y(F)l(unction)-1749 | |
1164 | b Fh(HIST_ENTRY)21 b(*)e Fg(previous)p 615 1786 V 20 | |
1165 | w(history)k Ff(\(\))195 1841 y Fo(Bac)o(k)17 b(up)h(the)f(curren)o(t)g | |
1166 | (history)g(o\013set)f(to)h(the)g(previous)h(history)f(en)o(try)l(,)g | |
1167 | (and)g(return)g(a)195 1896 y(p)q(oin)o(ter)f(to)e(that)h(en)o(try)l(.)k | |
1168 | (If)d(there)f(is)h(no)f(previous)h(en)o(try)l(,)f(return)g(a)g | |
1169 | Fn(NULL)f Fo(p)q(oin)o(ter.)1650 1987 y(F)l(unction)-1749 | |
1170 | b Fh(HIST_ENTRY)21 b(*)e Fg(next)p 514 1987 V 21 w(history)k | |
1171 | Ff(\(\))195 2042 y Fo(Mo)o(v)o(e)17 b(the)h(curren)o(t)g(history)f | |
1172 | (o\013set)g(forw)o(ard)g(to)g(the)h(next)g(history)g(en)o(try)l(,)g | |
1173 | (and)g(return)195 2097 y(the)d(a)g(p)q(oin)o(ter)h(to)e(that)h(en)o | |
1174 | (try)l(.)20 b(If)15 b(there)g(is)h(no)f(next)g(en)o(try)l(,)g(return)g | |
1175 | (a)g Fn(NULL)g Fo(p)q(oin)o(ter.)75 2208 y Fi(2.3.5)30 | |
1176 | b(Searc)n(hing)21 b(the)f(History)h(List)137 2304 y Fo(These)14 | |
1177 | b(functions)g(allo)o(w)g(searc)o(hing)g(of)e(the)i(history)f(list)h | |
1178 | (for)f(en)o(tries)h(con)o(taining)g(a)f(sp)q(eci\014c)i(string.)75 | |
1179 | 2359 y(Searc)o(hing)f(ma)o(y)g(b)q(e)g(p)q(erformed)g(b)q(oth)g(forw)o | |
1180 | (ard)e(and)i(bac)o(kw)o(ard)f(from)g(the)h(curren)o(t)g(history)f(p)q | |
1181 | (osition.)75 2414 y(The)j(searc)o(h)f(ma)o(y)g(b)q(e)i | |
1182 | Fj(anc)o(hored)p Fo(,)e(meaning)h(that)f(the)h(string)g(m)o(ust)f(matc) | |
1183 | o(h)g(at)g(the)h(b)q(eginning)i(of)d(the)75 2469 y(history)g(en)o(try)l | |
1184 | (.)1650 2560 y(F)l(unction)-1749 b Fh(int)20 b Fg(history)p | |
1185 | 351 2560 V 20 w(searc)n(h)j Ff(\()p Fn(char)14 b(*string,)g(int)h | |
1186 | (direction)p Ff(\))195 2615 y Fo(Searc)o(h)g(the)h(history)f(for)f | |
1187 | Fj(string)p Fo(,)h(starting)f(at)h(the)g(curren)o(t)g(history)g | |
1188 | (o\013set.)k(If)d Fj(direction)195 2670 y Fn(<)j Fo(0,)g(then)g(the)h | |
1189 | (searc)o(h)e(is)i(through)e(previous)i(en)o(tries,)g(else)g(through)f | |
1190 | (subsequen)o(t.)32 b(If)p eop | |
f9267e15 EZ |
1191 | %%Page: 8 10 |
1192 | 8 9 bop 75 -58 a Fo(8)1347 b(GNU)15 b(History)g(Library)195 | |
a44161c3 EZ |
1193 | 183 y Fj(string)k Fo(is)d(found,)f(then)h(the)f(curren)o(t)g(history)g |
1194 | (index)i(is)f(set)f(to)f(that)h(history)g(en)o(try)l(,)g(and)195 | |
1195 | 238 y(the)g(v)m(alue)h(returned)f(is)g(the)g(o\013set)f(in)h(the)g | |
1196 | (line)h(of)e(the)h(en)o(try)g(where)g Fj(string)j Fo(w)o(as)c(found.) | |
1197 | 195 293 y(Otherwise,)i(nothing)f(is)h(c)o(hanged,)f(and)h(a)e(-1)h(is)h | |
1198 | (returned.)1650 396 y(F)l(unction)-1749 b Fh(int)20 b | |
1199 | Fg(history)p 351 396 18 3 v 20 w(searc)n(h)p 527 396 | |
1200 | V 21 w(pre\014x)i Ff(\()p Fn(char)15 b(*string,)f(int)g(direction)p | |
1201 | Ff(\))195 451 y Fo(Searc)o(h)i(the)f(history)g(for)g | |
1202 | Fj(string)p Fo(,)g(starting)g(at)g(the)g(curren)o(t)h(history)f | |
1203 | (o\013set.)k(The)d(searc)o(h)195 506 y(is)h(anc)o(hored:)23 | |
1204 | b(matc)o(hing)17 b(lines)h(m)o(ust)e(b)q(egin)i(with)f | |
1205 | Fj(string)p Fo(.)25 b(If)17 b Fj(direction)h Fn(<)e Fo(0,)h(then)g(the) | |
1206 | 195 560 y(searc)o(h)f(is)g(through)f(previous)i(en)o(tries,)f(else)g | |
1207 | (through)g(subsequen)o(t.)22 b(If)16 b Fj(string)k Fo(is)c(found,)195 | |
1208 | 615 y(then)i(the)g(curren)o(t)g(history)g(index)h(is)g(set)e(to)h(that) | |
1209 | f(en)o(try)l(,)h(and)g(the)g(return)g(v)m(alue)h(is)g(0.)195 | |
1210 | 670 y(Otherwise,)d(nothing)f(is)h(c)o(hanged,)f(and)h(a)e(-1)h(is)h | |
1211 | (returned.)1650 773 y(F)l(unction)-1749 b Fh(int)20 b | |
1212 | Fg(history)p 351 773 V 20 w(searc)n(h)p 527 773 V 21 | |
1213 | w(p)r(os)h Ff(\()p Fn(char)15 b(*string,)f(int)g(direction,)g(int)283 | |
1214 | 828 y(pos)p Ff(\))195 883 y Fo(Searc)o(h)h(for)g Fj(string)k | |
1215 | Fo(in)d(the)f(history)g(list,)g(starting)g(at)f Fj(p)q(os)p | |
1216 | Fo(,)h(an)g(absolute)g(index)i(in)o(to)e(the)195 937 | |
1217 | y(list.)21 b(If)15 b Fj(direction)h Fo(is)g(negativ)o(e,)f(the)g(searc) | |
1218 | o(h)g(pro)q(ceeds)g(bac)o(kw)o(ard)g(from)f Fj(p)q(os)p | |
1219 | Fo(,)h(otherwise)195 992 y(forw)o(ard.)27 b(Returns)18 | |
1220 | b(the)g(absolute)g(index)h(of)f(the)g(history)f(elemen)o(t)i(where)f | |
1221 | Fj(string)k Fo(w)o(as)195 1047 y(found,)15 b(or)g(-1)g(otherwise.)75 | |
1222 | 1170 y Fi(2.3.6)30 b(Managing)20 b(the)g(History)h(File)137 | |
1223 | 1272 y Fo(The)16 b(History)g(library)h(can)e(read)h(the)g(history)g | |
1224 | (from)f(and)h(write)g(it)g(to)f(a)h(\014le.)22 b(This)17 | |
1225 | b(section)f(do)q(cu-)75 1327 y(men)o(ts)f(the)g(functions)h(for)f | |
1226 | (managing)g(a)g(history)g(\014le.)1650 1430 y(F)l(unction)-1749 | |
1227 | b Fh(int)20 b Fg(read)p 286 1430 V 20 w(history)i Ff(\()p | |
1228 | Fn(char)15 b(*filename)p Ff(\))195 1485 y Fo(Add)h(the)f(con)o(ten)o | |
1229 | (ts)f(of)h Fj(\014lename)j Fo(to)d(the)g(history)g(list,)g(a)g(line)h | |
1230 | (at)f(a)f(time.)21 b(If)15 b Fj(\014lename)j Fo(is)195 | |
1231 | 1539 y Fn(NULL)p Fo(,)c(then)i(read)f(from)f(`)p Fn(~/.history)p | |
1232 | Fo('.)k(Returns)e(0)f(if)g(successful,)i(or)d(errno)h(if)h(not.)1650 | |
1233 | 1643 y(F)l(unction)-1749 b Fh(int)20 b Fg(read)p 286 | |
1234 | 1643 V 20 w(history)p 481 1643 V 20 w(range)i Ff(\()p | |
1235 | Fn(char)15 b(*filename,)e(int)i(from,)g(int)f(to)p Ff(\))195 | |
1236 | 1697 y Fo(Read)21 b(a)f(range)g(of)g(lines)i(from)e Fj(\014lename)p | |
1237 | Fo(,)i(adding)f(them)g(to)f(the)g(history)h(list.)36 | |
1238 | b(Start)195 1752 y(reading)15 b(at)e(line)j Fj(from)e | |
1239 | Fo(and)g(end)h(at)e Fj(to)p Fo(.)19 b(If)c Fj(from)e | |
1240 | Fo(is)i(zero,)f(start)f(at)g(the)h(b)q(eginning.)22 b(If)15 | |
1241 | b Fj(to)195 1807 y Fo(is)i(less)g(than)f Fj(from)p Fo(,)g(then)h(read)f | |
1242 | (un)o(til)i(the)e(end)h(of)f(the)h(\014le.)24 b(If)17 | |
1243 | b Fj(\014lename)j Fo(is)d Fn(NULL)p Fo(,)f(then)195 1862 | |
1244 | y(read)f(from)g(`)p Fn(~/.history)p Fo('.)i(Returns)f(0)f(if)h | |
1245 | (successful,)g(or)e Fn(errno)h Fo(if)h(not.)1650 1965 | |
1246 | y(F)l(unction)-1749 b Fh(int)20 b Fg(write)p 304 1965 | |
1247 | V 22 w(history)i Ff(\()p Fn(char)15 b(*filename)p Ff(\))195 | |
1248 | 2020 y Fo(W)l(rite)23 b(the)f(curren)o(t)g(history)h(to)f | |
1249 | Fj(\014lename)p Fo(,)j(o)o(v)o(erwriting)d Fj(\014lename)k | |
1250 | Fo(if)d(necessary)l(.)42 b(If)195 2074 y Fj(\014lename)20 | |
1251 | b Fo(is)d Fn(NULL)p Fo(,)f(then)g(write)h(the)f(history)h(list)g(to)f | |
1252 | (`)p Fn(~/.history)p Fo('.)21 b(V)l(alues)d(returned)195 | |
1253 | 2129 y(are)d(as)g(in)h Fn(read_history)d(\(\))p Fo(.)1650 | |
1254 | 2232 y(F)l(unction)-1749 b Fh(int)20 b Fg(app)r(end)p | |
1255 | 360 2232 V 19 w(history)j Ff(\()p Fn(int)14 b(nelements,)g(char)h | |
1256 | (*filename)p Ff(\))195 2287 y Fo(App)q(end)i(the)e(last)g | |
1257 | Fj(nelemen)o(ts)j Fo(of)d(the)g(history)g(list)h(to)f | |
1258 | Fj(\014lename)p Fo(.)1650 2390 y(F)l(unction)-1749 b | |
1259 | Fh(int)20 b Fg(history)p 351 2390 V 20 w(truncate)p 582 | |
1260 | 2390 V 21 w(\014le)k Ff(\()p Fn(char)14 b(*filename,)g(int)h(nlines)p | |
1261 | Ff(\))195 2445 y Fo(T)l(runcate)g(the)h(history)f(\014le)h | |
1262 | Fj(\014lename)p Fo(,)g(lea)o(ving)g(only)g(the)f(last)g | |
1263 | Fj(nlines)k Fo(lines.)75 2568 y Fi(2.3.7)30 b(History)20 | |
1264 | b(Expansion)137 2670 y Fo(These)c(functions)g(implemen)o(t)g | |
1265 | Fn(csh)p Fo(-lik)o(e)g(history)g(expansion.)p eop | |
f9267e15 EZ |
1266 | %%Page: 9 11 |
1267 | 9 10 bop 75 -58 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g | |
1268 | (History)889 b(9)1650 183 y(F)l(unction)-1749 b Fh(int)20 | |
a44161c3 EZ |
1269 | b Fg(history)p 351 183 18 3 v 20 w(expand)j Ff(\()p Fn(char)14 |
1270 | b(*string,)g(char)h(**output)p Ff(\))195 238 y Fo(Expand)k | |
1271 | Fj(string)p Fo(,)g(placing)h(the)e(result)h(in)o(to)g | |
1272 | Fj(output)p Fo(,)g(a)f(p)q(oin)o(ter)h(to)f(a)g(string)h(\(see)f(Sec-) | |
1273 | 195 293 y(tion)d(1.1)g([History)f(In)o(teraction],)h(page)g(1\).)k | |
1274 | (Returns:)195 370 y Fn(0)216 b Fo(If)16 b(no)g(expansions)h(to)q(ok)e | |
1275 | (place)i(\(or,)d(if)j(the)f(only)g(c)o(hange)g(in)h(the)e(text)h(w)o | |
1276 | (as)435 425 y(the)f(de-slashifying)j(of)c(the)i(history)f(expansion)h | |
1277 | (c)o(haracter\);)195 502 y Fn(1)216 b Fo(if)16 b(expansions)g(did)g | |
1278 | (tak)o(e)e(place;)195 580 y Fn(-1)192 b Fo(if)16 b(there)f(w)o(as)f(an) | |
1279 | h(error)g(in)h(expansion;)195 657 y Fn(2)216 b Fo(if)16 | |
f9267e15 EZ |
1280 | b(the)g(returned)f(line)j(should)e(b)q(e)g(displa)o(y)o(ed,)h(but)e |
1281 | (not)g(executed,)i(as)e(with)435 712 y(the)g Fn(:p)g | |
1282 | Fo(mo)q(di\014er)h(\(see)f(Section)i(1.1.3)c([Mo)q(di\014ers],)i(page)g | |
1283 | (2\).)195 789 y(If)g(an)g(error)f(o)q(curred)i(in)g(expansion,)f(then)h | |
a44161c3 EZ |
1284 | Fj(output)f Fo(con)o(tains)g(a)g(descriptiv)o(e)i(error)d(mes-)195 |
1285 | 844 y(sage.)1650 932 y(F)l(unction)-1749 b Fh(char)20 | |
1286 | b(*)f Fg(history)p 422 932 V 21 w(arg)p 524 932 V 19 | |
1287 | w(extract)24 b Ff(\()p Fn(int)14 b(first,)h(int)g(last,)f(char)283 | |
1288 | 987 y(*string)p Ff(\))195 1042 y Fo(Extract)g(a)g(string)g(segmen)o(t)g | |
1289 | (consisting)i(of)e(the)g Fj(\014rst)i Fo(through)e Fj(last)h | |
1290 | Fo(argumen)o(ts)f(presen)o(t)195 1097 y(in)i Fj(string)p | |
1291 | Fo(.)k(Argumen)o(ts)15 b(are)f(brok)o(en)i(up)f(as)g(in)h(Bash.)1650 | |
1292 | 1185 y(F)l(unction)-1749 b Fh(char)20 b(*)f Fg(get)p | |
1293 | 324 1185 V 21 w(history)p 520 1185 V 20 w(ev)n(en)n(t)25 | |
1294 | b Ff(\()p Fn(char)14 b(*string,)g(int)h(*cindex,)f(int)283 | |
1295 | 1240 y(qchar)p Ff(\))195 1295 y Fo(Returns)h(the)g(text)f(of)g(the)h | |
1296 | (history)g(ev)o(en)o(t)f(b)q(eginning)j(at)d Fj(string)k | |
1297 | Fn(+)d Fj(*cindex)p Fo(.)20 b Fj(*cindex)f Fo(is)195 | |
1298 | 1350 y(mo)q(di\014ed)e(to)e(p)q(oin)o(t)h(to)f(after)g(the)h(ev)o(en)o | |
1299 | (t)f(sp)q(eci\014er.)23 b(A)o(t)16 b(function)g(en)o(try)l(,)f | |
1300 | Fj(cindex)21 b Fo(p)q(oin)o(ts)195 1404 y(to)16 b(the)h(index)h(in)o | |
1301 | (to)e Fj(string)21 b Fo(where)c(the)g(history)f(ev)o(en)o(t)h(sp)q | |
1302 | (eci\014cation)h(b)q(egins.)26 b Fj(qc)o(har)19 b Fo(is)195 | |
1303 | 1459 y(a)h(c)o(haracter)g(that)g(is)h(allo)o(w)o(ed)f(to)g(end)h(the)g | |
1304 | (ev)o(en)o(t)f(sp)q(eci\014cation)i(in)g(addition)f(to)f(the)195 | |
1305 | 1514 y(\\normal")15 b(terminating)g(c)o(haracters.)1650 | |
1306 | 1602 y(F)l(unction)-1749 b Fh(char)20 b(**)f Fg(history)p | |
1307 | 448 1602 V 21 w(tok)n(enize)25 b Ff(\()p Fn(char)14 b(*string)p | |
1308 | Ff(\))195 1657 y Fo(Return)j(an)g(arra)o(y)f(of)g(tok)o(ens)g(parsed)h | |
1309 | (out)g(of)f Fj(string)p Fo(,)h(m)o(uc)o(h)g(as)f(the)h(shell)h(migh)o | |
1310 | (t.)25 b(The)195 1712 y(tok)o(ens)d(are)g(split)i(on)f(white)g(space)g | |
1311 | (and)f(on)h(the)g(c)o(haracters)f Fn(\(\)<>;&|$)p Fo(,)h(and)f(shell) | |
1312 | 195 1767 y(quoting)15 b(con)o(v)o(en)o(tions)h(are)e(ob)q(ey)o(ed.)75 | |
1313 | 1892 y Fm(2.4)33 b(History)22 b(V)-6 b(ariables)137 1987 | |
1314 | y Fo(This)23 b(section)f(describ)q(es)h(the)f(externally)h(visible)h(v) | |
1315 | m(ariables)f(exp)q(orted)f(b)o(y)g(the)g(GNU)f(History)75 | |
1316 | 2042 y(Library)l(.)1661 2130 y(V)l(ariable)-1749 b Fh(int)20 | |
1317 | b Fg(history)p 351 2130 V 20 w(base)195 2185 y Fo(The)15 | |
1318 | b(logical)i(o\013set)d(of)h(the)g(\014rst)g(en)o(try)g(in)h(the)f | |
1319 | (history)g(list.)1661 2274 y(V)l(ariable)-1749 b Fh(int)20 | |
1320 | b Fg(history)p 351 2274 V 20 w(length)195 2329 y Fo(The)15 | |
1321 | b(n)o(um)o(b)q(er)h(of)f(en)o(tries)g(curren)o(tly)h(stored)f(in)h(the) | |
1322 | f(history)g(list.)1661 2417 y(V)l(ariable)-1749 b Fh(int)20 | |
1323 | b Fg(max)p 283 2417 V 19 w(input)p 435 2417 V 21 w(history)195 | |
1324 | 2472 y Fo(The)14 b(maxim)o(um)f(n)o(um)o(b)q(er)h(of)e(history)i(en)o | |
1325 | (tries.)19 b(This)14 b(m)o(ust)f(b)q(e)h(c)o(hanged)g(using)g | |
1326 | Fn(stifle_)195 2527 y(history)g(\(\))p Fo(.)1661 2615 | |
1327 | y(V)l(ariable)-1749 b Fh(char)20 b Fg(history)p 377 2615 | |
1328 | V 20 w(expansion)p 644 2615 V 21 w(c)n(har)195 2670 y | |
1329 | Fo(The)15 b(c)o(haracter)g(that)f(starts)g(a)h(history)g(ev)o(en)o(t.) | |
1330 | 20 b(The)15 b(default)h(is)g(`)p Fn(!)p Fo('.)p eop | |
f9267e15 EZ |
1331 | %%Page: 10 12 |
1332 | 10 11 bop 75 -58 a Fo(10)1324 b(GNU)15 b(History)g(Library)1661 | |
a44161c3 EZ |
1333 | 183 y(V)l(ariable)-1749 b Fh(char)20 b Fg(history)p 377 |
1334 | 183 18 3 v 20 w(subst)p 529 183 V 20 w(c)n(har)195 238 | |
1335 | y Fo(The)13 b(c)o(haracter)e(that)h(in)o(v)o(ok)o(es)g(w)o(ord)g | |
1336 | (substitution)h(if)g(found)g(at)e(the)i(start)e(of)h(a)g(line.)21 | |
1337 | b(The)195 293 y(default)16 b(is)f(`)p Fn(^)p Fo('.)1661 | |
1338 | 388 y(V)l(ariable)-1749 b Fh(char)20 b Fg(history)p 377 | |
1339 | 388 V 20 w(commen)n(t)p 627 388 V 19 w(c)n(har)195 443 | |
1340 | y Fo(During)e(tok)o(enization,)h(if)f(this)h(c)o(haracter)e(is)i(seen)f | |
1341 | (as)g(the)g(\014rst)g(c)o(haracter)f(of)g(a)h(w)o(ord,)195 | |
1342 | 498 y(then)e(it)g(and)g(all)h(subsequen)o(t)g(c)o(haracters)e(up)h(to)g | |
1343 | (a)f(newline)j(are)e(ignored,)g(suppressing)195 553 y(history)f | |
1344 | (expansion)h(for)f(the)g(remainder)h(of)f(the)g(line.)22 | |
1345 | b(This)15 b(is)h(disabled)h(b)o(y)e(default.)1661 648 | |
1346 | y(V)l(ariable)-1749 b Fh(char)20 b(*)f Fg(history)p 422 | |
1347 | 648 V 21 w(no)p 504 648 V 20 w(expand)p 704 648 V 20 | |
1348 | w(c)n(hars)195 703 y Fo(The)j(list)h(of)f(c)o(haracters)f(whic)o(h)i | |
1349 | (inhibit)h(history)e(expansion)h(if)g(found)f(immediately)195 | |
1350 | 758 y(follo)o(wing)16 b Fj(history)p 528 758 14 2 v 16 | |
1351 | w(expansion)p 739 758 V 18 w(c)o(har)p Fo(.)j(The)d(default)f(is)h | |
1352 | (whitespace)g(and)g(`)p Fn(=)p Fo('.)1661 853 y(V)l(ariable)-1749 | |
1353 | b Fh(char)20 b(*)f Fg(history)p 422 853 18 3 v 21 w(searc)n(h)p | |
1354 | 599 853 V 20 w(delimiter)p 843 853 V 23 w(c)n(hars)195 | |
1355 | 908 y Fo(The)f(list)h(of)e(additional)i(c)o(haracters)e(whic)o(h)i(can) | |
1356 | f(delimit)h(a)f(history)g(searc)o(h)f(string,)h(in)195 | |
1357 | 963 y(addition)c(to)d(whitespace,)j(`)p Fn(:)p Fo(')d(and)i(`)p | |
1358 | Fn(?)p Fo(')f(in)h(the)f(case)h(of)f(a)g(substring)h(searc)o(h.)19 | |
1359 | b(The)12 b(default)195 1018 y(is)k(empt)o(y)l(.)1661 | |
1360 | 1113 y(V)l(ariable)-1749 b Fh(int)20 b Fg(history)p 351 | |
1361 | 1113 V 20 w(quotes)p 533 1113 V 21 w(inhibit)p 717 1113 | |
1362 | V 23 w(expansion)195 1168 y Fo(If)13 b(non-zero,)f(single-quoted)i(w)o | |
1363 | (ords)e(are)g(not)g(scanned)h(for)f(the)g(history)h(expansion)g(c)o | |
1364 | (har-)195 1223 y(acter.)19 b(The)d(default)g(v)m(alue)g(is)g(0.)1661 | |
1365 | 1318 y(V)l(ariable)-1749 b Fh(Function)20 b(*)g Fg(history)p | |
1366 | 527 1318 V 20 w(inhibit)p 710 1318 V 23 w(expansion)p | |
1367 | 980 1318 V 21 w(function)195 1373 y Fo(This)12 b(should)g(b)q(e)g(set)f | |
1368 | (to)f(the)i(address)f(of)g(a)g(function)h(that)e(tak)o(es)h(t)o(w)o(o)f | |
1369 | (argumen)o(ts:)17 b(a)11 b Fn(char)195 1428 y(*)j Fo(\()p | |
1370 | Fj(string)t Fo(\))f(and)i(an)f(in)o(teger)g(index)h(in)o(to)f(that)g | |
1371 | (string)g(\()p Fj(i)r Fo(\).)20 b(It)14 b(should)h(return)f(a)g | |
1372 | (non-zero)195 1482 y(v)m(alue)g(if)e(the)h(history)f(expansion)h | |
1373 | (starting)f(at)g Fj(string[i])i Fo(should)f(not)f(b)q(e)h(p)q | |
1374 | (erformed;)g(zero)195 1537 y(if)g(the)h(expansion)f(should)h(b)q(e)g | |
1375 | (done.)20 b(It)13 b(is)g(in)o(tended)i(for)d(use)h(b)o(y)g | |
1376 | (applications)i(lik)o(e)f(Bash)195 1592 y(that)j(use)h(the)g(history)f | |
1377 | (expansion)i(c)o(haracter)e(for)g(additional)i(purp)q(oses.)28 | |
1378 | b(By)18 b(default,)195 1647 y(this)e(v)m(ariable)g(is)g(set)f(to)f | |
1379 | (NULL.)75 1780 y Fm(2.5)33 b(History)22 b(Programming)h(Example)137 | |
1380 | 1878 y Fo(The)16 b(follo)o(wing)g(program)e(demonstrates)g(simple)j | |
1381 | (use)e(of)g(the)g(GNU)g(History)g(Library)l(.)195 1944 | |
1382 | y Fn(main)23 b(\(\))195 1995 y({)243 2047 y(char)g(line[1024],)f(*t;) | |
1383 | 243 2099 y(int)h(len,)g(done)h(=)g(0;)243 2203 y(line[0])f(=)g(0;)243 | |
1384 | 2307 y(using_history)f(\(\);)243 2359 y(while)h(\(!done\))290 | |
1385 | 2411 y({)338 2462 y(printf)g(\("history$)g("\);)338 2514 | |
1386 | y(fflush)g(\(stdout\);)338 2566 y(t)h(=)g(fgets)f(\(line,)g(sizeof)g | |
1387 | (\(line\))g(-)h(1,)f(stdin\);)338 2618 y(if)h(\(t)f(&&)h(*t\))386 | |
1388 | 2670 y({)p eop | |
f9267e15 EZ |
1389 | %%Page: 11 13 |
1390 | 11 12 bop 75 -58 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g | |
1391 | (History)867 b(11)434 183 y Fn(len)23 b(=)h(strlen)f(\(t\);)434 | |
a44161c3 EZ |
1392 | 235 y(if)g(\(t[len)g(-)h(1])g(==)f('\\n'\))481 287 y(t[len)h(-)f(1])h |
1393 | (=)g('\\0';)386 339 y(})338 443 y(if)g(\(!t\))386 495 | |
1394 | y(strcpy)f(\(line,)g("quit"\);)338 598 y(if)h(\(line[0]\))386 | |
1395 | 650 y({)434 702 y(char)f(*expansion;)434 754 y(int)g(result;)434 | |
1396 | 858 y(result)g(=)g(history_expand)f(\(line,)h(&expansion\);)434 | |
1397 | 910 y(if)g(\(result\))481 962 y(fprintf)g(\(stderr,)g("\045s\\n",)g | |
1398 | (expansion\);)434 1065 y(if)g(\(result)g(<)h(0)g(||)f(result)g(==)h | |
1399 | (2\))481 1117 y({)529 1169 y(free)f(\(expansion\);)529 | |
1400 | 1221 y(continue;)481 1273 y(})434 1377 y(add_history)f(\(expansion\);) | |
1401 | 434 1429 y(strncpy)h(\(line,)g(expansion,)f(sizeof)h(\(line\))g(-)h | |
1402 | (1\);)434 1480 y(free)f(\(expansion\);)386 1532 y(})338 | |
1403 | 1636 y(if)h(\(strcmp)f(\(line,)g("quit"\))g(==)g(0\))386 | |
1404 | 1688 y(done)g(=)h(1;)338 1740 y(else)f(if)h(\(strcmp)f(\(line,)g | |
1405 | ("save"\))g(==)h(0\))386 1792 y(write_history)e(\("history_file"\);)338 | |
1406 | 1844 y(else)h(if)h(\(strcmp)f(\(line,)g("read"\))g(==)h(0\))386 | |
1407 | 1896 y(read_history)e(\("history_file"\);)338 1947 y(else)h(if)h | |
1408 | (\(strcmp)f(\(line,)g("list"\))g(==)h(0\))386 1999 y({)434 | |
1409 | 2051 y(register)e(HIST_ENTRY)h(**the_list;)434 2103 y(register)f(int)i | |
1410 | (i;)434 2207 y(the_list)e(=)i(history_list)e(\(\);)434 | |
1411 | 2259 y(if)h(\(the_list\))481 2311 y(for)h(\(i)f(=)h(0;)g(the_list[i];)e | |
1412 | (i++\))529 2363 y(printf)h(\("\045d:)g(\045s\\n",)g(i)h(+)g | |
1413 | (history_base,)e(the_list[i]->line\);)386 2414 y(})338 | |
1414 | 2466 y(else)h(if)h(\(strncmp)f(\(line,)g("delete",)g(6\))g(==)h(0\))386 | |
1415 | 2518 y({)434 2570 y(int)f(which;)434 2622 y(if)g(\(\(sscanf)g(\(line)g | |
1416 | (+)h(6,)f("\045d",)h(&which\)\))e(==)i(1\))p eop | |
f9267e15 EZ |
1417 | %%Page: 12 14 |
1418 | 12 13 bop 75 -58 a Fo(12)1324 b(GNU)15 b(History)g(Library)481 | |
a44161c3 EZ |
1419 | 183 y Fn({)529 235 y(HIST_ENTRY)23 b(*entry)g(=)g(remove_history)f |
1420 | (\(which\);)529 287 y(if)i(\(!entry\))577 339 y(fprintf)f(\(stderr,)f | |
1421 | ("No)i(such)f(entry)g(\045d\\n",)g(which\);)529 391 y(else)577 | |
1422 | 443 y({)625 495 y(free)g(\(entry->line\);)625 546 y(free)g(\(entry\);) | |
1423 | 577 598 y(})481 650 y(})434 702 y(else)481 754 y({)529 | |
1424 | 806 y(fprintf)g(\(stderr,)g("non-numeric)f(arg)h(given)h(to)f | |
1425 | (`delete'\\n"\);)481 858 y(})386 910 y(})290 962 y(})195 | |
1426 | 1013 y(})p eop | |
f9267e15 EZ |
1427 | %%Page: 13 15 |
1428 | 13 14 bop 75 -58 a Fo(App)q(endix)17 b(A:)e(Concept)g(Index)1196 | |
1429 | b(13)75 183 y Fk(App)r(endix)25 b(A)41 b(Concept)27 b(Index)75 | |
a44161c3 EZ |
1430 | 359 y Fm(A)75 417 y Fe(anc)o(hored)14 b(searc)o(h)s Fd(.)7 |
1431 | b(.)f(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
1432 | (.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)16 | |
f9267e15 | 1433 | b Fe(7)75 517 y Fm(E)75 575 y Fe(ev)o(en)o(t)d(designators)c |
a44161c3 EZ |
1434 | Fd(.)g(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g |
1435 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)21 | |
1436 | b Fe(1)1012 359 y Fm(H)1012 417 y Fe(history)15 b(ev)o(en)o(ts)s | |
1437 | Fd(.)7 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
1438 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g | |
1439 | (.)16 b Fe(1)1012 467 y(history)f(expansion)6 b Fd(.)j(.)d(.)g(.)g(.)g | |
1440 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1441 | g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)19 b Fe(1)1012 517 y(History)14 | |
1442 | b(Searc)o(hing)5 b Fd(.)j(.)e(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
1443 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
f9267e15 EZ |
1444 | g(.)18 b Fe(7)p eop |
1445 | %%Page: 14 16 | |
1446 | 14 15 bop 75 -58 a Fo(14)1324 b(GNU)15 b(History)g(Library)p | |
a44161c3 | 1447 | eop |
f9267e15 EZ |
1448 | %%Page: 15 17 |
1449 | 15 16 bop 75 -58 a Fo(App)q(endix)17 b(B:)e(F)l(unction)h(and)g(V)l | |
1450 | (ariable)g(Index)919 b(15)75 183 y Fk(App)r(endix)25 | |
a44161c3 EZ |
1451 | b(B)41 b(F)-7 b(unction)26 b(and)h(V)-7 b(ariable)26 |
1452 | b(Index)75 359 y Fm(A)75 417 y Fc(add)p 137 417 12 2 | |
1453 | v 13 w(history)6 b Fd(.)s(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
1454 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
f9267e15 | 1455 | g(.)g(.)g(.)g(.)g(.)h(.)18 b Fe(6)75 467 y Fc(append)p |
a44161c3 EZ |
1456 | 197 467 V 12 w(history)8 b Fd(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
1457 | (.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
f9267e15 | 1458 | g(.)g(.)g(.)g(.)23 b Fe(8)75 567 y Fm(C)75 625 y Fc(clear)p |
a44161c3 EZ |
1459 | 177 625 V 12 w(history)s Fd(.)t(.)6 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f |
1460 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.) | |
f9267e15 | 1461 | g(.)g(.)g(.)g(.)g(.)g(.)16 b Fe(6)75 675 y Fc(current)p |
a44161c3 EZ |
1462 | 217 675 V 11 w(history)7 b Fd(.)f(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g |
1463 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
f9267e15 | 1464 | g(.)g(.)g(.)22 b Fe(7)75 774 y Fm(G)75 832 y Fc(get)p |
a44161c3 EZ |
1465 | 137 832 V 13 w(history)p 290 832 V 11 w(event)8 b Fd(.)e(.)g(.)g(.)g(.) |
1466 | g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h | |
f9267e15 | 1467 | (.)f(.)g(.)g(.)g(.)g(.)g(.)22 b Fe(9)75 932 y Fm(H)75 |
a44161c3 EZ |
1468 | 990 y Fc(history)p 217 990 V 11 w(arg)p 288 990 V 13 |
1469 | w(extract)7 b Fd(.)t(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
1470 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)20 | |
f9267e15 | 1471 | b Fe(9)75 1040 y Fc(history)p 217 1040 V 11 w(base)f |
a44161c3 EZ |
1472 | Fd(.)6 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) |
1473 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)19 | |
f9267e15 EZ |
1474 | b Fe(9)75 1090 y Fc(history_co)o(mm)o(ent)o(_c)o(har)g |
1475 | Fd(.)6 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1476 | g(.)g(.)g(.)g(.)g(.)g(.)23 b Fe(10)75 1139 y Fc(history)p | |
a44161c3 EZ |
1477 | 217 1139 V 11 w(expand)9 b Fd(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
1478 | (.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.) | |
f9267e15 | 1479 | g(.)g(.)g(.)g(.)23 b Fe(9)75 1189 y Fc(history)p 217 |
a44161c3 EZ |
1480 | 1189 V 11 w(expansion)p 408 1189 V 11 w(char)17 b Fd(.)6 |
1481 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g | |
f9267e15 | 1482 | (.)g(.)g(.)g(.)g(.)18 b Fe(9)75 1239 y Fc(history)p 217 |
a44161c3 EZ |
1483 | 1239 V 11 w(get)6 b Fd(.)f(.)h(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
1484 | (.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
f9267e15 | 1485 | g(.)g(.)g(.)g(.)g(.)h(.)18 b Fe(7)75 1289 y Fc(history)p |
a44161c3 EZ |
1486 | 217 1289 V 11 w(get)p 288 1289 V 13 w(history)p 441 1289 |
1487 | V 12 w(state)9 b Fd(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
f9267e15 EZ |
1488 | (.)h(.)f(.)g(.)g(.)g(.)g(.)23 b Fe(6)75 1339 y Fc(history_in)o(hi)o |
1489 | (bit)o(_e)o(xpa)o(nsi)o(on)o(_fu)o(nc)o(tio)o(n)c Fd(.)6 | |
1490 | b(.)g(.)g(.)g(.)g(.)g(.)22 b Fe(10)75 1389 y Fc(history)p | |
a44161c3 EZ |
1491 | 217 1389 V 11 w(is)p 268 1389 V 14 w(stifled)8 b Fd(.)s(.)f(.)f(.)g(.)g |
1492 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.) | |
f9267e15 | 1493 | g(.)g(.)g(.)g(.)g(.)21 b Fe(6)75 1438 y Fc(history)p |
a44161c3 EZ |
1494 | 217 1438 V 11 w(length)15 b Fd(.)6 b(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.) |
1495 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
f9267e15 | 1496 | (.)g(.)g(.)g(.)g(.)17 b Fe(9)75 1488 y Fc(history)p 217 |
a44161c3 EZ |
1497 | 1488 V 11 w(list)5 b Fd(.)g(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g |
1498 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
f9267e15 EZ |
1499 | f(.)g(.)g(.)g(.)g(.)17 b Fe(7)75 1538 y Fc(history_no)o(_e)o(xpa)o(nd)o |
1500 | (_ch)o(ars)e Fd(.)6 b(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
1501 | (.)g(.)g(.)g(.)g(.)g(.)g(.)19 b Fe(10)75 1588 y Fc(history_qu)o(ot)o | |
1502 | (es_)o(in)o(hib)o(it_)o(ex)o(pan)o(si)o(on)13 b Fd(.)6 | |
1503 | b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)16 b Fe(10)75 1638 | |
1504 | y Fc(history)p 217 1638 V 11 w(search)9 b Fd(.)d(.)g(.)g(.)g(.)g(.)g(.) | |
1505 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
1506 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)23 b Fe(7)75 1687 y Fc(history_se)o(ar)o | |
1507 | (ch_)o(de)o(lim)o(ite)o(r_)o(cha)o(rs)15 b Fd(.)6 b(.)g(.)g(.)g(.)g(.)g | |
1508 | (.)g(.)g(.)h(.)f(.)g(.)18 b Fe(10)75 1737 y Fc(history)p | |
1509 | 217 1737 V 11 w(search)p 348 1737 V 12 w(pos)8 b Fd(.)d(.)i(.)f(.)g(.)g | |
1510 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.) | |
1511 | g(.)g(.)g(.)g(.)g(.)21 b Fe(8)75 1787 y Fc(history)p | |
1512 | 217 1787 V 11 w(search)p 348 1787 V 12 w(prefix)5 b Fd(.)t(.)h(.)g(.)g | |
a44161c3 | 1513 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.) |
f9267e15 EZ |
1514 | g(.)g(.)g(.)17 b Fe(8)75 1837 y Fc(history)p 217 1837 |
1515 | V 11 w(set)p 288 1837 V 13 w(history)p 441 1837 V 12 | |
1516 | w(state)9 b Fd(.)d(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h | |
1517 | (.)f(.)g(.)g(.)g(.)g(.)23 b Fe(6)75 1887 y Fc(history)p | |
1518 | 217 1887 V 11 w(set)p 288 1887 V 13 w(pos)t Fd(.)5 b(.)h(.)g(.)g(.)g(.) | |
1519 | g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g | |
1520 | (.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)16 b Fe(7)1012 359 | |
1521 | y Fc(history_sub)o(st)o(_ch)o(ar)d Fd(.)6 b(.)g(.)g(.)g(.)g(.)h(.)f(.)g | |
1522 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.) | |
1523 | 17 b Fe(10)1012 409 y Fc(history)p 1154 409 V 12 w(tokenize)8 | |
1524 | b Fd(.)s(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
1525 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)21 | |
1526 | b Fe(9)1012 459 y Fc(history)p 1154 459 V 12 w(total)p | |
1527 | 1266 459 V 12 w(bytes)7 b Fd(.)t(.)f(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.) | |
1528 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)20 | |
1529 | b Fe(7)1012 509 y Fc(history)p 1154 509 V 12 w(truncate)p | |
1530 | 1326 509 V 11 w(file)5 b Fd(.)t(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h | |
1531 | (.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)18 | |
1532 | b Fe(8)1012 612 y Fm(M)1012 670 y Fc(max)p 1074 670 V | |
1533 | 13 w(input)p 1187 670 V 13 w(history)13 b Fd(.)6 b(.)g(.)g(.)g(.)g(.)g | |
1534 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1535 | g(.)h(.)f(.)g(.)g(.)16 b Fe(9)1012 773 y Fm(N)1012 831 | |
1536 | y Fc(next)p 1094 831 V 13 w(history)5 b Fd(.)s(.)h(.)g(.)g(.)g(.)g(.)g | |
1537 | (.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.) | |
1538 | f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)18 b Fe(7)1012 | |
1539 | 934 y Fm(P)1012 992 y Fc(previous)p 1174 992 V 11 w(history)8 | |
1540 | b Fd(.)t(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.) | |
1541 | g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)21 | |
1542 | b Fe(7)1012 1096 y Fm(R)1012 1154 y Fc(read)p 1094 1154 | |
1543 | V 13 w(history)5 b Fd(.)s(.)h(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g | |
1544 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.) | |
1545 | g(.)g(.)g(.)g(.)g(.)18 b Fe(8)1012 1204 y Fc(read)p 1094 | |
1546 | 1204 V 13 w(history)p 1247 1204 V 11 w(range)8 b Fd(.)d(.)h(.)g(.)g(.)g | |
1547 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1548 | g(.)g(.)g(.)h(.)f(.)21 b Fe(8)1012 1253 y Fc(remove)p | |
1549 | 1134 1253 V 12 w(history)8 b Fd(.)e(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
1550 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1551 | g(.)g(.)g(.)g(.)24 b Fe(6)1012 1303 y Fc(replace)p 1154 | |
1552 | 1303 V 12 w(history)p 1306 1303 V 11 w(entry)5 b Fd(.)t(.)h(.)g(.)g(.)g | |
1553 | (.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1554 | g(.)g(.)18 b Fe(6)1012 1406 y Fm(S)1012 1464 y Fc(stifle)p | |
1555 | 1134 1464 V 12 w(history)8 b Fd(.)e(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g | |
1556 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1557 | g(.)g(.)g(.)g(.)24 b Fe(6)1012 1568 y Fm(U)1012 1626 | |
1558 | y Fc(unstifle)p 1174 1626 V 11 w(history)8 b Fd(.)t(.)e(.)g(.)g(.)g(.)g | |
1559 | (.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1560 | g(.)h(.)f(.)g(.)g(.)g(.)21 b Fe(6)1012 1676 y Fc(using)p | |
1561 | 1114 1676 V 13 w(history)s Fd(.)s(.)6 b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g | |
a44161c3 | 1562 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) |
f9267e15 EZ |
1563 | g(.)g(.)g(.)g(.)g(.)g(.)17 b Fe(6)1012 1779 y Fm(W)1012 |
1564 | 1837 y Fc(where)p 1114 1837 V 13 w(history)s Fd(.)s(.)6 | |
1565 | b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f | |
1566 | (.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)17 | |
1567 | b Fe(7)1012 1887 y Fc(write)p 1114 1887 V 13 w(history)s | |
1568 | Fd(.)s(.)6 b(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.) | |
1569 | g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)17 | |
1570 | b Fe(8)p eop | |
1571 | %%Page: 16 18 | |
1572 | 16 17 bop 75 -58 a Fo(16)1324 b(GNU)15 b(History)g(Library)p | |
a44161c3 | 1573 | eop |
f9267e15 EZ |
1574 | %%Page: -1 19 |
1575 | -1 18 bop 1862 -58 a Fo(i)75 183 y Fk(T)-7 b(able)27 | |
a44161c3 EZ |
1576 | b(of)f(Con)n(ten)n(ts)75 354 y Fm(1)67 b(Using)22 b(History)h(In)n |
1577 | (teractiv)n(ely)9 b Fb(.)k(.)d(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)h | |
1578 | (.)f(.)g(.)g(.)h(.)31 b Fm(1)224 423 y Fo(1.1)45 b(History)15 | |
1579 | b(Expansion)5 b Fa(.)j(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)g(.)f(.)h(.)f | |
1580 | (.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
1581 | f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)19 b Fo(1)374 478 y(1.1.1)44 | |
1582 | b(Ev)o(en)o(t)14 b(Designators)e Fa(.)7 b(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
1583 | (.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
1584 | f(.)h(.)f(.)h(.)26 b Fo(1)374 532 y(1.1.2)44 b(W)l(ord)15 | |
1585 | b(Designators)5 b Fa(.)h(.)i(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
1586 | f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
1587 | (.)19 b Fo(2)374 587 y(1.1.3)44 b(Mo)q(di\014ers)t Fa(.)8 | |
1588 | b(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)g(.)f | |
1589 | (.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
1590 | f(.)h(.)f(.)19 b Fo(2)75 708 y Fm(2)67 b(Programming)23 | |
1591 | b(with)g(GNU)f(History)16 b Fb(.)10 b(.)g(.)g(.)h(.)f(.)g(.)g(.)h(.)f | |
f9267e15 | 1592 | (.)g(.)38 b Fm(5)224 777 y Fo(2.1)45 b(In)o(tro)q(duction)16 |
a44161c3 EZ |
1593 | b(to)f(History)10 b Fa(.)d(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f |
1594 | (.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
f9267e15 | 1595 | f(.)h(.)f(.)h(.)24 b Fo(5)224 832 y(2.2)45 b(History)15 |
a44161c3 EZ |
1596 | b(Storage)c Fa(.)d(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f |
1597 | (.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
f9267e15 | 1598 | g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)26 b Fo(5)224 886 |
a44161c3 EZ |
1599 | y(2.3)45 b(History)15 b(F)l(unctions)d Fa(.)c(.)f(.)h(.)f(.)h(.)f(.)h |
1600 | (.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) | |
1601 | f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)26 | |
f9267e15 | 1602 | b Fo(6)374 941 y(2.3.1)44 b(Initializing)18 b(History)d(and)h(State)e |
a44161c3 | 1603 | (Managemen)o(t)g Fa(.)7 b(.)h(.)g(.)f(.)h(.)f(.)29 b |
f9267e15 | 1604 | Fo(6)374 996 y(2.3.2)44 b(History)15 b(List)h(Managemen)o(t)d |
a44161c3 | 1605 | Fa(.)7 b(.)h(.)f(.)h(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.) |
f9267e15 | 1606 | h(.)f(.)h(.)f(.)h(.)f(.)29 b Fo(6)374 1051 y(2.3.3)44 |
a44161c3 EZ |
1607 | b(Information)15 b(Ab)q(out)g(the)h(History)f(List)c |
1608 | Fa(.)d(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)26 | |
f9267e15 | 1609 | b Fo(7)374 1106 y(2.3.4)44 b(Mo)o(ving)15 b(Around)g(the)g(History)g |
a44161c3 | 1610 | (List)c Fa(.)d(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f |
f9267e15 | 1611 | (.)h(.)25 b Fo(7)374 1160 y(2.3.5)44 b(Searc)o(hing)16 |
a44161c3 EZ |
1612 | b(the)f(History)g(List)7 b Fa(.)h(.)g(.)f(.)h(.)g(.)f(.)h(.)f(.)h(.)f |
1613 | (.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)22 | |
f9267e15 | 1614 | b Fo(7)374 1215 y(2.3.6)44 b(Managing)15 b(the)g(History)g(File)6 |
a44161c3 | 1615 | b Fa(.)i(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.) |
f9267e15 | 1616 | f(.)h(.)f(.)h(.)f(.)h(.)20 b Fo(8)374 1270 y(2.3.7)44 |
a44161c3 EZ |
1617 | b(History)15 b(Expansion)9 b Fa(.)f(.)g(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h |
1618 | (.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.) | |
f9267e15 | 1619 | h(.)f(.)24 b Fo(8)224 1325 y(2.4)45 b(History)15 b(V)l(ariables)6 |
a44161c3 EZ |
1620 | b Fa(.)j(.)e(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)g(.)f(.)h(.)f(.)h(.) |
1621 | f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h | |
f9267e15 EZ |
1622 | (.)f(.)h(.)f(.)h(.)f(.)21 b Fo(9)224 1380 y(2.5)45 b(History)15 |
1623 | b(Programming)f(Example)7 b Fa(.)h(.)f(.)h(.)f(.)h(.)g(.)f(.)h(.)f(.)h | |
1624 | (.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)22 | |
1625 | b Fo(10)75 1501 y Fm(App)r(endix)i(A)67 b(Concept)22 | |
1626 | b(Index)17 b Fb(.)10 b(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)h(.)f(.)g(.)g | |
1627 | (.)h(.)f(.)g(.)38 b Fm(13)75 1636 y(App)r(endix)24 b(B)67 | |
1628 | b(F)-6 b(unction)25 b(and)e(V)-6 b(ariable)24 b(Index)16 | |
1629 | b Fb(.)10 b(.)g(.)g(.)38 b Fm(15)p eop | |
1630 | %%Page: -2 20 | |
1631 | -2 19 bop 75 -58 a Fo(ii)1346 b(GNU)15 b(History)g(Library)p | |
a44161c3 EZ |
1632 | eop |
1633 | %%Trailer | |
1634 | end | |
1635 | userdict /end-hook known{end-hook}if | |
1636 | %%EOF |